instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_966>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_966>.
**Token:** <BB_966> **SMILES:** NCc1ccc(C2CC2)cc1F **Molecular Formula:** C10H12FN **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_967>.
COC(=O)c1c[nH]c2ccc(Br)cc12
What is the building block token for the following molecule?
COC(=O)c1c[nH]c2ccc(Br)cc12
<BB_967>
What is the molecular formula for <BB_967>?
The molecular formula for <BB_967> (COC(=O)c1c[nH]c2ccc(Br)cc12) is C10H8BrNO2.
Describe the ring structures in building block <BB_967>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_967>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_967>.
**Token:** <BB_967> **SMILES:** COC(=O)c1c[nH]c2ccc(Br)cc12 **Molecular Formula:** C10H8BrNO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_968>.
NS(=O)(=O)c1cnc(Cl)c(Cl)c1
What is the building block token for the following molecule?
NS(=O)(=O)c1cnc(Cl)c(Cl)c1
<BB_968>
What is the molecular formula for <BB_968>?
The molecular formula for <BB_968> (NS(=O)(=O)c1cnc(Cl)c(Cl)c1) is C5H4Cl2N2O2S.
Describe the ring structures in building block <BB_968>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_968>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_968>.
**Token:** <BB_968> **SMILES:** NS(=O)(=O)c1cnc(Cl)c(Cl)c1 **Molecular Formula:** C5H4Cl2N2O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_969>.
CCn1cc(N)ccc1=O.Cl
What is the building block token for the following molecule?
CCn1cc(N)ccc1=O.Cl
<BB_969>
What is the molecular formula for <BB_969>?
The molecular formula for <BB_969> (CCn1cc(N)ccc1=O.Cl) is C7H11ClN2O.
Describe the ring structures in building block <BB_969>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_969>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_969>.
**Token:** <BB_969> **SMILES:** CCn1cc(N)ccc1=O.Cl **Molecular Formula:** C7H11ClN2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_970>.
CCOC1(CNC(=O)OC(C)(C)C)CNC1
What is the building block token for the following molecule?
CCOC1(CNC(=O)OC(C)(C)C)CNC1
<BB_970>
What is the molecular formula for <BB_970>?
The molecular formula for <BB_970> (CCOC1(CNC(=O)OC(C)(C)C)CNC1) is C11H22N2O3.
Describe the ring structures in building block <BB_970>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_970>.
The molecule contains the following groups: Secondary Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_970>.
**Token:** <BB_970> **SMILES:** CCOC1(CNC(=O)OC(C)(C)C)CNC1 **Molecular Formula:** C11H22N2O3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Secondary Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_971>.
Cl.O=C(C1CCCCN1)N1CCCCC1
What is the building block token for the following molecule?
Cl.O=C(C1CCCCN1)N1CCCCC1
<BB_971>
What is the molecular formula for <BB_971>?
The molecular formula for <BB_971> (Cl.O=C(C1CCCCN1)N1CCCCC1) is C11H21ClN2O.
Describe the ring structures in building block <BB_971>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_971>.
The molecule contains the following groups: Secondary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_971>.
**Token:** <BB_971> **SMILES:** Cl.O=C(C1CCCCN1)N1CCCCC1 **Molecular Formula:** C11H21ClN2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_972>.
Cc1ccc(NC2CCOCC2)cc1C.Cl
What is the building block token for the following molecule?
Cc1ccc(NC2CCOCC2)cc1C.Cl
<BB_972>
What is the molecular formula for <BB_972>?
The molecular formula for <BB_972> (Cc1ccc(NC2CCOCC2)cc1C.Cl) is C13H20ClNO.
Describe the ring structures in building block <BB_972>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_972>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_972>.
**Token:** <BB_972> **SMILES:** Cc1ccc(NC2CCOCC2)cc1C.Cl **Molecular Formula:** C13H20ClNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_973>.
C#CCC(NC(=O)OC(C)(C)C)C(=O)OC
What is the building block token for the following molecule?
C#CCC(NC(=O)OC(C)(C)C)C(=O)OC
<BB_973>
What is the molecular formula for <BB_973>?
The molecular formula for <BB_973> (C#CCC(NC(=O)OC(C)(C)C)C(=O)OC) is C11H17NO4.
Describe the ring structures in building block <BB_973>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_973>.
The molecule contains the following groups: Amide, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_973>.
**Token:** <BB_973> **SMILES:** C#CCC(NC(=O)OC(C)(C)C)C(=O)OC **Molecular Formula:** C11H17NO4 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amide, Ester, Ether
Provide the SMILES representation for the building block token <BB_974>.
O=C1NC(=O)C(F)(F)c2ccccc21
What is the building block token for the following molecule?
O=C1NC(=O)C(F)(F)c2ccccc21
<BB_974>
What is the molecular formula for <BB_974>?
The molecular formula for <BB_974> (O=C1NC(=O)C(F)(F)c2ccccc21) is C9H5F2NO2.
Describe the ring structures in building block <BB_974>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_974>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_974>.
**Token:** <BB_974> **SMILES:** O=C1NC(=O)C(F)(F)c2ccccc21 **Molecular Formula:** C9H5F2NO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_975>.
