instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_9450>.
C[C@@H](ON)c1ccncc1
What is the building block token for the following molecule?
C[C@@H](ON)c1ccncc1
<BB_9450>
What is the molecular formula for <BB_9450>?
The molecular formula for <BB_9450> (C[C@@H](ON)c1ccncc1) is C7H10N2O.
Describe the ring structures in building block <BB_9450>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9450>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_9450>.
**Token:** <BB_9450> **SMILES:** C[C@@H](ON)c1ccncc1 **Molecular Formula:** C7H10N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_9451>.
OCCc1ccsn1
What is the building block token for the following molecule?
OCCc1ccsn1
<BB_9451>
What is the molecular formula for <BB_9451>?
The molecular formula for <BB_9451> (OCCc1ccsn1) is C5H7NOS.
Describe the ring structures in building block <BB_9451>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9451>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_9451>.
**Token:** <BB_9451> **SMILES:** OCCc1ccsn1 **Molecular Formula:** C5H7NOS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_9452>.
CC1(N)CCC(CC(=O)OC(C)(C)C)CC1.Cl
What is the building block token for the following molecule?
CC1(N)CCC(CC(=O)OC(C)(C)C)CC1.Cl
<BB_9452>
What is the molecular formula for <BB_9452>?
The molecular formula for <BB_9452> (CC1(N)CCC(CC(=O)OC(C)(C)C)CC1.Cl) is C13H26ClNO2.
Describe the ring structures in building block <BB_9452>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9452>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9452>.
**Token:** <BB_9452> **SMILES:** CC1(N)CCC(CC(=O)OC(C)(C)C)CC1.Cl **Molecular Formula:** C13H26ClNO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9453>.
O=C(O)[C@H]1C[C@@H](O)[C@@H](O)C1
What is the building block token for the following molecule?
O=C(O)[C@H]1C[C@@H](O)[C@@H](O)C1
<BB_9453>
What is the molecular formula for <BB_9453>?
The molecular formula for <BB_9453> (O=C(O)[C@H]1C[C@@H](O)[C@@H](O)C1) is C6H10O4.
Describe the ring structures in building block <BB_9453>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_9453>.
The molecule contains the following groups: Carboxylic Acid, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_9453>.
**Token:** <BB_9453> **SMILES:** O=C(O)[C@H]1C[C@@H](O)[C@@H](O)C1 **Molecular Formula:** C6H10O4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Alcohol
Provide the SMILES representation for the building block token <BB_9454>.
CNS(=O)(=O)CCCCl
What is the building block token for the following molecule?
CNS(=O)(=O)CCCCl
<BB_9454>
What is the molecular formula for <BB_9454>?
The molecular formula for <BB_9454> (CNS(=O)(=O)CCCCl) is C4H10ClNO2S.
Describe the ring structures in building block <BB_9454>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9454>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_9454>.
**Token:** <BB_9454> **SMILES:** CNS(=O)(=O)CCCCl **Molecular Formula:** C4H10ClNO2S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_9455>.
CC(C)(C)c1cc(Br)cc(C(C)(C)C)c1O
What is the building block token for the following molecule?
CC(C)(C)c1cc(Br)cc(C(C)(C)C)c1O
<BB_9455>
What is the molecular formula for <BB_9455>?
The molecular formula for <BB_9455> (CC(C)(C)c1cc(Br)cc(C(C)(C)C)c1O) is C14H21BrO.
Describe the ring structures in building block <BB_9455>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9455>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9455>.
**Token:** <BB_9455> **SMILES:** CC(C)(C)c1cc(Br)cc(C(C)(C)C)c1O **Molecular Formula:** C14H21BrO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9456>.
O=C1NCCc2c(F)cccc21
What is the building block token for the following molecule?
O=C1NCCc2c(F)cccc21
<BB_9456>
What is the molecular formula for <BB_9456>?
The molecular formula for <BB_9456> (O=C1NCCc2c(F)cccc21) is C9H8FNO.
Describe the ring structures in building block <BB_9456>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9456>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9456>.
**Token:** <BB_9456> **SMILES:** O=C1NCCc2c(F)cccc21 **Molecular Formula:** C9H8FNO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9457>.
COCCN(Cc1ccccc1)C(=O)CCl
What is the building block token for the following molecule?
COCCN(Cc1ccccc1)C(=O)CCl
<BB_9457>
What is the molecular formula for <BB_9457>?
The molecular formula for <BB_9457> (COCCN(Cc1ccccc1)C(=O)CCl) is C12H16ClNO2.
Describe the ring structures in building block <BB_9457>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9457>.
The molecule contains the following groups: Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9457>.
**Token:** <BB_9457> **SMILES:** COCCN(Cc1ccccc1)C(=O)CCl **Molecular Formula:** C12H16ClNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9458>.
COc1cc(OC)c(Cl)cc1N
What is the building block token for the following molecule?
