instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_1050>.
Nc1ncc(-c2ccccc2)s1
What is the building block token for the following molecule?
Nc1ncc(-c2ccccc2)s1
<BB_1050>
What is the molecular formula for <BB_1050>?
The molecular formula for <BB_1050> (Nc1ncc(-c2ccccc2)s1) is C9H8N2S.
Describe the ring structures in building block <BB_1050>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1050>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_1050>.
**Token:** <BB_1050> **SMILES:** Nc1ncc(-c2ccccc2)s1 **Molecular Formula:** C9H8N2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_1051>.
O=C1CCCc2nn(-c3ccccc3)cc21
What is the building block token for the following molecule?
O=C1CCCc2nn(-c3ccccc3)cc21
<BB_1051>
What is the molecular formula for <BB_1051>?
The molecular formula for <BB_1051> (O=C1CCCc2nn(-c3ccccc3)cc21) is C13H12N2O.
Describe the ring structures in building block <BB_1051>.
The molecule contains 3 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1051>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_1051>.
**Token:** <BB_1051> **SMILES:** O=C1CCCc2nn(-c3ccccc3)cc21 **Molecular Formula:** C13H12N2O **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_1052>.
NNC(=O)c1ccc2[nH]ccc2c1
What is the building block token for the following molecule?
NNC(=O)c1ccc2[nH]ccc2c1
<BB_1052>
What is the molecular formula for <BB_1052>?
The molecular formula for <BB_1052> (NNC(=O)c1ccc2[nH]ccc2c1) is C9H9N3O.
Describe the ring structures in building block <BB_1052>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1052>.
The molecule contains the following groups: Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_1052>.
**Token:** <BB_1052> **SMILES:** NNC(=O)c1ccc2[nH]ccc2c1 **Molecular Formula:** C9H9N3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine, Amide
Provide the SMILES representation for the building block token <BB_1053>.
O=C(O)C1=CCCC1
What is the building block token for the following molecule?
O=C(O)C1=CCCC1
<BB_1053>
What is the molecular formula for <BB_1053>?
The molecular formula for <BB_1053> (O=C(O)C1=CCCC1) is C6H8O2.
Describe the ring structures in building block <BB_1053>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_1053>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1053>.
**Token:** <BB_1053> **SMILES:** O=C(O)C1=CCCC1 **Molecular Formula:** C6H8O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1054>.
Cl.Nc1ccc2cc(C(=O)O)ccc2n1
What is the building block token for the following molecule?
Cl.Nc1ccc2cc(C(=O)O)ccc2n1
<BB_1054>
What is the molecular formula for <BB_1054>?
The molecular formula for <BB_1054> (Cl.Nc1ccc2cc(C(=O)O)ccc2n1) is C10H9ClN2O2.
Describe the ring structures in building block <BB_1054>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1054>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1054>.
**Token:** <BB_1054> **SMILES:** Cl.Nc1ccc2cc(C(=O)O)ccc2n1 **Molecular Formula:** C10H9ClN2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1055>.
CC(C)(C)S(=O)[O-].[Na+]
What is the building block token for the following molecule?
CC(C)(C)S(=O)[O-].[Na+]
<BB_1055>
What is the molecular formula for <BB_1055>?
The molecular formula for <BB_1055> (CC(C)(C)S(=O)[O-].[Na+]) is C4H9NaO2S.
Describe the ring structures in building block <BB_1055>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1055>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_1055>.
**Token:** <BB_1055> **SMILES:** CC(C)(C)S(=O)[O-].[Na+] **Molecular Formula:** C4H9NaO2S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_1056>.
COC1CCCC(Oc2ccnc(N)n2)C1
What is the building block token for the following molecule?
COC1CCCC(Oc2ccnc(N)n2)C1
<BB_1056>
What is the molecular formula for <BB_1056>?
The molecular formula for <BB_1056> (COC1CCCC(Oc2ccnc(N)n2)C1) is C11H17N3O2.
Describe the ring structures in building block <BB_1056>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1056>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_1056>.
**Token:** <BB_1056> **SMILES:** COC1CCCC(Oc2ccnc(N)n2)C1 **Molecular Formula:** C11H17N3O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_1057>.
CCC(C)c1ccc(N)cn1.Cl.Cl
What is the building block token for the following molecule?
CCC(C)c1ccc(N)cn1.Cl.Cl
<BB_1057>
What is the molecular formula for <BB_1057>?
The molecular formula for <BB_1057> (CCC(C)c1ccc(N)cn1.Cl.Cl) is C9H16Cl2N2.
Describe the ring structures in building block <BB_1057>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1057>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1057>.
**Token:** <BB_1057> **SMILES:** CCC(C)c1ccc(N)cn1.Cl.Cl **Molecular Formula:** C9H16Cl2N2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1058>.
Clc1cc(Br)c2c(c1)CCC2
What is the building block token for the following molecule?
Clc1cc(Br)c2c(c1)CCC2
<BB_1058>
What is the molecular formula for <BB_1058>?
The molecular formula for <BB_1058> (Clc1cc(Br)c2c(c1)CCC2) is C9H8BrCl.
