instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_9333>?
The molecular formula for <BB_9333> (O=C(O)c1cc(Br)cc(C(F)(F)F)c1) is C8H4BrF3O2.
Describe the ring structures in building block <BB_9333>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9333>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9333>.
**Token:** <BB_9333> **SMILES:** O=C(O)c1cc(Br)cc(C(F)(F)F)c1 **Molecular Formula:** C8H4BrF3O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9334>.
O=c1ccc(Br)cn1C(F)(F)Br
What is the building block token for the following molecule?
O=c1ccc(Br)cn1C(F)(F)Br
<BB_9334>
What is the molecular formula for <BB_9334>?
The molecular formula for <BB_9334> (O=c1ccc(Br)cn1C(F)(F)Br) is C6H3Br2F2NO.
Describe the ring structures in building block <BB_9334>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9334>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9334>.
**Token:** <BB_9334> **SMILES:** O=c1ccc(Br)cn1C(F)(F)Br **Molecular Formula:** C6H3Br2F2NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9335>.
C=CC(=O)Nc1cc(C(=O)O)ccc1O
What is the building block token for the following molecule?
C=CC(=O)Nc1cc(C(=O)O)ccc1O
<BB_9335>
What is the molecular formula for <BB_9335>?
The molecular formula for <BB_9335> (C=CC(=O)Nc1cc(C(=O)O)ccc1O) is C10H9NO4.
Describe the ring structures in building block <BB_9335>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9335>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_9335>.
**Token:** <BB_9335> **SMILES:** C=CC(=O)Nc1cc(C(=O)O)ccc1O **Molecular Formula:** C10H9NO4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_9336>.
CC1(C)SCCC1CN
What is the building block token for the following molecule?
CC1(C)SCCC1CN
<BB_9336>
What is the molecular formula for <BB_9336>?
The molecular formula for <BB_9336> (CC1(C)SCCC1CN) is C7H15NS.
Describe the ring structures in building block <BB_9336>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_9336>.
The molecule contains the following groups: Amine, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_9336>.
**Token:** <BB_9336> **SMILES:** CC1(C)SCCC1CN **Molecular Formula:** C7H15NS **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amine, Sulfide
Provide the SMILES representation for the building block token <BB_9337>.
COC(=O)[C@H](O)c1cccnc1.Cl
What is the building block token for the following molecule?
COC(=O)[C@H](O)c1cccnc1.Cl
<BB_9337>
What is the molecular formula for <BB_9337>?
The molecular formula for <BB_9337> (COC(=O)[C@H](O)c1cccnc1.Cl) is C8H10ClNO3.
Describe the ring structures in building block <BB_9337>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9337>.
The molecule contains the following groups: Ester, Alcohol, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9337>.
**Token:** <BB_9337> **SMILES:** COC(=O)[C@H](O)c1cccnc1.Cl **Molecular Formula:** C8H10ClNO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Alcohol, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9338>.
COc1cc(Cl)ccc1C(N)C(=O)O
What is the building block token for the following molecule?
COc1cc(Cl)ccc1C(N)C(=O)O
<BB_9338>
What is the molecular formula for <BB_9338>?
The molecular formula for <BB_9338> (COc1cc(Cl)ccc1C(N)C(=O)O) is C9H10ClNO3.
Describe the ring structures in building block <BB_9338>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9338>.
The molecule contains the following groups: Carboxylic Acid, Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9338>.
**Token:** <BB_9338> **SMILES:** COc1cc(Cl)ccc1C(N)C(=O)O **Molecular Formula:** C9H10ClNO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9339>.
CC(C)(C)OC(=O)N1CCCC(c2csc(Br)n2)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCCC(c2csc(Br)n2)C1
<BB_9339>
What is the molecular formula for <BB_9339>?
The molecular formula for <BB_9339> (CC(C)(C)OC(=O)N1CCCC(c2csc(Br)n2)C1) is C13H19BrN2O2S.
Describe the ring structures in building block <BB_9339>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9339>.
The molecule contains the following groups: Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9339>.
**Token:** <BB_9339> **SMILES:** CC(C)(C)OC(=O)N1CCCC(c2csc(Br)n2)C1 **Molecular Formula:** C13H19BrN2O2S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9340>.
CN1CCC2(CC1)CC(N)c1ccccc1O2.Cl.Cl
What is the building block token for the following molecule?
CN1CCC2(CC1)CC(N)c1ccccc1O2.Cl.Cl
<BB_9340>
What is the molecular formula for <BB_9340>?
The molecular formula for <BB_9340> (CN1CCC2(CC1)CC(N)c1ccccc1O2.Cl.Cl) is C14H22Cl2N2O.
Describe the ring structures in building block <BB_9340>.
The molecule contains 3 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9340>.
The molecule contains the following groups: Amine, Tertiary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9340>.
**Token:** <BB_9340> **SMILES:** CN1CCC2(CC1)CC(N)c1ccccc1O2.Cl.Cl **Molecular Formula:** C14H22Cl2N2O **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9341>.
CN1C(=O)C[C@H](C#N)[C@H]1c1ccccc1
What is the building block token for the following molecule?
