instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_9733>?
The molecular formula for <BB_9733> (CCN1CC(C)C(N)C1) is C7H16N2.
Describe the ring structures in building block <BB_9733>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_9733>.
The molecule contains the following groups: Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_9733>.
**Token:** <BB_9733> **SMILES:** CCN1CC(C)C(N)C1 **Molecular Formula:** C7H16N2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_9734>.
O=S1(=O)CCC(Cc2nnc(S)o2)C1
What is the building block token for the following molecule?
O=S1(=O)CCC(Cc2nnc(S)o2)C1
<BB_9734>
What is the molecular formula for <BB_9734>?
The molecular formula for <BB_9734> (O=S1(=O)CCC(Cc2nnc(S)o2)C1) is C7H10N2O3S2.
Describe the ring structures in building block <BB_9734>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_9734>.
The molecule contains the following groups: Thiol.
Provide a comprehensive chemical profile for the building block <BB_9734>.
**Token:** <BB_9734> **SMILES:** O=S1(=O)CCC(Cc2nnc(S)o2)C1 **Molecular Formula:** C7H10N2O3S2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Thiol
Provide the SMILES representation for the building block token <BB_9735>.
COC(=O)C1CC(F)(F)C1(Cl)Cl
What is the building block token for the following molecule?
COC(=O)C1CC(F)(F)C1(Cl)Cl
<BB_9735>
What is the molecular formula for <BB_9735>?
The molecular formula for <BB_9735> (COC(=O)C1CC(F)(F)C1(Cl)Cl) is C6H6Cl2F2O2.
Describe the ring structures in building block <BB_9735>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_9735>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9735>.
**Token:** <BB_9735> **SMILES:** COC(=O)C1CC(F)(F)C1(Cl)Cl **Molecular Formula:** C6H6Cl2F2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9736>.
CN(C)/C=C(\C#N)c1nc2ccccc2[nH]1
What is the building block token for the following molecule?
CN(C)/C=C(\C#N)c1nc2ccccc2[nH]1
<BB_9736>
What is the molecular formula for <BB_9736>?
The molecular formula for <BB_9736> (CN(C)/C=C(\C#N)c1nc2ccccc2[nH]1) is C12H12N4.
Describe the ring structures in building block <BB_9736>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9736>.
The molecule contains the following groups: Tertiary Amine, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9736>.
**Token:** <BB_9736> **SMILES:** CN(C)/C=C(\C#N)c1nc2ccccc2[nH]1 **Molecular Formula:** C12H12N4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Nitrile
Provide the SMILES representation for the building block token <BB_9737>.
COc1ccc(N2CC(C(N)=O)CC2=O)cc1
What is the building block token for the following molecule?
COc1ccc(N2CC(C(N)=O)CC2=O)cc1
<BB_9737>
What is the molecular formula for <BB_9737>?
The molecular formula for <BB_9737> (COc1ccc(N2CC(C(N)=O)CC2=O)cc1) is C12H14N2O3.
Describe the ring structures in building block <BB_9737>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9737>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_9737>.
**Token:** <BB_9737> **SMILES:** COc1ccc(N2CC(C(N)=O)CC2=O)cc1 **Molecular Formula:** C12H14N2O3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amide, Ether
Provide the SMILES representation for the building block token <BB_9738>.
O=[N+]([O-])c1cc(S(=O)(=O)N2CCCCC2)ccc1Cl
What is the building block token for the following molecule?
O=[N+]([O-])c1cc(S(=O)(=O)N2CCCCC2)ccc1Cl
<BB_9738>
What is the molecular formula for <BB_9738>?
The molecular formula for <BB_9738> (O=[N+]([O-])c1cc(S(=O)(=O)N2CCCCC2)ccc1Cl) is C11H13ClN2O4S.
Describe the ring structures in building block <BB_9738>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9738>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I), Nitro, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_9738>.
