instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_9400>.
Cl.O=[N+]([O-])c1cccc2c1CNC2
What is the building block token for the following molecule?
Cl.O=[N+]([O-])c1cccc2c1CNC2
<BB_9400>
What is the molecular formula for <BB_9400>?
The molecular formula for <BB_9400> (Cl.O=[N+]([O-])c1cccc2c1CNC2) is C8H9ClN2O2.
Describe the ring structures in building block <BB_9400>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9400>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_9400>.
**Token:** <BB_9400> **SMILES:** Cl.O=[N+]([O-])c1cccc2c1CNC2 **Molecular Formula:** C8H9ClN2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_9401>.
CN(C)C(=S)Oc1cccc(C=O)c1
What is the building block token for the following molecule?
CN(C)C(=S)Oc1cccc(C=O)c1
<BB_9401>
What is the molecular formula for <BB_9401>?
The molecular formula for <BB_9401> (CN(C)C(=S)Oc1cccc(C=O)c1) is C10H11NO2S.
Describe the ring structures in building block <BB_9401>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9401>.
The molecule contains the following groups: Tertiary Amine, Aldehyde, Ether.
Provide a comprehensive chemical profile for the building block <BB_9401>.
**Token:** <BB_9401> **SMILES:** CN(C)C(=S)Oc1cccc(C=O)c1 **Molecular Formula:** C10H11NO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Aldehyde, Ether
Provide the SMILES representation for the building block token <BB_9402>.
Cl.Cl.NCc1ccc(-c2ncc[nH]2)cc1
What is the building block token for the following molecule?
Cl.Cl.NCc1ccc(-c2ncc[nH]2)cc1
<BB_9402>
What is the molecular formula for <BB_9402>?
The molecular formula for <BB_9402> (Cl.Cl.NCc1ccc(-c2ncc[nH]2)cc1) is C10H13Cl2N3.
Describe the ring structures in building block <BB_9402>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9402>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9402>.
**Token:** <BB_9402> **SMILES:** Cl.Cl.NCc1ccc(-c2ncc[nH]2)cc1 **Molecular Formula:** C10H13Cl2N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9403>.
Cn1nnnc1-c1cccc(S(N)(=O)=O)c1
What is the building block token for the following molecule?
Cn1nnnc1-c1cccc(S(N)(=O)=O)c1
<BB_9403>
What is the molecular formula for <BB_9403>?
The molecular formula for <BB_9403> (Cn1nnnc1-c1cccc(S(N)(=O)=O)c1) is C8H9N5O2S.
Describe the ring structures in building block <BB_9403>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9403>.
The molecule contains the following groups: Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_9403>.
**Token:** <BB_9403> **SMILES:** Cn1nnnc1-c1cccc(S(N)(=O)=O)c1 **Molecular Formula:** C8H9N5O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_9404>.
O=C(NC1(C(=O)CBr)CCCC1)C(F)(F)F
What is the building block token for the following molecule?
O=C(NC1(C(=O)CBr)CCCC1)C(F)(F)F
<BB_9404>
What is the molecular formula for <BB_9404>?
The molecular formula for <BB_9404> (O=C(NC1(C(=O)CBr)CCCC1)C(F)(F)F) is C9H11BrF3NO2.
Describe the ring structures in building block <BB_9404>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_9404>.
The molecule contains the following groups: Amide, Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9404>.
**Token:** <BB_9404> **SMILES:** O=C(NC1(C(=O)CBr)CCCC1)C(F)(F)F **Molecular Formula:** C9H11BrF3NO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amide, Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9405>.
CO[Si](CCCn1ccnc1)(OC)OC
What is the building block token for the following molecule?
CO[Si](CCCn1ccnc1)(OC)OC
<BB_9405>
What is the molecular formula for <BB_9405>?
The molecular formula for <BB_9405> (CO[Si](CCCn1ccnc1)(OC)OC) is C9H18N2O3Si.
Describe the ring structures in building block <BB_9405>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9405>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_9405>.
**Token:** <BB_9405> **SMILES:** CO[Si](CCCn1ccnc1)(OC)OC **Molecular Formula:** C9H18N2O3Si **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_9406>.
Nc1cc(C(F)(F)F)ccc1N1CCS(=O)(=O)CC1
What is the building block token for the following molecule?
Nc1cc(C(F)(F)F)ccc1N1CCS(=O)(=O)CC1
<BB_9406>
What is the molecular formula for <BB_9406>?
The molecular formula for <BB_9406> (Nc1cc(C(F)(F)F)ccc1N1CCS(=O)(=O)CC1) is C11H13F3N2O2S.
Describe the ring structures in building block <BB_9406>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9406>.
The molecule contains the following groups: Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9406>.
**Token:** <BB_9406> **SMILES:** Nc1cc(C(F)(F)F)ccc1N1CCS(=O)(=O)CC1 **Molecular Formula:** C11H13F3N2O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9407>.
Cc1c(F)cccc1CCN.Cl
What is the building block token for the following molecule?
Cc1c(F)cccc1CCN.Cl
<BB_9407>
What is the molecular formula for <BB_9407>?
The molecular formula for <BB_9407> (Cc1c(F)cccc1CCN.Cl) is C9H13ClFN.
Describe the ring structures in building block <BB_9407>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9407>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9407>.
