instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_9683>?
The molecular formula for <BB_9683> (CC(C)(C)OC(=O)N1C2C(CC[C@H]1CN)C2(F)F) is C12H20F2N2O2.
Describe the ring structures in building block <BB_9683>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_9683>.
The molecule contains the following groups: Amine, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9683>.
**Token:** <BB_9683> **SMILES:** CC(C)(C)OC(=O)N1C2C(CC[C@H]1CN)C2(F)F **Molecular Formula:** C12H20F2N2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Amine, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9684>.
COC(=O)C(C)Nc1ccc([N+](=O)[O-])cc1
What is the building block token for the following molecule?
COC(=O)C(C)Nc1ccc([N+](=O)[O-])cc1
<BB_9684>
What is the molecular formula for <BB_9684>?
The molecular formula for <BB_9684> (COC(=O)C(C)Nc1ccc([N+](=O)[O-])cc1) is C10H12N2O4.
Describe the ring structures in building block <BB_9684>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9684>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Ester, Ether, Nitro.
Provide a comprehensive chemical profile for the building block <BB_9684>.
**Token:** <BB_9684> **SMILES:** COC(=O)C(C)Nc1ccc([N+](=O)[O-])cc1 **Molecular Formula:** C10H12N2O4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Ester, Ether, Nitro
Provide the SMILES representation for the building block token <BB_9685>.
O=C(O)c1ccnn1-c1ccc(Br)cc1
What is the building block token for the following molecule?
O=C(O)c1ccnn1-c1ccc(Br)cc1
<BB_9685>
What is the molecular formula for <BB_9685>?
The molecular formula for <BB_9685> (O=C(O)c1ccnn1-c1ccc(Br)cc1) is C10H7BrN2O2.
Describe the ring structures in building block <BB_9685>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9685>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9685>.
**Token:** <BB_9685> **SMILES:** O=C(O)c1ccnn1-c1ccc(Br)cc1 **Molecular Formula:** C10H7BrN2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9686>.
NC1=NCC2(CCC(c3ccccc3)CC2)O1
What is the building block token for the following molecule?
NC1=NCC2(CCC(c3ccccc3)CC2)O1
<BB_9686>
What is the molecular formula for <BB_9686>?
The molecular formula for <BB_9686> (NC1=NCC2(CCC(c3ccccc3)CC2)O1) is C14H18N2O.
Describe the ring structures in building block <BB_9686>.
The molecule contains 3 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9686>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_9686>.
**Token:** <BB_9686> **SMILES:** NC1=NCC2(CCC(c3ccccc3)CC2)O1 **Molecular Formula:** C14H18N2O **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_9687>.
CC(C)(C)Oc1cc(CN)ccn1
What is the building block token for the following molecule?
CC(C)(C)Oc1cc(CN)ccn1
<BB_9687>
What is the molecular formula for <BB_9687>?
The molecular formula for <BB_9687> (CC(C)(C)Oc1cc(CN)ccn1) is C10H16N2O.
Describe the ring structures in building block <BB_9687>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9687>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_9687>.
**Token:** <BB_9687> **SMILES:** CC(C)(C)Oc1cc(CN)ccn1 **Molecular Formula:** C10H16N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_9688>.
C#CCC1(C(=O)O)CC1
What is the building block token for the following molecule?
C#CCC1(C(=O)O)CC1
<BB_9688>
What is the molecular formula for <BB_9688>?
The molecular formula for <BB_9688> (C#CCC1(C(=O)O)CC1) is C7H8O2.
Describe the ring structures in building block <BB_9688>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_9688>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_9688>.
**Token:** <BB_9688> **SMILES:** C#CCC1(C(=O)O)CC1 **Molecular Formula:** C7H8O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_9689>.
CCNCCO.Cl
What is the building block token for the following molecule?
CCNCCO.Cl
<BB_9689>
What is the molecular formula for <BB_9689>?
The molecular formula for <BB_9689> (CCNCCO.Cl) is C4H12ClNO.
Describe the ring structures in building block <BB_9689>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9689>.
The molecule contains the following groups: Secondary Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9689>.
**Token:** <BB_9689> **SMILES:** CCNCCO.Cl **Molecular Formula:** C4H12ClNO **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Secondary Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9690>.
FC(F)c1cnc2ccccc2c1
What is the building block token for the following molecule?
FC(F)c1cnc2ccccc2c1
<BB_9690>
What is the molecular formula for <BB_9690>?
The molecular formula for <BB_9690> (FC(F)c1cnc2ccccc2c1) is C10H7F2N.
Describe the ring structures in building block <BB_9690>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9690>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9690>.
**Token:** <BB_9690> **SMILES:** FC(F)c1cnc2ccccc2c1 **Molecular Formula:** C10H7F2N **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9691>.
O=CC12CC(F)(C1)C2
What is the building block token for the following molecule?
O=CC12CC(F)(C1)C2
<BB_9691>
What is the molecular formula for <BB_9691>?
The molecular formula for <BB_9691> (O=CC12CC(F)(C1)C2) is C6H7FO.
Describe the ring structures in building block <BB_9691>.
The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4, an aliphatic ring of size 4.
List the primary functional groups present in <BB_9691>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9691>.
