instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_9283>?
The molecular formula for <BB_9283> (O=C(O)c1cccc(-n2cnnc2)c1) is C9H7N3O2.
Describe the ring structures in building block <BB_9283>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9283>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_9283>.
**Token:** <BB_9283> **SMILES:** O=C(O)c1cccc(-n2cnnc2)c1 **Molecular Formula:** C9H7N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_9284>.
OCCc1ccnc(F)c1F
What is the building block token for the following molecule?
OCCc1ccnc(F)c1F
<BB_9284>
What is the molecular formula for <BB_9284>?
The molecular formula for <BB_9284> (OCCc1ccnc(F)c1F) is C7H7F2NO.
Describe the ring structures in building block <BB_9284>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9284>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9284>.
**Token:** <BB_9284> **SMILES:** OCCc1ccnc(F)c1F **Molecular Formula:** C7H7F2NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9285>.
CC(=CB1OC(C)(C)C(C)(C)O1)c1ccccc1
What is the building block token for the following molecule?
CC(=CB1OC(C)(C)C(C)(C)O1)c1ccccc1
<BB_9285>
What is the molecular formula for <BB_9285>?
The molecular formula for <BB_9285> (CC(=CB1OC(C)(C)C(C)(C)O1)c1ccccc1) is C15H21BO2.
Describe the ring structures in building block <BB_9285>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9285>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_9285>.
**Token:** <BB_9285> **SMILES:** CC(=CB1OC(C)(C)C(C)(C)O1)c1ccccc1 **Molecular Formula:** C15H21BO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_9286>.
Cl.O[C@@H]1CN[C@H]1C1CCC1
What is the building block token for the following molecule?
Cl.O[C@@H]1CN[C@H]1C1CCC1
<BB_9286>
What is the molecular formula for <BB_9286>?
The molecular formula for <BB_9286> (Cl.O[C@@H]1CN[C@H]1C1CCC1) is C7H14ClNO.
Describe the ring structures in building block <BB_9286>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4.
List the primary functional groups present in <BB_9286>.
The molecule contains the following groups: Secondary Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9286>.
**Token:** <BB_9286> **SMILES:** Cl.O[C@@H]1CN[C@H]1C1CCC1 **Molecular Formula:** C7H14ClNO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4. **Functional Groups:** Secondary Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9287>.
Cc1cc(Cl)c([N+](=O)[O-])cc1O
What is the building block token for the following molecule?
Cc1cc(Cl)c([N+](=O)[O-])cc1O
<BB_9287>
What is the molecular formula for <BB_9287>?
The molecular formula for <BB_9287> (Cc1cc(Cl)c([N+](=O)[O-])cc1O) is C7H6ClNO3.
Describe the ring structures in building block <BB_9287>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9287>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_9287>.
**Token:** <BB_9287> **SMILES:** Cc1cc(Cl)c([N+](=O)[O-])cc1O **Molecular Formula:** C7H6ClNO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_9288>.
CC(=O)c1sc2nc(CCl)[nH]c(=O)c2c1C
What is the building block token for the following molecule?
CC(=O)c1sc2nc(CCl)[nH]c(=O)c2c1C
<BB_9288>
What is the molecular formula for <BB_9288>?
The molecular formula for <BB_9288> (CC(=O)c1sc2nc(CCl)[nH]c(=O)c2c1C) is C10H9ClN2O2S.
Describe the ring structures in building block <BB_9288>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9288>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9288>.
**Token:** <BB_9288> **SMILES:** CC(=O)c1sc2nc(CCl)[nH]c(=O)c2c1C **Molecular Formula:** C10H9ClN2O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9289>.
N#CCCCCCC#N
What is the building block token for the following molecule?
N#CCCCCCC#N
<BB_9289>
What is the molecular formula for <BB_9289>?
The molecular formula for <BB_9289> (N#CCCCCCC#N) is C7H10N2.
Describe the ring structures in building block <BB_9289>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9289>.
The molecule contains the following groups: Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9289>.
**Token:** <BB_9289> **SMILES:** N#CCCCCCC#N **Molecular Formula:** C7H10N2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Nitrile
Provide the SMILES representation for the building block token <BB_9290>.
CCCN(N)C(=O)C1CC1
What is the building block token for the following molecule?
CCCN(N)C(=O)C1CC1
<BB_9290>
What is the molecular formula for <BB_9290>?
The molecular formula for <BB_9290> (CCCN(N)C(=O)C1CC1) is C7H14N2O.
Describe the ring structures in building block <BB_9290>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_9290>.
The molecule contains the following groups: Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_9290>.
**Token:** <BB_9290> **SMILES:** CCCN(N)C(=O)C1CC1 **Molecular Formula:** C7H14N2O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Amine, Amide
Provide the SMILES representation for the building block token <BB_9291>.
CC1CNC(C2CC2)C1.Cl
What is the building block token for the following molecule?
CC1CNC(C2CC2)C1.Cl
<BB_9291>
What is the molecular formula for <BB_9291>?