**Token:** <BB_9407> **SMILES:** Cc1c(F)cccc1CCN.Cl **Molecular Formula:** C9H13ClFN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9408>.
CC1(C)C2CCC13CCNC3C2.Cl
What is the building block token for the following molecule?
CC1(C)C2CCC13CCNC3C2.Cl
<BB_9408>
What is the molecular formula for <BB_9408>?
The molecular formula for <BB_9408> (CC1(C)C2CCC13CCNC3C2.Cl) is C11H20ClN.
Describe the ring structures in building block <BB_9408>.
The molecule contains 3 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9408>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9408>.
**Token:** <BB_9408> **SMILES:** CC1(C)C2CCC13CCNC3C2.Cl **Molecular Formula:** C11H20ClN **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9409>.
Cn1nc(C(=O)O)c2c1CCOC2
What is the building block token for the following molecule?
Cn1nc(C(=O)O)c2c1CCOC2
<BB_9409>
What is the molecular formula for <BB_9409>?
The molecular formula for <BB_9409> (Cn1nc(C(=O)O)c2c1CCOC2) is C8H10N2O3.
Describe the ring structures in building block <BB_9409>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9409>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_9409>.
**Token:** <BB_9409> **SMILES:** Cn1nc(C(=O)O)c2c1CCOC2 **Molecular Formula:** C8H10N2O3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_9410>.
CC(c1cccnc1)S(N)(=O)=O
What is the building block token for the following molecule?
CC(c1cccnc1)S(N)(=O)=O
<BB_9410>
What is the molecular formula for <BB_9410>?
The molecular formula for <BB_9410> (CC(c1cccnc1)S(N)(=O)=O) is C7H10N2O2S.
Describe the ring structures in building block <BB_9410>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9410>.
The molecule contains the following groups: Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_9410>.
**Token:** <BB_9410> **SMILES:** CC(c1cccnc1)S(N)(=O)=O **Molecular Formula:** C7H10N2O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_9411>.
Cl.N[C@H]1CC[C@H](I)CC1
What is the building block token for the following molecule?
Cl.N[C@H]1CC[C@H](I)CC1
<BB_9411>
What is the molecular formula for <BB_9411>?
The molecular formula for <BB_9411> (Cl.N[C@H]1CC[C@H](I)CC1) is C6H13ClIN.
Describe the ring structures in building block <BB_9411>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9411>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9411>.
**Token:** <BB_9411> **SMILES:** Cl.N[C@H]1CC[C@H](I)CC1 **Molecular Formula:** C6H13ClIN **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9412>.
Cc1ccc(N2CCCC2)c(N)c1
What is the building block token for the following molecule?
Cc1ccc(N2CCCC2)c(N)c1
<BB_9412>
What is the molecular formula for <BB_9412>?
The molecular formula for <BB_9412> (Cc1ccc(N2CCCC2)c(N)c1) is C11H16N2.
Describe the ring structures in building block <BB_9412>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9412>.
The molecule contains the following groups: Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_9412>.
**Token:** <BB_9412> **SMILES:** Cc1ccc(N2CCCC2)c(N)c1 **Molecular Formula:** C11H16N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_9413>.
Nc1cccc(-c2ncc3n2CCCC3)c1
What is the building block token for the following molecule?
Nc1cccc(-c2ncc3n2CCCC3)c1
<BB_9413>
What is the molecular formula for <BB_9413>?
The molecular formula for <BB_9413> (Nc1cccc(-c2ncc3n2CCCC3)c1) is C13H15N3.
Describe the ring structures in building block <BB_9413>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9413>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_9413>.
**Token:** <BB_9413> **SMILES:** Nc1cccc(-c2ncc3n2CCCC3)c1 **Molecular Formula:** C13H15N3 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_9414>.
O=C(CCC1CCCCC1)N1CCOCC1
What is the building block token for the following molecule?
O=C(CCC1CCCCC1)N1CCOCC1
<BB_9414>
What is the molecular formula for <BB_9414>?
The molecular formula for <BB_9414> (O=C(CCC1CCCCC1)N1CCOCC1) is C13H23NO2.
Describe the ring structures in building block <BB_9414>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9414>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_9414>.
**Token:** <BB_9414> **SMILES:** O=C(CCC1CCCCC1)N1CCOCC1 **Molecular Formula:** C13H23NO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amide, Ether
Provide the SMILES representation for the building block token <BB_9415>.
NN1CCc2ccc(F)cc21
What is the building block token for the following molecule?
NN1CCc2ccc(F)cc21
<BB_9415>
What is the molecular formula for <BB_9415>?
The molecular formula for <BB_9415> (NN1CCc2ccc(F)cc21) is C8H9FN2.
Describe the ring structures in building block <BB_9415>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9415>.
The molecule contains the following groups: Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9415>.
**Token:** <BB_9415> **SMILES:** NN1CCc2ccc(F)cc21 **Molecular Formula:** C8H9FN2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9416>.
O=C(O)c1cc(F)cnc1NC1CC(F)(F)C1
What is the building block token for the following molecule?
O=C(O)c1cc(F)cnc1NC1CC(F)(F)C1
<BB_9416>
What is the molecular formula for <BB_9416>?
The molecular formula for <BB_9416> (O=C(O)c1cc(F)cnc1NC1CC(F)(F)C1) is C10H9F3N2O2.
Describe the ring structures in building block <BB_9416>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4.