instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_9700>.
N#Cc1cc(C#N)c(Cl)nc1N
What is the building block token for the following molecule?
N#Cc1cc(C#N)c(Cl)nc1N
<BB_9700>
What is the molecular formula for <BB_9700>?
The molecular formula for <BB_9700> (N#Cc1cc(C#N)c(Cl)nc1N) is C7H3ClN4.
Describe the ring structures in building block <BB_9700>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9700>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9700>.
**Token:** <BB_9700> **SMILES:** N#Cc1cc(C#N)c(Cl)nc1N **Molecular Formula:** C7H3ClN4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_9701>.
CC(C)(C)c1cc(I)cc(C=O)c1O
What is the building block token for the following molecule?
CC(C)(C)c1cc(I)cc(C=O)c1O
<BB_9701>
What is the molecular formula for <BB_9701>?
The molecular formula for <BB_9701> (CC(C)(C)c1cc(I)cc(C=O)c1O) is C11H13IO2.
Describe the ring structures in building block <BB_9701>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9701>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9701>.
**Token:** <BB_9701> **SMILES:** CC(C)(C)c1cc(I)cc(C=O)c1O **Molecular Formula:** C11H13IO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9702>.
FC(F)(F)c1cc(Cl)nc2[nH]nc(Br)c12
What is the building block token for the following molecule?
FC(F)(F)c1cc(Cl)nc2[nH]nc(Br)c12
<BB_9702>
What is the molecular formula for <BB_9702>?
The molecular formula for <BB_9702> (FC(F)(F)c1cc(Cl)nc2[nH]nc(Br)c12) is C7H2BrClF3N3.
Describe the ring structures in building block <BB_9702>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9702>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9702>.
**Token:** <BB_9702> **SMILES:** FC(F)(F)c1cc(Cl)nc2[nH]nc(Br)c12 **Molecular Formula:** C7H2BrClF3N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9703>.
Nc1cc2c(cc1S(=O)(=O)[O-])CCC2.[Na+]
What is the building block token for the following molecule?
Nc1cc2c(cc1S(=O)(=O)[O-])CCC2.[Na+]
<BB_9703>
What is the molecular formula for <BB_9703>?
The molecular formula for <BB_9703> (Nc1cc2c(cc1S(=O)(=O)[O-])CCC2.[Na+]) is C9H10NNaO3S.
Describe the ring structures in building block <BB_9703>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9703>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_9703>.
**Token:** <BB_9703> **SMILES:** Nc1cc2c(cc1S(=O)(=O)[O-])CCC2.[Na+] **Molecular Formula:** C9H10NNaO3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_9704>.
O=C(CCl)Nc1cc(Br)ccc1O
What is the building block token for the following molecule?
O=C(CCl)Nc1cc(Br)ccc1O
<BB_9704>
What is the molecular formula for <BB_9704>?
The molecular formula for <BB_9704> (O=C(CCl)Nc1cc(Br)ccc1O) is C8H7BrClNO2.
Describe the ring structures in building block <BB_9704>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9704>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9704>.
**Token:** <BB_9704> **SMILES:** O=C(CCl)Nc1cc(Br)ccc1O **Molecular Formula:** C8H7BrClNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9705>.
Br.CNCc1ccccc1O
What is the building block token for the following molecule?
Br.CNCc1ccccc1O
<BB_9705>
What is the molecular formula for <BB_9705>?
The molecular formula for <BB_9705> (Br.CNCc1ccccc1O) is C8H12BrNO.
Describe the ring structures in building block <BB_9705>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9705>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9705>.
**Token:** <BB_9705> **SMILES:** Br.CNCc1ccccc1O **Molecular Formula:** C8H12BrNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9706>.
CC(=O)N1CCC(N)C1
What is the building block token for the following molecule?
CC(=O)N1CCC(N)C1
<BB_9706>
What is the molecular formula for <BB_9706>?
The molecular formula for <BB_9706> (CC(=O)N1CCC(N)C1) is C6H12N2O.
Describe the ring structures in building block <BB_9706>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_9706>.
The molecule contains the following groups: Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_9706>.
**Token:** <BB_9706> **SMILES:** CC(=O)N1CCC(N)C1 **Molecular Formula:** C6H12N2O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amine, Amide
Provide the SMILES representation for the building block token <BB_9707>.
CC12CC1(CO)C2
What is the building block token for the following molecule?
CC12CC1(CO)C2
<BB_9707>
What is the molecular formula for <BB_9707>?
The molecular formula for <BB_9707> (CC12CC1(CO)C2) is C6H10O.
Describe the ring structures in building block <BB_9707>.
The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 3.
List the primary functional groups present in <BB_9707>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_9707>.
**Token:** <BB_9707> **SMILES:** CC12CC1(CO)C2 **Molecular Formula:** C6H10O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 3. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_9708>.
Cc1ccc(C)c(C=O)c1O
What is the building block token for the following molecule?
Cc1ccc(C)c(C=O)c1O
<BB_9708>
What is the molecular formula for <BB_9708>?
