instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_983>?
The molecular formula for <BB_983> (Cc1cc(C)c(CC=O)c(C)c1) is C11H14O.
Describe the ring structures in building block <BB_983>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_983>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_983>.
**Token:** <BB_983> **SMILES:** Cc1cc(C)c(CC=O)c(C)c1 **Molecular Formula:** C11H14O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_984>.
BrCCCCCCCCCC1CC1
What is the building block token for the following molecule?
BrCCCCCCCCCC1CC1
<BB_984>
What is the molecular formula for <BB_984>?
The molecular formula for <BB_984> (BrCCCCCCCCCC1CC1) is C12H23Br.
Describe the ring structures in building block <BB_984>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_984>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_984>.
**Token:** <BB_984> **SMILES:** BrCCCCCCCCCC1CC1 **Molecular Formula:** C12H23Br **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_985>.
COC(=O)C1CC2(CC(=O)N2)C1
What is the building block token for the following molecule?
COC(=O)C1CC2(CC(=O)N2)C1
<BB_985>
What is the molecular formula for <BB_985>?
The molecular formula for <BB_985> (COC(=O)C1CC2(CC(=O)N2)C1) is C8H11NO3.
Describe the ring structures in building block <BB_985>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4.
List the primary functional groups present in <BB_985>.
The molecule contains the following groups: Amide, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_985>.
**Token:** <BB_985> **SMILES:** COC(=O)C1CC2(CC(=O)N2)C1 **Molecular Formula:** C8H11NO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4. **Functional Groups:** Amide, Ester, Ether
Provide the SMILES representation for the building block token <BB_986>.
CCOC=C1C(=O)NC(=O)c2ccccc21
What is the building block token for the following molecule?
CCOC=C1C(=O)NC(=O)c2ccccc21
<BB_986>
What is the molecular formula for <BB_986>?
The molecular formula for <BB_986> (CCOC=C1C(=O)NC(=O)c2ccccc21) is C12H11NO3.
Describe the ring structures in building block <BB_986>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_986>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_986>.
**Token:** <BB_986> **SMILES:** CCOC=C1C(=O)NC(=O)c2ccccc21 **Molecular Formula:** C12H11NO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amide, Ether
Provide the SMILES representation for the building block token <BB_987>.
CNCc1ncco1.Cl
What is the building block token for the following molecule?
CNCc1ncco1.Cl
<BB_987>
What is the molecular formula for <BB_987>?
The molecular formula for <BB_987> (CNCc1ncco1.Cl) is C5H9ClN2O.
Describe the ring structures in building block <BB_987>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_987>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_987>.
**Token:** <BB_987> **SMILES:** CNCc1ncco1.Cl **Molecular Formula:** C5H9ClN2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_988>.
CC(C)(C)OC(=O)N(O)CC(=O)O
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N(O)CC(=O)O
<BB_988>
What is the molecular formula for <BB_988>?
The molecular formula for <BB_988> (CC(C)(C)OC(=O)N(O)CC(=O)O) is C7H13NO5.
Describe the ring structures in building block <BB_988>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_988>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_988>.
**Token:** <BB_988> **SMILES:** CC(C)(C)OC(=O)N(O)CC(=O)O **Molecular Formula:** C7H13NO5 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_989>.
CSc1ccnc(C(=N)N)c1.Cl
What is the building block token for the following molecule?
CSc1ccnc(C(=N)N)c1.Cl
<BB_989>
What is the molecular formula for <BB_989>?
The molecular formula for <BB_989> (CSc1ccnc(C(=N)N)c1.Cl) is C7H10ClN3S.
Describe the ring structures in building block <BB_989>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_989>.
The molecule contains the following groups: Amine, Sulfide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_989>.
**Token:** <BB_989> **SMILES:** CSc1ccnc(C(=N)N)c1.Cl **Molecular Formula:** C7H10ClN3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Sulfide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_990>.
O=C(O)CC1(c2ccon2)CS(=O)(=O)C1
What is the building block token for the following molecule?
O=C(O)CC1(c2ccon2)CS(=O)(=O)C1
<BB_990>
What is the molecular formula for <BB_990>?
The molecular formula for <BB_990> (O=C(O)CC1(c2ccon2)CS(=O)(=O)C1) is C8H9NO5S.
Describe the ring structures in building block <BB_990>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 4.
List the primary functional groups present in <BB_990>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_990>.
**Token:** <BB_990> **SMILES:** O=C(O)CC1(c2ccon2)CS(=O)(=O)C1 **Molecular Formula:** C8H9NO5S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_991>.
Cc1nc(CCl)oc1-c1ccc(Cl)cc1
What is the building block token for the following molecule?
Cc1nc(CCl)oc1-c1ccc(Cl)cc1
<BB_991>
What is the molecular formula for <BB_991>?
The molecular formula for <BB_991> (Cc1nc(CCl)oc1-c1ccc(Cl)cc1) is C11H9Cl2NO.