The molecular formula for <BB_9291> (CC1CNC(C2CC2)C1.Cl) is C8H16ClN.
Describe the ring structures in building block <BB_9291>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_9291>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9291>.
**Token:** <BB_9291> **SMILES:** CC1CNC(C2CC2)C1.Cl **Molecular Formula:** C8H16ClN **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9292>.
Cc1nccn1CCN
What is the building block token for the following molecule?
Cc1nccn1CCN
<BB_9292>
What is the molecular formula for <BB_9292>?
The molecular formula for <BB_9292> (Cc1nccn1CCN) is C6H11N3.
Describe the ring structures in building block <BB_9292>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9292>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_9292>.
**Token:** <BB_9292> **SMILES:** Cc1nccn1CCN **Molecular Formula:** C6H11N3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_9293>.
O=c1nc2cccccc-2n1Cc1ccccc1
What is the building block token for the following molecule?
O=c1nc2cccccc-2n1Cc1ccccc1
<BB_9293>
What is the molecular formula for <BB_9293>?
The molecular formula for <BB_9293> (O=c1nc2cccccc-2n1Cc1ccccc1) is C15H12N2O.
Describe the ring structures in building block <BB_9293>.
The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 7, an aromatic ring of size 6.
List the primary functional groups present in <BB_9293>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_9293>.
**Token:** <BB_9293> **SMILES:** O=c1nc2cccccc-2n1Cc1ccccc1 **Molecular Formula:** C15H12N2O **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 7, an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_9294>.
CN1CC2(CNC2)C1.Cl.Cl
What is the building block token for the following molecule?
CN1CC2(CNC2)C1.Cl.Cl
<BB_9294>
What is the molecular formula for <BB_9294>?
The molecular formula for <BB_9294> (CN1CC2(CNC2)C1.Cl.Cl) is C6H14Cl2N2.
Describe the ring structures in building block <BB_9294>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4.
List the primary functional groups present in <BB_9294>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9294>.
**Token:** <BB_9294> **SMILES:** CN1CC2(CNC2)C1.Cl.Cl **Molecular Formula:** C6H14Cl2N2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4. **Functional Groups:** Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9295>.
NC1CCN(CCCO)C1
What is the building block token for the following molecule?
NC1CCN(CCCO)C1
<BB_9295>
What is the molecular formula for <BB_9295>?
The molecular formula for <BB_9295> (NC1CCN(CCCO)C1) is C7H16N2O.
Describe the ring structures in building block <BB_9295>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_9295>.
The molecule contains the following groups: Amine, Tertiary Amine, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_9295>.
**Token:** <BB_9295> **SMILES:** NC1CCN(CCCO)C1 **Molecular Formula:** C7H16N2O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amine, Tertiary Amine, Alcohol
Provide the SMILES representation for the building block token <BB_9296>.
O=C(CCCl)c1ccc(F)cc1F
What is the building block token for the following molecule?
O=C(CCCl)c1ccc(F)cc1F
<BB_9296>
What is the molecular formula for <BB_9296>?
The molecular formula for <BB_9296> (O=C(CCCl)c1ccc(F)cc1F) is C9H7ClF2O.
Describe the ring structures in building block <BB_9296>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9296>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9296>.
**Token:** <BB_9296> **SMILES:** O=C(CCCl)c1ccc(F)cc1F **Molecular Formula:** C9H7ClF2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9297>.
O=C(O)c1csc2c(I)ncn12
What is the building block token for the following molecule?
O=C(O)c1csc2c(I)ncn12
<BB_9297>
What is the molecular formula for <BB_9297>?
The molecular formula for <BB_9297> (O=C(O)c1csc2c(I)ncn12) is C6H3IN2O2S.
Describe the ring structures in building block <BB_9297>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_9297>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9297>.
**Token:** <BB_9297> **SMILES:** O=C(O)c1csc2c(I)ncn12 **Molecular Formula:** C6H3IN2O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9298>.
C[C@H](N)COCc1ccccc1
What is the building block token for the following molecule?
C[C@H](N)COCc1ccccc1
<BB_9298>
What is the molecular formula for <BB_9298>?
The molecular formula for <BB_9298> (C[C@H](N)COCc1ccccc1) is C10H15NO.
Describe the ring structures in building block <BB_9298>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9298>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_9298>.
**Token:** <BB_9298> **SMILES:** C[C@H](N)COCc1ccccc1 **Molecular Formula:** C10H15NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_9299>.
Cc1c(N)cccc1-c1nnco1
What is the building block token for the following molecule?
Cc1c(N)cccc1-c1nnco1
<BB_9299>
What is the molecular formula for <BB_9299>?
The molecular formula for <BB_9299> (Cc1c(N)cccc1-c1nnco1) is C9H9N3O.
Describe the ring structures in building block <BB_9299>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9299>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_9299>.
**Token:** <BB_9299> **SMILES:** Cc1c(N)cccc1-c1nnco1 **Molecular Formula:** C9H9N3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine