instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_9300>.
Cl.N[C@@H](CC(=O)O)c1ccc(-c2ccccc2)cc1
What is the building block token for the following molecule?
Cl.N[C@@H](CC(=O)O)c1ccc(-c2ccccc2)cc1
<BB_9300>
What is the molecular formula for <BB_9300>?
The molecular formula for <BB_9300> (Cl.N[C@@H](CC(=O)O)c1ccc(-c2ccccc2)cc1) is C15H16ClNO2.
Describe the ring structures in building block <BB_9300>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9300>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9300>.
**Token:** <BB_9300> **SMILES:** Cl.N[C@@H](CC(=O)O)c1ccc(-c2ccccc2)cc1 **Molecular Formula:** C15H16ClNO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9301>.
NC(=O)N[C@@H](Cc1ccccc1)C(=O)O
What is the building block token for the following molecule?
NC(=O)N[C@@H](Cc1ccccc1)C(=O)O
<BB_9301>
What is the molecular formula for <BB_9301>?
The molecular formula for <BB_9301> (NC(=O)N[C@@H](Cc1ccccc1)C(=O)O) is C10H12N2O3.
Describe the ring structures in building block <BB_9301>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9301>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_9301>.
**Token:** <BB_9301> **SMILES:** NC(=O)N[C@@H](Cc1ccccc1)C(=O)O **Molecular Formula:** C10H12N2O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_9302>.
COc1cc(C#N)ccc1OCCCO
What is the building block token for the following molecule?
COc1cc(C#N)ccc1OCCCO
<BB_9302>
What is the molecular formula for <BB_9302>?
The molecular formula for <BB_9302> (COc1cc(C#N)ccc1OCCCO) is C11H13NO3.
Describe the ring structures in building block <BB_9302>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9302>.
The molecule contains the following groups: Alcohol, Ether, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9302>.
**Token:** <BB_9302> **SMILES:** COc1cc(C#N)ccc1OCCCO **Molecular Formula:** C11H13NO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol, Ether, Nitrile
Provide the SMILES representation for the building block token <BB_9303>.
COc1cc(Br)nc(OC)n1
What is the building block token for the following molecule?
COc1cc(Br)nc(OC)n1
<BB_9303>
What is the molecular formula for <BB_9303>?
The molecular formula for <BB_9303> (COc1cc(Br)nc(OC)n1) is C6H7BrN2O2.
Describe the ring structures in building block <BB_9303>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9303>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9303>.
**Token:** <BB_9303> **SMILES:** COc1cc(Br)nc(OC)n1 **Molecular Formula:** C6H7BrN2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9304>.
O=C1OC(=O)[C@@H]2CC=CC[C@H]12
What is the building block token for the following molecule?
O=C1OC(=O)[C@@H]2CC=CC[C@H]12
<BB_9304>
What is the molecular formula for <BB_9304>?
The molecular formula for <BB_9304> (O=C1OC(=O)[C@@H]2CC=CC[C@H]12) is C8H8O3.
Describe the ring structures in building block <BB_9304>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9304>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_9304>.
**Token:** <BB_9304> **SMILES:** O=C1OC(=O)[C@@H]2CC=CC[C@H]12 **Molecular Formula:** C8H8O3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_9305>.
Cl.NC(=O)C(N)c1ccccc1
What is the building block token for the following molecule?
Cl.NC(=O)C(N)c1ccccc1
<BB_9305>
What is the molecular formula for <BB_9305>?
The molecular formula for <BB_9305> (Cl.NC(=O)C(N)c1ccccc1) is C8H11ClN2O.
Describe the ring structures in building block <BB_9305>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9305>.
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9305>.
**Token:** <BB_9305> **SMILES:** Cl.NC(=O)C(N)c1ccccc1 **Molecular Formula:** C8H11ClN2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9306>.
CC(=O)N1CCSc2ccc(N)cc21
What is the building block token for the following molecule?
CC(=O)N1CCSc2ccc(N)cc21
<BB_9306>
What is the molecular formula for <BB_9306>?
The molecular formula for <BB_9306> (CC(=O)N1CCSc2ccc(N)cc21) is C10H12N2OS.
Describe the ring structures in building block <BB_9306>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9306>.
The molecule contains the following groups: Amine, Amide, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_9306>.
**Token:** <BB_9306> **SMILES:** CC(=O)N1CCSc2ccc(N)cc21 **Molecular Formula:** C10H12N2OS **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Sulfide
Provide the SMILES representation for the building block token <BB_9307>.
FC(F)c1cc(Cl)ccn1
What is the building block token for the following molecule?
FC(F)c1cc(Cl)ccn1
<BB_9307>
What is the molecular formula for <BB_9307>?
The molecular formula for <BB_9307> (FC(F)c1cc(Cl)ccn1) is C6H4ClF2N.
Describe the ring structures in building block <BB_9307>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9307>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9307>.
**Token:** <BB_9307> **SMILES:** FC(F)c1cc(Cl)ccn1 **Molecular Formula:** C6H4ClF2N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9308>.
Cl.NCc1nc2ncc(Br)cn2n1
What is the building block token for the following molecule?
