instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_9266>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9266>.
**Token:** <BB_9266> **SMILES:** O=C1CCc2cc(Cl)ccc2N1 **Molecular Formula:** C9H8ClNO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9267>.
Br[C@H]1CC=C[C@H]2C=C[C@@H]1C2
What is the building block token for the following molecule?
Br[C@H]1CC=C[C@H]2C=C[C@@H]1C2
<BB_9267>
What is the molecular formula for <BB_9267>?
The molecular formula for <BB_9267> (Br[C@H]1CC=C[C@H]2C=C[C@@H]1C2) is C9H11Br.
Describe the ring structures in building block <BB_9267>.
The molecule contains 2 ring(s): an aliphatic ring of size 7, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9267>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9267>.
**Token:** <BB_9267> **SMILES:** Br[C@H]1CC=C[C@H]2C=C[C@@H]1C2 **Molecular Formula:** C9H11Br **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 7, an aliphatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9268>.
CCCn1ncc(C=O)c1C
What is the building block token for the following molecule?
CCCn1ncc(C=O)c1C
<BB_9268>
What is the molecular formula for <BB_9268>?
The molecular formula for <BB_9268> (CCCn1ncc(C=O)c1C) is C8H12N2O.
Describe the ring structures in building block <BB_9268>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9268>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_9268>.
**Token:** <BB_9268> **SMILES:** CCCn1ncc(C=O)c1C **Molecular Formula:** C8H12N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_9269>.
COc1ccc(Cl)c(C)c1C(=O)O
What is the building block token for the following molecule?
COc1ccc(Cl)c(C)c1C(=O)O
<BB_9269>
What is the molecular formula for <BB_9269>?
The molecular formula for <BB_9269> (COc1ccc(Cl)c(C)c1C(=O)O) is C9H9ClO3.
Describe the ring structures in building block <BB_9269>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9269>.
The molecule contains the following groups: Carboxylic Acid, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9269>.
**Token:** <BB_9269> **SMILES:** COc1ccc(Cl)c(C)c1C(=O)O **Molecular Formula:** C9H9ClO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9270>.
Cc1nc(Br)cn1CC(=O)O.Cl
What is the building block token for the following molecule?
Cc1nc(Br)cn1CC(=O)O.Cl
<BB_9270>
What is the molecular formula for <BB_9270>?
The molecular formula for <BB_9270> (Cc1nc(Br)cn1CC(=O)O.Cl) is C6H8BrClN2O2.
Describe the ring structures in building block <BB_9270>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9270>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9270>.
**Token:** <BB_9270> **SMILES:** Cc1nc(Br)cn1CC(=O)O.Cl **Molecular Formula:** C6H8BrClN2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9271>.
CCc1noc(C)c1CCl
What is the building block token for the following molecule?
CCc1noc(C)c1CCl
<BB_9271>
What is the molecular formula for <BB_9271>?
The molecular formula for <BB_9271> (CCc1noc(C)c1CCl) is C7H10ClNO.
Describe the ring structures in building block <BB_9271>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9271>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9271>.
**Token:** <BB_9271> **SMILES:** CCc1noc(C)c1CCl **Molecular Formula:** C7H10ClNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9272>.
CC(C)(C)OC(=O)NCC/C=C/C(=O)O
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NCC/C=C/C(=O)O
<BB_9272>
What is the molecular formula for <BB_9272>?
The molecular formula for <BB_9272> (CC(C)(C)OC(=O)NCC/C=C/C(=O)O) is C10H17NO4.
Describe the ring structures in building block <BB_9272>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9272>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_9272>.
**Token:** <BB_9272> **SMILES:** CC(C)(C)OC(=O)NCC/C=C/C(=O)O **Molecular Formula:** C10H17NO4 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_9273>.
COC(=O)[C@]1(O)CCNC[C@H]1O.Cl
What is the building block token for the following molecule?
COC(=O)[C@]1(O)CCNC[C@H]1O.Cl
<BB_9273>
What is the molecular formula for <BB_9273>?
The molecular formula for <BB_9273> (COC(=O)[C@]1(O)CCNC[C@H]1O.Cl) is C7H14ClNO4.
Describe the ring structures in building block <BB_9273>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9273>.
The molecule contains the following groups: Secondary Amine, Ester, Alcohol, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9273>.
**Token:** <BB_9273> **SMILES:** COC(=O)[C@]1(O)CCNC[C@H]1O.Cl **Molecular Formula:** C7H14ClNO4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ester, Alcohol, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9274>.
COc1ccc(CN)c2ccccc12
What is the building block token for the following molecule?
COc1ccc(CN)c2ccccc12
<BB_9274>
What is the molecular formula for <BB_9274>?
The molecular formula for <BB_9274> (COc1ccc(CN)c2ccccc12) is C12H13NO.
Describe the ring structures in building block <BB_9274>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9274>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_9274>.
**Token:** <BB_9274> **SMILES:** COc1ccc(CN)c2ccccc12 **Molecular Formula:** C12H13NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_9275>.
CCC(N)C(=O)c1cccc(C)c1.Cl
What is the building block token for the following molecule?
CCC(N)C(=O)c1cccc(C)c1.Cl
<BB_9275>
What is the molecular formula for <BB_9275>?
The molecular formula for <BB_9275> (CCC(N)C(=O)c1cccc(C)c1.Cl) is C11H16ClNO.
