instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_9433>?
The molecular formula for <BB_9433> (CCC(C)Oc1cc(C(=O)O)ccn1) is C10H13NO3.
Describe the ring structures in building block <BB_9433>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9433>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_9433>.
**Token:** <BB_9433> **SMILES:** CCC(C)Oc1cc(C(=O)O)ccn1 **Molecular Formula:** C10H13NO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_9434>.
COCCC(C)CCS(=O)(=O)Cl
What is the building block token for the following molecule?
COCCC(C)CCS(=O)(=O)Cl
<BB_9434>
What is the molecular formula for <BB_9434>?
The molecular formula for <BB_9434> (COCCC(C)CCS(=O)(=O)Cl) is C7H15ClO3S.
Describe the ring structures in building block <BB_9434>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9434>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9434>.
**Token:** <BB_9434> **SMILES:** COCCC(C)CCS(=O)(=O)Cl **Molecular Formula:** C7H15ClO3S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9435>.
Cl.Cl.Cn1cnc2c1CNC2
What is the building block token for the following molecule?
Cl.Cl.Cn1cnc2c1CNC2
<BB_9435>
What is the molecular formula for <BB_9435>?
The molecular formula for <BB_9435> (Cl.Cl.Cn1cnc2c1CNC2) is C6H11Cl2N3.
Describe the ring structures in building block <BB_9435>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9435>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9435>.
**Token:** <BB_9435> **SMILES:** Cl.Cl.Cn1cnc2c1CNC2 **Molecular Formula:** C6H11Cl2N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9436>.
Cl.NCC(O)C(F)F
What is the building block token for the following molecule?
Cl.NCC(O)C(F)F
<BB_9436>
What is the molecular formula for <BB_9436>?
The molecular formula for <BB_9436> (Cl.NCC(O)C(F)F) is C3H8ClF2NO.
Describe the ring structures in building block <BB_9436>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9436>.
The molecule contains the following groups: Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9436>.
**Token:** <BB_9436> **SMILES:** Cl.NCC(O)C(F)F **Molecular Formula:** C3H8ClF2NO **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9437>.
Cl.N[C@H]1CCO[C@@H](c2ccc(Br)cc2)C1
What is the building block token for the following molecule?
Cl.N[C@H]1CCO[C@@H](c2ccc(Br)cc2)C1
<BB_9437>
What is the molecular formula for <BB_9437>?
The molecular formula for <BB_9437> (Cl.N[C@H]1CCO[C@@H](c2ccc(Br)cc2)C1) is C11H15BrClNO.
Describe the ring structures in building block <BB_9437>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9437>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9437>.
**Token:** <BB_9437> **SMILES:** Cl.N[C@H]1CCO[C@@H](c2ccc(Br)cc2)C1 **Molecular Formula:** C11H15BrClNO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9438>.
O=C(Cl)OCCBr
What is the building block token for the following molecule?
O=C(Cl)OCCBr
<BB_9438>
What is the molecular formula for <BB_9438>?
The molecular formula for <BB_9438> (O=C(Cl)OCCBr) is C3H4BrClO2.
Describe the ring structures in building block <BB_9438>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9438>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9438>.
**Token:** <BB_9438> **SMILES:** O=C(Cl)OCCBr **Molecular Formula:** C3H4BrClO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9439>.
NNC(=O)c1ccn(Cn2cc(Br)cn2)n1
What is the building block token for the following molecule?
NNC(=O)c1ccn(Cn2cc(Br)cn2)n1
<BB_9439>
What is the molecular formula for <BB_9439>?
The molecular formula for <BB_9439> (NNC(=O)c1ccn(Cn2cc(Br)cn2)n1) is C8H9BrN6O.
Describe the ring structures in building block <BB_9439>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_9439>.
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9439>.
**Token:** <BB_9439> **SMILES:** NNC(=O)c1ccn(Cn2cc(Br)cn2)n1 **Molecular Formula:** C8H9BrN6O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9440>.
O=[N+]([O-])c1ccc(S(=O)(=O)Cl)c(C(F)F)c1
What is the building block token for the following molecule?
O=[N+]([O-])c1ccc(S(=O)(=O)Cl)c(C(F)F)c1
<BB_9440>
What is the molecular formula for <BB_9440>?
The molecular formula for <BB_9440> (O=[N+]([O-])c1ccc(S(=O)(=O)Cl)c(C(F)F)c1) is C7H4ClF2NO4S.
Describe the ring structures in building block <BB_9440>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9440>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_9440>.
**Token:** <BB_9440> **SMILES:** O=[N+]([O-])c1ccc(S(=O)(=O)Cl)c(C(F)F)c1 **Molecular Formula:** C7H4ClF2NO4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_9441>.
CC(Cc1ccccc1)C(F)(F)F
What is the building block token for the following molecule?
CC(Cc1ccccc1)C(F)(F)F
<BB_9441>
What is the molecular formula for <BB_9441>?
