instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_9616>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9616>.
**Token:** <BB_9616> **SMILES:** O=C1CCCC(CBr)C1 **Molecular Formula:** C7H11BrO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9617>.
Cl.NCc1ncsn1
What is the building block token for the following molecule?
Cl.NCc1ncsn1
<BB_9617>
What is the molecular formula for <BB_9617>?
The molecular formula for <BB_9617> (Cl.NCc1ncsn1) is C3H6ClN3S.
Describe the ring structures in building block <BB_9617>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9617>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9617>.
**Token:** <BB_9617> **SMILES:** Cl.NCc1ncsn1 **Molecular Formula:** C3H6ClN3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9618>.
Cn1nccc1[C@H]1[C@H](N)CCC(=O)N1C1CC1
What is the building block token for the following molecule?
Cn1nccc1[C@H]1[C@H](N)CCC(=O)N1C1CC1
<BB_9618>
What is the molecular formula for <BB_9618>?
The molecular formula for <BB_9618> (Cn1nccc1[C@H]1[C@H](N)CCC(=O)N1C1CC1) is C12H18N4O.
Describe the ring structures in building block <BB_9618>.
The molecule contains 3 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_9618>.
The molecule contains the following groups: Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_9618>.
**Token:** <BB_9618> **SMILES:** Cn1nccc1[C@H]1[C@H](N)CCC(=O)N1C1CC1 **Molecular Formula:** C12H18N4O **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Amine, Amide
Provide the SMILES representation for the building block token <BB_9619>.
O=c1cc(N2CCN(CCO)CC2)nc[nH]1
What is the building block token for the following molecule?
O=c1cc(N2CCN(CCO)CC2)nc[nH]1
<BB_9619>
What is the molecular formula for <BB_9619>?
The molecular formula for <BB_9619> (O=c1cc(N2CCN(CCO)CC2)nc[nH]1) is C10H16N4O2.
Describe the ring structures in building block <BB_9619>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9619>.
The molecule contains the following groups: Tertiary Amine, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_9619>.
**Token:** <BB_9619> **SMILES:** O=c1cc(N2CCN(CCO)CC2)nc[nH]1 **Molecular Formula:** C10H16N4O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine, Alcohol
Provide the SMILES representation for the building block token <BB_9620>.
Clc1cc2c(nn1)-c1cc(Br)ccc1C2
What is the building block token for the following molecule?
Clc1cc2c(nn1)-c1cc(Br)ccc1C2
<BB_9620>
What is the molecular formula for <BB_9620>?
The molecular formula for <BB_9620> (Clc1cc2c(nn1)-c1cc(Br)ccc1C2) is C11H6BrClN2.
Describe the ring structures in building block <BB_9620>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9620>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9620>.
**Token:** <BB_9620> **SMILES:** Clc1cc2c(nn1)-c1cc(Br)ccc1C2 **Molecular Formula:** C11H6BrClN2 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9621>.
CN1CCC(O)(C(=O)O)CC1.Cl
What is the building block token for the following molecule?
CN1CCC(O)(C(=O)O)CC1.Cl
<BB_9621>
What is the molecular formula for <BB_9621>?
The molecular formula for <BB_9621> (CN1CCC(O)(C(=O)O)CC1.Cl) is C7H14ClNO3.
Describe the ring structures in building block <BB_9621>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9621>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9621>.
**Token:** <BB_9621> **SMILES:** CN1CCC(O)(C(=O)O)CC1.Cl **Molecular Formula:** C7H14ClNO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Tertiary Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9622>.
NNC(=O)Cn1nc(C(F)F)cc1C(F)F
What is the building block token for the following molecule?
NNC(=O)Cn1nc(C(F)F)cc1C(F)F
<BB_9622>
What is the molecular formula for <BB_9622>?
The molecular formula for <BB_9622> (NNC(=O)Cn1nc(C(F)F)cc1C(F)F) is C7H8F4N4O.
Describe the ring structures in building block <BB_9622>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9622>.
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9622>.
**Token:** <BB_9622> **SMILES:** NNC(=O)Cn1nc(C(F)F)cc1C(F)F **Molecular Formula:** C7H8F4N4O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9623>.
CCC(C)(COC)C(=O)O
What is the building block token for the following molecule?
CCC(C)(COC)C(=O)O
<BB_9623>
What is the molecular formula for <BB_9623>?
The molecular formula for <BB_9623> (CCC(C)(COC)C(=O)O) is C7H14O3.
Describe the ring structures in building block <BB_9623>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9623>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_9623>.
**Token:** <BB_9623> **SMILES:** CCC(C)(COC)C(=O)O **Molecular Formula:** C7H14O3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_9624>.
Cc1cc(C(=O)O)nc(N2CCCCC2)n1
What is the building block token for the following molecule?
Cc1cc(C(=O)O)nc(N2CCCCC2)n1
<BB_9624>
What is the molecular formula for <BB_9624>?
The molecular formula for <BB_9624> (Cc1cc(C(=O)O)nc(N2CCCCC2)n1) is C11H15N3O2.
Describe the ring structures in building block <BB_9624>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9624>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_9624>.