COc1cc(OC)c(Cl)cc1N
<BB_9458>
What is the molecular formula for <BB_9458>?
The molecular formula for <BB_9458> (COc1cc(OC)c(Cl)cc1N) is C8H10ClNO2.
Describe the ring structures in building block <BB_9458>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9458>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9458>.
**Token:** <BB_9458> **SMILES:** COc1cc(OC)c(Cl)cc1N **Molecular Formula:** C8H10ClNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9459>.
Cc1cc(F)ccc1C(F)(F)C(=O)O
What is the building block token for the following molecule?
Cc1cc(F)ccc1C(F)(F)C(=O)O
<BB_9459>
What is the molecular formula for <BB_9459>?
The molecular formula for <BB_9459> (Cc1cc(F)ccc1C(F)(F)C(=O)O) is C9H7F3O2.
Describe the ring structures in building block <BB_9459>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9459>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9459>.
**Token:** <BB_9459> **SMILES:** Cc1cc(F)ccc1C(F)(F)C(=O)O **Molecular Formula:** C9H7F3O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9460>.
CN1Cc2cc(Br)ccc2C1=O
What is the building block token for the following molecule?
CN1Cc2cc(Br)ccc2C1=O
<BB_9460>
What is the molecular formula for <BB_9460>?
The molecular formula for <BB_9460> (CN1Cc2cc(Br)ccc2C1=O) is C9H8BrNO.
Describe the ring structures in building block <BB_9460>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9460>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9460>.
**Token:** <BB_9460> **SMILES:** CN1Cc2cc(Br)ccc2C1=O **Molecular Formula:** C9H8BrNO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9461>.
CC(O)c1cccnc1
What is the building block token for the following molecule?
CC(O)c1cccnc1
<BB_9461>
What is the molecular formula for <BB_9461>?
The molecular formula for <BB_9461> (CC(O)c1cccnc1) is C7H9NO.
Describe the ring structures in building block <BB_9461>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9461>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_9461>.
**Token:** <BB_9461> **SMILES:** CC(O)c1cccnc1 **Molecular Formula:** C7H9NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_9462>.
CC(C)(C)c1ccccc1O
What is the building block token for the following molecule?
CC(C)(C)c1ccccc1O
<BB_9462>
What is the molecular formula for <BB_9462>?
The molecular formula for <BB_9462> (CC(C)(C)c1ccccc1O) is C10H14O.
Describe the ring structures in building block <BB_9462>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9462>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_9462>.
**Token:** <BB_9462> **SMILES:** CC(C)(C)c1ccccc1O **Molecular Formula:** C10H14O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_9463>.
O=S(=O)(Cl)CCCC(F)F
What is the building block token for the following molecule?
O=S(=O)(Cl)CCCC(F)F
<BB_9463>
What is the molecular formula for <BB_9463>?
The molecular formula for <BB_9463> (O=S(=O)(Cl)CCCC(F)F) is C4H7ClF2O2S.
Describe the ring structures in building block <BB_9463>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9463>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9463>.
**Token:** <BB_9463> **SMILES:** O=S(=O)(Cl)CCCC(F)F **Molecular Formula:** C4H7ClF2O2S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9464>.
Cl.Cl.NCC1CCN(c2ncnc3[nH]ccc23)CC1
What is the building block token for the following molecule?
Cl.Cl.NCC1CCN(c2ncnc3[nH]ccc23)CC1
<BB_9464>
What is the molecular formula for <BB_9464>?
The molecular formula for <BB_9464> (Cl.Cl.NCC1CCN(c2ncnc3[nH]ccc23)CC1) is C12H19Cl2N5.
Describe the ring structures in building block <BB_9464>.
The molecule contains 3 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9464>.
The molecule contains the following groups: Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9464>.
**Token:** <BB_9464> **SMILES:** Cl.Cl.NCC1CCN(c2ncnc3[nH]ccc23)CC1 **Molecular Formula:** C12H19Cl2N5 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9465>.
Cc1cc(Br)ccc1[C@@H](C)N.Cl
What is the building block token for the following molecule?
Cc1cc(Br)ccc1[C@@H](C)N.Cl
<BB_9465>
What is the molecular formula for <BB_9465>?
The molecular formula for <BB_9465> (Cc1cc(Br)ccc1[C@@H](C)N.Cl) is C9H13BrClN.
Describe the ring structures in building block <BB_9465>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9465>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9465>.
**Token:** <BB_9465> **SMILES:** Cc1cc(Br)ccc1[C@@H](C)N.Cl **Molecular Formula:** C9H13BrClN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9466>.
CC(C)(C)OC(=O)N1CCN(S(C)(=N)=O)CC1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCN(S(C)(=N)=O)CC1
<BB_9466>
What is the molecular formula for <BB_9466>?
The molecular formula for <BB_9466> (CC(C)(C)OC(=O)N1CCN(S(C)(=N)=O)CC1) is C10H21N3O3S.
Describe the ring structures in building block <BB_9466>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.