instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_9200>.
c1ccc(CC2CNCCS2)cc1
What is the building block token for the following molecule?
c1ccc(CC2CNCCS2)cc1
<BB_9200>
What is the molecular formula for <BB_9200>?
The molecular formula for <BB_9200> (c1ccc(CC2CNCCS2)cc1) is C11H15NS.
Describe the ring structures in building block <BB_9200>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9200>.
The molecule contains the following groups: Secondary Amine, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_9200>.
**Token:** <BB_9200> **SMILES:** c1ccc(CC2CNCCS2)cc1 **Molecular Formula:** C11H15NS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Sulfide
Provide the SMILES representation for the building block token <BB_9201>.
CCOC(=O)c1cc(F)ccc1S(=O)(=O)Cl
What is the building block token for the following molecule?
CCOC(=O)c1cc(F)ccc1S(=O)(=O)Cl
<BB_9201>
What is the molecular formula for <BB_9201>?
The molecular formula for <BB_9201> (CCOC(=O)c1cc(F)ccc1S(=O)(=O)Cl) is C9H8ClFO4S.
Describe the ring structures in building block <BB_9201>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9201>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9201>.
**Token:** <BB_9201> **SMILES:** CCOC(=O)c1cc(F)ccc1S(=O)(=O)Cl **Molecular Formula:** C9H8ClFO4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9202>.
Cl.c1ccc(C[C@H]2CCCN2)cc1
What is the building block token for the following molecule?
Cl.c1ccc(C[C@H]2CCCN2)cc1
<BB_9202>
What is the molecular formula for <BB_9202>?
The molecular formula for <BB_9202> (Cl.c1ccc(C[C@H]2CCCN2)cc1) is C11H16ClN.
Describe the ring structures in building block <BB_9202>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9202>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9202>.
**Token:** <BB_9202> **SMILES:** Cl.c1ccc(C[C@H]2CCCN2)cc1 **Molecular Formula:** C11H16ClN **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9203>.
CC(C)C(C(C)C)C(N)C(=O)O.Cl
What is the building block token for the following molecule?
CC(C)C(C(C)C)C(N)C(=O)O.Cl
<BB_9203>
What is the molecular formula for <BB_9203>?
The molecular formula for <BB_9203> (CC(C)C(C(C)C)C(N)C(=O)O.Cl) is C9H20ClNO2.
Describe the ring structures in building block <BB_9203>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9203>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9203>.
**Token:** <BB_9203> **SMILES:** CC(C)C(C(C)C)C(N)C(=O)O.Cl **Molecular Formula:** C9H20ClNO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9204>.
Nc1n[nH]c2ccc(Cl)cc12
What is the building block token for the following molecule?
Nc1n[nH]c2ccc(Cl)cc12
<BB_9204>
What is the molecular formula for <BB_9204>?
The molecular formula for <BB_9204> (Nc1n[nH]c2ccc(Cl)cc12) is C7H6ClN3.
Describe the ring structures in building block <BB_9204>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9204>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9204>.
**Token:** <BB_9204> **SMILES:** Nc1n[nH]c2ccc(Cl)cc12 **Molecular Formula:** C7H6ClN3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9205>.
CC(C)(C)NS(=O)(=O)c1ccccc1NN
What is the building block token for the following molecule?
CC(C)(C)NS(=O)(=O)c1ccccc1NN
<BB_9205>
What is the molecular formula for <BB_9205>?
The molecular formula for <BB_9205> (CC(C)(C)NS(=O)(=O)c1ccccc1NN) is C10H17N3O2S.
Describe the ring structures in building block <BB_9205>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9205>.
The molecule contains the following groups: Amine, Secondary Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_9205>.
**Token:** <BB_9205> **SMILES:** CC(C)(C)NS(=O)(=O)c1ccccc1NN **Molecular Formula:** C10H17N3O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_9206>.
COc1ccc(C(O)CN(C)C)cc1
What is the building block token for the following molecule?
COc1ccc(C(O)CN(C)C)cc1
<BB_9206>
What is the molecular formula for <BB_9206>?
The molecular formula for <BB_9206> (COc1ccc(C(O)CN(C)C)cc1) is C11H17NO2.
Describe the ring structures in building block <BB_9206>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9206>.
The molecule contains the following groups: Tertiary Amine, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_9206>.
**Token:** <BB_9206> **SMILES:** COc1ccc(C(O)CN(C)C)cc1 **Molecular Formula:** C11H17NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_9207>.
N#Cc1cc(C(=O)[O-])ncc1N.[Na+]
What is the building block token for the following molecule?
N#Cc1cc(C(=O)[O-])ncc1N.[Na+]
<BB_9207>
What is the molecular formula for <BB_9207>?
The molecular formula for <BB_9207> (N#Cc1cc(C(=O)[O-])ncc1N.[Na+]) is C7H4N3NaO2.
Describe the ring structures in building block <BB_9207>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9207>.
The molecule contains the following groups: Amine, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9207>.
**Token:** <BB_9207> **SMILES:** N#Cc1cc(C(=O)[O-])ncc1N.[Na+] **Molecular Formula:** C7H4N3NaO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Nitrile
Provide the SMILES representation for the building block token <BB_9208>.
Cl.N#C[C@H]1CCCC[C@H]1N
What is the building block token for the following molecule?