**Token:** <BB_9691> **SMILES:** O=CC12CC(F)(C1)C2 **Molecular Formula:** C6H7FO **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4, an aliphatic ring of size 4. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9692>.
COc1ccc(C(=O)C(C)C)cc1
What is the building block token for the following molecule?
COc1ccc(C(=O)C(C)C)cc1
<BB_9692>
What is the molecular formula for <BB_9692>?
The molecular formula for <BB_9692> (COc1ccc(C(=O)C(C)C)cc1) is C11H14O2.
Describe the ring structures in building block <BB_9692>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9692>.
The molecule contains the following groups: Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_9692>.
**Token:** <BB_9692> **SMILES:** COc1ccc(C(=O)C(C)C)cc1 **Molecular Formula:** C11H14O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Ether
Provide the SMILES representation for the building block token <BB_9693>.
NC(Cc1ccc(F)cc1)c1ccccc1
What is the building block token for the following molecule?
NC(Cc1ccc(F)cc1)c1ccccc1
<BB_9693>
What is the molecular formula for <BB_9693>?
The molecular formula for <BB_9693> (NC(Cc1ccc(F)cc1)c1ccccc1) is C14H14FN.
Describe the ring structures in building block <BB_9693>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9693>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9693>.
**Token:** <BB_9693> **SMILES:** NC(Cc1ccc(F)cc1)c1ccccc1 **Molecular Formula:** C14H14FN **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9694>.
CC(C)(C)NS(=O)(=O)c1ccc(O)cc1
What is the building block token for the following molecule?
CC(C)(C)NS(=O)(=O)c1ccc(O)cc1
<BB_9694>
What is the molecular formula for <BB_9694>?
The molecular formula for <BB_9694> (CC(C)(C)NS(=O)(=O)c1ccc(O)cc1) is C10H15NO3S.
Describe the ring structures in building block <BB_9694>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9694>.
The molecule contains the following groups: Secondary Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_9694>.
**Token:** <BB_9694> **SMILES:** CC(C)(C)NS(=O)(=O)c1ccc(O)cc1 **Molecular Formula:** C10H15NO3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_9695>.
O=C(O)CCNC(=O)c1cc(=O)c2ccccc2o1
What is the building block token for the following molecule?
O=C(O)CCNC(=O)c1cc(=O)c2ccccc2o1
<BB_9695>
What is the molecular formula for <BB_9695>?
The molecular formula for <BB_9695> (O=C(O)CCNC(=O)c1cc(=O)c2ccccc2o1) is C13H11NO5.
Describe the ring structures in building block <BB_9695>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9695>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_9695>.
**Token:** <BB_9695> **SMILES:** O=C(O)CCNC(=O)c1cc(=O)c2ccccc2o1 **Molecular Formula:** C13H11NO5 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_9696>.
CC1(NC(=O)C2CC2)CCS(=O)(=O)C1
What is the building block token for the following molecule?
CC1(NC(=O)C2CC2)CCS(=O)(=O)C1
<BB_9696>
What is the molecular formula for <BB_9696>?
The molecular formula for <BB_9696> (CC1(NC(=O)C2CC2)CCS(=O)(=O)C1) is C9H15NO3S.
Describe the ring structures in building block <BB_9696>.
The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9696>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_9696>.
**Token:** <BB_9696> **SMILES:** CC1(NC(=O)C2CC2)CCS(=O)(=O)C1 **Molecular Formula:** C9H15NO3S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 5. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_9697>.
O=C1CC(c2ccccc2)C12CC(F)(F)C2
What is the building block token for the following molecule?
O=C1CC(c2ccccc2)C12CC(F)(F)C2
<BB_9697>
What is the molecular formula for <BB_9697>?
The molecular formula for <BB_9697> (O=C1CC(c2ccccc2)C12CC(F)(F)C2) is C13H12F2O.
Describe the ring structures in building block <BB_9697>.
The molecule contains 3 ring(s): an aliphatic ring of size 4, an aromatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_9697>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9697>.
**Token:** <BB_9697> **SMILES:** O=C1CC(c2ccccc2)C12CC(F)(F)C2 **Molecular Formula:** C13H12F2O **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 4, an aromatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9698>.
CC1CCOCC1N.Cl
What is the building block token for the following molecule?
CC1CCOCC1N.Cl
<BB_9698>
What is the molecular formula for <BB_9698>?
The molecular formula for <BB_9698> (CC1CCOCC1N.Cl) is C6H14ClNO.
Describe the ring structures in building block <BB_9698>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9698>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9698>.
**Token:** <BB_9698> **SMILES:** CC1CCOCC1N.Cl **Molecular Formula:** C6H14ClNO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9699>.
CC(Cl)c1nc(-c2nnc[nH]2)no1
What is the building block token for the following molecule?
CC(Cl)c1nc(-c2nnc[nH]2)no1
<BB_9699>
What is the molecular formula for <BB_9699>?
The molecular formula for <BB_9699> (CC(Cl)c1nc(-c2nnc[nH]2)no1) is C6H6ClN5O.
Describe the ring structures in building block <BB_9699>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_9699>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9699>.
**Token:** <BB_9699> **SMILES:** CC(Cl)c1nc(-c2nnc[nH]2)no1 **Molecular Formula:** C6H6ClN5O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)