instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_9366>.
The molecule contains the following groups: Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9366>.
**Token:** <BB_9366> **SMILES:** COC(=O)C1NCCn2nccc21.Cl.Cl **Molecular Formula:** C8H13Cl2N3O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9367>.
c1csc(C2CCCC2)n1
What is the building block token for the following molecule?
c1csc(C2CCCC2)n1
<BB_9367>
What is the molecular formula for <BB_9367>?
The molecular formula for <BB_9367> (c1csc(C2CCCC2)n1) is C8H11NS.
Describe the ring structures in building block <BB_9367>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9367>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_9367>.
**Token:** <BB_9367> **SMILES:** c1csc(C2CCCC2)n1 **Molecular Formula:** C8H11NS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_9368>.
COC(=O)C(C)(C)NCC(C)C
What is the building block token for the following molecule?
COC(=O)C(C)(C)NCC(C)C
<BB_9368>
What is the molecular formula for <BB_9368>?
The molecular formula for <BB_9368> (COC(=O)C(C)(C)NCC(C)C) is C9H19NO2.
Describe the ring structures in building block <BB_9368>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9368>.
The molecule contains the following groups: Secondary Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_9368>.
**Token:** <BB_9368> **SMILES:** COC(=O)C(C)(C)NCC(C)C **Molecular Formula:** C9H19NO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Secondary Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_9369>.
O=C1NC(=O)[C@]2(CCC[C@@H]2C(=O)O)N1
What is the building block token for the following molecule?
O=C1NC(=O)[C@]2(CCC[C@@H]2C(=O)O)N1
<BB_9369>
What is the molecular formula for <BB_9369>?
The molecular formula for <BB_9369> (O=C1NC(=O)[C@]2(CCC[C@@H]2C(=O)O)N1) is C8H10N2O4.
Describe the ring structures in building block <BB_9369>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9369>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_9369>.
**Token:** <BB_9369> **SMILES:** O=C1NC(=O)[C@]2(CCC[C@@H]2C(=O)O)N1 **Molecular Formula:** C8H10N2O4 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_9370>.
C/C=C/C(N)c1nn(C)cc1Br.Cl
What is the building block token for the following molecule?
C/C=C/C(N)c1nn(C)cc1Br.Cl
<BB_9370>
What is the molecular formula for <BB_9370>?
The molecular formula for <BB_9370> (C/C=C/C(N)c1nn(C)cc1Br.Cl) is C8H13BrClN3.
Describe the ring structures in building block <BB_9370>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9370>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9370>.
**Token:** <BB_9370> **SMILES:** C/C=C/C(N)c1nn(C)cc1Br.Cl **Molecular Formula:** C8H13BrClN3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9371>.
Cc1cc(C2CC2)ccc1CN.Cl
What is the building block token for the following molecule?
Cc1cc(C2CC2)ccc1CN.Cl
<BB_9371>
What is the molecular formula for <BB_9371>?
The molecular formula for <BB_9371> (Cc1cc(C2CC2)ccc1CN.Cl) is C11H16ClN.
Describe the ring structures in building block <BB_9371>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_9371>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9371>.
**Token:** <BB_9371> **SMILES:** Cc1cc(C2CC2)ccc1CN.Cl **Molecular Formula:** C11H16ClN **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9372>.
C[C@H](N)c1cn(C)nn1.Cl
What is the building block token for the following molecule?
C[C@H](N)c1cn(C)nn1.Cl
<BB_9372>
What is the molecular formula for <BB_9372>?
The molecular formula for <BB_9372> (C[C@H](N)c1cn(C)nn1.Cl) is C5H11ClN4.
Describe the ring structures in building block <BB_9372>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9372>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9372>.
**Token:** <BB_9372> **SMILES:** C[C@H](N)c1cn(C)nn1.Cl **Molecular Formula:** C5H11ClN4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9373>.
CC1CN(c2ccncc2)CCN1
What is the building block token for the following molecule?
CC1CN(c2ccncc2)CCN1
<BB_9373>
What is the molecular formula for <BB_9373>?
The molecular formula for <BB_9373> (CC1CN(c2ccncc2)CCN1) is C10H15N3.
Describe the ring structures in building block <BB_9373>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9373>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_9373>.
**Token:** <BB_9373> **SMILES:** CC1CN(c2ccncc2)CCN1 **Molecular Formula:** C10H15N3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_9374>.
O=S(=O)(F)c1cc(Br)ccc1Cl
What is the building block token for the following molecule?
O=S(=O)(F)c1cc(Br)ccc1Cl
<BB_9374>
What is the molecular formula for <BB_9374>?
The molecular formula for <BB_9374> (O=S(=O)(F)c1cc(Br)ccc1Cl) is C6H3BrClFO2S.
Describe the ring structures in building block <BB_9374>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9374>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9374>.
**Token:** <BB_9374> **SMILES:** O=S(=O)(F)c1cc(Br)ccc1Cl **Molecular Formula:** C6H3BrClFO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9375>.
O=C1Nc2cccnc2C1=O
What is the building block token for the following molecule?
O=C1Nc2cccnc2C1=O
<BB_9375>
What is the molecular formula for <BB_9375>?
The molecular formula for <BB_9375> (O=C1Nc2cccnc2C1=O) is C7H4N2O2.
