instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_9350>.
CCOC(C#CC(C)N)OCC
What is the building block token for the following molecule?
CCOC(C#CC(C)N)OCC
<BB_9350>
What is the molecular formula for <BB_9350>?
The molecular formula for <BB_9350> (CCOC(C#CC(C)N)OCC) is C9H17NO2.
Describe the ring structures in building block <BB_9350>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9350>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_9350>.
**Token:** <BB_9350> **SMILES:** CCOC(C#CC(C)N)OCC **Molecular Formula:** C9H17NO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_9351>.
ClCc1cnco1
What is the building block token for the following molecule?
ClCc1cnco1
<BB_9351>
What is the molecular formula for <BB_9351>?
The molecular formula for <BB_9351> (ClCc1cnco1) is C4H4ClNO.
Describe the ring structures in building block <BB_9351>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9351>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9351>.
**Token:** <BB_9351> **SMILES:** ClCc1cnco1 **Molecular Formula:** C4H4ClNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9352>.
COc1cccc(Cl)c1C(C)Br
What is the building block token for the following molecule?
COc1cccc(Cl)c1C(C)Br
<BB_9352>
What is the molecular formula for <BB_9352>?
The molecular formula for <BB_9352> (COc1cccc(Cl)c1C(C)Br) is C9H10BrClO.
Describe the ring structures in building block <BB_9352>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9352>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9352>.
**Token:** <BB_9352> **SMILES:** COc1cccc(Cl)c1C(C)Br **Molecular Formula:** C9H10BrClO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9353>.
O=C(O)CCn1sc2ccccc2c1=O
What is the building block token for the following molecule?
O=C(O)CCn1sc2ccccc2c1=O
<BB_9353>
What is the molecular formula for <BB_9353>?
The molecular formula for <BB_9353> (O=C(O)CCn1sc2ccccc2c1=O) is C10H9NO3S.
Describe the ring structures in building block <BB_9353>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9353>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_9353>.
**Token:** <BB_9353> **SMILES:** O=C(O)CCn1sc2ccccc2c1=O **Molecular Formula:** C10H9NO3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_9354>.
N#Cc1cccc(C(F)(F)F)n1
What is the building block token for the following molecule?
N#Cc1cccc(C(F)(F)F)n1
<BB_9354>
What is the molecular formula for <BB_9354>?
The molecular formula for <BB_9354> (N#Cc1cccc(C(F)(F)F)n1) is C7H3F3N2.
Describe the ring structures in building block <BB_9354>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9354>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9354>.
**Token:** <BB_9354> **SMILES:** N#Cc1cccc(C(F)(F)F)n1 **Molecular Formula:** C7H3F3N2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_9355>.
CC(C)(CN)c1ncc[nH]1.Cl.Cl
What is the building block token for the following molecule?
CC(C)(CN)c1ncc[nH]1.Cl.Cl
<BB_9355>
What is the molecular formula for <BB_9355>?
The molecular formula for <BB_9355> (CC(C)(CN)c1ncc[nH]1.Cl.Cl) is C7H15Cl2N3.
Describe the ring structures in building block <BB_9355>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9355>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9355>.
**Token:** <BB_9355> **SMILES:** CC(C)(CN)c1ncc[nH]1.Cl.Cl **Molecular Formula:** C7H15Cl2N3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9356>.
O=C(O)COCc1nc[nH]n1
What is the building block token for the following molecule?
O=C(O)COCc1nc[nH]n1
<BB_9356>
What is the molecular formula for <BB_9356>?
The molecular formula for <BB_9356> (O=C(O)COCc1nc[nH]n1) is C5H7N3O3.
Describe the ring structures in building block <BB_9356>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9356>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_9356>.
**Token:** <BB_9356> **SMILES:** O=C(O)COCc1nc[nH]n1 **Molecular Formula:** C5H7N3O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_9357>.
Cc1nc2c(n1C)CNCC2.Cl
What is the building block token for the following molecule?
Cc1nc2c(n1C)CNCC2.Cl
<BB_9357>
What is the molecular formula for <BB_9357>?
The molecular formula for <BB_9357> (Cc1nc2c(n1C)CNCC2.Cl) is C8H14ClN3.
Describe the ring structures in building block <BB_9357>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9357>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9357>.
**Token:** <BB_9357> **SMILES:** Cc1nc2c(n1C)CNCC2.Cl **Molecular Formula:** C8H14ClN3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9358>.
CCCC(N)C1CCCC1
What is the building block token for the following molecule?
CCCC(N)C1CCCC1
<BB_9358>
What is the molecular formula for <BB_9358>?
The molecular formula for <BB_9358> (CCCC(N)C1CCCC1) is C9H19N.
Describe the ring structures in building block <BB_9358>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_9358>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_9358>.
**Token:** <BB_9358> **SMILES:** CCCC(N)C1CCCC1 **Molecular Formula:** C9H19N **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_9359>.
