instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_1016>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_1016>.
**Token:** <BB_1016> **SMILES:** CC(C)N1CCC(=O)NC1=O **Molecular Formula:** C7H12N2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_1017>.
CC(CN)CN1CCOC1=O.O=C(O)C(F)(F)F
What is the building block token for the following molecule?
CC(CN)CN1CCOC1=O.O=C(O)C(F)(F)F
<BB_1017>
What is the molecular formula for <BB_1017>?
The molecular formula for <BB_1017> (CC(CN)CN1CCOC1=O.O=C(O)C(F)(F)F) is C9H15F3N2O4.
Describe the ring structures in building block <BB_1017>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_1017>.
The molecule contains the following groups: Carboxylic Acid, Amine, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1017>.
**Token:** <BB_1017> **SMILES:** CC(CN)CN1CCOC1=O.O=C(O)C(F)(F)F **Molecular Formula:** C9H15F3N2O4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amine, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1018>.
COC(=O)c1cc(OC)ccc1CBr
What is the building block token for the following molecule?
COC(=O)c1cc(OC)ccc1CBr
<BB_1018>
What is the molecular formula for <BB_1018>?
The molecular formula for <BB_1018> (COC(=O)c1cc(OC)ccc1CBr) is C10H11BrO3.
Describe the ring structures in building block <BB_1018>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1018>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1018>.
**Token:** <BB_1018> **SMILES:** COC(=O)c1cc(OC)ccc1CBr **Molecular Formula:** C10H11BrO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1019>.
CNCCc1ccc(O)c(Br)c1.Cl
What is the building block token for the following molecule?
CNCCc1ccc(O)c(Br)c1.Cl
<BB_1019>
What is the molecular formula for <BB_1019>?
The molecular formula for <BB_1019> (CNCCc1ccc(O)c(Br)c1.Cl) is C9H13BrClNO.
Describe the ring structures in building block <BB_1019>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1019>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1019>.
**Token:** <BB_1019> **SMILES:** CNCCc1ccc(O)c(Br)c1.Cl **Molecular Formula:** C9H13BrClNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1020>.
O=C1CCC2(CC1)N=N2
What is the building block token for the following molecule?
O=C1CCC2(CC1)N=N2
<BB_1020>
What is the molecular formula for <BB_1020>?
The molecular formula for <BB_1020> (O=C1CCC2(CC1)N=N2) is C6H8N2O.
Describe the ring structures in building block <BB_1020>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_1020>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_1020>.
**Token:** <BB_1020> **SMILES:** O=C1CCC2(CC1)N=N2 **Molecular Formula:** C6H8N2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_1021>.
O=c1ccn(-c2cccc(Br)c2)[nH]1
What is the building block token for the following molecule?
O=c1ccn(-c2cccc(Br)c2)[nH]1
<BB_1021>
What is the molecular formula for <BB_1021>?
The molecular formula for <BB_1021> (O=c1ccn(-c2cccc(Br)c2)[nH]1) is C9H7BrN2O.
Describe the ring structures in building block <BB_1021>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1021>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1021>.
**Token:** <BB_1021> **SMILES:** O=c1ccn(-c2cccc(Br)c2)[nH]1 **Molecular Formula:** C9H7BrN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1022>.
Cl.NCCCSC(F)F
What is the building block token for the following molecule?
Cl.NCCCSC(F)F
<BB_1022>
What is the molecular formula for <BB_1022>?
The molecular formula for <BB_1022> (Cl.NCCCSC(F)F) is C4H10ClF2NS.
Describe the ring structures in building block <BB_1022>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1022>.
The molecule contains the following groups: Amine, Sulfide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1022>.
**Token:** <BB_1022> **SMILES:** Cl.NCCCSC(F)F **Molecular Formula:** C4H10ClF2NS **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Sulfide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1023>.
C[C@@H]1CC[C@H](CCCN)O1
What is the building block token for the following molecule?
C[C@@H]1CC[C@H](CCCN)O1
<BB_1023>
What is the molecular formula for <BB_1023>?
The molecular formula for <BB_1023> (C[C@@H]1CC[C@H](CCCN)O1) is C8H17NO.
Describe the ring structures in building block <BB_1023>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_1023>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_1023>.
**Token:** <BB_1023> **SMILES:** C[C@@H]1CC[C@H](CCCN)O1 **Molecular Formula:** C8H17NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_1024>.
COc1cccc(-c2nc(CC(=O)[O-])cs2)c1.[Na+]
What is the building block token for the following molecule?
COc1cccc(-c2nc(CC(=O)[O-])cs2)c1.[Na+]
<BB_1024>
What is the molecular formula for <BB_1024>?
The molecular formula for <BB_1024> (COc1cccc(-c2nc(CC(=O)[O-])cs2)c1.[Na+]) is C12H10NNaO3S.
Describe the ring structures in building block <BB_1024>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1024>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_1024>.
**Token:** <BB_1024> **SMILES:** COc1cccc(-c2nc(CC(=O)[O-])cs2)c1.[Na+] **Molecular Formula:** C12H10NNaO3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_1025>.
CCC(NC(C)=O)C(=O)O
What is the building block token for the following molecule?
CCC(NC(C)=O)C(=O)O
<BB_1025>
What is the molecular formula for <BB_1025>?