Describe the ring structures in building block <BB_9375>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9375>.
The molecule contains the following groups: Amide, Ketone.
Provide a comprehensive chemical profile for the building block <BB_9375>.
**Token:** <BB_9375> **SMILES:** O=C1Nc2cccnc2C1=O **Molecular Formula:** C7H4N2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amide, Ketone
Provide the SMILES representation for the building block token <BB_9376>.
COc1ccc(CN2CCCC2)cc1N
What is the building block token for the following molecule?
COc1ccc(CN2CCCC2)cc1N
<BB_9376>
What is the molecular formula for <BB_9376>?
The molecular formula for <BB_9376> (COc1ccc(CN2CCCC2)cc1N) is C12H18N2O.
Describe the ring structures in building block <BB_9376>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9376>.
The molecule contains the following groups: Amine, Tertiary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_9376>.
**Token:** <BB_9376> **SMILES:** COc1ccc(CN2CCCC2)cc1N **Molecular Formula:** C12H18N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Tertiary Amine, Ether
Provide the SMILES representation for the building block token <BB_9377>.
NNC(=O)c1cc(C2CC2)[nH]n1
What is the building block token for the following molecule?
NNC(=O)c1cc(C2CC2)[nH]n1
<BB_9377>
What is the molecular formula for <BB_9377>?
The molecular formula for <BB_9377> (NNC(=O)c1cc(C2CC2)[nH]n1) is C7H10N4O.
Describe the ring structures in building block <BB_9377>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_9377>.
The molecule contains the following groups: Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_9377>.
**Token:** <BB_9377> **SMILES:** NNC(=O)c1cc(C2CC2)[nH]n1 **Molecular Formula:** C7H10N4O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Amine, Amide
Provide the SMILES representation for the building block token <BB_9378>.
O=[N+]([O-])c1ccccc1NCCO
What is the building block token for the following molecule?
O=[N+]([O-])c1ccccc1NCCO
<BB_9378>
What is the molecular formula for <BB_9378>?
The molecular formula for <BB_9378> (O=[N+]([O-])c1ccccc1NCCO) is C8H10N2O3.
Describe the ring structures in building block <BB_9378>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9378>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Alcohol, Nitro.
Provide a comprehensive chemical profile for the building block <BB_9378>.
**Token:** <BB_9378> **SMILES:** O=[N+]([O-])c1ccccc1NCCO **Molecular Formula:** C8H10N2O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Alcohol, Nitro
Provide the SMILES representation for the building block token <BB_9379>.
Sc1nnc(-c2ccc(Cl)cc2)n1-c1ccccc1
What is the building block token for the following molecule?
Sc1nnc(-c2ccc(Cl)cc2)n1-c1ccccc1
<BB_9379>
What is the molecular formula for <BB_9379>?
The molecular formula for <BB_9379> (Sc1nnc(-c2ccc(Cl)cc2)n1-c1ccccc1) is C14H10ClN3S.
Describe the ring structures in building block <BB_9379>.
The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9379>.
The molecule contains the following groups: Thiol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9379>.
**Token:** <BB_9379> **SMILES:** Sc1nnc(-c2ccc(Cl)cc2)n1-c1ccccc1 **Molecular Formula:** C14H10ClN3S **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Thiol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9380>.
Cl.N=C(N)C(O)C1CC1
What is the building block token for the following molecule?
Cl.N=C(N)C(O)C1CC1
<BB_9380>
What is the molecular formula for <BB_9380>?
The molecular formula for <BB_9380> (Cl.N=C(N)C(O)C1CC1) is C5H11ClN2O.
Describe the ring structures in building block <BB_9380>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_9380>.
The molecule contains the following groups: Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9380>.
**Token:** <BB_9380> **SMILES:** Cl.N=C(N)C(O)C1CC1 **Molecular Formula:** C5H11ClN2O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9381>.
Cc1nn(CC(C)C)cc1S(=O)(=O)Cl
What is the building block token for the following molecule?
Cc1nn(CC(C)C)cc1S(=O)(=O)Cl
<BB_9381>
What is the molecular formula for <BB_9381>?
The molecular formula for <BB_9381> (Cc1nn(CC(C)C)cc1S(=O)(=O)Cl) is C8H13ClN2O2S.
Describe the ring structures in building block <BB_9381>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9381>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9381>.
**Token:** <BB_9381> **SMILES:** Cc1nn(CC(C)C)cc1S(=O)(=O)Cl **Molecular Formula:** C8H13ClN2O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9382>.
ClCc1csc(-c2c(Cl)cccc2Cl)n1
What is the building block token for the following molecule?
ClCc1csc(-c2c(Cl)cccc2Cl)n1
<BB_9382>
What is the molecular formula for <BB_9382>?
The molecular formula for <BB_9382> (ClCc1csc(-c2c(Cl)cccc2Cl)n1) is C10H6Cl3NS.
Describe the ring structures in building block <BB_9382>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9382>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9382>.
**Token:** <BB_9382> **SMILES:** ClCc1csc(-c2c(Cl)cccc2Cl)n1 **Molecular Formula:** C10H6Cl3NS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9383>.
CC(C)C(Cl)c1nccs1
What is the building block token for the following molecule?
CC(C)C(Cl)c1nccs1
<BB_9383>