CN1C(=O)C[C@H](C#N)[C@H]1c1ccccc1
<BB_9341>
What is the molecular formula for <BB_9341>?
The molecular formula for <BB_9341> (CN1C(=O)C[C@H](C#N)[C@H]1c1ccccc1) is C12H12N2O.
Describe the ring structures in building block <BB_9341>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9341>.
The molecule contains the following groups: Amide, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9341>.
**Token:** <BB_9341> **SMILES:** CN1C(=O)C[C@H](C#N)[C@H]1c1ccccc1 **Molecular Formula:** C12H12N2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amide, Nitrile
Provide the SMILES representation for the building block token <BB_9342>.
Cc1cc(N)cc(-c2cccc(F)c2OC(F)F)c1
What is the building block token for the following molecule?
Cc1cc(N)cc(-c2cccc(F)c2OC(F)F)c1
<BB_9342>
What is the molecular formula for <BB_9342>?
The molecular formula for <BB_9342> (Cc1cc(N)cc(-c2cccc(F)c2OC(F)F)c1) is C14H12F3NO.
Describe the ring structures in building block <BB_9342>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9342>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9342>.
**Token:** <BB_9342> **SMILES:** Cc1cc(N)cc(-c2cccc(F)c2OC(F)F)c1 **Molecular Formula:** C14H12F3NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9343>.
COc1nccc(Br)n1
What is the building block token for the following molecule?
COc1nccc(Br)n1
<BB_9343>
What is the molecular formula for <BB_9343>?
The molecular formula for <BB_9343> (COc1nccc(Br)n1) is C5H5BrN2O.
Describe the ring structures in building block <BB_9343>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9343>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9343>.
**Token:** <BB_9343> **SMILES:** COc1nccc(Br)n1 **Molecular Formula:** C5H5BrN2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9344>.
CCOC(=O)C=C1CCOC1
What is the building block token for the following molecule?
CCOC(=O)C=C1CCOC1
<BB_9344>
What is the molecular formula for <BB_9344>?
The molecular formula for <BB_9344> (CCOC(=O)C=C1CCOC1) is C8H12O3.
Describe the ring structures in building block <BB_9344>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_9344>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_9344>.
**Token:** <BB_9344> **SMILES:** CCOC(=O)C=C1CCOC1 **Molecular Formula:** C8H12O3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_9345>.
[N-]=[N+]=NCCC1OCCO1
What is the building block token for the following molecule?
[N-]=[N+]=NCCC1OCCO1
<BB_9345>
What is the molecular formula for <BB_9345>?
The molecular formula for <BB_9345> ([N-]=[N+]=NCCC1OCCO1) is C5H9N3O2.
Describe the ring structures in building block <BB_9345>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_9345>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_9345>.
**Token:** <BB_9345> **SMILES:** [N-]=[N+]=NCCC1OCCO1 **Molecular Formula:** C5H9N3O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_9346>.
Cc1cc(F)ccc1[C@H](O)C(=O)O
What is the building block token for the following molecule?
Cc1cc(F)ccc1[C@H](O)C(=O)O
<BB_9346>
What is the molecular formula for <BB_9346>?
The molecular formula for <BB_9346> (Cc1cc(F)ccc1[C@H](O)C(=O)O) is C9H9FO3.
Describe the ring structures in building block <BB_9346>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9346>.
The molecule contains the following groups: Carboxylic Acid, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9346>.
**Token:** <BB_9346> **SMILES:** Cc1cc(F)ccc1[C@H](O)C(=O)O **Molecular Formula:** C9H9FO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9347>.
OCc1ncon1
What is the building block token for the following molecule?
OCc1ncon1
<BB_9347>
What is the molecular formula for <BB_9347>?
The molecular formula for <BB_9347> (OCc1ncon1) is C3H4N2O2.
Describe the ring structures in building block <BB_9347>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9347>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_9347>.
**Token:** <BB_9347> **SMILES:** OCc1ncon1 **Molecular Formula:** C3H4N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_9348>.
CCOc1ccc(CN)cc1Cl.Cl
What is the building block token for the following molecule?
CCOc1ccc(CN)cc1Cl.Cl
<BB_9348>
What is the molecular formula for <BB_9348>?
The molecular formula for <BB_9348> (CCOc1ccc(CN)cc1Cl.Cl) is C9H13Cl2NO.
Describe the ring structures in building block <BB_9348>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9348>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9348>.
**Token:** <BB_9348> **SMILES:** CCOc1ccc(CN)cc1Cl.Cl **Molecular Formula:** C9H13Cl2NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9349>.
CC(C)n1cc2ncc(C(=O)O)cc2n1
What is the building block token for the following molecule?
CC(C)n1cc2ncc(C(=O)O)cc2n1
<BB_9349>
What is the molecular formula for <BB_9349>?
The molecular formula for <BB_9349> (CC(C)n1cc2ncc(C(=O)O)cc2n1) is C10H11N3O2.
Describe the ring structures in building block <BB_9349>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9349>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_9349>.
**Token:** <BB_9349> **SMILES:** CC(C)n1cc2ncc(C(=O)O)cc2n1 **Molecular Formula:** C10H11N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid