instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_9216>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9216>.
**Token:** <BB_9216> **SMILES:** O=Cc1ccc2[nH]nc(Cl)c2c1 **Molecular Formula:** C8H5ClN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9217>.
CC(C)(CN)c1ccc(F)cn1
What is the building block token for the following molecule?
CC(C)(CN)c1ccc(F)cn1
<BB_9217>
What is the molecular formula for <BB_9217>?
The molecular formula for <BB_9217> (CC(C)(CN)c1ccc(F)cn1) is C9H13FN2.
Describe the ring structures in building block <BB_9217>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9217>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9217>.
**Token:** <BB_9217> **SMILES:** CC(C)(CN)c1ccc(F)cn1 **Molecular Formula:** C9H13FN2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9218>.
CC(C)(N)CCc1ccccn1
What is the building block token for the following molecule?
CC(C)(N)CCc1ccccn1
<BB_9218>
What is the molecular formula for <BB_9218>?
The molecular formula for <BB_9218> (CC(C)(N)CCc1ccccn1) is C10H16N2.
Describe the ring structures in building block <BB_9218>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9218>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_9218>.
**Token:** <BB_9218> **SMILES:** CC(C)(N)CCc1ccccn1 **Molecular Formula:** C10H16N2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_9219>.
COc1c(F)ccc(C(C)=O)c1F
What is the building block token for the following molecule?
COc1c(F)ccc(C(C)=O)c1F
<BB_9219>
What is the molecular formula for <BB_9219>?
The molecular formula for <BB_9219> (COc1c(F)ccc(C(C)=O)c1F) is C9H8F2O2.
Describe the ring structures in building block <BB_9219>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9219>.
The molecule contains the following groups: Ketone, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9219>.
**Token:** <BB_9219> **SMILES:** COc1c(F)ccc(C(C)=O)c1F **Molecular Formula:** C9H8F2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9220>.
Clc1ccc(COCc2ccc(Cl)cc2Cl)c(Cl)c1
What is the building block token for the following molecule?
Clc1ccc(COCc2ccc(Cl)cc2Cl)c(Cl)c1
<BB_9220>
What is the molecular formula for <BB_9220>?
The molecular formula for <BB_9220> (Clc1ccc(COCc2ccc(Cl)cc2Cl)c(Cl)c1) is C14H10Cl4O.
Describe the ring structures in building block <BB_9220>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9220>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9220>.
**Token:** <BB_9220> **SMILES:** Clc1ccc(COCc2ccc(Cl)cc2Cl)c(Cl)c1 **Molecular Formula:** C14H10Cl4O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9221>.
Cl.ClCc1ccccn1
What is the building block token for the following molecule?
Cl.ClCc1ccccn1
<BB_9221>
What is the molecular formula for <BB_9221>?
The molecular formula for <BB_9221> (Cl.ClCc1ccccn1) is C6H7Cl2N.
Describe the ring structures in building block <BB_9221>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9221>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9221>.
**Token:** <BB_9221> **SMILES:** Cl.ClCc1ccccn1 **Molecular Formula:** C6H7Cl2N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9222>.
O=S(=O)(Cl)c1ccc(F)c(I)c1
What is the building block token for the following molecule?
O=S(=O)(Cl)c1ccc(F)c(I)c1
<BB_9222>
What is the molecular formula for <BB_9222>?
The molecular formula for <BB_9222> (O=S(=O)(Cl)c1ccc(F)c(I)c1) is C6H3ClFIO2S.
Describe the ring structures in building block <BB_9222>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9222>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9222>.
**Token:** <BB_9222> **SMILES:** O=S(=O)(Cl)c1ccc(F)c(I)c1 **Molecular Formula:** C6H3ClFIO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9223>.
Cl.NC1CC2CCC(C1)C2
What is the building block token for the following molecule?
Cl.NC1CC2CCC(C1)C2
<BB_9223>
What is the molecular formula for <BB_9223>?
The molecular formula for <BB_9223> (Cl.NC1CC2CCC(C1)C2) is C8H16ClN.
Describe the ring structures in building block <BB_9223>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9223>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9223>.
**Token:** <BB_9223> **SMILES:** Cl.NC1CC2CCC(C1)C2 **Molecular Formula:** C8H16ClN **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9224>.
CC(C)=C(F)CO
What is the building block token for the following molecule?
CC(C)=C(F)CO
<BB_9224>
What is the molecular formula for <BB_9224>?
The molecular formula for <BB_9224> (CC(C)=C(F)CO) is C5H9FO.
Describe the ring structures in building block <BB_9224>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9224>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9224>.
**Token:** <BB_9224> **SMILES:** CC(C)=C(F)CO **Molecular Formula:** C5H9FO **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9225>.
Cl.Cl.NC(CO)CN1CCCCC1
What is the building block token for the following molecule?
Cl.Cl.NC(CO)CN1CCCCC1
<BB_9225>
What is the molecular formula for <BB_9225>?
