instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_9650>.
CCSC(C)C(=N)N.Cl
What is the building block token for the following molecule?
CCSC(C)C(=N)N.Cl
<BB_9650>
What is the molecular formula for <BB_9650>?
The molecular formula for <BB_9650> (CCSC(C)C(=N)N.Cl) is C5H13ClN2S.
Describe the ring structures in building block <BB_9650>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9650>.
The molecule contains the following groups: Amine, Sulfide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9650>.
**Token:** <BB_9650> **SMILES:** CCSC(C)C(=N)N.Cl **Molecular Formula:** C5H13ClN2S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Sulfide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9651>.
CNC(=O)c1cnc(Cl)cn1
What is the building block token for the following molecule?
CNC(=O)c1cnc(Cl)cn1
<BB_9651>
What is the molecular formula for <BB_9651>?
The molecular formula for <BB_9651> (CNC(=O)c1cnc(Cl)cn1) is C6H6ClN3O.
Describe the ring structures in building block <BB_9651>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9651>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9651>.
**Token:** <BB_9651> **SMILES:** CNC(=O)c1cnc(Cl)cn1 **Molecular Formula:** C6H6ClN3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9652>.
CC1NN=C(c2ccccn2)NC1=O
What is the building block token for the following molecule?
CC1NN=C(c2ccccn2)NC1=O
<BB_9652>
What is the molecular formula for <BB_9652>?
The molecular formula for <BB_9652> (CC1NN=C(c2ccccn2)NC1=O) is C9H10N4O.
Describe the ring structures in building block <BB_9652>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9652>.
The molecule contains the following groups: Secondary Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_9652>.
**Token:** <BB_9652> **SMILES:** CC1NN=C(c2ccccn2)NC1=O **Molecular Formula:** C9H10N4O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Amide
Provide the SMILES representation for the building block token <BB_9653>.
COC1CCC(C(F)C(=O)O)CC1
What is the building block token for the following molecule?
COC1CCC(C(F)C(=O)O)CC1
<BB_9653>
What is the molecular formula for <BB_9653>?
The molecular formula for <BB_9653> (COC1CCC(C(F)C(=O)O)CC1) is C9H15FO3.
Describe the ring structures in building block <BB_9653>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9653>.
The molecule contains the following groups: Carboxylic Acid, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9653>.
**Token:** <BB_9653> **SMILES:** COC1CCC(C(F)C(=O)O)CC1 **Molecular Formula:** C9H15FO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9654>.
O=Cc1cccc(CCC(=O)O)c1
What is the building block token for the following molecule?
O=Cc1cccc(CCC(=O)O)c1
<BB_9654>
What is the molecular formula for <BB_9654>?
The molecular formula for <BB_9654> (O=Cc1cccc(CCC(=O)O)c1) is C10H10O3.
Describe the ring structures in building block <BB_9654>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9654>.
The molecule contains the following groups: Carboxylic Acid, Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_9654>.
**Token:** <BB_9654> **SMILES:** O=Cc1cccc(CCC(=O)O)c1 **Molecular Formula:** C10H10O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Aldehyde
Provide the SMILES representation for the building block token <BB_9655>.
Cc1cccc(CC(CN)CO)c1.Cl
What is the building block token for the following molecule?
Cc1cccc(CC(CN)CO)c1.Cl
<BB_9655>
What is the molecular formula for <BB_9655>?
The molecular formula for <BB_9655> (Cc1cccc(CC(CN)CO)c1.Cl) is C11H18ClNO.
Describe the ring structures in building block <BB_9655>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9655>.
The molecule contains the following groups: Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9655>.
**Token:** <BB_9655> **SMILES:** Cc1cccc(CC(CN)CO)c1.Cl **Molecular Formula:** C11H18ClNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9656>.
O=C1Cc2ccccc2C1
What is the building block token for the following molecule?
O=C1Cc2ccccc2C1
<BB_9656>
What is the molecular formula for <BB_9656>?
The molecular formula for <BB_9656> (O=C1Cc2ccccc2C1) is C9H8O.
Describe the ring structures in building block <BB_9656>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9656>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_9656>.
**Token:** <BB_9656> **SMILES:** O=C1Cc2ccccc2C1 **Molecular Formula:** C9H8O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_9657>.
CCC(=O)c1cccc(C#N)c1O
What is the building block token for the following molecule?
CCC(=O)c1cccc(C#N)c1O
<BB_9657>
What is the molecular formula for <BB_9657>?
The molecular formula for <BB_9657> (CCC(=O)c1cccc(C#N)c1O) is C10H9NO2.
Describe the ring structures in building block <BB_9657>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9657>.
The molecule contains the following groups: Ketone, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9657>.
**Token:** <BB_9657> **SMILES:** CCC(=O)c1cccc(C#N)c1O **Molecular Formula:** C10H9NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Nitrile
Provide the SMILES representation for the building block token <BB_9658>.
Cc1ccccc1CC(C)NC(=O)CCl
What is the building block token for the following molecule?
Cc1ccccc1CC(C)NC(=O)CCl
<BB_9658>
What is the molecular formula for <BB_9658>?
The molecular formula for <BB_9658> (Cc1ccccc1CC(C)NC(=O)CCl) is C12H16ClNO.
