instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_9716>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9716>.
**Token:** <BB_9716> **SMILES:** Fc1cc2nc(Cl)ccc2c(F)c1Br **Molecular Formula:** C9H3BrClF2N **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9717>.
O=Cc1ncc(C(F)(F)F)cc1C(F)(F)F
What is the building block token for the following molecule?
O=Cc1ncc(C(F)(F)F)cc1C(F)(F)F
<BB_9717>
What is the molecular formula for <BB_9717>?
The molecular formula for <BB_9717> (O=Cc1ncc(C(F)(F)F)cc1C(F)(F)F) is C8H3F6NO.
Describe the ring structures in building block <BB_9717>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9717>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9717>.
**Token:** <BB_9717> **SMILES:** O=Cc1ncc(C(F)(F)F)cc1C(F)(F)F **Molecular Formula:** C8H3F6NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9718>.
COC(=O)c1ccc(COc2ccc(Cl)cc2Cl)o1
What is the building block token for the following molecule?
COC(=O)c1ccc(COc2ccc(Cl)cc2Cl)o1
<BB_9718>
What is the molecular formula for <BB_9718>?
The molecular formula for <BB_9718> (COC(=O)c1ccc(COc2ccc(Cl)cc2Cl)o1) is C13H10Cl2O4.
Describe the ring structures in building block <BB_9718>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9718>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9718>.
**Token:** <BB_9718> **SMILES:** COC(=O)c1ccc(COc2ccc(Cl)cc2Cl)o1 **Molecular Formula:** C13H10Cl2O4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9719>.
CC(C)(C)OC(=O)N1CCn2c(cnc2N)C1.Cl
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCn2c(cnc2N)C1.Cl
<BB_9719>
What is the molecular formula for <BB_9719>?
The molecular formula for <BB_9719> (CC(C)(C)OC(=O)N1CCn2c(cnc2N)C1.Cl) is C11H19ClN4O2.
Describe the ring structures in building block <BB_9719>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9719>.
The molecule contains the following groups: Amine, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9719>.
**Token:** <BB_9719> **SMILES:** CC(C)(C)OC(=O)N1CCn2c(cnc2N)C1.Cl **Molecular Formula:** C11H19ClN4O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9720>.
c1csc(C2CNCCO2)n1
What is the building block token for the following molecule?
c1csc(C2CNCCO2)n1
<BB_9720>
What is the molecular formula for <BB_9720>?
The molecular formula for <BB_9720> (c1csc(C2CNCCO2)n1) is C7H10N2OS.
Describe the ring structures in building block <BB_9720>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9720>.
The molecule contains the following groups: Secondary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_9720>.
**Token:** <BB_9720> **SMILES:** c1csc(C2CNCCO2)n1 **Molecular Formula:** C7H10N2OS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ether
Provide the SMILES representation for the building block token <BB_9721>.
COC(=O)c1c(Cl)cnc(Br)c1Br
What is the building block token for the following molecule?
COC(=O)c1c(Cl)cnc(Br)c1Br
<BB_9721>
What is the molecular formula for <BB_9721>?
The molecular formula for <BB_9721> (COC(=O)c1c(Cl)cnc(Br)c1Br) is C7H4Br2ClNO2.
Describe the ring structures in building block <BB_9721>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9721>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9721>.
**Token:** <BB_9721> **SMILES:** COC(=O)c1c(Cl)cnc(Br)c1Br **Molecular Formula:** C7H4Br2ClNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9722>.
COC(=O)c1n[nH]c(C)c1Cl
What is the building block token for the following molecule?
COC(=O)c1n[nH]c(C)c1Cl
<BB_9722>
What is the molecular formula for <BB_9722>?
The molecular formula for <BB_9722> (COC(=O)c1n[nH]c(C)c1Cl) is C6H7ClN2O2.
Describe the ring structures in building block <BB_9722>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9722>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9722>.
**Token:** <BB_9722> **SMILES:** COC(=O)c1n[nH]c(C)c1Cl **Molecular Formula:** C6H7ClN2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9723>.
CCN(CC1COc2ccccc2O1)C(=O)CCl
What is the building block token for the following molecule?
CCN(CC1COc2ccccc2O1)C(=O)CCl
<BB_9723>
What is the molecular formula for <BB_9723>?
The molecular formula for <BB_9723> (CCN(CC1COc2ccccc2O1)C(=O)CCl) is C13H16ClNO3.
Describe the ring structures in building block <BB_9723>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9723>.
The molecule contains the following groups: Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9723>.
**Token:** <BB_9723> **SMILES:** CCN(CC1COc2ccccc2O1)C(=O)CCl **Molecular Formula:** C13H16ClNO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9724>.
CC(C)(C)OC(=O)NCCC1CCCNC1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NCCC1CCCNC1
<BB_9724>
What is the molecular formula for <BB_9724>?
The molecular formula for <BB_9724> (CC(C)(C)OC(=O)NCCC1CCCNC1) is C12H24N2O2.
Describe the ring structures in building block <BB_9724>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9724>.
The molecule contains the following groups: Secondary Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_9724>.