The molecular formula for <BB_9225> (Cl.Cl.NC(CO)CN1CCCCC1) is C8H20Cl2N2O.
Describe the ring structures in building block <BB_9225>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9225>.
The molecule contains the following groups: Amine, Tertiary Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9225>.
**Token:** <BB_9225> **SMILES:** Cl.Cl.NC(CO)CN1CCCCC1 **Molecular Formula:** C8H20Cl2N2O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9226>.
CC(=O)O.CSc1cccc(F)c1C(C)N
What is the building block token for the following molecule?
CC(=O)O.CSc1cccc(F)c1C(C)N
<BB_9226>
What is the molecular formula for <BB_9226>?
The molecular formula for <BB_9226> (CC(=O)O.CSc1cccc(F)c1C(C)N) is C11H16FNO2S.
Describe the ring structures in building block <BB_9226>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9226>.
The molecule contains the following groups: Carboxylic Acid, Amine, Sulfide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9226>.
**Token:** <BB_9226> **SMILES:** CC(=O)O.CSc1cccc(F)c1C(C)N **Molecular Formula:** C11H16FNO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine, Sulfide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9227>.
CC(C)(C)OC(=O)N1CC2(CCN2)C1.Cl
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CC2(CCN2)C1.Cl
<BB_9227>
What is the molecular formula for <BB_9227>?
The molecular formula for <BB_9227> (CC(C)(C)OC(=O)N1CC2(CCN2)C1.Cl) is C10H19ClN2O2.
Describe the ring structures in building block <BB_9227>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4.
List the primary functional groups present in <BB_9227>.
The molecule contains the following groups: Secondary Amine, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9227>.
**Token:** <BB_9227> **SMILES:** CC(C)(C)OC(=O)N1CC2(CCN2)C1.Cl **Molecular Formula:** C10H19ClN2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4. **Functional Groups:** Secondary Amine, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9228>.
O=C(Cc1ccsc1)NCCOCCO
What is the building block token for the following molecule?
O=C(Cc1ccsc1)NCCOCCO
<BB_9228>
What is the molecular formula for <BB_9228>?
The molecular formula for <BB_9228> (O=C(Cc1ccsc1)NCCOCCO) is C10H15NO3S.
Describe the ring structures in building block <BB_9228>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9228>.
The molecule contains the following groups: Amide, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_9228>.
**Token:** <BB_9228> **SMILES:** O=C(Cc1ccsc1)NCCOCCO **Molecular Formula:** C10H15NO3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amide, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_9229>.
Brc1ccnc2ccnn12
What is the building block token for the following molecule?
Brc1ccnc2ccnn12
<BB_9229>
What is the molecular formula for <BB_9229>?
The molecular formula for <BB_9229> (Brc1ccnc2ccnn12) is C6H4BrN3.
Describe the ring structures in building block <BB_9229>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9229>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9229>.
**Token:** <BB_9229> **SMILES:** Brc1ccnc2ccnn12 **Molecular Formula:** C6H4BrN3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9230>.
CC(=NO)c1sc(N)nc1C
What is the building block token for the following molecule?
CC(=NO)c1sc(N)nc1C
<BB_9230>
What is the molecular formula for <BB_9230>?
The molecular formula for <BB_9230> (CC(=NO)c1sc(N)nc1C) is C6H9N3OS.
Describe the ring structures in building block <BB_9230>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9230>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_9230>.
**Token:** <BB_9230> **SMILES:** CC(=NO)c1sc(N)nc1C **Molecular Formula:** C6H9N3OS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_9231>.
CC1CCN(Cc2ccc(Br)cc2)CC1
What is the building block token for the following molecule?
CC1CCN(Cc2ccc(Br)cc2)CC1
<BB_9231>
What is the molecular formula for <BB_9231>?
The molecular formula for <BB_9231> (CC1CCN(Cc2ccc(Br)cc2)CC1) is C13H18BrN.
Describe the ring structures in building block <BB_9231>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9231>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9231>.
**Token:** <BB_9231> **SMILES:** CC1CCN(Cc2ccc(Br)cc2)CC1 **Molecular Formula:** C13H18BrN **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9232>.
CCOc1cc(C#N)c(Br)cc1O
What is the building block token for the following molecule?
CCOc1cc(C#N)c(Br)cc1O
<BB_9232>
What is the molecular formula for <BB_9232>?
The molecular formula for <BB_9232> (CCOc1cc(C#N)c(Br)cc1O) is C9H8BrNO2.
Describe the ring structures in building block <BB_9232>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9232>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9232>.
**Token:** <BB_9232> **SMILES:** CCOc1cc(C#N)c(Br)cc1O **Molecular Formula:** C9H8BrNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_9233>.
Cc1ncc(Br)c(C#N)n1
What is the building block token for the following molecule?
Cc1ncc(Br)c(C#N)n1
<BB_9233>