The molecular formula for <BB_1025> (CCC(NC(C)=O)C(=O)O) is C6H11NO3.
Describe the ring structures in building block <BB_1025>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1025>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_1025>.
**Token:** <BB_1025> **SMILES:** CCC(NC(C)=O)C(=O)O **Molecular Formula:** C6H11NO3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_1026>.
O=C(O)C1C[C@]2(c3cccc(C(F)(F)F)c3)C[C@H]1C2
What is the building block token for the following molecule?
O=C(O)C1C[C@]2(c3cccc(C(F)(F)F)c3)C[C@H]1C2
<BB_1026>
What is the molecular formula for <BB_1026>?
The molecular formula for <BB_1026> (O=C(O)C1C[C@]2(c3cccc(C(F)(F)F)c3)C[C@H]1C2) is C14H13F3O2.
Describe the ring structures in building block <BB_1026>.
The molecule contains 4 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 5, an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1026>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1026>.
**Token:** <BB_1026> **SMILES:** O=C(O)C1C[C@]2(c3cccc(C(F)(F)F)c3)C[C@H]1C2 **Molecular Formula:** C14H13F3O2 **Ring System:** The molecule contains 4 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 5, an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1027>.
O=C(O)c1nc(F)ccc1Br
What is the building block token for the following molecule?
O=C(O)c1nc(F)ccc1Br
<BB_1027>
What is the molecular formula for <BB_1027>?
The molecular formula for <BB_1027> (O=C(O)c1nc(F)ccc1Br) is C6H3BrFNO2.
Describe the ring structures in building block <BB_1027>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1027>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1027>.
**Token:** <BB_1027> **SMILES:** O=C(O)c1nc(F)ccc1Br **Molecular Formula:** C6H3BrFNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1028>.
C1CCC(c2nc(C3CNCCO3)no2)C1.Cl
What is the building block token for the following molecule?
C1CCC(c2nc(C3CNCCO3)no2)C1.Cl
<BB_1028>
What is the molecular formula for <BB_1028>?
The molecular formula for <BB_1028> (C1CCC(c2nc(C3CNCCO3)no2)C1.Cl) is C11H18ClN3O2.
Describe the ring structures in building block <BB_1028>.
The molecule contains 3 ring(s): an aliphatic ring of size 5, an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1028>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1028>.
**Token:** <BB_1028> **SMILES:** C1CCC(c2nc(C3CNCCO3)no2)C1.Cl **Molecular Formula:** C11H18ClN3O2 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 5, an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1029>.
O=c1c(Cl)c(Cl)cnn1C1CCS(=O)(=O)C1
What is the building block token for the following molecule?
O=c1c(Cl)c(Cl)cnn1C1CCS(=O)(=O)C1
<BB_1029>
What is the molecular formula for <BB_1029>?
The molecular formula for <BB_1029> (O=c1c(Cl)c(Cl)cnn1C1CCS(=O)(=O)C1) is C8H8Cl2N2O3S.
Describe the ring structures in building block <BB_1029>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1029>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1029>.
**Token:** <BB_1029> **SMILES:** O=c1c(Cl)c(Cl)cnn1C1CCS(=O)(=O)C1 **Molecular Formula:** C8H8Cl2N2O3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1030>.
Cc1cc(NC(=O)CCl)n(-c2ccccc2F)n1
What is the building block token for the following molecule?
Cc1cc(NC(=O)CCl)n(-c2ccccc2F)n1
<BB_1030>
What is the molecular formula for <BB_1030>?
The molecular formula for <BB_1030> (Cc1cc(NC(=O)CCl)n(-c2ccccc2F)n1) is C12H11ClFN3O.
Describe the ring structures in building block <BB_1030>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1030>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1030>.
**Token:** <BB_1030> **SMILES:** Cc1cc(NC(=O)CCl)n(-c2ccccc2F)n1 **Molecular Formula:** C12H11ClFN3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1031>.
COC(=O)C(N)c1ccc2c(c1)OCCO2.Cl
What is the building block token for the following molecule?
COC(=O)C(N)c1ccc2c(c1)OCCO2.Cl
<BB_1031>
What is the molecular formula for <BB_1031>?
The molecular formula for <BB_1031> (COC(=O)C(N)c1ccc2c(c1)OCCO2.Cl) is C11H14ClNO4.
Describe the ring structures in building block <BB_1031>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1031>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1031>.
**Token:** <BB_1031> **SMILES:** COC(=O)C(N)c1ccc2c(c1)OCCO2.Cl **Molecular Formula:** C11H14ClNO4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1032>.
CCOC(=O)C(F)(Br)C1CCC1
What is the building block token for the following molecule?
CCOC(=O)C(F)(Br)C1CCC1
<BB_1032>
What is the molecular formula for <BB_1032>?
The molecular formula for <BB_1032> (CCOC(=O)C(F)(Br)C1CCC1) is C8H12BrFO2.
Describe the ring structures in building block <BB_1032>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_1032>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1032>.
**Token:** <BB_1032> **SMILES:** CCOC(=O)C(F)(Br)C1CCC1 **Molecular Formula:** C8H12BrFO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1033>.
CCOC(C)CN.Cl
What is the building block token for the following molecule?
CCOC(C)CN.Cl
<BB_1033>