The molecular formula for <BB_9708> (Cc1ccc(C)c(C=O)c1O) is C9H10O2.
Describe the ring structures in building block <BB_9708>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9708>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_9708>.
**Token:** <BB_9708> **SMILES:** Cc1ccc(C)c(C=O)c1O **Molecular Formula:** C9H10O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_9709>.
O=Cc1cc2ccc(Br)cc2s1
What is the building block token for the following molecule?
O=Cc1cc2ccc(Br)cc2s1
<BB_9709>
What is the molecular formula for <BB_9709>?
The molecular formula for <BB_9709> (O=Cc1cc2ccc(Br)cc2s1) is C9H5BrOS.
Describe the ring structures in building block <BB_9709>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9709>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9709>.
**Token:** <BB_9709> **SMILES:** O=Cc1cc2ccc(Br)cc2s1 **Molecular Formula:** C9H5BrOS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9710>.
COC(=O)c1cc(Cl)c2cccc(Br)c2n1
What is the building block token for the following molecule?
COC(=O)c1cc(Cl)c2cccc(Br)c2n1
<BB_9710>
What is the molecular formula for <BB_9710>?
The molecular formula for <BB_9710> (COC(=O)c1cc(Cl)c2cccc(Br)c2n1) is C11H7BrClNO2.
Describe the ring structures in building block <BB_9710>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9710>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9710>.
**Token:** <BB_9710> **SMILES:** COC(=O)c1cc(Cl)c2cccc(Br)c2n1 **Molecular Formula:** C11H7BrClNO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9711>.
CC(C)C(=O)OCS(C)(=O)=O
What is the building block token for the following molecule?
CC(C)C(=O)OCS(C)(=O)=O
<BB_9711>
What is the molecular formula for <BB_9711>?
The molecular formula for <BB_9711> (CC(C)C(=O)OCS(C)(=O)=O) is C6H12O4S.
Describe the ring structures in building block <BB_9711>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9711>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_9711>.
**Token:** <BB_9711> **SMILES:** CC(C)C(=O)OCS(C)(=O)=O **Molecular Formula:** C6H12O4S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_9712>.
O=C(CN=C=S)NC1CC1
What is the building block token for the following molecule?
O=C(CN=C=S)NC1CC1
<BB_9712>
What is the molecular formula for <BB_9712>?
The molecular formula for <BB_9712> (O=C(CN=C=S)NC1CC1) is C6H8N2OS.
Describe the ring structures in building block <BB_9712>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_9712>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_9712>.
**Token:** <BB_9712> **SMILES:** O=C(CN=C=S)NC1CC1 **Molecular Formula:** C6H8N2OS **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_9713>.
CC(=O)c1cc(F)ccc1N1CCN(C(C)=O)CC1
What is the building block token for the following molecule?
CC(=O)c1cc(F)ccc1N1CCN(C(C)=O)CC1
<BB_9713>
What is the molecular formula for <BB_9713>?
The molecular formula for <BB_9713> (CC(=O)c1cc(F)ccc1N1CCN(C(C)=O)CC1) is C14H17FN2O2.
Describe the ring structures in building block <BB_9713>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9713>.
The molecule contains the following groups: Tertiary Amine, Amide, Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9713>.
**Token:** <BB_9713> **SMILES:** CC(=O)c1cc(F)ccc1N1CCN(C(C)=O)CC1 **Molecular Formula:** C14H17FN2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine, Amide, Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9714>.
Cc1cc(C(=O)O)cn(C)c1=O
What is the building block token for the following molecule?
Cc1cc(C(=O)O)cn(C)c1=O
<BB_9714>
What is the molecular formula for <BB_9714>?
The molecular formula for <BB_9714> (Cc1cc(C(=O)O)cn(C)c1=O) is C8H9NO3.
Describe the ring structures in building block <BB_9714>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9714>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_9714>.
**Token:** <BB_9714> **SMILES:** Cc1cc(C(=O)O)cn(C)c1=O **Molecular Formula:** C8H9NO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_9715>.
CC(C)(C)c1ccncc1C(=O)O.Cl
What is the building block token for the following molecule?
CC(C)(C)c1ccncc1C(=O)O.Cl
<BB_9715>
What is the molecular formula for <BB_9715>?
The molecular formula for <BB_9715> (CC(C)(C)c1ccncc1C(=O)O.Cl) is C10H14ClNO2.
Describe the ring structures in building block <BB_9715>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9715>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9715>.
**Token:** <BB_9715> **SMILES:** CC(C)(C)c1ccncc1C(=O)O.Cl **Molecular Formula:** C10H14ClNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9716>.
Fc1cc2nc(Cl)ccc2c(F)c1Br
What is the building block token for the following molecule?
Fc1cc2nc(Cl)ccc2c(F)c1Br
<BB_9716>
What is the molecular formula for <BB_9716>?
The molecular formula for <BB_9716> (Fc1cc2nc(Cl)ccc2c(F)c1Br) is C9H3BrClF2N.
Describe the ring structures in building block <BB_9716>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.