Describe the ring structures in building block <BB_9275>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9275>.
The molecule contains the following groups: Amine, Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9275>.
**Token:** <BB_9275> **SMILES:** CCC(N)C(=O)c1cccc(C)c1.Cl **Molecular Formula:** C11H16ClNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9276>.
CC(=O)N1CCCC(CNS(C)(=O)=O)C1
What is the building block token for the following molecule?
CC(=O)N1CCCC(CNS(C)(=O)=O)C1
<BB_9276>
What is the molecular formula for <BB_9276>?
The molecular formula for <BB_9276> (CC(=O)N1CCCC(CNS(C)(=O)=O)C1) is C9H18N2O3S.
Describe the ring structures in building block <BB_9276>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9276>.
The molecule contains the following groups: Secondary Amine, Amide, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_9276>.
**Token:** <BB_9276> **SMILES:** CC(=O)N1CCCC(CNS(C)(=O)=O)C1 **Molecular Formula:** C9H18N2O3S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Sulfonamide
Provide the SMILES representation for the building block token <BB_9277>.
Cc1ccc2c(c1)C(N)C(=O)N2C.Cl.Cl
What is the building block token for the following molecule?
Cc1ccc2c(c1)C(N)C(=O)N2C.Cl.Cl
<BB_9277>
What is the molecular formula for <BB_9277>?
The molecular formula for <BB_9277> (Cc1ccc2c(c1)C(N)C(=O)N2C.Cl.Cl) is C10H14Cl2N2O.
Describe the ring structures in building block <BB_9277>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9277>.
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9277>.
**Token:** <BB_9277> **SMILES:** Cc1ccc2c(c1)C(N)C(=O)N2C.Cl.Cl **Molecular Formula:** C10H14Cl2N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9278>.
CN1CCCNC2(CC2)C1
What is the building block token for the following molecule?
CN1CCCNC2(CC2)C1
<BB_9278>
What is the molecular formula for <BB_9278>?
The molecular formula for <BB_9278> (CN1CCCNC2(CC2)C1) is C8H16N2.
Describe the ring structures in building block <BB_9278>.
The molecule contains 2 ring(s): an aliphatic ring of size 7, an aliphatic ring of size 3.
List the primary functional groups present in <BB_9278>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_9278>.
**Token:** <BB_9278> **SMILES:** CN1CCCNC2(CC2)C1 **Molecular Formula:** C8H16N2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 7, an aliphatic ring of size 3. **Functional Groups:** Secondary Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_9279>.
CC(C)(C)COS(=O)(=O)Cl
What is the building block token for the following molecule?
CC(C)(C)COS(=O)(=O)Cl
<BB_9279>
What is the molecular formula for <BB_9279>?
The molecular formula for <BB_9279> (CC(C)(C)COS(=O)(=O)Cl) is C5H11ClO3S.
Describe the ring structures in building block <BB_9279>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9279>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9279>.
**Token:** <BB_9279> **SMILES:** CC(C)(C)COS(=O)(=O)Cl **Molecular Formula:** C5H11ClO3S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9280>.
Cl.Cl.NCCNC1CC(=O)NC1=O
What is the building block token for the following molecule?
Cl.Cl.NCCNC1CC(=O)NC1=O
<BB_9280>
What is the molecular formula for <BB_9280>?
The molecular formula for <BB_9280> (Cl.Cl.NCCNC1CC(=O)NC1=O) is C6H13Cl2N3O2.
Describe the ring structures in building block <BB_9280>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_9280>.
The molecule contains the following groups: Amine, Secondary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9280>.
**Token:** <BB_9280> **SMILES:** Cl.Cl.NCCNC1CC(=O)NC1=O **Molecular Formula:** C6H13Cl2N3O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amine, Secondary Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9281>.
COC(=O)C1(C)CNC(C)(C)CO1.Cl
What is the building block token for the following molecule?
COC(=O)C1(C)CNC(C)(C)CO1.Cl
<BB_9281>
What is the molecular formula for <BB_9281>?
The molecular formula for <BB_9281> (COC(=O)C1(C)CNC(C)(C)CO1.Cl) is C9H18ClNO3.
Describe the ring structures in building block <BB_9281>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9281>.
The molecule contains the following groups: Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9281>.
**Token:** <BB_9281> **SMILES:** COC(=O)C1(C)CNC(C)(C)CO1.Cl **Molecular Formula:** C9H18ClNO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9282>.
CC(C)(C)OC(=O)N1CC(C)(N2CCCC2)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CC(C)(N2CCCC2)C1
<BB_9282>
What is the molecular formula for <BB_9282>?
The molecular formula for <BB_9282> (CC(C)(C)OC(=O)N1CC(C)(N2CCCC2)C1) is C13H24N2O2.
Describe the ring structures in building block <BB_9282>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9282>.
The molecule contains the following groups: Tertiary Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_9282>.
**Token:** <BB_9282> **SMILES:** CC(C)(C)OC(=O)N1CC(C)(N2CCCC2)C1 **Molecular Formula:** C13H24N2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 5. **Functional Groups:** Tertiary Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_9283>.
O=C(O)c1cccc(-n2cnnc2)c1
What is the building block token for the following molecule?
O=C(O)c1cccc(-n2cnnc2)c1
<BB_9283>