instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_9633>?
The molecular formula for <BB_9633> (CS(=O)(=NC(N)=S)c1cccc(Br)c1) is C8H9BrN2OS2.
Describe the ring structures in building block <BB_9633>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9633>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9633>.
**Token:** <BB_9633> **SMILES:** CS(=O)(=NC(N)=S)c1cccc(Br)c1 **Molecular Formula:** C8H9BrN2OS2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9634>.
Fc1cc(Br)ccc1OC(F)F
What is the building block token for the following molecule?
Fc1cc(Br)ccc1OC(F)F
<BB_9634>
What is the molecular formula for <BB_9634>?
The molecular formula for <BB_9634> (Fc1cc(Br)ccc1OC(F)F) is C7H4BrF3O.
Describe the ring structures in building block <BB_9634>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9634>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9634>.
**Token:** <BB_9634> **SMILES:** Fc1cc(Br)ccc1OC(F)F **Molecular Formula:** C7H4BrF3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9635>.
N#CCC(=O)CC1CC1
What is the building block token for the following molecule?
N#CCC(=O)CC1CC1
<BB_9635>
What is the molecular formula for <BB_9635>?
The molecular formula for <BB_9635> (N#CCC(=O)CC1CC1) is C7H9NO.
Describe the ring structures in building block <BB_9635>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_9635>.
The molecule contains the following groups: Ketone, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9635>.
**Token:** <BB_9635> **SMILES:** N#CCC(=O)CC1CC1 **Molecular Formula:** C7H9NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Ketone, Nitrile
Provide the SMILES representation for the building block token <BB_9636>.
COC(=O)C1(C(=O)O)C=CCC1
What is the building block token for the following molecule?
COC(=O)C1(C(=O)O)C=CCC1
<BB_9636>
What is the molecular formula for <BB_9636>?
The molecular formula for <BB_9636> (COC(=O)C1(C(=O)O)C=CCC1) is C8H10O4.
Describe the ring structures in building block <BB_9636>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_9636>.
The molecule contains the following groups: Carboxylic Acid, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_9636>.
**Token:** <BB_9636> **SMILES:** COC(=O)C1(C(=O)O)C=CCC1 **Molecular Formula:** C8H10O4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Ester, Ether
Provide the SMILES representation for the building block token <BB_9637>.
O=c1nc(NCc2ccco2)cc[nH]1
What is the building block token for the following molecule?
O=c1nc(NCc2ccco2)cc[nH]1
<BB_9637>
What is the molecular formula for <BB_9637>?
The molecular formula for <BB_9637> (O=c1nc(NCc2ccco2)cc[nH]1) is C9H9N3O2.
Describe the ring structures in building block <BB_9637>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9637>.
The molecule contains the following groups: Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_9637>.
**Token:** <BB_9637> **SMILES:** O=c1nc(NCc2ccco2)cc[nH]1 **Molecular Formula:** C9H9N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Secondary Amine
Provide the SMILES representation for the building block token <BB_9638>.
CN(C)CCCNC(=O)C1CCNCC1
What is the building block token for the following molecule?
CN(C)CCCNC(=O)C1CCNCC1
<BB_9638>
What is the molecular formula for <BB_9638>?
The molecular formula for <BB_9638> (CN(C)CCCNC(=O)C1CCNCC1) is C11H23N3O.
Describe the ring structures in building block <BB_9638>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9638>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_9638>.
**Token:** <BB_9638> **SMILES:** CN(C)CCCNC(=O)C1CCNCC1 **Molecular Formula:** C11H23N3O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Amide
Provide the SMILES representation for the building block token <BB_9639>.
Cc1cccc(C2(N)CCC2)c1.Cl
What is the building block token for the following molecule?
Cc1cccc(C2(N)CCC2)c1.Cl
<BB_9639>
What is the molecular formula for <BB_9639>?
The molecular formula for <BB_9639> (Cc1cccc(C2(N)CCC2)c1.Cl) is C11H16ClN.
Describe the ring structures in building block <BB_9639>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_9639>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9639>.
**Token:** <BB_9639> **SMILES:** Cc1cccc(C2(N)CCC2)c1.Cl **Molecular Formula:** C11H16ClN **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9640>.
CN1CCC2CCCNC2C1.Cl.Cl
What is the building block token for the following molecule?
CN1CCC2CCCNC2C1.Cl.Cl
<BB_9640>
What is the molecular formula for <BB_9640>?
The molecular formula for <BB_9640> (CN1CCC2CCCNC2C1.Cl.Cl) is C9H20Cl2N2.
Describe the ring structures in building block <BB_9640>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9640>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9640>.
**Token:** <BB_9640> **SMILES:** CN1CCC2CCCNC2C1.Cl.Cl **Molecular Formula:** C9H20Cl2N2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9641>.
C[Si](C)(C)CCOCn1ncc(F)c1CN
What is the building block token for the following molecule?
C[Si](C)(C)CCOCn1ncc(F)c1CN
<BB_9641>
What is the molecular formula for <BB_9641>?
