instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_9383>?
The molecular formula for <BB_9383> (CC(C)C(Cl)c1nccs1) is C7H10ClNS.
Describe the ring structures in building block <BB_9383>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9383>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9383>.
**Token:** <BB_9383> **SMILES:** CC(C)C(Cl)c1nccs1 **Molecular Formula:** C7H10ClNS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9384>.
CC(C)(C)OC(=O)Nc1cccc(C=O)c1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)Nc1cccc(C=O)c1
<BB_9384>
What is the molecular formula for <BB_9384>?
The molecular formula for <BB_9384> (CC(C)(C)OC(=O)Nc1cccc(C=O)c1) is C12H15NO3.
Describe the ring structures in building block <BB_9384>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9384>.
The molecule contains the following groups: Amide, Aldehyde, Ether.
Provide a comprehensive chemical profile for the building block <BB_9384>.
**Token:** <BB_9384> **SMILES:** CC(C)(C)OC(=O)Nc1cccc(C=O)c1 **Molecular Formula:** C12H15NO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Aldehyde, Ether
Provide the SMILES representation for the building block token <BB_9385>.
N#Cc1ccc(-c2c[nH]cn2)cc1
What is the building block token for the following molecule?
N#Cc1ccc(-c2c[nH]cn2)cc1
<BB_9385>
What is the molecular formula for <BB_9385>?
The molecular formula for <BB_9385> (N#Cc1ccc(-c2c[nH]cn2)cc1) is C10H7N3.
Describe the ring structures in building block <BB_9385>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9385>.
The molecule contains the following groups: Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9385>.
**Token:** <BB_9385> **SMILES:** N#Cc1ccc(-c2c[nH]cn2)cc1 **Molecular Formula:** C10H7N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Nitrile
Provide the SMILES representation for the building block token <BB_9386>.
ON=Cc1c(O)cccc1Cl
What is the building block token for the following molecule?
ON=Cc1c(O)cccc1Cl
<BB_9386>
What is the molecular formula for <BB_9386>?
The molecular formula for <BB_9386> (ON=Cc1c(O)cccc1Cl) is C7H6ClNO2.
Describe the ring structures in building block <BB_9386>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9386>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9386>.
**Token:** <BB_9386> **SMILES:** ON=Cc1c(O)cccc1Cl **Molecular Formula:** C7H6ClNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9387>.
Fc1ccc(C(F)(F)F)cn1
What is the building block token for the following molecule?
Fc1ccc(C(F)(F)F)cn1
<BB_9387>
What is the molecular formula for <BB_9387>?
The molecular formula for <BB_9387> (Fc1ccc(C(F)(F)F)cn1) is C6H3F4N.
Describe the ring structures in building block <BB_9387>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9387>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9387>.
**Token:** <BB_9387> **SMILES:** Fc1ccc(C(F)(F)F)cn1 **Molecular Formula:** C6H3F4N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9388>.
CC=C(C)CC
What is the building block token for the following molecule?
CC=C(C)CC
<BB_9388>
What is the molecular formula for <BB_9388>?
The molecular formula for <BB_9388> (CC=C(C)CC) is C6H12.
Describe the ring structures in building block <BB_9388>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9388>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_9388>.
**Token:** <BB_9388> **SMILES:** CC=C(C)CC **Molecular Formula:** C6H12 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_9389>.
NC(CC(F)(F)F)c1ccc(Cl)c(Cl)c1
What is the building block token for the following molecule?
NC(CC(F)(F)F)c1ccc(Cl)c(Cl)c1
<BB_9389>
What is the molecular formula for <BB_9389>?
The molecular formula for <BB_9389> (NC(CC(F)(F)F)c1ccc(Cl)c(Cl)c1) is C9H8Cl2F3N.
Describe the ring structures in building block <BB_9389>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9389>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9389>.
**Token:** <BB_9389> **SMILES:** NC(CC(F)(F)F)c1ccc(Cl)c(Cl)c1 **Molecular Formula:** C9H8Cl2F3N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9390>.
CCCCCCCCOCCCN.Cl
What is the building block token for the following molecule?
CCCCCCCCOCCCN.Cl
<BB_9390>
What is the molecular formula for <BB_9390>?
The molecular formula for <BB_9390> (CCCCCCCCOCCCN.Cl) is C11H26ClNO.
Describe the ring structures in building block <BB_9390>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9390>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9390>.
**Token:** <BB_9390> **SMILES:** CCCCCCCCOCCCN.Cl **Molecular Formula:** C11H26ClNO **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9391>.
CCC(N)c1noc(C)n1.Cl
What is the building block token for the following molecule?
CCC(N)c1noc(C)n1.Cl
<BB_9391>
What is the molecular formula for <BB_9391>?
The molecular formula for <BB_9391> (CCC(N)c1noc(C)n1.Cl) is C6H12ClN3O.
Describe the ring structures in building block <BB_9391>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9391>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9391>.
**Token:** <BB_9391> **SMILES:** CCC(N)c1noc(C)n1.Cl **Molecular Formula:** C6H12ClN3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9392>.
COc1cc([N+](=O)[O-])cc(F)c1OC
What is the building block token for the following molecule?
COc1cc([N+](=O)[O-])cc(F)c1OC
<BB_9392>
What is the molecular formula for <BB_9392>?
The molecular formula for <BB_9392> (COc1cc([N+](=O)[O-])cc(F)c1OC) is C8H8FNO4.
Describe the ring structures in building block <BB_9392>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9392>.