Describe the ring structures in building block <BB_991>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_991>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_991>.
**Token:** <BB_991> **SMILES:** Cc1nc(CCl)oc1-c1ccc(Cl)cc1 **Molecular Formula:** C11H9Cl2NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_992>.
Cn1cc(CCCl)nn1
What is the building block token for the following molecule?
Cn1cc(CCCl)nn1
<BB_992>
What is the molecular formula for <BB_992>?
The molecular formula for <BB_992> (Cn1cc(CCCl)nn1) is C5H8ClN3.
Describe the ring structures in building block <BB_992>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_992>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_992>.
**Token:** <BB_992> **SMILES:** Cn1cc(CCCl)nn1 **Molecular Formula:** C5H8ClN3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_993>.
FC(F)(F)c1cccc(Br)c1CBr
What is the building block token for the following molecule?
FC(F)(F)c1cccc(Br)c1CBr
<BB_993>
What is the molecular formula for <BB_993>?
The molecular formula for <BB_993> (FC(F)(F)c1cccc(Br)c1CBr) is C8H5Br2F3.
Describe the ring structures in building block <BB_993>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_993>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_993>.
**Token:** <BB_993> **SMILES:** FC(F)(F)c1cccc(Br)c1CBr **Molecular Formula:** C8H5Br2F3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_994>.
NC(c1ccccc1)c1ccc(Cl)cc1Cl
What is the building block token for the following molecule?
NC(c1ccccc1)c1ccc(Cl)cc1Cl
<BB_994>
What is the molecular formula for <BB_994>?
The molecular formula for <BB_994> (NC(c1ccccc1)c1ccc(Cl)cc1Cl) is C13H11Cl2N.
Describe the ring structures in building block <BB_994>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_994>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_994>.
**Token:** <BB_994> **SMILES:** NC(c1ccccc1)c1ccc(Cl)cc1Cl **Molecular Formula:** C13H11Cl2N **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_995>.
Clc1cc(Cl)n2ccnc2n1
What is the building block token for the following molecule?
Clc1cc(Cl)n2ccnc2n1
<BB_995>
What is the molecular formula for <BB_995>?
The molecular formula for <BB_995> (Clc1cc(Cl)n2ccnc2n1) is C6H3Cl2N3.
Describe the ring structures in building block <BB_995>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_995>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_995>.
**Token:** <BB_995> **SMILES:** Clc1cc(Cl)n2ccnc2n1 **Molecular Formula:** C6H3Cl2N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_996>.
CN(Cc1csc(N)n1)C(=O)OC(C)(C)C
What is the building block token for the following molecule?
CN(Cc1csc(N)n1)C(=O)OC(C)(C)C
<BB_996>
What is the molecular formula for <BB_996>?
The molecular formula for <BB_996> (CN(Cc1csc(N)n1)C(=O)OC(C)(C)C) is C10H17N3O2S.
Describe the ring structures in building block <BB_996>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_996>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_996>.
**Token:** <BB_996> **SMILES:** CN(Cc1csc(N)n1)C(=O)OC(C)(C)C **Molecular Formula:** C10H17N3O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_997>.
O=C(O)C12CCC(C(F)F)(CC1)CC2
What is the building block token for the following molecule?
O=C(O)C12CCC(C(F)F)(CC1)CC2
<BB_997>
What is the molecular formula for <BB_997>?
The molecular formula for <BB_997> (O=C(O)C12CCC(C(F)F)(CC1)CC2) is C10H14F2O2.
Describe the ring structures in building block <BB_997>.
The molecule contains 3 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_997>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_997>.
**Token:** <BB_997> **SMILES:** O=C(O)C12CCC(C(F)F)(CC1)CC2 **Molecular Formula:** C10H14F2O2 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_998>.
Cc1cc(C)n(CCCC(=O)O)n1
What is the building block token for the following molecule?
Cc1cc(C)n(CCCC(=O)O)n1
<BB_998>
What is the molecular formula for <BB_998>?
The molecular formula for <BB_998> (Cc1cc(C)n(CCCC(=O)O)n1) is C9H14N2O2.
Describe the ring structures in building block <BB_998>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_998>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_998>.
**Token:** <BB_998> **SMILES:** Cc1cc(C)n(CCCC(=O)O)n1 **Molecular Formula:** C9H14N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_999>.
COC(=O)C1(c2ccc(F)cc2)CCNC1.Cl
What is the building block token for the following molecule?
COC(=O)C1(c2ccc(F)cc2)CCNC1.Cl
<BB_999>
What is the molecular formula for <BB_999>?
The molecular formula for <BB_999> (COC(=O)C1(c2ccc(F)cc2)CCNC1.Cl) is C12H15ClFNO2.
Describe the ring structures in building block <BB_999>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_999>.
The molecule contains the following groups: Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_999>.
**Token:** <BB_999> **SMILES:** COC(=O)C1(c2ccc(F)cc2)CCNC1.Cl **Molecular Formula:** C12H15ClFNO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I)