instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_950>.
Br.BrCCCc1nc[nH]n1
What is the building block token for the following molecule?
Br.BrCCCc1nc[nH]n1
<BB_950>
What is the molecular formula for <BB_950>?
The molecular formula for <BB_950> (Br.BrCCCc1nc[nH]n1) is C5H9Br2N3.
Describe the ring structures in building block <BB_950>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_950>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_950>.
**Token:** <BB_950> **SMILES:** Br.BrCCCc1nc[nH]n1 **Molecular Formula:** C5H9Br2N3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_951>.
Cc1oc(C=O)cc1Br
What is the building block token for the following molecule?
Cc1oc(C=O)cc1Br
<BB_951>
What is the molecular formula for <BB_951>?
The molecular formula for <BB_951> (Cc1oc(C=O)cc1Br) is C6H5BrO2.
Describe the ring structures in building block <BB_951>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_951>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_951>.
**Token:** <BB_951> **SMILES:** Cc1oc(C=O)cc1Br **Molecular Formula:** C6H5BrO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_952>.
O=C(O)c1ccc(C2CCOC2)s1
What is the building block token for the following molecule?
O=C(O)c1ccc(C2CCOC2)s1
<BB_952>
What is the molecular formula for <BB_952>?
The molecular formula for <BB_952> (O=C(O)c1ccc(C2CCOC2)s1) is C9H10O3S.
Describe the ring structures in building block <BB_952>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_952>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_952>.
**Token:** <BB_952> **SMILES:** O=C(O)c1ccc(C2CCOC2)s1 **Molecular Formula:** C9H10O3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_953>.
O=C([O-])CC(O)CCO.[Li+]
What is the building block token for the following molecule?
O=C([O-])CC(O)CCO.[Li+]
<BB_953>
What is the molecular formula for <BB_953>?
The molecular formula for <BB_953> (O=C([O-])CC(O)CCO.[Li+]) is C5H9LiO4.
Describe the ring structures in building block <BB_953>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_953>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_953>.
**Token:** <BB_953> **SMILES:** O=C([O-])CC(O)CCO.[Li+] **Molecular Formula:** C5H9LiO4 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_954>.
CC(CO)N1CCCCC1.Cl
What is the building block token for the following molecule?
CC(CO)N1CCCCC1.Cl
<BB_954>
What is the molecular formula for <BB_954>?
The molecular formula for <BB_954> (CC(CO)N1CCCCC1.Cl) is C8H18ClNO.
Describe the ring structures in building block <BB_954>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_954>.
The molecule contains the following groups: Tertiary Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_954>.
**Token:** <BB_954> **SMILES:** CC(CO)N1CCCCC1.Cl **Molecular Formula:** C8H18ClNO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_955>.
COC12CC(CN=[N+]=[N-])(C1)C2
What is the building block token for the following molecule?
COC12CC(CN=[N+]=[N-])(C1)C2
<BB_955>
What is the molecular formula for <BB_955>?
The molecular formula for <BB_955> (COC12CC(CN=[N+]=[N-])(C1)C2) is C7H11N3O.
Describe the ring structures in building block <BB_955>.
The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4, an aliphatic ring of size 4.
List the primary functional groups present in <BB_955>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_955>.
**Token:** <BB_955> **SMILES:** COC12CC(CN=[N+]=[N-])(C1)C2 **Molecular Formula:** C7H11N3O **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4, an aliphatic ring of size 4. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_956>.
CCOC(=O)c1cc([N+](=O)[O-])c(OCC)cc1C
What is the building block token for the following molecule?
CCOC(=O)c1cc([N+](=O)[O-])c(OCC)cc1C
<BB_956>
What is the molecular formula for <BB_956>?
The molecular formula for <BB_956> (CCOC(=O)c1cc([N+](=O)[O-])c(OCC)cc1C) is C12H15NO5.
Describe the ring structures in building block <BB_956>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_956>.
The molecule contains the following groups: Tertiary Amine, Ester, Ether, Nitro.
Provide a comprehensive chemical profile for the building block <BB_956>.
**Token:** <BB_956> **SMILES:** CCOC(=O)c1cc([N+](=O)[O-])c(OCC)cc1C **Molecular Formula:** C12H15NO5 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Ester, Ether, Nitro
Provide the SMILES representation for the building block token <BB_957>.
CN(C)C(=O)CCCCCl
What is the building block token for the following molecule?
CN(C)C(=O)CCCCCl
<BB_957>
What is the molecular formula for <BB_957>?
The molecular formula for <BB_957> (CN(C)C(=O)CCCCCl) is C7H14ClNO.
Describe the ring structures in building block <BB_957>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_957>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_957>.
**Token:** <BB_957> **SMILES:** CN(C)C(=O)CCCCCl **Molecular Formula:** C7H14ClNO **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_958>.
COC1CC(C)CCC1=O
What is the building block token for the following molecule?
COC1CC(C)CCC1=O
<BB_958>
What is the molecular formula for <BB_958>?
The molecular formula for <BB_958> (COC1CC(C)CCC1=O) is C8H14O2.