Cc1cnc2nc(N)sc2n1
What is the building block token for the following molecule?
Cc1cnc2nc(N)sc2n1
<BB_9359>
What is the molecular formula for <BB_9359>?
The molecular formula for <BB_9359> (Cc1cnc2nc(N)sc2n1) is C6H6N4S.
Describe the ring structures in building block <BB_9359>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9359>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_9359>.
**Token:** <BB_9359> **SMILES:** Cc1cnc2nc(N)sc2n1 **Molecular Formula:** C6H6N4S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_9360>.
O=S(=O)(Cl)c1cccc2ocnc12
What is the building block token for the following molecule?
O=S(=O)(Cl)c1cccc2ocnc12
<BB_9360>
What is the molecular formula for <BB_9360>?
The molecular formula for <BB_9360> (O=S(=O)(Cl)c1cccc2ocnc12) is C7H4ClNO3S.
Describe the ring structures in building block <BB_9360>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9360>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9360>.
**Token:** <BB_9360> **SMILES:** O=S(=O)(Cl)c1cccc2ocnc12 **Molecular Formula:** C7H4ClNO3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9361>.
COC1=NCCC(C)C1
What is the building block token for the following molecule?
COC1=NCCC(C)C1
<BB_9361>
What is the molecular formula for <BB_9361>?
The molecular formula for <BB_9361> (COC1=NCCC(C)C1) is C7H13NO.
Describe the ring structures in building block <BB_9361>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9361>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_9361>.
**Token:** <BB_9361> **SMILES:** COC1=NCCC(C)C1 **Molecular Formula:** C7H13NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_9362>.
O=C(O)c1cc2c(c([N+](=O)[O-])c1)OCO2
What is the building block token for the following molecule?
O=C(O)c1cc2c(c([N+](=O)[O-])c1)OCO2
<BB_9362>
What is the molecular formula for <BB_9362>?
The molecular formula for <BB_9362> (O=C(O)c1cc2c(c([N+](=O)[O-])c1)OCO2) is C8H5NO6.
Describe the ring structures in building block <BB_9362>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9362>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Ether, Nitro.
Provide a comprehensive chemical profile for the building block <BB_9362>.
**Token:** <BB_9362> **SMILES:** O=C(O)c1cc2c(c([N+](=O)[O-])c1)OCO2 **Molecular Formula:** C8H5NO6 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Tertiary Amine, Ether, Nitro
Provide the SMILES representation for the building block token <BB_9363>.
O=S(=O)(F)c1ccc2[nH]cnc2c1
What is the building block token for the following molecule?
O=S(=O)(F)c1ccc2[nH]cnc2c1
<BB_9363>
What is the molecular formula for <BB_9363>?
The molecular formula for <BB_9363> (O=S(=O)(F)c1ccc2[nH]cnc2c1) is C7H5FN2O2S.
Describe the ring structures in building block <BB_9363>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9363>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9363>.
**Token:** <BB_9363> **SMILES:** O=S(=O)(F)c1ccc2[nH]cnc2c1 **Molecular Formula:** C7H5FN2O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9364>.
O=C(O)C1CC2(CSC2)C1
What is the building block token for the following molecule?
O=C(O)C1CC2(CSC2)C1
<BB_9364>
What is the molecular formula for <BB_9364>?
The molecular formula for <BB_9364> (O=C(O)C1CC2(CSC2)C1) is C7H10O2S.
Describe the ring structures in building block <BB_9364>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4.
List the primary functional groups present in <BB_9364>.
The molecule contains the following groups: Carboxylic Acid, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_9364>.
**Token:** <BB_9364> **SMILES:** O=C(O)C1CC2(CSC2)C1 **Molecular Formula:** C7H10O2S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid, Sulfide
Provide the SMILES representation for the building block token <BB_9365>.
COc1nsc(C=O)c1Br
What is the building block token for the following molecule?
COc1nsc(C=O)c1Br
<BB_9365>
What is the molecular formula for <BB_9365>?
The molecular formula for <BB_9365> (COc1nsc(C=O)c1Br) is C5H4BrNO2S.
Describe the ring structures in building block <BB_9365>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9365>.
The molecule contains the following groups: Aldehyde, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9365>.
**Token:** <BB_9365> **SMILES:** COc1nsc(C=O)c1Br **Molecular Formula:** C5H4BrNO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Aldehyde, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9366>.
COC(=O)C1NCCn2nccc21.Cl.Cl
What is the building block token for the following molecule?
COC(=O)C1NCCn2nccc21.Cl.Cl
<BB_9366>
What is the molecular formula for <BB_9366>?
The molecular formula for <BB_9366> (COC(=O)C1NCCn2nccc21.Cl.Cl) is C8H13Cl2N3O2.
Describe the ring structures in building block <BB_9366>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5.