Describe the ring structures in building block <BB_9658>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9658>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9658>.
**Token:** <BB_9658> **SMILES:** Cc1ccccc1CC(C)NC(=O)CCl **Molecular Formula:** C12H16ClNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9659>.
Cl.Cl.NNC1CCNCC1
What is the building block token for the following molecule?
Cl.Cl.NNC1CCNCC1
<BB_9659>
What is the molecular formula for <BB_9659>?
The molecular formula for <BB_9659> (Cl.Cl.NNC1CCNCC1) is C5H15Cl2N3.
Describe the ring structures in building block <BB_9659>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9659>.
The molecule contains the following groups: Amine, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9659>.
**Token:** <BB_9659> **SMILES:** Cl.Cl.NNC1CCNCC1 **Molecular Formula:** C5H15Cl2N3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9660>.
COc1cc(C(O)S(=O)(=O)[O-])sn1.[Na+]
What is the building block token for the following molecule?
COc1cc(C(O)S(=O)(=O)[O-])sn1.[Na+]
<BB_9660>
What is the molecular formula for <BB_9660>?
The molecular formula for <BB_9660> (COc1cc(C(O)S(=O)(=O)[O-])sn1.[Na+]) is C5H6NNaO5S2.
Describe the ring structures in building block <BB_9660>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9660>.
The molecule contains the following groups: Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_9660>.
**Token:** <BB_9660> **SMILES:** COc1cc(C(O)S(=O)(=O)[O-])sn1.[Na+] **Molecular Formula:** C5H6NNaO5S2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Alcohol, Ether
Provide the SMILES representation for the building block token <BB_9661>.
CC(=O)NC1(C(=O)O)CCC1
What is the building block token for the following molecule?
CC(=O)NC1(C(=O)O)CCC1
<BB_9661>
What is the molecular formula for <BB_9661>?
The molecular formula for <BB_9661> (CC(=O)NC1(C(=O)O)CCC1) is C7H11NO3.
Describe the ring structures in building block <BB_9661>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_9661>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_9661>.
**Token:** <BB_9661> **SMILES:** CC(=O)NC1(C(=O)O)CCC1 **Molecular Formula:** C7H11NO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_9662>.
Cc1ccc(-c2csc(NN)n2)cc1
What is the building block token for the following molecule?
Cc1ccc(-c2csc(NN)n2)cc1
<BB_9662>
What is the molecular formula for <BB_9662>?
The molecular formula for <BB_9662> (Cc1ccc(-c2csc(NN)n2)cc1) is C10H11N3S.
Describe the ring structures in building block <BB_9662>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9662>.
The molecule contains the following groups: Amine, Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_9662>.
**Token:** <BB_9662> **SMILES:** Cc1ccc(-c2csc(NN)n2)cc1 **Molecular Formula:** C10H11N3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine, Secondary Amine
Provide the SMILES representation for the building block token <BB_9663>.
CC(C)CC(CO)CNC(=O)OC(C)(C)C
What is the building block token for the following molecule?
CC(C)CC(CO)CNC(=O)OC(C)(C)C
<BB_9663>
What is the molecular formula for <BB_9663>?
The molecular formula for <BB_9663> (CC(C)CC(CO)CNC(=O)OC(C)(C)C) is C12H25NO3.
Describe the ring structures in building block <BB_9663>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9663>.
The molecule contains the following groups: Amide, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_9663>.
**Token:** <BB_9663> **SMILES:** CC(C)CC(CO)CNC(=O)OC(C)(C)C **Molecular Formula:** C12H25NO3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amide, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_9664>.
Clc1nnc(-c2ccon2)s1
What is the building block token for the following molecule?
Clc1nnc(-c2ccon2)s1
<BB_9664>
What is the molecular formula for <BB_9664>?
The molecular formula for <BB_9664> (Clc1nnc(-c2ccon2)s1) is C5H2ClN3OS.
Describe the ring structures in building block <BB_9664>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_9664>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9664>.
**Token:** <BB_9664> **SMILES:** Clc1nnc(-c2ccon2)s1 **Molecular Formula:** C5H2ClN3OS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9665>.
COC(=O)CC1CN(C(=O)Cl)C1
What is the building block token for the following molecule?
COC(=O)CC1CN(C(=O)Cl)C1
<BB_9665>
What is the molecular formula for <BB_9665>?
The molecular formula for <BB_9665> (COC(=O)CC1CN(C(=O)Cl)C1) is C7H10ClNO3.
Describe the ring structures in building block <BB_9665>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_9665>.
The molecule contains the following groups: Amide, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9665>.
**Token:** <BB_9665> **SMILES:** COC(=O)CC1CN(C(=O)Cl)C1 **Molecular Formula:** C7H10ClNO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Amide, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9666>.
COC(=O)/C=C/[N+](=O)[O-]
What is the building block token for the following molecule?
COC(=O)/C=C/[N+](=O)[O-]
<BB_9666>
What is the molecular formula for <BB_9666>?
The molecular formula for <BB_9666> (COC(=O)/C=C/[N+](=O)[O-]) is C4H5NO4.
Describe the ring structures in building block <BB_9666>.
The molecule is acyclic (contains no rings).