The molecular formula for <BB_9441> (CC(Cc1ccccc1)C(F)(F)F) is C10H11F3.
Describe the ring structures in building block <BB_9441>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9441>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9441>.
**Token:** <BB_9441> **SMILES:** CC(Cc1ccccc1)C(F)(F)F **Molecular Formula:** C10H11F3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9442>.
NS(=O)(=O)c1ccc(Br)c(C(=O)O)c1
What is the building block token for the following molecule?
NS(=O)(=O)c1ccc(Br)c(C(=O)O)c1
<BB_9442>
What is the molecular formula for <BB_9442>?
The molecular formula for <BB_9442> (NS(=O)(=O)c1ccc(Br)c(C(=O)O)c1) is C7H6BrNO4S.
Describe the ring structures in building block <BB_9442>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9442>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_9442>.
**Token:** <BB_9442> **SMILES:** NS(=O)(=O)c1ccc(Br)c(C(=O)O)c1 **Molecular Formula:** C7H6BrNO4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_9443>.
Cc1cc2cc(N)ccc2[nH]1
What is the building block token for the following molecule?
Cc1cc2cc(N)ccc2[nH]1
<BB_9443>
What is the molecular formula for <BB_9443>?
The molecular formula for <BB_9443> (Cc1cc2cc(N)ccc2[nH]1) is C9H10N2.
Describe the ring structures in building block <BB_9443>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9443>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_9443>.
**Token:** <BB_9443> **SMILES:** Cc1cc2cc(N)ccc2[nH]1 **Molecular Formula:** C9H10N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_9444>.
CC(C)(C)OC(=O)N[C@H](CC1CC1)C(=O)O
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N[C@H](CC1CC1)C(=O)O
<BB_9444>
What is the molecular formula for <BB_9444>?
The molecular formula for <BB_9444> (CC(C)(C)OC(=O)N[C@H](CC1CC1)C(=O)O) is C11H19NO4.
Describe the ring structures in building block <BB_9444>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_9444>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_9444>.
**Token:** <BB_9444> **SMILES:** CC(C)(C)OC(=O)N[C@H](CC1CC1)C(=O)O **Molecular Formula:** C11H19NO4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_9445>.
F[B-](F)(F)C(F)(F)F.[K+]
What is the building block token for the following molecule?
F[B-](F)(F)C(F)(F)F.[K+]
<BB_9445>
What is the molecular formula for <BB_9445>?
The molecular formula for <BB_9445> (F[B-](F)(F)C(F)(F)F.[K+]) is CBF6K.
Describe the ring structures in building block <BB_9445>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9445>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9445>.
**Token:** <BB_9445> **SMILES:** F[B-](F)(F)C(F)(F)F.[K+] **Molecular Formula:** CBF6K **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9446>.
Cl.NCCOc1ccsc1
What is the building block token for the following molecule?
Cl.NCCOc1ccsc1
<BB_9446>
What is the molecular formula for <BB_9446>?
The molecular formula for <BB_9446> (Cl.NCCOc1ccsc1) is C6H10ClNOS.
Describe the ring structures in building block <BB_9446>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9446>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9446>.
**Token:** <BB_9446> **SMILES:** Cl.NCCOc1ccsc1 **Molecular Formula:** C6H10ClNOS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9447>.
FC(F)(F)CC(Br)c1ccccc1
What is the building block token for the following molecule?
FC(F)(F)CC(Br)c1ccccc1
<BB_9447>
What is the molecular formula for <BB_9447>?
The molecular formula for <BB_9447> (FC(F)(F)CC(Br)c1ccccc1) is C9H8BrF3.
Describe the ring structures in building block <BB_9447>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9447>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9447>.
**Token:** <BB_9447> **SMILES:** FC(F)(F)CC(Br)c1ccccc1 **Molecular Formula:** C9H8BrF3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9448>.
CCOS(=O)(=O)c1ccc(C)cc1
What is the building block token for the following molecule?
CCOS(=O)(=O)c1ccc(C)cc1
<BB_9448>
What is the molecular formula for <BB_9448>?
The molecular formula for <BB_9448> (CCOS(=O)(=O)c1ccc(C)cc1) is C9H12O3S.
Describe the ring structures in building block <BB_9448>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9448>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_9448>.
**Token:** <BB_9448> **SMILES:** CCOS(=O)(=O)c1ccc(C)cc1 **Molecular Formula:** C9H12O3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_9449>.
c1ccc(-c2nnco2)cc1
What is the building block token for the following molecule?
c1ccc(-c2nnco2)cc1
<BB_9449>
What is the molecular formula for <BB_9449>?
The molecular formula for <BB_9449> (c1ccc(-c2nnco2)cc1) is C8H6N2O.
Describe the ring structures in building block <BB_9449>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9449>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_9449>.
**Token:** <BB_9449> **SMILES:** c1ccc(-c2nnco2)cc1 **Molecular Formula:** C8H6N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** None specific