**Token:** <BB_9738> **SMILES:** O=[N+]([O-])c1cc(S(=O)(=O)N2CCCCC2)ccc1Cl **Molecular Formula:** C11H13ClN2O4S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I), Nitro, Sulfonamide
Provide the SMILES representation for the building block token <BB_9739>.
COC1(C(F)(F)F)CC(N)(CO)C1.Cl
What is the building block token for the following molecule?
COC1(C(F)(F)F)CC(N)(CO)C1.Cl
<BB_9739>
What is the molecular formula for <BB_9739>?
The molecular formula for <BB_9739> (COC1(C(F)(F)F)CC(N)(CO)C1.Cl) is C7H13ClF3NO2.
Describe the ring structures in building block <BB_9739>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_9739>.
The molecule contains the following groups: Amine, Alcohol, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9739>.
**Token:** <BB_9739> **SMILES:** COC1(C(F)(F)F)CC(N)(CO)C1.Cl **Molecular Formula:** C7H13ClF3NO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Amine, Alcohol, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9740>.
CC(C(=O)O)c1ccc(N2CCOCC2)cc1
What is the building block token for the following molecule?
CC(C(=O)O)c1ccc(N2CCOCC2)cc1
<BB_9740>
What is the molecular formula for <BB_9740>?
The molecular formula for <BB_9740> (CC(C(=O)O)c1ccc(N2CCOCC2)cc1) is C13H17NO3.
Describe the ring structures in building block <BB_9740>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9740>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_9740>.
**Token:** <BB_9740> **SMILES:** CC(C(=O)O)c1ccc(N2CCOCC2)cc1 **Molecular Formula:** C13H17NO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Tertiary Amine, Ether
Provide the SMILES representation for the building block token <BB_9741>.
N#C[C@H]1C[C@H](O)[C@@H](CO)O1
What is the building block token for the following molecule?
N#C[C@H]1C[C@H](O)[C@@H](CO)O1
<BB_9741>
What is the molecular formula for <BB_9741>?
The molecular formula for <BB_9741> (N#C[C@H]1C[C@H](O)[C@@H](CO)O1) is C6H9NO3.
Describe the ring structures in building block <BB_9741>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_9741>.
The molecule contains the following groups: Alcohol, Ether, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9741>.
**Token:** <BB_9741> **SMILES:** N#C[C@H]1C[C@H](O)[C@@H](CO)O1 **Molecular Formula:** C6H9NO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Alcohol, Ether, Nitrile
Provide the SMILES representation for the building block token <BB_9742>.
CN1CCC(F)(CN)CC1.Cl.Cl
What is the building block token for the following molecule?
CN1CCC(F)(CN)CC1.Cl.Cl
<BB_9742>
What is the molecular formula for <BB_9742>?
The molecular formula for <BB_9742> (CN1CCC(F)(CN)CC1.Cl.Cl) is C7H17Cl2FN2.
Describe the ring structures in building block <BB_9742>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9742>.
The molecule contains the following groups: Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9742>.
**Token:** <BB_9742> **SMILES:** CN1CCC(F)(CN)CC1.Cl.Cl **Molecular Formula:** C7H17Cl2FN2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9743>.
CC(=O)CCCCC(=O)O
What is the building block token for the following molecule?
CC(=O)CCCCC(=O)O
<BB_9743>
What is the molecular formula for <BB_9743>?
The molecular formula for <BB_9743> (CC(=O)CCCCC(=O)O) is C7H12O3.
Describe the ring structures in building block <BB_9743>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9743>.
The molecule contains the following groups: Carboxylic Acid, Ketone.
Provide a comprehensive chemical profile for the building block <BB_9743>.
**Token:** <BB_9743> **SMILES:** CC(=O)CCCCC(=O)O **Molecular Formula:** C7H12O3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Ketone
Provide the SMILES representation for the building block token <BB_9744>.
