instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_9233>?
The molecular formula for <BB_9233> (Cc1ncc(Br)c(C#N)n1) is C6H4BrN3.
Describe the ring structures in building block <BB_9233>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9233>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9233>.
**Token:** <BB_9233> **SMILES:** Cc1ncc(Br)c(C#N)n1 **Molecular Formula:** C6H4BrN3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_9234>.
OCC1(CBr)CC(F)(F)C1
What is the building block token for the following molecule?
OCC1(CBr)CC(F)(F)C1
<BB_9234>
What is the molecular formula for <BB_9234>?
The molecular formula for <BB_9234> (OCC1(CBr)CC(F)(F)C1) is C6H9BrF2O.
Describe the ring structures in building block <BB_9234>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_9234>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9234>.
**Token:** <BB_9234> **SMILES:** OCC1(CBr)CC(F)(F)C1 **Molecular Formula:** C6H9BrF2O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9235>.
CC(CO)CC1CCOCC1
What is the building block token for the following molecule?
CC(CO)CC1CCOCC1
<BB_9235>
What is the molecular formula for <BB_9235>?
The molecular formula for <BB_9235> (CC(CO)CC1CCOCC1) is C9H18O2.
Describe the ring structures in building block <BB_9235>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9235>.
The molecule contains the following groups: Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_9235>.
**Token:** <BB_9235> **SMILES:** CC(CO)CC1CCOCC1 **Molecular Formula:** C9H18O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Alcohol, Ether
Provide the SMILES representation for the building block token <BB_9236>.
COc1ccc(C(=O)Cc2ccccc2F)c(Br)c1
What is the building block token for the following molecule?
COc1ccc(C(=O)Cc2ccccc2F)c(Br)c1
<BB_9236>
What is the molecular formula for <BB_9236>?
The molecular formula for <BB_9236> (COc1ccc(C(=O)Cc2ccccc2F)c(Br)c1) is C15H12BrFO2.
Describe the ring structures in building block <BB_9236>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9236>.
The molecule contains the following groups: Ketone, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9236>.
**Token:** <BB_9236> **SMILES:** COc1ccc(C(=O)Cc2ccccc2F)c(Br)c1 **Molecular Formula:** C15H12BrFO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ketone, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9237>.
Nc1cc(F)c(C(=O)O)cc1[N+](=O)[O-]
What is the building block token for the following molecule?
Nc1cc(F)c(C(=O)O)cc1[N+](=O)[O-]
<BB_9237>
What is the molecular formula for <BB_9237>?
The molecular formula for <BB_9237> (Nc1cc(F)c(C(=O)O)cc1[N+](=O)[O-]) is C7H5FN2O4.
Describe the ring structures in building block <BB_9237>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9237>.
The molecule contains the following groups: Carboxylic Acid, Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_9237>.
**Token:** <BB_9237> **SMILES:** Nc1cc(F)c(C(=O)O)cc1[N+](=O)[O-] **Molecular Formula:** C7H5FN2O4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_9238>.
ClCCc1cscn1
What is the building block token for the following molecule?
ClCCc1cscn1
<BB_9238>
What is the molecular formula for <BB_9238>?
The molecular formula for <BB_9238> (ClCCc1cscn1) is C5H6ClNS.
Describe the ring structures in building block <BB_9238>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9238>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9238>.
**Token:** <BB_9238> **SMILES:** ClCCc1cscn1 **Molecular Formula:** C5H6ClNS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9239>.
CNCC1CCOCC1.Cl
What is the building block token for the following molecule?
CNCC1CCOCC1.Cl
<BB_9239>
What is the molecular formula for <BB_9239>?
The molecular formula for <BB_9239> (CNCC1CCOCC1.Cl) is C7H16ClNO.
Describe the ring structures in building block <BB_9239>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9239>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9239>.
**Token:** <BB_9239> **SMILES:** CNCC1CCOCC1.Cl **Molecular Formula:** C7H16ClNO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9240>.
C[C@]1(C(=O)O)C[C@H](C#N)C1
What is the building block token for the following molecule?
C[C@]1(C(=O)O)C[C@H](C#N)C1
<BB_9240>
What is the molecular formula for <BB_9240>?
The molecular formula for <BB_9240> (C[C@]1(C(=O)O)C[C@H](C#N)C1) is C7H9NO2.
Describe the ring structures in building block <BB_9240>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_9240>.
The molecule contains the following groups: Carboxylic Acid, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9240>.
**Token:** <BB_9240> **SMILES:** C[C@]1(C(=O)O)C[C@H](C#N)C1 **Molecular Formula:** C7H9NO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid, Nitrile
Provide the SMILES representation for the building block token <BB_9241>.
Cc1c(Br)ncc(Br)c1N
What is the building block token for the following molecule?
Cc1c(Br)ncc(Br)c1N
<BB_9241>
What is the molecular formula for <BB_9241>?
The molecular formula for <BB_9241> (Cc1c(Br)ncc(Br)c1N) is C6H6Br2N2.
Describe the ring structures in building block <BB_9241>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9241>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9241>.
**Token:** <BB_9241> **SMILES:** Cc1c(Br)ncc(Br)c1N **Molecular Formula:** C6H6Br2N2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9242>.