Cl.NCc1nc2ncc(Br)cn2n1
<BB_9308>
What is the molecular formula for <BB_9308>?
The molecular formula for <BB_9308> (Cl.NCc1nc2ncc(Br)cn2n1) is C6H7BrClN5.
Describe the ring structures in building block <BB_9308>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9308>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9308>.
**Token:** <BB_9308> **SMILES:** Cl.NCc1nc2ncc(Br)cn2n1 **Molecular Formula:** C6H7BrClN5 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9309>.
O=[N+]([O-])c1c(O)c(Br)cc2c1CCC2
What is the building block token for the following molecule?
O=[N+]([O-])c1c(O)c(Br)cc2c1CCC2
<BB_9309>
What is the molecular formula for <BB_9309>?
The molecular formula for <BB_9309> (O=[N+]([O-])c1c(O)c(Br)cc2c1CCC2) is C9H8BrNO3.
Describe the ring structures in building block <BB_9309>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9309>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_9309>.
**Token:** <BB_9309> **SMILES:** O=[N+]([O-])c1c(O)c(Br)cc2c1CCC2 **Molecular Formula:** C9H8BrNO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_9310>.
O=Cc1cc(Br)cc(F)c1F
What is the building block token for the following molecule?
O=Cc1cc(Br)cc(F)c1F
<BB_9310>
What is the molecular formula for <BB_9310>?
The molecular formula for <BB_9310> (O=Cc1cc(Br)cc(F)c1F) is C7H3BrF2O.
Describe the ring structures in building block <BB_9310>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9310>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9310>.
**Token:** <BB_9310> **SMILES:** O=Cc1cc(Br)cc(F)c1F **Molecular Formula:** C7H3BrF2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9311>.
CC(C)(N)c1nc(C(F)(F)F)cs1.Cl
What is the building block token for the following molecule?
CC(C)(N)c1nc(C(F)(F)F)cs1.Cl
<BB_9311>
What is the molecular formula for <BB_9311>?
The molecular formula for <BB_9311> (CC(C)(N)c1nc(C(F)(F)F)cs1.Cl) is C7H10ClF3N2S.
Describe the ring structures in building block <BB_9311>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9311>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9311>.
**Token:** <BB_9311> **SMILES:** CC(C)(N)c1nc(C(F)(F)F)cs1.Cl **Molecular Formula:** C7H10ClF3N2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9312>.
NC1CCC1N1CCOCC1
What is the building block token for the following molecule?
NC1CCC1N1CCOCC1
<BB_9312>
What is the molecular formula for <BB_9312>?
The molecular formula for <BB_9312> (NC1CCC1N1CCOCC1) is C8H16N2O.
Describe the ring structures in building block <BB_9312>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9312>.
The molecule contains the following groups: Amine, Tertiary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_9312>.
**Token:** <BB_9312> **SMILES:** NC1CCC1N1CCOCC1 **Molecular Formula:** C8H16N2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Ether
Provide the SMILES representation for the building block token <BB_9313>.
O=CCCC1CC2CCC1C2
What is the building block token for the following molecule?
O=CCCC1CC2CCC1C2
<BB_9313>
What is the molecular formula for <BB_9313>?
The molecular formula for <BB_9313> (O=CCCC1CC2CCC1C2) is C10H16O.
Describe the ring structures in building block <BB_9313>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9313>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_9313>.
**Token:** <BB_9313> **SMILES:** O=CCCC1CC2CCC1C2 **Molecular Formula:** C10H16O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_9314>.
Cc1oc(C(F)(F)F)nc1C(=O)O
What is the building block token for the following molecule?
Cc1oc(C(F)(F)F)nc1C(=O)O
<BB_9314>
What is the molecular formula for <BB_9314>?
The molecular formula for <BB_9314> (Cc1oc(C(F)(F)F)nc1C(=O)O) is C6H4F3NO3.
Describe the ring structures in building block <BB_9314>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9314>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9314>.
**Token:** <BB_9314> **SMILES:** Cc1oc(C(F)(F)F)nc1C(=O)O **Molecular Formula:** C6H4F3NO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9315>.
Cc1cc(CCN)ccc1C#N.Cl
What is the building block token for the following molecule?
Cc1cc(CCN)ccc1C#N.Cl
<BB_9315>
What is the molecular formula for <BB_9315>?
The molecular formula for <BB_9315> (Cc1cc(CCN)ccc1C#N.Cl) is C10H13ClN2.
Describe the ring structures in building block <BB_9315>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9315>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9315>.
**Token:** <BB_9315> **SMILES:** Cc1cc(CCN)ccc1C#N.Cl **Molecular Formula:** C10H13ClN2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_9316>.
Cl.N[C@H]1C[C@H]2CCCCCC[C@H]21
What is the building block token for the following molecule?
Cl.N[C@H]1C[C@H]2CCCCCC[C@H]21
<BB_9316>
What is the molecular formula for <BB_9316>?
The molecular formula for <BB_9316> (Cl.N[C@H]1C[C@H]2CCCCCC[C@H]21) is C10H20ClN.
Describe the ring structures in building block <BB_9316>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 8.