**Token:** <BB_9724> **SMILES:** CC(C)(C)OC(=O)NCCC1CCCNC1 **Molecular Formula:** C12H24N2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_9725>.
CS(=O)(=O)c1ccncc1N
What is the building block token for the following molecule?
CS(=O)(=O)c1ccncc1N
<BB_9725>
What is the molecular formula for <BB_9725>?
The molecular formula for <BB_9725> (CS(=O)(=O)c1ccncc1N) is C6H8N2O2S.
Describe the ring structures in building block <BB_9725>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9725>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_9725>.
**Token:** <BB_9725> **SMILES:** CS(=O)(=O)c1ccncc1N **Molecular Formula:** C6H8N2O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_9726>.
Cl.NC12CC(c3ccccc3)(C1)CS(=O)(=O)C2
What is the building block token for the following molecule?
Cl.NC12CC(c3ccccc3)(C1)CS(=O)(=O)C2
<BB_9726>
What is the molecular formula for <BB_9726>?
The molecular formula for <BB_9726> (Cl.NC12CC(c3ccccc3)(C1)CS(=O)(=O)C2) is C12H16ClNO2S.
Describe the ring structures in building block <BB_9726>.
The molecule contains 4 ring(s): an aliphatic ring of size 4, an aromatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9726>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9726>.
**Token:** <BB_9726> **SMILES:** Cl.NC12CC(c3ccccc3)(C1)CS(=O)(=O)C2 **Molecular Formula:** C12H16ClNO2S **Ring System:** The molecule contains 4 ring(s): an aliphatic ring of size 4, an aromatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9727>.
COC(=O)Nc1nc2c(C)cccc2[nH]1
What is the building block token for the following molecule?
COC(=O)Nc1nc2c(C)cccc2[nH]1
<BB_9727>
What is the molecular formula for <BB_9727>?
The molecular formula for <BB_9727> (COC(=O)Nc1nc2c(C)cccc2[nH]1) is C10H11N3O2.
Describe the ring structures in building block <BB_9727>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9727>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_9727>.
**Token:** <BB_9727> **SMILES:** COC(=O)Nc1nc2c(C)cccc2[nH]1 **Molecular Formula:** C10H11N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amide, Ether
Provide the SMILES representation for the building block token <BB_9728>.
CCCCCCCC(=O)c1ccc(O)cc1
What is the building block token for the following molecule?
CCCCCCCC(=O)c1ccc(O)cc1
<BB_9728>
What is the molecular formula for <BB_9728>?
The molecular formula for <BB_9728> (CCCCCCCC(=O)c1ccc(O)cc1) is C14H20O2.
Describe the ring structures in building block <BB_9728>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9728>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_9728>.
**Token:** <BB_9728> **SMILES:** CCCCCCCC(=O)c1ccc(O)cc1 **Molecular Formula:** C14H20O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_9729>.
O=C(O)/C=C/c1ccc(OCc2ccccn2)cc1
What is the building block token for the following molecule?
O=C(O)/C=C/c1ccc(OCc2ccccn2)cc1
<BB_9729>
What is the molecular formula for <BB_9729>?
The molecular formula for <BB_9729> (O=C(O)/C=C/c1ccc(OCc2ccccn2)cc1) is C15H13NO3.
Describe the ring structures in building block <BB_9729>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9729>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_9729>.
**Token:** <BB_9729> **SMILES:** O=C(O)/C=C/c1ccc(OCc2ccccn2)cc1 **Molecular Formula:** C15H13NO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_9730>.
Cn1nnnc1NC=O
What is the building block token for the following molecule?
Cn1nnnc1NC=O
<BB_9730>
What is the molecular formula for <BB_9730>?
The molecular formula for <BB_9730> (Cn1nnnc1NC=O) is C3H5N5O.
Describe the ring structures in building block <BB_9730>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9730>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_9730>.
**Token:** <BB_9730> **SMILES:** Cn1nnnc1NC=O **Molecular Formula:** C3H5N5O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_9731>.
C#C[C@@H](C)N.Cl
What is the building block token for the following molecule?
C#C[C@@H](C)N.Cl
<BB_9731>
What is the molecular formula for <BB_9731>?
The molecular formula for <BB_9731> (C#C[C@@H](C)N.Cl) is C4H8ClN.
Describe the ring structures in building block <BB_9731>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9731>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9731>.
**Token:** <BB_9731> **SMILES:** C#C[C@@H](C)N.Cl **Molecular Formula:** C4H8ClN **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9732>.
O=C(O)c1cnn(CC(F)(F)F)n1
What is the building block token for the following molecule?
O=C(O)c1cnn(CC(F)(F)F)n1
<BB_9732>
What is the molecular formula for <BB_9732>?
The molecular formula for <BB_9732> (O=C(O)c1cnn(CC(F)(F)F)n1) is C5H4F3N3O2.
Describe the ring structures in building block <BB_9732>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9732>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9732>.
**Token:** <BB_9732> **SMILES:** O=C(O)c1cnn(CC(F)(F)F)n1 **Molecular Formula:** C5H4F3N3O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9733>.
CCN1CC(C)C(N)C1
What is the building block token for the following molecule?
CCN1CC(C)C(N)C1
<BB_9733>