instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_9316>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9316>.
**Token:** <BB_9316> **SMILES:** Cl.N[C@H]1C[C@H]2CCCCCC[C@H]21 **Molecular Formula:** C10H20ClN **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 8. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9317>.
CC[C@H](C)[C@@H]1NC(=O)[C@H](C)NC1=O
What is the building block token for the following molecule?
CC[C@H](C)[C@@H]1NC(=O)[C@H](C)NC1=O
<BB_9317>
What is the molecular formula for <BB_9317>?
The molecular formula for <BB_9317> (CC[C@H](C)[C@@H]1NC(=O)[C@H](C)NC1=O) is C9H16N2O2.
Describe the ring structures in building block <BB_9317>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9317>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_9317>.
**Token:** <BB_9317> **SMILES:** CC[C@H](C)[C@@H]1NC(=O)[C@H](C)NC1=O **Molecular Formula:** C9H16N2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_9318>.
Cc1cccc(NC(=O)CCl)c1C
What is the building block token for the following molecule?
Cc1cccc(NC(=O)CCl)c1C
<BB_9318>
What is the molecular formula for <BB_9318>?
The molecular formula for <BB_9318> (Cc1cccc(NC(=O)CCl)c1C) is C10H12ClNO.
Describe the ring structures in building block <BB_9318>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9318>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9318>.
**Token:** <BB_9318> **SMILES:** Cc1cccc(NC(=O)CCl)c1C **Molecular Formula:** C10H12ClNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9319>.
C/C=C1/CCC(CO)C1
What is the building block token for the following molecule?
C/C=C1/CCC(CO)C1
<BB_9319>
What is the molecular formula for <BB_9319>?
The molecular formula for <BB_9319> (C/C=C1/CCC(CO)C1) is C8H14O.
Describe the ring structures in building block <BB_9319>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_9319>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_9319>.
**Token:** <BB_9319> **SMILES:** C/C=C1/CCC(CO)C1 **Molecular Formula:** C8H14O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_9320>.
Cn1nnnc1N
What is the building block token for the following molecule?
Cn1nnnc1N
<BB_9320>
What is the molecular formula for <BB_9320>?
The molecular formula for <BB_9320> (Cn1nnnc1N) is C2H5N5.
Describe the ring structures in building block <BB_9320>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9320>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_9320>.
**Token:** <BB_9320> **SMILES:** Cn1nnnc1N **Molecular Formula:** C2H5N5 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_9321>.
CC1(C)OB(c2ccc(N)c(N)c2)OC1(C)C
What is the building block token for the following molecule?
CC1(C)OB(c2ccc(N)c(N)c2)OC1(C)C
<BB_9321>
What is the molecular formula for <BB_9321>?
The molecular formula for <BB_9321> (CC1(C)OB(c2ccc(N)c(N)c2)OC1(C)C) is C12H19BN2O2.
Describe the ring structures in building block <BB_9321>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9321>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_9321>.
**Token:** <BB_9321> **SMILES:** CC1(C)OB(c2ccc(N)c(N)c2)OC1(C)C **Molecular Formula:** C12H19BN2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_9322>.
N#CCc1ccc(B(O)O)cc1
What is the building block token for the following molecule?
N#CCc1ccc(B(O)O)cc1
<BB_9322>
What is the molecular formula for <BB_9322>?
The molecular formula for <BB_9322> (N#CCc1ccc(B(O)O)cc1) is C8H8BNO2.
Describe the ring structures in building block <BB_9322>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9322>.
The molecule contains the following groups: Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9322>.
**Token:** <BB_9322> **SMILES:** N#CCc1ccc(B(O)O)cc1 **Molecular Formula:** C8H8BNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Nitrile
Provide the SMILES representation for the building block token <BB_9323>.
NC(=O)c1nn(CCO)c2ccccc12
What is the building block token for the following molecule?
NC(=O)c1nn(CCO)c2ccccc12
<BB_9323>
What is the molecular formula for <BB_9323>?
The molecular formula for <BB_9323> (NC(=O)c1nn(CCO)c2ccccc12) is C10H11N3O2.
Describe the ring structures in building block <BB_9323>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9323>.
The molecule contains the following groups: Amide, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_9323>.
**Token:** <BB_9323> **SMILES:** NC(=O)c1nn(CCO)c2ccccc12 **Molecular Formula:** C10H11N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amide, Alcohol
Provide the SMILES representation for the building block token <BB_9324>.
C=CN1CCNC1=O
What is the building block token for the following molecule?
C=CN1CCNC1=O
<BB_9324>
What is the molecular formula for <BB_9324>?
The molecular formula for <BB_9324> (C=CN1CCNC1=O) is C5H8N2O.
Describe the ring structures in building block <BB_9324>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_9324>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_9324>.
**Token:** <BB_9324> **SMILES:** C=CN1CCNC1=O **Molecular Formula:** C5H8N2O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_9325>.
Nc1ccc(-n2cnc3ccccc32)nc1
What is the building block token for the following molecule?