Cl.N#C[C@H]1CCCC[C@H]1N
<BB_9208>
What is the molecular formula for <BB_9208>?
The molecular formula for <BB_9208> (Cl.N#C[C@H]1CCCC[C@H]1N) is C7H13ClN2.
Describe the ring structures in building block <BB_9208>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9208>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9208>.
**Token:** <BB_9208> **SMILES:** Cl.N#C[C@H]1CCCC[C@H]1N **Molecular Formula:** C7H13ClN2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_9209>.
COc1cc(C)c2c(c1)NC(C(=O)O)C2.Cl
What is the building block token for the following molecule?
COc1cc(C)c2c(c1)NC(C(=O)O)C2.Cl
<BB_9209>
What is the molecular formula for <BB_9209>?
The molecular formula for <BB_9209> (COc1cc(C)c2c(c1)NC(C(=O)O)C2.Cl) is C11H14ClNO3.
Describe the ring structures in building block <BB_9209>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9209>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9209>.
**Token:** <BB_9209> **SMILES:** COc1cc(C)c2c(c1)NC(C(=O)O)C2.Cl **Molecular Formula:** C11H14ClNO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9210>.
CC(C)(C)C[C@@H]1C[C@H]1C(=O)O
What is the building block token for the following molecule?
CC(C)(C)C[C@@H]1C[C@H]1C(=O)O
<BB_9210>
What is the molecular formula for <BB_9210>?
The molecular formula for <BB_9210> (CC(C)(C)C[C@@H]1C[C@H]1C(=O)O) is C9H16O2.
Describe the ring structures in building block <BB_9210>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_9210>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_9210>.
**Token:** <BB_9210> **SMILES:** CC(C)(C)C[C@@H]1C[C@H]1C(=O)O **Molecular Formula:** C9H16O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_9211>.
C[C@H](N)CC1CC1.Cl
What is the building block token for the following molecule?
C[C@H](N)CC1CC1.Cl
<BB_9211>
What is the molecular formula for <BB_9211>?
The molecular formula for <BB_9211> (C[C@H](N)CC1CC1.Cl) is C6H14ClN.
Describe the ring structures in building block <BB_9211>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_9211>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9211>.
**Token:** <BB_9211> **SMILES:** C[C@H](N)CC1CC1.Cl **Molecular Formula:** C6H14ClN **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9212>.
COC1(OC)CCCN1C
What is the building block token for the following molecule?
COC1(OC)CCCN1C
<BB_9212>
What is the molecular formula for <BB_9212>?
The molecular formula for <BB_9212> (COC1(OC)CCCN1C) is C7H15NO2.
Describe the ring structures in building block <BB_9212>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_9212>.
The molecule contains the following groups: Tertiary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_9212>.
**Token:** <BB_9212> **SMILES:** COC1(OC)CCCN1C **Molecular Formula:** C7H15NO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Tertiary Amine, Ether
Provide the SMILES representation for the building block token <BB_9213>.
Nc1ncnc2c1ncn2CCCO
What is the building block token for the following molecule?
Nc1ncnc2c1ncn2CCCO
<BB_9213>
What is the molecular formula for <BB_9213>?
The molecular formula for <BB_9213> (Nc1ncnc2c1ncn2CCCO) is C8H11N5O.
Describe the ring structures in building block <BB_9213>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9213>.
The molecule contains the following groups: Amine, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_9213>.
**Token:** <BB_9213> **SMILES:** Nc1ncnc2c1ncn2CCCO **Molecular Formula:** C8H11N5O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine, Alcohol
Provide the SMILES representation for the building block token <BB_9214>.
CCN1CC2(CNC2)C1.Cl.Cl
What is the building block token for the following molecule?
CCN1CC2(CNC2)C1.Cl.Cl
<BB_9214>
What is the molecular formula for <BB_9214>?
The molecular formula for <BB_9214> (CCN1CC2(CNC2)C1.Cl.Cl) is C7H16Cl2N2.
Describe the ring structures in building block <BB_9214>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4.
List the primary functional groups present in <BB_9214>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9214>.
**Token:** <BB_9214> **SMILES:** CCN1CC2(CNC2)C1.Cl.Cl **Molecular Formula:** C7H16Cl2N2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4. **Functional Groups:** Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9215>.
O=C(O)C1CC(c2ccc(Cl)cc2Cl)=NO1
What is the building block token for the following molecule?
O=C(O)C1CC(c2ccc(Cl)cc2Cl)=NO1
<BB_9215>
What is the molecular formula for <BB_9215>?
The molecular formula for <BB_9215> (O=C(O)C1CC(c2ccc(Cl)cc2Cl)=NO1) is C10H7Cl2NO3.
Describe the ring structures in building block <BB_9215>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9215>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9215>.
**Token:** <BB_9215> **SMILES:** O=C(O)C1CC(c2ccc(Cl)cc2Cl)=NO1 **Molecular Formula:** C10H7Cl2NO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9216>.
O=Cc1ccc2[nH]nc(Cl)c2c1
What is the building block token for the following molecule?
O=Cc1ccc2[nH]nc(Cl)c2c1
<BB_9216>
What is the molecular formula for <BB_9216>?
The molecular formula for <BB_9216> (O=Cc1ccc2[nH]nc(Cl)c2c1) is C8H5ClN2O.
Describe the ring structures in building block <BB_9216>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.