Describe the ring structures in building block <BB_958>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_958>.
The molecule contains the following groups: Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_958>.
**Token:** <BB_958> **SMILES:** COC1CC(C)CCC1=O **Molecular Formula:** C8H14O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Ketone, Ether
Provide the SMILES representation for the building block token <BB_959>.
C1COC2(CCC3(CC2)CO3)O1
What is the building block token for the following molecule?
C1COC2(CCC3(CC2)CO3)O1
<BB_959>
What is the molecular formula for <BB_959>?
The molecular formula for <BB_959> (C1COC2(CCC3(CC2)CO3)O1) is C9H14O3.
Describe the ring structures in building block <BB_959>.
The molecule contains 3 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_959>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_959>.
**Token:** <BB_959> **SMILES:** C1COC2(CCC3(CC2)CO3)O1 **Molecular Formula:** C9H14O3 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_960>.
Cc1nnc(S)n1N
What is the building block token for the following molecule?
Cc1nnc(S)n1N
<BB_960>
What is the molecular formula for <BB_960>?
The molecular formula for <BB_960> (Cc1nnc(S)n1N) is C3H6N4S.
Describe the ring structures in building block <BB_960>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_960>.
The molecule contains the following groups: Amine, Thiol.
Provide a comprehensive chemical profile for the building block <BB_960>.
**Token:** <BB_960> **SMILES:** Cc1nnc(S)n1N **Molecular Formula:** C3H6N4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Thiol
Provide the SMILES representation for the building block token <BB_961>.
Clc1scc(-c2ccnc(N3CCOCC3)n2)c1Cl
What is the building block token for the following molecule?
Clc1scc(-c2ccnc(N3CCOCC3)n2)c1Cl
<BB_961>
What is the molecular formula for <BB_961>?
The molecular formula for <BB_961> (Clc1scc(-c2ccnc(N3CCOCC3)n2)c1Cl) is C12H11Cl2N3OS.
Describe the ring structures in building block <BB_961>.
The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_961>.
The molecule contains the following groups: Tertiary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_961>.
**Token:** <BB_961> **SMILES:** Clc1scc(-c2ccnc(N3CCOCC3)n2)c1Cl **Molecular Formula:** C12H11Cl2N3OS **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_962>.
Cl.O=C1Nc2ccccc2C1C1CCNCC1
What is the building block token for the following molecule?
Cl.O=C1Nc2ccccc2C1C1CCNCC1
<BB_962>
What is the molecular formula for <BB_962>?
The molecular formula for <BB_962> (Cl.O=C1Nc2ccccc2C1C1CCNCC1) is C13H17ClN2O.
Describe the ring structures in building block <BB_962>.
The molecule contains 3 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_962>.
The molecule contains the following groups: Secondary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_962>.
**Token:** <BB_962> **SMILES:** Cl.O=C1Nc2ccccc2C1C1CCNCC1 **Molecular Formula:** C13H17ClN2O **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_963>.
Cl.O=C(O)C1CC2CNCC1C2
What is the building block token for the following molecule?
Cl.O=C(O)C1CC2CNCC1C2
<BB_963>
What is the molecular formula for <BB_963>?
The molecular formula for <BB_963> (Cl.O=C(O)C1CC2CNCC1C2) is C8H14ClNO2.
Describe the ring structures in building block <BB_963>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_963>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_963>.
**Token:** <BB_963> **SMILES:** Cl.O=C(O)C1CC2CNCC1C2 **Molecular Formula:** C8H14ClNO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_964>.
O=C(O)C(F)c1ccc(Br)cc1Cl
What is the building block token for the following molecule?
O=C(O)C(F)c1ccc(Br)cc1Cl
<BB_964>
What is the molecular formula for <BB_964>?
The molecular formula for <BB_964> (O=C(O)C(F)c1ccc(Br)cc1Cl) is C8H5BrClFO2.
Describe the ring structures in building block <BB_964>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_964>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_964>.
**Token:** <BB_964> **SMILES:** O=C(O)C(F)c1ccc(Br)cc1Cl **Molecular Formula:** C8H5BrClFO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_965>.
CCc1cc(F)cc(B2OC(C)(C)C(C)(C)O2)c1
What is the building block token for the following molecule?
CCc1cc(F)cc(B2OC(C)(C)C(C)(C)O2)c1
<BB_965>
What is the molecular formula for <BB_965>?
The molecular formula for <BB_965> (CCc1cc(F)cc(B2OC(C)(C)C(C)(C)O2)c1) is C14H20BFO2.
Describe the ring structures in building block <BB_965>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_965>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_965>.
**Token:** <BB_965> **SMILES:** CCc1cc(F)cc(B2OC(C)(C)C(C)(C)O2)c1 **Molecular Formula:** C14H20BFO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_966>.
NCc1ccc(C2CC2)cc1F
What is the building block token for the following molecule?
NCc1ccc(C2CC2)cc1F
<BB_966>
What is the molecular formula for <BB_966>?
The molecular formula for <BB_966> (NCc1ccc(C2CC2)cc1F) is C10H12FN.
Describe the ring structures in building block <BB_966>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.