instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_9250>.
Oc1nc(O)c2ccc(Cl)nc2n1
What is the building block token for the following molecule?
Oc1nc(O)c2ccc(Cl)nc2n1
<BB_9250>
What is the molecular formula for <BB_9250>?
The molecular formula for <BB_9250> (Oc1nc(O)c2ccc(Cl)nc2n1) is C7H4ClN3O2.
Describe the ring structures in building block <BB_9250>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9250>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9250>.
**Token:** <BB_9250> **SMILES:** Oc1nc(O)c2ccc(Cl)nc2n1 **Molecular Formula:** C7H4ClN3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9251>.
C[C@H](C=O)NC(=O)OC(C)(C)C
What is the building block token for the following molecule?
C[C@H](C=O)NC(=O)OC(C)(C)C
<BB_9251>
What is the molecular formula for <BB_9251>?
The molecular formula for <BB_9251> (C[C@H](C=O)NC(=O)OC(C)(C)C) is C8H15NO3.
Describe the ring structures in building block <BB_9251>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9251>.
The molecule contains the following groups: Amide, Aldehyde, Ether.
Provide a comprehensive chemical profile for the building block <BB_9251>.
**Token:** <BB_9251> **SMILES:** C[C@H](C=O)NC(=O)OC(C)(C)C **Molecular Formula:** C8H15NO3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amide, Aldehyde, Ether
Provide the SMILES representation for the building block token <BB_9252>.
CC(C)(CC(=O)O)C1CC(=O)C1
What is the building block token for the following molecule?
CC(C)(CC(=O)O)C1CC(=O)C1
<BB_9252>
What is the molecular formula for <BB_9252>?
The molecular formula for <BB_9252> (CC(C)(CC(=O)O)C1CC(=O)C1) is C9H14O3.
Describe the ring structures in building block <BB_9252>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_9252>.
The molecule contains the following groups: Carboxylic Acid, Ketone.
Provide a comprehensive chemical profile for the building block <BB_9252>.
**Token:** <BB_9252> **SMILES:** CC(C)(CC(=O)O)C1CC(=O)C1 **Molecular Formula:** C9H14O3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid, Ketone
Provide the SMILES representation for the building block token <BB_9253>.
Cc1nc(CNC(C(=O)O)C(C)C)cs1.Cl.Cl
What is the building block token for the following molecule?
Cc1nc(CNC(C(=O)O)C(C)C)cs1.Cl.Cl
<BB_9253>
What is the molecular formula for <BB_9253>?
The molecular formula for <BB_9253> (Cc1nc(CNC(C(=O)O)C(C)C)cs1.Cl.Cl) is C10H18Cl2N2O2S.
Describe the ring structures in building block <BB_9253>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9253>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9253>.
**Token:** <BB_9253> **SMILES:** Cc1nc(CNC(C(=O)O)C(C)C)cs1.Cl.Cl **Molecular Formula:** C10H18Cl2N2O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9254>.
Cl.NCCC1CC1(Br)Br
What is the building block token for the following molecule?
Cl.NCCC1CC1(Br)Br
<BB_9254>
What is the molecular formula for <BB_9254>?
The molecular formula for <BB_9254> (Cl.NCCC1CC1(Br)Br) is C5H10Br2ClN.
Describe the ring structures in building block <BB_9254>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_9254>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9254>.
**Token:** <BB_9254> **SMILES:** Cl.NCCC1CC1(Br)Br **Molecular Formula:** C5H10Br2ClN **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9255>.
O=C(c1ccccc1)c1ccsn1
What is the building block token for the following molecule?
O=C(c1ccccc1)c1ccsn1
<BB_9255>
What is the molecular formula for <BB_9255>?
The molecular formula for <BB_9255> (O=C(c1ccccc1)c1ccsn1) is C10H7NOS.
Describe the ring structures in building block <BB_9255>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9255>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_9255>.
**Token:** <BB_9255> **SMILES:** O=C(c1ccccc1)c1ccsn1 **Molecular Formula:** C10H7NOS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_9256>.
CC(=O)c1cnn2c1OCCC2
What is the building block token for the following molecule?
CC(=O)c1cnn2c1OCCC2
<BB_9256>
What is the molecular formula for <BB_9256>?
The molecular formula for <BB_9256> (CC(=O)c1cnn2c1OCCC2) is C8H10N2O2.
Describe the ring structures in building block <BB_9256>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9256>.
The molecule contains the following groups: Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_9256>.
**Token:** <BB_9256> **SMILES:** CC(=O)c1cnn2c1OCCC2 **Molecular Formula:** C8H10N2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Ketone, Ether
Provide the SMILES representation for the building block token <BB_9257>.
CC(C)(C)OC(=O)NCC12CC(CN)(C1)C2(F)F
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NCC12CC(CN)(C1)C2(F)F
<BB_9257>
What is the molecular formula for <BB_9257>?
The molecular formula for <BB_9257> (CC(C)(C)OC(=O)NCC12CC(CN)(C1)C2(F)F) is C12H20F2N2O2.
Describe the ring structures in building block <BB_9257>.
The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4, an aliphatic ring of size 4.
List the primary functional groups present in <BB_9257>.
The molecule contains the following groups: Amine, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9257>.
**Token:** <BB_9257> **SMILES:** CC(C)(C)OC(=O)NCC12CC(CN)(C1)C2(F)F **Molecular Formula:** C12H20F2N2O2 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4, an aliphatic ring of size 4. **Functional Groups:** Amine, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9258>.
