instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_9416>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9416>.
**Token:** <BB_9416> **SMILES:** O=C(O)c1cc(F)cnc1NC1CC(F)(F)C1 **Molecular Formula:** C10H9F3N2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9417>.
CC(=O)Nc1ccccc1O
What is the building block token for the following molecule?
CC(=O)Nc1ccccc1O
<BB_9417>
What is the molecular formula for <BB_9417>?
The molecular formula for <BB_9417> (CC(=O)Nc1ccccc1O) is C8H9NO2.
Describe the ring structures in building block <BB_9417>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9417>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_9417>.
**Token:** <BB_9417> **SMILES:** CC(=O)Nc1ccccc1O **Molecular Formula:** C8H9NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_9418>.
COCCCCC[B-](F)(F)F.[K+]
What is the building block token for the following molecule?
COCCCCC[B-](F)(F)F.[K+]
<BB_9418>
What is the molecular formula for <BB_9418>?
The molecular formula for <BB_9418> (COCCCCC[B-](F)(F)F.[K+]) is C6H13BF3KO.
Describe the ring structures in building block <BB_9418>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9418>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9418>.
**Token:** <BB_9418> **SMILES:** COCCCCC[B-](F)(F)F.[K+] **Molecular Formula:** C6H13BF3KO **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9419>.
Cl.FC(F)(F)c1ccnc(C2CNC2)n1
What is the building block token for the following molecule?
Cl.FC(F)(F)c1ccnc(C2CNC2)n1
<BB_9419>
What is the molecular formula for <BB_9419>?
The molecular formula for <BB_9419> (Cl.FC(F)(F)c1ccnc(C2CNC2)n1) is C8H9ClF3N3.
Describe the ring structures in building block <BB_9419>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_9419>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9419>.
**Token:** <BB_9419> **SMILES:** Cl.FC(F)(F)c1ccnc(C2CNC2)n1 **Molecular Formula:** C8H9ClF3N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9420>.
Br.NNC1=NC2CCCCC2N1
What is the building block token for the following molecule?
Br.NNC1=NC2CCCCC2N1
<BB_9420>
What is the molecular formula for <BB_9420>?
The molecular formula for <BB_9420> (Br.NNC1=NC2CCCCC2N1) is C7H15BrN4.
Describe the ring structures in building block <BB_9420>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9420>.
The molecule contains the following groups: Amine, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9420>.
**Token:** <BB_9420> **SMILES:** Br.NNC1=NC2CCCCC2N1 **Molecular Formula:** C7H15BrN4 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9421>.
CC1(C)OB(c2ccc(F)c(C3CC3)c2)OC1(C)C
What is the building block token for the following molecule?
CC1(C)OB(c2ccc(F)c(C3CC3)c2)OC1(C)C
<BB_9421>
What is the molecular formula for <BB_9421>?
The molecular formula for <BB_9421> (CC1(C)OB(c2ccc(F)c(C3CC3)c2)OC1(C)C) is C15H20BFO2.
Describe the ring structures in building block <BB_9421>.
The molecule contains 3 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_9421>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9421>.
**Token:** <BB_9421> **SMILES:** CC1(C)OB(c2ccc(F)c(C3CC3)c2)OC1(C)C **Molecular Formula:** C15H20BFO2 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9422>.
O=Nc1ccc(O)cc1Br
What is the building block token for the following molecule?
O=Nc1ccc(O)cc1Br
<BB_9422>
What is the molecular formula for <BB_9422>?
The molecular formula for <BB_9422> (O=Nc1ccc(O)cc1Br) is C6H4BrNO2.
Describe the ring structures in building block <BB_9422>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9422>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9422>.
**Token:** <BB_9422> **SMILES:** O=Nc1ccc(O)cc1Br **Molecular Formula:** C6H4BrNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9423>.
CCCCCCCCCCCCI
What is the building block token for the following molecule?
CCCCCCCCCCCCI
<BB_9423>
What is the molecular formula for <BB_9423>?
The molecular formula for <BB_9423> (CCCCCCCCCCCCI) is C12H25I.
Describe the ring structures in building block <BB_9423>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9423>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9423>.
**Token:** <BB_9423> **SMILES:** CCCCCCCCCCCCI **Molecular Formula:** C12H25I **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9424>.
Cc1ccnc(Oc2ccc(CC(=O)O)cc2)c1
What is the building block token for the following molecule?
Cc1ccnc(Oc2ccc(CC(=O)O)cc2)c1
<BB_9424>
What is the molecular formula for <BB_9424>?
The molecular formula for <BB_9424> (Cc1ccnc(Oc2ccc(CC(=O)O)cc2)c1) is C14H13NO3.
Describe the ring structures in building block <BB_9424>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9424>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_9424>.
**Token:** <BB_9424> **SMILES:** Cc1ccnc(Oc2ccc(CC(=O)O)cc2)c1 **Molecular Formula:** C14H13NO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_9425>.