Fc1ccc(Nc2ccc(F)cc2)cc1
What is the building block token for the following molecule?
Fc1ccc(Nc2ccc(F)cc2)cc1
<BB_9242>
What is the molecular formula for <BB_9242>?
The molecular formula for <BB_9242> (Fc1ccc(Nc2ccc(F)cc2)cc1) is C12H9F2N.
Describe the ring structures in building block <BB_9242>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9242>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9242>.
**Token:** <BB_9242> **SMILES:** Fc1ccc(Nc2ccc(F)cc2)cc1 **Molecular Formula:** C12H9F2N **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9243>.
Cc1ccc(S(=O)(=O)Cl)cc1I
What is the building block token for the following molecule?
Cc1ccc(S(=O)(=O)Cl)cc1I
<BB_9243>
What is the molecular formula for <BB_9243>?
The molecular formula for <BB_9243> (Cc1ccc(S(=O)(=O)Cl)cc1I) is C7H6ClIO2S.
Describe the ring structures in building block <BB_9243>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9243>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9243>.
**Token:** <BB_9243> **SMILES:** Cc1ccc(S(=O)(=O)Cl)cc1I **Molecular Formula:** C7H6ClIO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9244>.
OC1CCc2ccccc2NC1
What is the building block token for the following molecule?
OC1CCc2ccccc2NC1
<BB_9244>
What is the molecular formula for <BB_9244>?
The molecular formula for <BB_9244> (OC1CCc2ccccc2NC1) is C10H13NO.
Describe the ring structures in building block <BB_9244>.
The molecule contains 2 ring(s): an aliphatic ring of size 7, an aromatic ring of size 6.
List the primary functional groups present in <BB_9244>.
The molecule contains the following groups: Secondary Amine, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_9244>.
**Token:** <BB_9244> **SMILES:** OC1CCc2ccccc2NC1 **Molecular Formula:** C10H13NO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 7, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Alcohol
Provide the SMILES representation for the building block token <BB_9245>.
Brc1cccc(I)c1
What is the building block token for the following molecule?
Brc1cccc(I)c1
<BB_9245>
What is the molecular formula for <BB_9245>?
The molecular formula for <BB_9245> (Brc1cccc(I)c1) is C6H4BrI.
Describe the ring structures in building block <BB_9245>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9245>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9245>.
**Token:** <BB_9245> **SMILES:** Brc1cccc(I)c1 **Molecular Formula:** C6H4BrI **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9246>.
C[C@H]1O[C@H]1C(=O)[O-].[K+]
What is the building block token for the following molecule?
C[C@H]1O[C@H]1C(=O)[O-].[K+]
<BB_9246>
What is the molecular formula for <BB_9246>?
The molecular formula for <BB_9246> (C[C@H]1O[C@H]1C(=O)[O-].[K+]) is C4H5KO3.
Describe the ring structures in building block <BB_9246>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_9246>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_9246>.
**Token:** <BB_9246> **SMILES:** C[C@H]1O[C@H]1C(=O)[O-].[K+] **Molecular Formula:** C4H5KO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_9247>.
CC(C)Oc1ccc(C(C)N)cc1.Cl
What is the building block token for the following molecule?
CC(C)Oc1ccc(C(C)N)cc1.Cl
<BB_9247>
What is the molecular formula for <BB_9247>?
The molecular formula for <BB_9247> (CC(C)Oc1ccc(C(C)N)cc1.Cl) is C11H18ClNO.
Describe the ring structures in building block <BB_9247>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9247>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9247>.
**Token:** <BB_9247> **SMILES:** CC(C)Oc1ccc(C(C)N)cc1.Cl **Molecular Formula:** C11H18ClNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9248>.
Nc1ccc(OC(F)F)c(C(F)(F)F)c1
What is the building block token for the following molecule?
Nc1ccc(OC(F)F)c(C(F)(F)F)c1
<BB_9248>
What is the molecular formula for <BB_9248>?
The molecular formula for <BB_9248> (Nc1ccc(OC(F)F)c(C(F)(F)F)c1) is C8H6F5NO.
Describe the ring structures in building block <BB_9248>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9248>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9248>.
**Token:** <BB_9248> **SMILES:** Nc1ccc(OC(F)F)c(C(F)(F)F)c1 **Molecular Formula:** C8H6F5NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9249>.
CC(C)(C)OC(=O)CN1CCCCC(N)C1=O
What is the building block token for the following molecule?
CC(C)(C)OC(=O)CN1CCCCC(N)C1=O
<BB_9249>
What is the molecular formula for <BB_9249>?
The molecular formula for <BB_9249> (CC(C)(C)OC(=O)CN1CCCCC(N)C1=O) is C12H22N2O3.
Describe the ring structures in building block <BB_9249>.
The molecule contains 1 ring(s): an aliphatic ring of size 7.
List the primary functional groups present in <BB_9249>.
The molecule contains the following groups: Amine, Amide, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_9249>.
**Token:** <BB_9249> **SMILES:** CC(C)(C)OC(=O)CN1CCCCC(N)C1=O **Molecular Formula:** C12H22N2O3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 7. **Functional Groups:** Amine, Amide, Ester, Ether