NC(=O)C1C(=O)c2ccccc2C1c1ccccc1
What is the building block token for the following molecule?
NC(=O)C1C(=O)c2ccccc2C1c1ccccc1
<BB_9258>
What is the molecular formula for <BB_9258>?
The molecular formula for <BB_9258> (NC(=O)C1C(=O)c2ccccc2C1c1ccccc1) is C16H13NO2.
Describe the ring structures in building block <BB_9258>.
The molecule contains 3 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9258>.
The molecule contains the following groups: Amide, Ketone.
Provide a comprehensive chemical profile for the building block <BB_9258>.
**Token:** <BB_9258> **SMILES:** NC(=O)C1C(=O)c2ccccc2C1c1ccccc1 **Molecular Formula:** C16H13NO2 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amide, Ketone
Provide the SMILES representation for the building block token <BB_9259>.
Cc1nc2nccc(C)c2[nH]1
What is the building block token for the following molecule?
Cc1nc2nccc(C)c2[nH]1
<BB_9259>
What is the molecular formula for <BB_9259>?
The molecular formula for <BB_9259> (Cc1nc2nccc(C)c2[nH]1) is C8H9N3.
Describe the ring structures in building block <BB_9259>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9259>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_9259>.
**Token:** <BB_9259> **SMILES:** Cc1nc2nccc(C)c2[nH]1 **Molecular Formula:** C8H9N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_9260>.
Nc1nc2cnc(Cl)cc2s1
What is the building block token for the following molecule?
Nc1nc2cnc(Cl)cc2s1
<BB_9260>
What is the molecular formula for <BB_9260>?
The molecular formula for <BB_9260> (Nc1nc2cnc(Cl)cc2s1) is C6H4ClN3S.
Describe the ring structures in building block <BB_9260>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9260>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9260>.
**Token:** <BB_9260> **SMILES:** Nc1nc2cnc(Cl)cc2s1 **Molecular Formula:** C6H4ClN3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9261>.
OC1CC2ON=C(Br)C2C1
What is the building block token for the following molecule?
OC1CC2ON=C(Br)C2C1
<BB_9261>
What is the molecular formula for <BB_9261>?
The molecular formula for <BB_9261> (OC1CC2ON=C(Br)C2C1) is C6H8BrNO2.
Describe the ring structures in building block <BB_9261>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9261>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9261>.
**Token:** <BB_9261> **SMILES:** OC1CC2ON=C(Br)C2C1 **Molecular Formula:** C6H8BrNO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9262>.
NC(=O)COc1ccc(C=O)cc1
What is the building block token for the following molecule?
NC(=O)COc1ccc(C=O)cc1
<BB_9262>
What is the molecular formula for <BB_9262>?
The molecular formula for <BB_9262> (NC(=O)COc1ccc(C=O)cc1) is C9H9NO3.
Describe the ring structures in building block <BB_9262>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9262>.
The molecule contains the following groups: Amide, Aldehyde, Ether.
Provide a comprehensive chemical profile for the building block <BB_9262>.
**Token:** <BB_9262> **SMILES:** NC(=O)COc1ccc(C=O)cc1 **Molecular Formula:** C9H9NO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Aldehyde, Ether
Provide the SMILES representation for the building block token <BB_9263>.
NC(=O)CN1CCN(CCO)CC1
What is the building block token for the following molecule?
NC(=O)CN1CCN(CCO)CC1
<BB_9263>
What is the molecular formula for <BB_9263>?
The molecular formula for <BB_9263> (NC(=O)CN1CCN(CCO)CC1) is C8H17N3O2.
Describe the ring structures in building block <BB_9263>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9263>.
The molecule contains the following groups: Tertiary Amine, Amide, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_9263>.
**Token:** <BB_9263> **SMILES:** NC(=O)CN1CCN(CCO)CC1 **Molecular Formula:** C8H17N3O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine, Amide, Alcohol
Provide the SMILES representation for the building block token <BB_9264>.
COC(C)(C)CCS(=O)(=O)Cl
What is the building block token for the following molecule?
COC(C)(C)CCS(=O)(=O)Cl
<BB_9264>
What is the molecular formula for <BB_9264>?
The molecular formula for <BB_9264> (COC(C)(C)CCS(=O)(=O)Cl) is C6H13ClO3S.
Describe the ring structures in building block <BB_9264>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9264>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9264>.
**Token:** <BB_9264> **SMILES:** COC(C)(C)CCS(=O)(=O)Cl **Molecular Formula:** C6H13ClO3S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9265>.
COc1ccccc1C(N)CC(C)C
What is the building block token for the following molecule?
COc1ccccc1C(N)CC(C)C
<BB_9265>
What is the molecular formula for <BB_9265>?
The molecular formula for <BB_9265> (COc1ccccc1C(N)CC(C)C) is C12H19NO.
Describe the ring structures in building block <BB_9265>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9265>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_9265>.
**Token:** <BB_9265> **SMILES:** COc1ccccc1C(N)CC(C)C **Molecular Formula:** C12H19NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_9266>.
O=C1CCc2cc(Cl)ccc2N1
What is the building block token for the following molecule?
O=C1CCc2cc(Cl)ccc2N1
<BB_9266>
What is the molecular formula for <BB_9266>?
The molecular formula for <BB_9266> (O=C1CCc2cc(Cl)ccc2N1) is C9H8ClNO.
Describe the ring structures in building block <BB_9266>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.