Describe the ring structures in building block <BB_1058>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1058>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1058>.
**Token:** <BB_1058> **SMILES:** Clc1cc(Br)c2c(c1)CCC2 **Molecular Formula:** C9H8BrCl **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1059>.
CN1CCNC(=O)C1=O
What is the building block token for the following molecule?
CN1CCNC(=O)C1=O
<BB_1059>
What is the molecular formula for <BB_1059>?
The molecular formula for <BB_1059> (CN1CCNC(=O)C1=O) is C5H8N2O2.
Describe the ring structures in building block <BB_1059>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1059>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_1059>.
**Token:** <BB_1059> **SMILES:** CN1CCNC(=O)C1=O **Molecular Formula:** C5H8N2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_1060>.
COc1ccc(CCC(=O)O)c(Cl)c1OC
What is the building block token for the following molecule?
COc1ccc(CCC(=O)O)c(Cl)c1OC
<BB_1060>
What is the molecular formula for <BB_1060>?
The molecular formula for <BB_1060> (COc1ccc(CCC(=O)O)c(Cl)c1OC) is C11H13ClO4.
Describe the ring structures in building block <BB_1060>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1060>.
The molecule contains the following groups: Carboxylic Acid, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1060>.
**Token:** <BB_1060> **SMILES:** COc1ccc(CCC(=O)O)c(Cl)c1OC **Molecular Formula:** C11H13ClO4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1061>.
COc1ccc(-c2noc(CCl)n2)cc1F
What is the building block token for the following molecule?
COc1ccc(-c2noc(CCl)n2)cc1F
<BB_1061>
What is the molecular formula for <BB_1061>?
The molecular formula for <BB_1061> (COc1ccc(-c2noc(CCl)n2)cc1F) is C10H8ClFN2O2.
Describe the ring structures in building block <BB_1061>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1061>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1061>.
**Token:** <BB_1061> **SMILES:** COc1ccc(-c2noc(CCl)n2)cc1F **Molecular Formula:** C10H8ClFN2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1062>.
COC(=O)CCOc1ccc(S(=O)(=O)Cl)cc1
What is the building block token for the following molecule?
COC(=O)CCOc1ccc(S(=O)(=O)Cl)cc1
<BB_1062>
What is the molecular formula for <BB_1062>?
The molecular formula for <BB_1062> (COC(=O)CCOc1ccc(S(=O)(=O)Cl)cc1) is C10H11ClO5S.
Describe the ring structures in building block <BB_1062>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1062>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1062>.
**Token:** <BB_1062> **SMILES:** COC(=O)CCOc1ccc(S(=O)(=O)Cl)cc1 **Molecular Formula:** C10H11ClO5S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1063>.
CC12CC(O)(C1)C2
What is the building block token for the following molecule?
CC12CC(O)(C1)C2
<BB_1063>
What is the molecular formula for <BB_1063>?
The molecular formula for <BB_1063> (CC12CC(O)(C1)C2) is C6H10O.
Describe the ring structures in building block <BB_1063>.
The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4, an aliphatic ring of size 4.
List the primary functional groups present in <BB_1063>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_1063>.
**Token:** <BB_1063> **SMILES:** CC12CC(O)(C1)C2 **Molecular Formula:** C6H10O **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4, an aliphatic ring of size 4. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_1064>.
Cl.NCCNS(=O)(=O)c1cccs1
What is the building block token for the following molecule?
Cl.NCCNS(=O)(=O)c1cccs1
<BB_1064>
What is the molecular formula for <BB_1064>?
The molecular formula for <BB_1064> (Cl.NCCNS(=O)(=O)c1cccs1) is C6H11ClN2O2S2.
Describe the ring structures in building block <BB_1064>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1064>.
The molecule contains the following groups: Amine, Secondary Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_1064>.
**Token:** <BB_1064> **SMILES:** Cl.NCCNS(=O)(=O)c1cccs1 **Molecular Formula:** C6H11ClN2O2S2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Secondary Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_1065>.
CCN1C(=O)CC[C@H](C(=O)O)[C@H]1c1ccccc1Cl
What is the building block token for the following molecule?
CCN1C(=O)CC[C@H](C(=O)O)[C@H]1c1ccccc1Cl
<BB_1065>
What is the molecular formula for <BB_1065>?
The molecular formula for <BB_1065> (CCN1C(=O)CC[C@H](C(=O)O)[C@H]1c1ccccc1Cl) is C14H16ClNO3.
Describe the ring structures in building block <BB_1065>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1065>.
The molecule contains the following groups: Carboxylic Acid, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1065>.
**Token:** <BB_1065> **SMILES:** CCN1C(=O)CC[C@H](C(=O)O)[C@H]1c1ccccc1Cl **Molecular Formula:** C14H16ClNO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1066>.
CS(=O)(=O)N1CCC(Br)C1
What is the building block token for the following molecule?
CS(=O)(=O)N1CCC(Br)C1
<BB_1066>
What is the molecular formula for <BB_1066>?
The molecular formula for <BB_1066> (CS(=O)(=O)N1CCC(Br)C1) is C5H10BrNO2S.
Describe the ring structures in building block <BB_1066>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.