**Token:** <BB_9624> **SMILES:** Cc1cc(C(=O)O)nc(N2CCCCC2)n1 **Molecular Formula:** C11H15N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Tertiary Amine
Provide the SMILES representation for the building block token <BB_9625>.
OCc1noc2c1CC(F)(F)CC2
What is the building block token for the following molecule?
OCc1noc2c1CC(F)(F)CC2
<BB_9625>
What is the molecular formula for <BB_9625>?
The molecular formula for <BB_9625> (OCc1noc2c1CC(F)(F)CC2) is C8H9F2NO2.
Describe the ring structures in building block <BB_9625>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9625>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9625>.
**Token:** <BB_9625> **SMILES:** OCc1noc2c1CC(F)(F)CC2 **Molecular Formula:** C8H9F2NO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9626>.
O=C1CCC2CN(Cc3ccccc3)CC2C1
What is the building block token for the following molecule?
O=C1CCC2CN(Cc3ccccc3)CC2C1
<BB_9626>
What is the molecular formula for <BB_9626>?
The molecular formula for <BB_9626> (O=C1CCC2CN(Cc3ccccc3)CC2C1) is C15H19NO.
Describe the ring structures in building block <BB_9626>.
The molecule contains 3 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9626>.
The molecule contains the following groups: Tertiary Amine, Ketone.
Provide a comprehensive chemical profile for the building block <BB_9626>.
**Token:** <BB_9626> **SMILES:** O=C1CCC2CN(Cc3ccccc3)CC2C1 **Molecular Formula:** C15H19NO **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Ketone
Provide the SMILES representation for the building block token <BB_9627>.
C#CCS(=O)(=O)[O-].[Na+]
What is the building block token for the following molecule?
C#CCS(=O)(=O)[O-].[Na+]
<BB_9627>
What is the molecular formula for <BB_9627>?
The molecular formula for <BB_9627> (C#CCS(=O)(=O)[O-].[Na+]) is C3H3NaO3S.
Describe the ring structures in building block <BB_9627>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9627>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_9627>.
**Token:** <BB_9627> **SMILES:** C#CCS(=O)(=O)[O-].[Na+] **Molecular Formula:** C3H3NaO3S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_9628>.
COC(=O)c1ccc2[nH]cc(I)c2c1
What is the building block token for the following molecule?
COC(=O)c1ccc2[nH]cc(I)c2c1
<BB_9628>
What is the molecular formula for <BB_9628>?
The molecular formula for <BB_9628> (COC(=O)c1ccc2[nH]cc(I)c2c1) is C10H8INO2.
Describe the ring structures in building block <BB_9628>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9628>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9628>.
**Token:** <BB_9628> **SMILES:** COC(=O)c1ccc2[nH]cc(I)c2c1 **Molecular Formula:** C10H8INO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9629>.
COCn1ccc(C(=O)O)n1
What is the building block token for the following molecule?
COCn1ccc(C(=O)O)n1
<BB_9629>
What is the molecular formula for <BB_9629>?
The molecular formula for <BB_9629> (COCn1ccc(C(=O)O)n1) is C6H8N2O3.
Describe the ring structures in building block <BB_9629>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9629>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_9629>.
**Token:** <BB_9629> **SMILES:** COCn1ccc(C(=O)O)n1 **Molecular Formula:** C6H8N2O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_9630>.
Cl.Cl.NCCc1c[nH]c2ccncc12
What is the building block token for the following molecule?
Cl.Cl.NCCc1c[nH]c2ccncc12
<BB_9630>
What is the molecular formula for <BB_9630>?
The molecular formula for <BB_9630> (Cl.Cl.NCCc1c[nH]c2ccncc12) is C9H13Cl2N3.
Describe the ring structures in building block <BB_9630>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9630>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9630>.
**Token:** <BB_9630> **SMILES:** Cl.Cl.NCCc1c[nH]c2ccncc12 **Molecular Formula:** C9H13Cl2N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9631>.
CCCCN(C)C[C@@H](C)N
What is the building block token for the following molecule?
CCCCN(C)C[C@@H](C)N
<BB_9631>
What is the molecular formula for <BB_9631>?
The molecular formula for <BB_9631> (CCCCN(C)C[C@@H](C)N) is C8H20N2.
Describe the ring structures in building block <BB_9631>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9631>.
The molecule contains the following groups: Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_9631>.
**Token:** <BB_9631> **SMILES:** CCCCN(C)C[C@@H](C)N **Molecular Formula:** C8H20N2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_9632>.
O=C1NC2(C(=O)O)CC3CC1C2C3
What is the building block token for the following molecule?
O=C1NC2(C(=O)O)CC3CC1C2C3
<BB_9632>
What is the molecular formula for <BB_9632>?
The molecular formula for <BB_9632> (O=C1NC2(C(=O)O)CC3CC1C2C3) is C9H11NO3.
Describe the ring structures in building block <BB_9632>.
The molecule contains 3 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9632>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_9632>.
**Token:** <BB_9632> **SMILES:** O=C1NC2(C(=O)O)CC3CC1C2C3 **Molecular Formula:** C9H11NO3 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_9633>.
CS(=O)(=NC(N)=S)c1cccc(Br)c1
What is the building block token for the following molecule?
CS(=O)(=NC(N)=S)c1cccc(Br)c1
<BB_9633>