The molecule contains the following groups: Tertiary Amine, Ether, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_9392>.
**Token:** <BB_9392> **SMILES:** COc1cc([N+](=O)[O-])cc(F)c1OC **Molecular Formula:** C8H8FNO4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Ether, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_9393>.
Cl.N#Cc1cccc(C2CCCN2)c1
What is the building block token for the following molecule?
Cl.N#Cc1cccc(C2CCCN2)c1
<BB_9393>
What is the molecular formula for <BB_9393>?
The molecular formula for <BB_9393> (Cl.N#Cc1cccc(C2CCCN2)c1) is C11H13ClN2.
Describe the ring structures in building block <BB_9393>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9393>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9393>.
**Token:** <BB_9393> **SMILES:** Cl.N#Cc1cccc(C2CCCN2)c1 **Molecular Formula:** C11H13ClN2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_9394>.
Cn1cc([N+](=O)[O-])c(C(N)=O)n1
What is the building block token for the following molecule?
Cn1cc([N+](=O)[O-])c(C(N)=O)n1
<BB_9394>
What is the molecular formula for <BB_9394>?
The molecular formula for <BB_9394> (Cn1cc([N+](=O)[O-])c(C(N)=O)n1) is C5H6N4O3.
Describe the ring structures in building block <BB_9394>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9394>.
The molecule contains the following groups: Tertiary Amine, Amide, Nitro.
Provide a comprehensive chemical profile for the building block <BB_9394>.
**Token:** <BB_9394> **SMILES:** Cn1cc([N+](=O)[O-])c(C(N)=O)n1 **Molecular Formula:** C5H6N4O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Tertiary Amine, Amide, Nitro
Provide the SMILES representation for the building block token <BB_9395>.
COC(=O)[C@@H]1C[C@H]2CC(=O)C[C@@H](C1)N2.Cl
What is the building block token for the following molecule?
COC(=O)[C@@H]1C[C@H]2CC(=O)C[C@@H](C1)N2.Cl
<BB_9395>
What is the molecular formula for <BB_9395>?
The molecular formula for <BB_9395> (COC(=O)[C@@H]1C[C@H]2CC(=O)C[C@@H](C1)N2.Cl) is C10H16ClNO3.
Describe the ring structures in building block <BB_9395>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9395>.
The molecule contains the following groups: Secondary Amine, Ester, Ketone, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9395>.
**Token:** <BB_9395> **SMILES:** COC(=O)[C@@H]1C[C@H]2CC(=O)C[C@@H](C1)N2.Cl **Molecular Formula:** C10H16ClNO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ester, Ketone, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9396>.
COC(=O)CNc1ncc(C)cc1[N+](=O)[O-]
What is the building block token for the following molecule?
COC(=O)CNc1ncc(C)cc1[N+](=O)[O-]
<BB_9396>
What is the molecular formula for <BB_9396>?
The molecular formula for <BB_9396> (COC(=O)CNc1ncc(C)cc1[N+](=O)[O-]) is C9H11N3O4.
Describe the ring structures in building block <BB_9396>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9396>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Ester, Ether, Nitro.
Provide a comprehensive chemical profile for the building block <BB_9396>.
**Token:** <BB_9396> **SMILES:** COC(=O)CNc1ncc(C)cc1[N+](=O)[O-] **Molecular Formula:** C9H11N3O4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Ester, Ether, Nitro
Provide the SMILES representation for the building block token <BB_9397>.
CSc1ccc(CN)cc1.Cl
What is the building block token for the following molecule?
CSc1ccc(CN)cc1.Cl
<BB_9397>
What is the molecular formula for <BB_9397>?
The molecular formula for <BB_9397> (CSc1ccc(CN)cc1.Cl) is C8H12ClNS.
Describe the ring structures in building block <BB_9397>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9397>.
The molecule contains the following groups: Amine, Sulfide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9397>.
**Token:** <BB_9397> **SMILES:** CSc1ccc(CN)cc1.Cl **Molecular Formula:** C8H12ClNS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Sulfide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9398>.
CCC[C@@H]1CN(Cc2ccccc2)C[C@H]1C(=O)O
What is the building block token for the following molecule?
CCC[C@@H]1CN(Cc2ccccc2)C[C@H]1C(=O)O
<BB_9398>
What is the molecular formula for <BB_9398>?
The molecular formula for <BB_9398> (CCC[C@@H]1CN(Cc2ccccc2)C[C@H]1C(=O)O) is C15H21NO2.
Describe the ring structures in building block <BB_9398>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9398>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_9398>.
**Token:** <BB_9398> **SMILES:** CCC[C@@H]1CN(Cc2ccccc2)C[C@H]1C(=O)O **Molecular Formula:** C15H21NO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Tertiary Amine
Provide the SMILES representation for the building block token <BB_9399>.
COC(=O)C(C)C(C)S
What is the building block token for the following molecule?
COC(=O)C(C)C(C)S
<BB_9399>
What is the molecular formula for <BB_9399>?
The molecular formula for <BB_9399> (COC(=O)C(C)C(C)S) is C6H12O2S.
Describe the ring structures in building block <BB_9399>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9399>.
The molecule contains the following groups: Ester, Ether, Thiol.
Provide a comprehensive chemical profile for the building block <BB_9399>.
**Token:** <BB_9399> **SMILES:** COC(=O)C(C)C(C)S **Molecular Formula:** C6H12O2S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ester, Ether, Thiol