CNC1CC2(CC2)C1.Cl
What is the building block token for the following molecule?
CNC1CC2(CC2)C1.Cl
<BB_9425>
What is the molecular formula for <BB_9425>?
The molecular formula for <BB_9425> (CNC1CC2(CC2)C1.Cl) is C7H14ClN.
Describe the ring structures in building block <BB_9425>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 3.
List the primary functional groups present in <BB_9425>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9425>.
**Token:** <BB_9425> **SMILES:** CNC1CC2(CC2)C1.Cl **Molecular Formula:** C7H14ClN **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 3. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9426>.
CCOC(=O)c1ncn2c(C)cc(C)nc12
What is the building block token for the following molecule?
CCOC(=O)c1ncn2c(C)cc(C)nc12
<BB_9426>
What is the molecular formula for <BB_9426>?
The molecular formula for <BB_9426> (CCOC(=O)c1ncn2c(C)cc(C)nc12) is C11H13N3O2.
Describe the ring structures in building block <BB_9426>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9426>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_9426>.
**Token:** <BB_9426> **SMILES:** CCOC(=O)c1ncn2c(C)cc(C)nc12 **Molecular Formula:** C11H13N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_9427>.
CSCCC=O
What is the building block token for the following molecule?
CSCCC=O
<BB_9427>
What is the molecular formula for <BB_9427>?
The molecular formula for <BB_9427> (CSCCC=O) is C4H8OS.
Describe the ring structures in building block <BB_9427>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9427>.
The molecule contains the following groups: Aldehyde, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_9427>.
**Token:** <BB_9427> **SMILES:** CSCCC=O **Molecular Formula:** C4H8OS **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Aldehyde, Sulfide
Provide the SMILES representation for the building block token <BB_9428>.
[N-]=[N+]=NCc1cccnn1
What is the building block token for the following molecule?
[N-]=[N+]=NCc1cccnn1
<BB_9428>
What is the molecular formula for <BB_9428>?
The molecular formula for <BB_9428> ([N-]=[N+]=NCc1cccnn1) is C5H5N5.
Describe the ring structures in building block <BB_9428>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9428>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_9428>.
**Token:** <BB_9428> **SMILES:** [N-]=[N+]=NCc1cccnn1 **Molecular Formula:** C5H5N5 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_9429>.
CC(N)c1c(F)cccc1F.Cl
What is the building block token for the following molecule?
CC(N)c1c(F)cccc1F.Cl
<BB_9429>
What is the molecular formula for <BB_9429>?
The molecular formula for <BB_9429> (CC(N)c1c(F)cccc1F.Cl) is C8H10ClF2N.
Describe the ring structures in building block <BB_9429>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9429>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9429>.
**Token:** <BB_9429> **SMILES:** CC(N)c1c(F)cccc1F.Cl **Molecular Formula:** C8H10ClF2N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9430>.
COCC1(C)CCNCC1
What is the building block token for the following molecule?
COCC1(C)CCNCC1
<BB_9430>
What is the molecular formula for <BB_9430>?
The molecular formula for <BB_9430> (COCC1(C)CCNCC1) is C8H17NO.
Describe the ring structures in building block <BB_9430>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9430>.
The molecule contains the following groups: Secondary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_9430>.
**Token:** <BB_9430> **SMILES:** COCC1(C)CCNCC1 **Molecular Formula:** C8H17NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ether
Provide the SMILES representation for the building block token <BB_9431>.
Cc1nc2ccc(C=O)cc2o1
What is the building block token for the following molecule?
Cc1nc2ccc(C=O)cc2o1
<BB_9431>
What is the molecular formula for <BB_9431>?
The molecular formula for <BB_9431> (Cc1nc2ccc(C=O)cc2o1) is C9H7NO2.
Describe the ring structures in building block <BB_9431>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9431>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_9431>.
**Token:** <BB_9431> **SMILES:** Cc1nc2ccc(C=O)cc2o1 **Molecular Formula:** C9H7NO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_9432>.
Cl.Cl.N#Cc1cccc(-c2c[nH]c(CN)n2)c1
What is the building block token for the following molecule?
Cl.Cl.N#Cc1cccc(-c2c[nH]c(CN)n2)c1
<BB_9432>
What is the molecular formula for <BB_9432>?
The molecular formula for <BB_9432> (Cl.Cl.N#Cc1cccc(-c2c[nH]c(CN)n2)c1) is C11H12Cl2N4.
Describe the ring structures in building block <BB_9432>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9432>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9432>.
**Token:** <BB_9432> **SMILES:** Cl.Cl.N#Cc1cccc(-c2c[nH]c(CN)n2)c1 **Molecular Formula:** C11H12Cl2N4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_9433>.
CCC(C)Oc1cc(C(=O)O)ccn1
What is the building block token for the following molecule?
CCC(C)Oc1cc(C(=O)O)ccn1
<BB_9433>