Nc1nc2ccc(F)cc2o1
What is the building block token for the following molecule?
Nc1nc2ccc(F)cc2o1
<BB_975>
What is the molecular formula for <BB_975>?
The molecular formula for <BB_975> (Nc1nc2ccc(F)cc2o1) is C7H5FN2O.
Describe the ring structures in building block <BB_975>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_975>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_975>.
**Token:** <BB_975> **SMILES:** Nc1nc2ccc(F)cc2o1 **Molecular Formula:** C7H5FN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_976>.
CNc1ccc(Cl)c(OC)c1.Cl
What is the building block token for the following molecule?
CNc1ccc(Cl)c(OC)c1.Cl
<BB_976>
What is the molecular formula for <BB_976>?
The molecular formula for <BB_976> (CNc1ccc(Cl)c(OC)c1.Cl) is C8H11Cl2NO.
Describe the ring structures in building block <BB_976>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_976>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_976>.
**Token:** <BB_976> **SMILES:** CNc1ccc(Cl)c(OC)c1.Cl **Molecular Formula:** C8H11Cl2NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_977>.
CCOC(=O)Cc1nc(Br)n(C)c1C
What is the building block token for the following molecule?
CCOC(=O)Cc1nc(Br)n(C)c1C
<BB_977>
What is the molecular formula for <BB_977>?
The molecular formula for <BB_977> (CCOC(=O)Cc1nc(Br)n(C)c1C) is C9H13BrN2O2.
Describe the ring structures in building block <BB_977>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_977>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_977>.
**Token:** <BB_977> **SMILES:** CCOC(=O)Cc1nc(Br)n(C)c1C **Molecular Formula:** C9H13BrN2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_978>.
Brc1cccc2c1c(I)nn2C1CCCCO1
What is the building block token for the following molecule?
Brc1cccc2c1c(I)nn2C1CCCCO1
<BB_978>
What is the molecular formula for <BB_978>?
The molecular formula for <BB_978> (Brc1cccc2c1c(I)nn2C1CCCCO1) is C12H12BrIN2O.
Describe the ring structures in building block <BB_978>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_978>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_978>.
**Token:** <BB_978> **SMILES:** Brc1cccc2c1c(I)nn2C1CCCCO1 **Molecular Formula:** C12H12BrIN2O **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_979>.
Brc1ccc2c(c1)C1(CCNCC1)OC2.Cl
What is the building block token for the following molecule?
Brc1ccc2c(c1)C1(CCNCC1)OC2.Cl
<BB_979>
What is the molecular formula for <BB_979>?
The molecular formula for <BB_979> (Brc1ccc2c(c1)C1(CCNCC1)OC2.Cl) is C12H15BrClNO.
Describe the ring structures in building block <BB_979>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_979>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_979>.
**Token:** <BB_979> **SMILES:** Brc1ccc2c(c1)C1(CCNCC1)OC2.Cl **Molecular Formula:** C12H15BrClNO **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_980>.
O=[N+]([O-])c1ccc(S(=O)(=O)Cl)s1
What is the building block token for the following molecule?
O=[N+]([O-])c1ccc(S(=O)(=O)Cl)s1
<BB_980>
What is the molecular formula for <BB_980>?
The molecular formula for <BB_980> (O=[N+]([O-])c1ccc(S(=O)(=O)Cl)s1) is C4H2ClNO4S2.
Describe the ring structures in building block <BB_980>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_980>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_980>.
**Token:** <BB_980> **SMILES:** O=[N+]([O-])c1ccc(S(=O)(=O)Cl)s1 **Molecular Formula:** C4H2ClNO4S2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_981>.
CC(C)(C)OC(=O)N1CCNC(CF)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCNC(CF)C1
<BB_981>
What is the molecular formula for <BB_981>?
The molecular formula for <BB_981> (CC(C)(C)OC(=O)N1CCNC(CF)C1) is C10H19FN2O2.
Describe the ring structures in building block <BB_981>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_981>.
The molecule contains the following groups: Secondary Amine, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_981>.
**Token:** <BB_981> **SMILES:** CC(C)(C)OC(=O)N1CCNC(CF)C1 **Molecular Formula:** C10H19FN2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_982>.
CC1(C)CN(c2ccccc2N)C1=O
What is the building block token for the following molecule?
CC1(C)CN(c2ccccc2N)C1=O
<BB_982>
What is the molecular formula for <BB_982>?
The molecular formula for <BB_982> (CC1(C)CN(c2ccccc2N)C1=O) is C11H14N2O.
Describe the ring structures in building block <BB_982>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 6.
List the primary functional groups present in <BB_982>.
The molecule contains the following groups: Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_982>.
**Token:** <BB_982> **SMILES:** CC1(C)CN(c2ccccc2N)C1=O **Molecular Formula:** C11H14N2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 6. **Functional Groups:** Amine, Amide
Provide the SMILES representation for the building block token <BB_983>.
Cc1cc(C)c(CC=O)c(C)c1
What is the building block token for the following molecule?
Cc1cc(C)c(CC=O)c(C)c1
<BB_983>