instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_1000>.
CN(C)C(=O)c1cnc(Br)s1
What is the building block token for the following molecule?
CN(C)C(=O)c1cnc(Br)s1
<BB_1000>
What is the molecular formula for <BB_1000>?
The molecular formula for <BB_1000> (CN(C)C(=O)c1cnc(Br)s1) is C6H7BrN2OS.
Describe the ring structures in building block <BB_1000>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1000>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1000>.
**Token:** <BB_1000> **SMILES:** CN(C)C(=O)c1cnc(Br)s1 **Molecular Formula:** C6H7BrN2OS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1001>.
CCC/C=C(/C=O)CC
What is the building block token for the following molecule?
CCC/C=C(/C=O)CC
<BB_1001>
What is the molecular formula for <BB_1001>?
The molecular formula for <BB_1001> (CCC/C=C(/C=O)CC) is C8H14O.
Describe the ring structures in building block <BB_1001>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1001>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_1001>.
**Token:** <BB_1001> **SMILES:** CCC/C=C(/C=O)CC **Molecular Formula:** C8H14O **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_1002>.
Cc1c(Cl)nn2cnnc2c1C
What is the building block token for the following molecule?
Cc1c(Cl)nn2cnnc2c1C
<BB_1002>
What is the molecular formula for <BB_1002>?
The molecular formula for <BB_1002> (Cc1c(Cl)nn2cnnc2c1C) is C7H7ClN4.
Describe the ring structures in building block <BB_1002>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1002>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1002>.
**Token:** <BB_1002> **SMILES:** Cc1c(Cl)nn2cnnc2c1C **Molecular Formula:** C7H7ClN4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1003>.
Cc1nsc(C)c1CCl.Cl
What is the building block token for the following molecule?
Cc1nsc(C)c1CCl.Cl
<BB_1003>
What is the molecular formula for <BB_1003>?
The molecular formula for <BB_1003> (Cc1nsc(C)c1CCl.Cl) is C6H9Cl2NS.
Describe the ring structures in building block <BB_1003>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1003>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1003>.
**Token:** <BB_1003> **SMILES:** Cc1nsc(C)c1CCl.Cl **Molecular Formula:** C6H9Cl2NS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1004>.
Cc1occ(C(F)(F)F)c1C(N)=O
What is the building block token for the following molecule?
Cc1occ(C(F)(F)F)c1C(N)=O
<BB_1004>
What is the molecular formula for <BB_1004>?
The molecular formula for <BB_1004> (Cc1occ(C(F)(F)F)c1C(N)=O) is C7H6F3NO2.
Describe the ring structures in building block <BB_1004>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1004>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1004>.
**Token:** <BB_1004> **SMILES:** Cc1occ(C(F)(F)F)c1C(N)=O **Molecular Formula:** C7H6F3NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1005>.
OCc1ccc(OC(F)(F)F)cc1Cl
What is the building block token for the following molecule?
OCc1ccc(OC(F)(F)F)cc1Cl
<BB_1005>
What is the molecular formula for <BB_1005>?
The molecular formula for <BB_1005> (OCc1ccc(OC(F)(F)F)cc1Cl) is C8H6ClF3O2.
Describe the ring structures in building block <BB_1005>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1005>.
The molecule contains the following groups: Alcohol, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1005>.
**Token:** <BB_1005> **SMILES:** OCc1ccc(OC(F)(F)F)cc1Cl **Molecular Formula:** C8H6ClF3O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1006>.
COC(=O)[C@@H](N)c1ccc(O)cc1.Cl
What is the building block token for the following molecule?
COC(=O)[C@@H](N)c1ccc(O)cc1.Cl
<BB_1006>
What is the molecular formula for <BB_1006>?
The molecular formula for <BB_1006> (COC(=O)[C@@H](N)c1ccc(O)cc1.Cl) is C9H12ClNO3.
Describe the ring structures in building block <BB_1006>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1006>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1006>.
**Token:** <BB_1006> **SMILES:** COC(=O)[C@@H](N)c1ccc(O)cc1.Cl **Molecular Formula:** C9H12ClNO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1007>.
CC(C)(C)OC(=O)N1CCC(=O)CC1C(F)F
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCC(=O)CC1C(F)F
<BB_1007>
What is the molecular formula for <BB_1007>?
The molecular formula for <BB_1007> (CC(C)(C)OC(=O)N1CCC(=O)CC1C(F)F) is C11H17F2NO3.
Describe the ring structures in building block <BB_1007>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1007>.
The molecule contains the following groups: Amide, Ketone, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1007>.
**Token:** <BB_1007> **SMILES:** CC(C)(C)OC(=O)N1CCC(=O)CC1C(F)F **Molecular Formula:** C11H17F2NO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amide, Ketone, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1008>.
CC(CN)c1ccc(Cl)c(Cl)c1.Cl
What is the building block token for the following molecule?