NCCOP(=O)([O-])OCC(=O)O.[K+]
What is the building block token for the following molecule?
NCCOP(=O)([O-])OCC(=O)O.[K+]
<BB_9744>
What is the molecular formula for <BB_9744>?
The molecular formula for <BB_9744> (NCCOP(=O)([O-])OCC(=O)O.[K+]) is C4H9KNO6P.
Describe the ring structures in building block <BB_9744>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9744>.
The molecule contains the following groups: Carboxylic Acid, Amine.
Provide a comprehensive chemical profile for the building block <BB_9744>.
**Token:** <BB_9744> **SMILES:** NCCOP(=O)([O-])OCC(=O)O.[K+] **Molecular Formula:** C4H9KNO6P **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Amine
Provide the SMILES representation for the building block token <BB_9745>.
CC(C)(C)OC(=O)N1CCC(C(=O)O)C2C1C2(F)F
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCC(C(=O)O)C2C1C2(F)F
<BB_9745>
What is the molecular formula for <BB_9745>?
The molecular formula for <BB_9745> (CC(C)(C)OC(=O)N1CCC(C(=O)O)C2C1C2(F)F) is C12H17F2NO4.
Describe the ring structures in building block <BB_9745>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_9745>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9745>.
**Token:** <BB_9745> **SMILES:** CC(C)(C)OC(=O)N1CCC(C(=O)O)C2C1C2(F)F **Molecular Formula:** C12H17F2NO4 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Carboxylic Acid, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9746>.
Cl.Cl.NCc1c(F)ccc(N)c1F
What is the building block token for the following molecule?
Cl.Cl.NCc1c(F)ccc(N)c1F
<BB_9746>
What is the molecular formula for <BB_9746>?
The molecular formula for <BB_9746> (Cl.Cl.NCc1c(F)ccc(N)c1F) is C7H10Cl2F2N2.
Describe the ring structures in building block <BB_9746>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9746>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9746>.
**Token:** <BB_9746> **SMILES:** Cl.Cl.NCc1c(F)ccc(N)c1F **Molecular Formula:** C7H10Cl2F2N2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9747>.
Cn1cc(CO)ccc1=O
What is the building block token for the following molecule?
Cn1cc(CO)ccc1=O
<BB_9747>
What is the molecular formula for <BB_9747>?
The molecular formula for <BB_9747> (Cn1cc(CO)ccc1=O) is C7H9NO2.
Describe the ring structures in building block <BB_9747>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9747>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_9747>.
**Token:** <BB_9747> **SMILES:** Cn1cc(CO)ccc1=O **Molecular Formula:** C7H9NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_9748>.
COC(=O)[C@H]1COC(C)(C)O1
What is the building block token for the following molecule?
COC(=O)[C@H]1COC(C)(C)O1
<BB_9748>
What is the molecular formula for <BB_9748>?
The molecular formula for <BB_9748> (COC(=O)[C@H]1COC(C)(C)O1) is C7H12O4.
Describe the ring structures in building block <BB_9748>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_9748>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_9748>.
**Token:** <BB_9748> **SMILES:** COC(=O)[C@H]1COC(C)(C)O1 **Molecular Formula:** C7H12O4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_9749>.
O=CC1=C(c2ccccc2)Nc2ncnn2C1
What is the building block token for the following molecule?
O=CC1=C(c2ccccc2)Nc2ncnn2C1
<BB_9749>
What is the molecular formula for <BB_9749>?
The molecular formula for <BB_9749> (O=CC1=C(c2ccccc2)Nc2ncnn2C1) is C12H10N4O.
Describe the ring structures in building block <BB_9749>.
The molecule contains 3 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9749>.
The molecule contains the following groups: Secondary Amine, Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_9749>.
**Token:** <BB_9749> **SMILES:** O=CC1=C(c2ccccc2)Nc2ncnn2C1 **Molecular Formula:** C12H10N4O **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Secondary Amine, Aldehyde