instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_9666>.
The molecule contains the following groups: Tertiary Amine, Ester, Ether, Nitro.
Provide a comprehensive chemical profile for the building block <BB_9666>.
**Token:** <BB_9666> **SMILES:** COC(=O)/C=C/[N+](=O)[O-] **Molecular Formula:** C4H5NO4 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Tertiary Amine, Ester, Ether, Nitro
Provide the SMILES representation for the building block token <BB_9667>.
COC(=O)C1CC2C=CC1O2
What is the building block token for the following molecule?
COC(=O)C1CC2C=CC1O2
<BB_9667>
What is the molecular formula for <BB_9667>?
The molecular formula for <BB_9667> (COC(=O)C1CC2C=CC1O2) is C8H10O3.
Describe the ring structures in building block <BB_9667>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9667>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_9667>.
**Token:** <BB_9667> **SMILES:** COC(=O)C1CC2C=CC1O2 **Molecular Formula:** C8H10O3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_9668>.
CNC(C(=O)OC)C1CCOCC1.Cl
What is the building block token for the following molecule?
CNC(C(=O)OC)C1CCOCC1.Cl
<BB_9668>
What is the molecular formula for <BB_9668>?
The molecular formula for <BB_9668> (CNC(C(=O)OC)C1CCOCC1.Cl) is C9H18ClNO3.
Describe the ring structures in building block <BB_9668>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9668>.
The molecule contains the following groups: Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9668>.
**Token:** <BB_9668> **SMILES:** CNC(C(=O)OC)C1CCOCC1.Cl **Molecular Formula:** C9H18ClNO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9669>.
N#CC1(c2ccc(O)cc2)CCCCC1
What is the building block token for the following molecule?
N#CC1(c2ccc(O)cc2)CCCCC1
<BB_9669>
What is the molecular formula for <BB_9669>?
The molecular formula for <BB_9669> (N#CC1(c2ccc(O)cc2)CCCCC1) is C13H15NO.
Describe the ring structures in building block <BB_9669>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9669>.
The molecule contains the following groups: Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9669>.
**Token:** <BB_9669> **SMILES:** N#CC1(c2ccc(O)cc2)CCCCC1 **Molecular Formula:** C13H15NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Nitrile
Provide the SMILES representation for the building block token <BB_9670>.
CC(=O)c1cccc(NC(=O)N2CCOCC2)c1
What is the building block token for the following molecule?
CC(=O)c1cccc(NC(=O)N2CCOCC2)c1
<BB_9670>
What is the molecular formula for <BB_9670>?
The molecular formula for <BB_9670> (CC(=O)c1cccc(NC(=O)N2CCOCC2)c1) is C13H16N2O3.
Describe the ring structures in building block <BB_9670>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9670>.
The molecule contains the following groups: Amide, Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_9670>.
**Token:** <BB_9670> **SMILES:** CC(=O)c1cccc(NC(=O)N2CCOCC2)c1 **Molecular Formula:** C13H16N2O3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amide, Ketone, Ether
Provide the SMILES representation for the building block token <BB_9671>.
Cl.Cl.Fc1cccc(N2CCCNCC2)c1F
What is the building block token for the following molecule?
Cl.Cl.Fc1cccc(N2CCCNCC2)c1F
<BB_9671>
What is the molecular formula for <BB_9671>?
The molecular formula for <BB_9671> (Cl.Cl.Fc1cccc(N2CCCNCC2)c1F) is C11H16Cl2F2N2.
Describe the ring structures in building block <BB_9671>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 7.
List the primary functional groups present in <BB_9671>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9671>.
**Token:** <BB_9671> **SMILES:** Cl.Cl.Fc1cccc(N2CCCNCC2)c1F **Molecular Formula:** C11H16Cl2F2N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 7. **Functional Groups:** Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9672>.
COC(=O)C(N)C(C)C.Cl
What is the building block token for the following molecule?
COC(=O)C(N)C(C)C.Cl
<BB_9672>
What is the molecular formula for <BB_9672>?
The molecular formula for <BB_9672> (COC(=O)C(N)C(C)C.Cl) is C6H14ClNO2.
Describe the ring structures in building block <BB_9672>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9672>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9672>.
**Token:** <BB_9672> **SMILES:** COC(=O)C(N)C(C)C.Cl **Molecular Formula:** C6H14ClNO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9673>.
CC(C)n1cc(Br)c(C(=O)O)n1
What is the building block token for the following molecule?
CC(C)n1cc(Br)c(C(=O)O)n1
<BB_9673>
What is the molecular formula for <BB_9673>?
The molecular formula for <BB_9673> (CC(C)n1cc(Br)c(C(=O)O)n1) is C7H9BrN2O2.
Describe the ring structures in building block <BB_9673>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9673>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9673>.
**Token:** <BB_9673> **SMILES:** CC(C)n1cc(Br)c(C(=O)O)n1 **Molecular Formula:** C7H9BrN2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9674>.
CCOC1(C(=O)NN)CCOC1
What is the building block token for the following molecule?
CCOC1(C(=O)NN)CCOC1
<BB_9674>
What is the molecular formula for <BB_9674>?
The molecular formula for <BB_9674> (CCOC1(C(=O)NN)CCOC1) is C7H14N2O3.