The molecular formula for <BB_9641> (C[Si](C)(C)CCOCn1ncc(F)c1CN) is C10H20FN3OSi.
Describe the ring structures in building block <BB_9641>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9641>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9641>.
**Token:** <BB_9641> **SMILES:** C[Si](C)(C)CCOCn1ncc(F)c1CN **Molecular Formula:** C10H20FN3OSi **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9642>.
O=C=NCCc1ccc(Cl)c(Cl)c1
What is the building block token for the following molecule?
O=C=NCCc1ccc(Cl)c(Cl)c1
<BB_9642>
What is the molecular formula for <BB_9642>?
The molecular formula for <BB_9642> (O=C=NCCc1ccc(Cl)c(Cl)c1) is C9H7Cl2NO.
Describe the ring structures in building block <BB_9642>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9642>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9642>.
**Token:** <BB_9642> **SMILES:** O=C=NCCc1ccc(Cl)c(Cl)c1 **Molecular Formula:** C9H7Cl2NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9643>.
CC(C)CCCC1(C)CO1
What is the building block token for the following molecule?
CC(C)CCCC1(C)CO1
<BB_9643>
What is the molecular formula for <BB_9643>?
The molecular formula for <BB_9643> (CC(C)CCCC1(C)CO1) is C9H18O.
Describe the ring structures in building block <BB_9643>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_9643>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_9643>.
**Token:** <BB_9643> **SMILES:** CC(C)CCCC1(C)CO1 **Molecular Formula:** C9H18O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_9644>.
COC(=O)c1nc(C)ccc1N
What is the building block token for the following molecule?
COC(=O)c1nc(C)ccc1N
<BB_9644>
What is the molecular formula for <BB_9644>?
The molecular formula for <BB_9644> (COC(=O)c1nc(C)ccc1N) is C8H10N2O2.
Describe the ring structures in building block <BB_9644>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9644>.
The molecule contains the following groups: Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_9644>.
**Token:** <BB_9644> **SMILES:** COC(=O)c1nc(C)ccc1N **Molecular Formula:** C8H10N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_9645>.
FC(F)(F)Oc1ccc(Cl)c(CCl)c1
What is the building block token for the following molecule?
FC(F)(F)Oc1ccc(Cl)c(CCl)c1
<BB_9645>
What is the molecular formula for <BB_9645>?
The molecular formula for <BB_9645> (FC(F)(F)Oc1ccc(Cl)c(CCl)c1) is C8H5Cl2F3O.
Describe the ring structures in building block <BB_9645>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9645>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9645>.
**Token:** <BB_9645> **SMILES:** FC(F)(F)Oc1ccc(Cl)c(CCl)c1 **Molecular Formula:** C8H5Cl2F3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9646>.
CCCCc1nc2ccccc2n1CC(=O)[O-].[K+]
What is the building block token for the following molecule?
CCCCc1nc2ccccc2n1CC(=O)[O-].[K+]
<BB_9646>
What is the molecular formula for <BB_9646>?
The molecular formula for <BB_9646> (CCCCc1nc2ccccc2n1CC(=O)[O-].[K+]) is C13H15KN2O2.
Describe the ring structures in building block <BB_9646>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9646>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_9646>.
**Token:** <BB_9646> **SMILES:** CCCCc1nc2ccccc2n1CC(=O)[O-].[K+] **Molecular Formula:** C13H15KN2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_9647>.
Cl.Nc1ncccc1C(F)C(F)(F)F
What is the building block token for the following molecule?
Cl.Nc1ncccc1C(F)C(F)(F)F
<BB_9647>
What is the molecular formula for <BB_9647>?
The molecular formula for <BB_9647> (Cl.Nc1ncccc1C(F)C(F)(F)F) is C7H7ClF4N2.
Describe the ring structures in building block <BB_9647>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9647>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9647>.
**Token:** <BB_9647> **SMILES:** Cl.Nc1ncccc1C(F)C(F)(F)F **Molecular Formula:** C7H7ClF4N2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9648>.
Cn1cnnc1Br
What is the building block token for the following molecule?
Cn1cnnc1Br
<BB_9648>
What is the molecular formula for <BB_9648>?
The molecular formula for <BB_9648> (Cn1cnnc1Br) is C3H4BrN3.
Describe the ring structures in building block <BB_9648>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9648>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9648>.
**Token:** <BB_9648> **SMILES:** Cn1cnnc1Br **Molecular Formula:** C3H4BrN3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9649>.
Cc1ccc(OC2CCCC2)c(B(O)O)c1
What is the building block token for the following molecule?
Cc1ccc(OC2CCCC2)c(B(O)O)c1
<BB_9649>
What is the molecular formula for <BB_9649>?
The molecular formula for <BB_9649> (Cc1ccc(OC2CCCC2)c(B(O)O)c1) is C12H17BO3.
Describe the ring structures in building block <BB_9649>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9649>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_9649>.
**Token:** <BB_9649> **SMILES:** Cc1ccc(OC2CCCC2)c(B(O)O)c1 **Molecular Formula:** C12H17BO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Ether