Nc1ccc(-n2cnc3ccccc32)nc1
<BB_9325>
What is the molecular formula for <BB_9325>?
The molecular formula for <BB_9325> (Nc1ccc(-n2cnc3ccccc32)nc1) is C12H10N4.
Describe the ring structures in building block <BB_9325>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9325>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_9325>.
**Token:** <BB_9325> **SMILES:** Nc1ccc(-n2cnc3ccccc32)nc1 **Molecular Formula:** C12H10N4 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_9326>.
CC1(C(=O)O)Cc2cccc(Br)c21
What is the building block token for the following molecule?
CC1(C(=O)O)Cc2cccc(Br)c21
<BB_9326>
What is the molecular formula for <BB_9326>?
The molecular formula for <BB_9326> (CC1(C(=O)O)Cc2cccc(Br)c21) is C10H9BrO2.
Describe the ring structures in building block <BB_9326>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 6.
List the primary functional groups present in <BB_9326>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9326>.
**Token:** <BB_9326> **SMILES:** CC1(C(=O)O)Cc2cccc(Br)c21 **Molecular Formula:** C10H9BrO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9327>.
CC(C)(CN)c1cccc(C2CC2)c1.Cl
What is the building block token for the following molecule?
CC(C)(CN)c1cccc(C2CC2)c1.Cl
<BB_9327>
What is the molecular formula for <BB_9327>?
The molecular formula for <BB_9327> (CC(C)(CN)c1cccc(C2CC2)c1.Cl) is C13H20ClN.
Describe the ring structures in building block <BB_9327>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_9327>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9327>.
**Token:** <BB_9327> **SMILES:** CC(C)(CN)c1cccc(C2CC2)c1.Cl **Molecular Formula:** C13H20ClN **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9328>.
CC(CN)c1ccc(F)cc1
What is the building block token for the following molecule?
CC(CN)c1ccc(F)cc1
<BB_9328>
What is the molecular formula for <BB_9328>?
The molecular formula for <BB_9328> (CC(CN)c1ccc(F)cc1) is C9H12FN.
Describe the ring structures in building block <BB_9328>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9328>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9328>.
**Token:** <BB_9328> **SMILES:** CC(CN)c1ccc(F)cc1 **Molecular Formula:** C9H12FN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9329>.
CCOP(=O)(CC(C)=CC(=O)OC)OCC
What is the building block token for the following molecule?
CCOP(=O)(CC(C)=CC(=O)OC)OCC
<BB_9329>
What is the molecular formula for <BB_9329>?
The molecular formula for <BB_9329> (CCOP(=O)(CC(C)=CC(=O)OC)OCC) is C10H19O5P.
Describe the ring structures in building block <BB_9329>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9329>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_9329>.
**Token:** <BB_9329> **SMILES:** CCOP(=O)(CC(C)=CC(=O)OC)OCC **Molecular Formula:** C10H19O5P **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_9330>.
COC(=O)[C@@]12CCCC[C@@H]1[C@H]2Br
What is the building block token for the following molecule?
COC(=O)[C@@]12CCCC[C@@H]1[C@H]2Br
<BB_9330>
What is the molecular formula for <BB_9330>?
The molecular formula for <BB_9330> (COC(=O)[C@@]12CCCC[C@@H]1[C@H]2Br) is C9H13BrO2.
Describe the ring structures in building block <BB_9330>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_9330>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9330>.
**Token:** <BB_9330> **SMILES:** COC(=O)[C@@]12CCCC[C@@H]1[C@H]2Br **Molecular Formula:** C9H13BrO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9331>.
O=C1OC2CCCC2C2COCCN12
What is the building block token for the following molecule?
O=C1OC2CCCC2C2COCCN12
<BB_9331>
What is the molecular formula for <BB_9331>?
The molecular formula for <BB_9331> (O=C1OC2CCCC2C2COCCN12) is C10H15NO3.
Describe the ring structures in building block <BB_9331>.
The molecule contains 3 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9331>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_9331>.
**Token:** <BB_9331> **SMILES:** O=C1OC2CCCC2C2COCCN12 **Molecular Formula:** C10H15NO3 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Amide, Ether
Provide the SMILES representation for the building block token <BB_9332>.
Cc1cc(N)nn1Cc1cccc(C(=O)O)c1.Cl
What is the building block token for the following molecule?
Cc1cc(N)nn1Cc1cccc(C(=O)O)c1.Cl
<BB_9332>
What is the molecular formula for <BB_9332>?
The molecular formula for <BB_9332> (Cc1cc(N)nn1Cc1cccc(C(=O)O)c1.Cl) is C12H14ClN3O2.
Describe the ring structures in building block <BB_9332>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9332>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9332>.
**Token:** <BB_9332> **SMILES:** Cc1cc(N)nn1Cc1cccc(C(=O)O)c1.Cl **Molecular Formula:** C12H14ClN3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9333>.
O=C(O)c1cc(Br)cc(C(F)(F)F)c1
What is the building block token for the following molecule?
O=C(O)c1cc(Br)cc(C(F)(F)F)c1
<BB_9333>