Describe the ring structures in building block <BB_9674>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_9674>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_9674>.
**Token:** <BB_9674> **SMILES:** CCOC1(C(=O)NN)CCOC1 **Molecular Formula:** C7H14N2O3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_9675>.
Cl.Cl.NC1CNCC1(F)F
What is the building block token for the following molecule?
Cl.Cl.NC1CNCC1(F)F
<BB_9675>
What is the molecular formula for <BB_9675>?
The molecular formula for <BB_9675> (Cl.Cl.NC1CNCC1(F)F) is C4H10Cl2F2N2.
Describe the ring structures in building block <BB_9675>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_9675>.
The molecule contains the following groups: Amine, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9675>.
**Token:** <BB_9675> **SMILES:** Cl.Cl.NC1CNCC1(F)F **Molecular Formula:** C4H10Cl2F2N2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amine, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9676>.
Nc1ccc(OCC2CCC2)cc1
What is the building block token for the following molecule?
Nc1ccc(OCC2CCC2)cc1
<BB_9676>
What is the molecular formula for <BB_9676>?
The molecular formula for <BB_9676> (Nc1ccc(OCC2CCC2)cc1) is C11H15NO.
Describe the ring structures in building block <BB_9676>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_9676>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_9676>.
**Token:** <BB_9676> **SMILES:** Nc1ccc(OCC2CCC2)cc1 **Molecular Formula:** C11H15NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_9677>.
Cc1ccc(S/C=C\C(=O)O)cc1
What is the building block token for the following molecule?
Cc1ccc(S/C=C\C(=O)O)cc1
<BB_9677>
What is the molecular formula for <BB_9677>?
The molecular formula for <BB_9677> (Cc1ccc(S/C=C\C(=O)O)cc1) is C10H10O2S.
Describe the ring structures in building block <BB_9677>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9677>.
The molecule contains the following groups: Carboxylic Acid, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_9677>.
**Token:** <BB_9677> **SMILES:** Cc1ccc(S/C=C\C(=O)O)cc1 **Molecular Formula:** C10H10O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Sulfide
Provide the SMILES representation for the building block token <BB_9678>.
Cl.O=C(O)c1ccc(CN2CCCC2)cc1
What is the building block token for the following molecule?
Cl.O=C(O)c1ccc(CN2CCCC2)cc1
<BB_9678>
What is the molecular formula for <BB_9678>?
The molecular formula for <BB_9678> (Cl.O=C(O)c1ccc(CN2CCCC2)cc1) is C12H16ClNO2.
Describe the ring structures in building block <BB_9678>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9678>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9678>.
**Token:** <BB_9678> **SMILES:** Cl.O=C(O)c1ccc(CN2CCCC2)cc1 **Molecular Formula:** C12H16ClNO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9679>.
COc1cc(C)cc(OC)c1
What is the building block token for the following molecule?
COc1cc(C)cc(OC)c1
<BB_9679>
What is the molecular formula for <BB_9679>?
The molecular formula for <BB_9679> (COc1cc(C)cc(OC)c1) is C9H12O2.
Describe the ring structures in building block <BB_9679>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9679>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_9679>.
**Token:** <BB_9679> **SMILES:** COc1cc(C)cc(OC)c1 **Molecular Formula:** C9H12O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_9680>.
Cc1cc(N)nn1Cn1nc(C(F)(F)F)cc1C
What is the building block token for the following molecule?
Cc1cc(N)nn1Cn1nc(C(F)(F)F)cc1C
<BB_9680>
What is the molecular formula for <BB_9680>?
The molecular formula for <BB_9680> (Cc1cc(N)nn1Cn1nc(C(F)(F)F)cc1C) is C10H12F3N5.
Describe the ring structures in building block <BB_9680>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_9680>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9680>.
**Token:** <BB_9680> **SMILES:** Cc1cc(N)nn1Cn1nc(C(F)(F)F)cc1C **Molecular Formula:** C10H12F3N5 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9681>.
Cc1ncccc1O
What is the building block token for the following molecule?
Cc1ncccc1O
<BB_9681>
What is the molecular formula for <BB_9681>?
The molecular formula for <BB_9681> (Cc1ncccc1O) is C6H7NO.
Describe the ring structures in building block <BB_9681>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9681>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_9681>.
**Token:** <BB_9681> **SMILES:** Cc1ncccc1O **Molecular Formula:** C6H7NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_9682>.
CCC1Cn2cc(Br)cc2C(=O)N1
What is the building block token for the following molecule?
CCC1Cn2cc(Br)cc2C(=O)N1
<BB_9682>
What is the molecular formula for <BB_9682>?
The molecular formula for <BB_9682> (CCC1Cn2cc(Br)cc2C(=O)N1) is C9H11BrN2O.
Describe the ring structures in building block <BB_9682>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9682>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9682>.
**Token:** <BB_9682> **SMILES:** CCC1Cn2cc(Br)cc2C(=O)N1 **Molecular Formula:** C9H11BrN2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9683>.
CC(C)(C)OC(=O)N1C2C(CC[C@H]1CN)C2(F)F
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1C2C(CC[C@H]1CN)C2(F)F
<BB_9683>