CC(CN)c1ccc(Cl)c(Cl)c1.Cl
<BB_1008>
What is the molecular formula for <BB_1008>?
The molecular formula for <BB_1008> (CC(CN)c1ccc(Cl)c(Cl)c1.Cl) is C9H12Cl3N.
Describe the ring structures in building block <BB_1008>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1008>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1008>.
**Token:** <BB_1008> **SMILES:** CC(CN)c1ccc(Cl)c(Cl)c1.Cl **Molecular Formula:** C9H12Cl3N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1009>.
O=C(O)C1(c2ccno2)CCOCC1
What is the building block token for the following molecule?
O=C(O)C1(c2ccno2)CCOCC1
<BB_1009>
What is the molecular formula for <BB_1009>?
The molecular formula for <BB_1009> (O=C(O)C1(c2ccno2)CCOCC1) is C9H11NO4.
Describe the ring structures in building block <BB_1009>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1009>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_1009>.
**Token:** <BB_1009> **SMILES:** O=C(O)C1(c2ccno2)CCOCC1 **Molecular Formula:** C9H11NO4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_1010>.
C=CCC(N)Cc1ccccc1
What is the building block token for the following molecule?
C=CCC(N)Cc1ccccc1
<BB_1010>
What is the molecular formula for <BB_1010>?
The molecular formula for <BB_1010> (C=CCC(N)Cc1ccccc1) is C11H15N.
Describe the ring structures in building block <BB_1010>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1010>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_1010>.
**Token:** <BB_1010> **SMILES:** C=CCC(N)Cc1ccccc1 **Molecular Formula:** C11H15N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_1011>.
CC1(C)OB(c2cc(C#N)ccc2F)OC1(C)C
What is the building block token for the following molecule?
CC1(C)OB(c2cc(C#N)ccc2F)OC1(C)C
<BB_1011>
What is the molecular formula for <BB_1011>?
The molecular formula for <BB_1011> (CC1(C)OB(c2cc(C#N)ccc2F)OC1(C)C) is C13H15BFNO2.
Describe the ring structures in building block <BB_1011>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1011>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1011>.
**Token:** <BB_1011> **SMILES:** CC1(C)OB(c2cc(C#N)ccc2F)OC1(C)C **Molecular Formula:** C13H15BFNO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_1012>.
Cc1ccc(C=CC=O)cn1
What is the building block token for the following molecule?
Cc1ccc(C=CC=O)cn1
<BB_1012>
What is the molecular formula for <BB_1012>?
The molecular formula for <BB_1012> (Cc1ccc(C=CC=O)cn1) is C9H9NO.
Describe the ring structures in building block <BB_1012>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1012>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_1012>.
**Token:** <BB_1012> **SMILES:** Cc1ccc(C=CC=O)cn1 **Molecular Formula:** C9H9NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_1013>.
BrCCCOC1CCC1
What is the building block token for the following molecule?
BrCCCOC1CCC1
<BB_1013>
What is the molecular formula for <BB_1013>?
The molecular formula for <BB_1013> (BrCCCOC1CCC1) is C7H13BrO.
Describe the ring structures in building block <BB_1013>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_1013>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1013>.
**Token:** <BB_1013> **SMILES:** BrCCCOC1CCC1 **Molecular Formula:** C7H13BrO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1014>.
c1ccc(COc2ccc3cc[nH]c3c2)cc1
What is the building block token for the following molecule?
c1ccc(COc2ccc3cc[nH]c3c2)cc1
<BB_1014>
What is the molecular formula for <BB_1014>?
The molecular formula for <BB_1014> (c1ccc(COc2ccc3cc[nH]c3c2)cc1) is C15H13NO.
Describe the ring structures in building block <BB_1014>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1014>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_1014>.
**Token:** <BB_1014> **SMILES:** c1ccc(COc2ccc3cc[nH]c3c2)cc1 **Molecular Formula:** C15H13NO **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_1015>.
COc1cc(N2CCN(C)CC2)ccc1N
What is the building block token for the following molecule?
COc1cc(N2CCN(C)CC2)ccc1N
<BB_1015>
What is the molecular formula for <BB_1015>?
The molecular formula for <BB_1015> (COc1cc(N2CCN(C)CC2)ccc1N) is C12H19N3O.
Describe the ring structures in building block <BB_1015>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1015>.
The molecule contains the following groups: Amine, Tertiary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_1015>.
**Token:** <BB_1015> **SMILES:** COc1cc(N2CCN(C)CC2)ccc1N **Molecular Formula:** C12H19N3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Ether
Provide the SMILES representation for the building block token <BB_1016>.
CC(C)N1CCC(=O)NC1=O
What is the building block token for the following molecule?
CC(C)N1CCC(=O)NC1=O
<BB_1016>
What is the molecular formula for <BB_1016>?
The molecular formula for <BB_1016> (CC(C)N1CCC(=O)NC1=O) is C7H12N2O2.
Describe the ring structures in building block <BB_1016>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.