instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_1083>?
The molecular formula for <BB_1083> (Cn1cncc1C1CCCNC1) is C9H15N3.
Describe the ring structures in building block <BB_1083>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1083>.
The molecule contains the following groups: Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_1083>.
**Token:** <BB_1083> **SMILES:** Cn1cncc1C1CCCNC1 **Molecular Formula:** C9H15N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine
Provide the SMILES representation for the building block token <BB_1084>.
Cc1ccc2ncc(C(=O)O)n2c1.Cl
What is the building block token for the following molecule?
Cc1ccc2ncc(C(=O)O)n2c1.Cl
<BB_1084>
What is the molecular formula for <BB_1084>?
The molecular formula for <BB_1084> (Cc1ccc2ncc(C(=O)O)n2c1.Cl) is C9H9ClN2O2.
Describe the ring structures in building block <BB_1084>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1084>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1084>.
**Token:** <BB_1084> **SMILES:** Cc1ccc2ncc(C(=O)O)n2c1.Cl **Molecular Formula:** C9H9ClN2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1085>.
Nc1cccc(-c2ccc(Cl)nc2)c1
What is the building block token for the following molecule?
Nc1cccc(-c2ccc(Cl)nc2)c1
<BB_1085>
What is the molecular formula for <BB_1085>?
The molecular formula for <BB_1085> (Nc1cccc(-c2ccc(Cl)nc2)c1) is C11H9ClN2.
Describe the ring structures in building block <BB_1085>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1085>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1085>.
**Token:** <BB_1085> **SMILES:** Nc1cccc(-c2ccc(Cl)nc2)c1 **Molecular Formula:** C11H9ClN2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1086>.
CCOC(=O)CC1=CCc2ccccc21
What is the building block token for the following molecule?
CCOC(=O)CC1=CCc2ccccc21
<BB_1086>
What is the molecular formula for <BB_1086>?
The molecular formula for <BB_1086> (CCOC(=O)CC1=CCc2ccccc21) is C13H14O2.
Describe the ring structures in building block <BB_1086>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1086>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_1086>.
**Token:** <BB_1086> **SMILES:** CCOC(=O)CC1=CCc2ccccc21 **Molecular Formula:** C13H14O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_1087>.
CCC(=O)/C=C/Cl
What is the building block token for the following molecule?
CCC(=O)/C=C/Cl
<BB_1087>
What is the molecular formula for <BB_1087>?
The molecular formula for <BB_1087> (CCC(=O)/C=C/Cl) is C5H7ClO.
Describe the ring structures in building block <BB_1087>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1087>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1087>.
**Token:** <BB_1087> **SMILES:** CCC(=O)/C=C/Cl **Molecular Formula:** C5H7ClO **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1088>.
O=C1CCCc2occ(C(=O)O)c2N1
What is the building block token for the following molecule?
O=C1CCCc2occ(C(=O)O)c2N1
<BB_1088>
What is the molecular formula for <BB_1088>?
The molecular formula for <BB_1088> (O=C1CCCc2occ(C(=O)O)c2N1) is C9H9NO4.
Describe the ring structures in building block <BB_1088>.
The molecule contains 2 ring(s): an aliphatic ring of size 7, an aromatic ring of size 5.
List the primary functional groups present in <BB_1088>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_1088>.
**Token:** <BB_1088> **SMILES:** O=C1CCCc2occ(C(=O)O)c2N1 **Molecular Formula:** C9H9NO4 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 7, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_1089>.
CCc1nc(CCN)cs1.Cl.Cl
What is the building block token for the following molecule?
CCc1nc(CCN)cs1.Cl.Cl
<BB_1089>
What is the molecular formula for <BB_1089>?
The molecular formula for <BB_1089> (CCc1nc(CCN)cs1.Cl.Cl) is C7H14Cl2N2S.
Describe the ring structures in building block <BB_1089>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1089>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1089>.
**Token:** <BB_1089> **SMILES:** CCc1nc(CCN)cs1.Cl.Cl **Molecular Formula:** C7H14Cl2N2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1090>.
N#Cc1ccccc1Nc1ccccc1C(F)(F)F
What is the building block token for the following molecule?
N#Cc1ccccc1Nc1ccccc1C(F)(F)F
<BB_1090>
What is the molecular formula for <BB_1090>?
The molecular formula for <BB_1090> (N#Cc1ccccc1Nc1ccccc1C(F)(F)F) is C14H9F3N2.
Describe the ring structures in building block <BB_1090>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1090>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1090>.
**Token:** <BB_1090> **SMILES:** N#Cc1ccccc1Nc1ccccc1C(F)(F)F **Molecular Formula:** C14H9F3N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_1091>.
Cl.NCC1CC1Cl
What is the building block token for the following molecule?
Cl.NCC1CC1Cl
<BB_1091>
What is the molecular formula for <BB_1091>?
The molecular formula for <BB_1091> (Cl.NCC1CC1Cl) is C4H9Cl2N.
Describe the ring structures in building block <BB_1091>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_1091>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1091>.
**Token:** <BB_1091> **SMILES:** Cl.NCC1CC1Cl **Molecular Formula:** C4H9Cl2N **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1092>.
Cn1cc(-c2cc(C(=O)O)c3ccccc3n2)cn1
What is the building block token for the following molecule?
Cn1cc(-c2cc(C(=O)O)c3ccccc3n2)cn1
<BB_1092>
What is the molecular formula for <BB_1092>?
The molecular formula for <BB_1092> (Cn1cc(-c2cc(C(=O)O)c3ccccc3n2)cn1) is C14H11N3O2.
Describe the ring structures in building block <BB_1092>.
The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1092>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1092>.
**Token:** <BB_1092> **SMILES:** Cn1cc(-c2cc(C(=O)O)c3ccccc3n2)cn1 **Molecular Formula:** C14H11N3O2 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1093>.
NS(=O)(=O)c1ccc(C=O)cc1Cl
What is the building block token for the following molecule?
NS(=O)(=O)c1ccc(C=O)cc1Cl
<BB_1093>
What is the molecular formula for <BB_1093>?
The molecular formula for <BB_1093> (NS(=O)(=O)c1ccc(C=O)cc1Cl) is C7H6ClNO3S.
Describe the ring structures in building block <BB_1093>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1093>.
The molecule contains the following groups: Amine, Aldehyde, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_1093>.
**Token:** <BB_1093> **SMILES:** NS(=O)(=O)c1ccc(C=O)cc1Cl **Molecular Formula:** C7H6ClNO3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Aldehyde, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_1094>.
ClCCCCCI
What is the building block token for the following molecule?
ClCCCCCI
<BB_1094>
What is the molecular formula for <BB_1094>?
The molecular formula for <BB_1094> (ClCCCCCI) is C5H10ClI.
Describe the ring structures in building block <BB_1094>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1094>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1094>.
**Token:** <BB_1094> **SMILES:** ClCCCCCI **Molecular Formula:** C5H10ClI **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1095>.
COc1cc(Cl)ncc1F
What is the building block token for the following molecule?
COc1cc(Cl)ncc1F
<BB_1095>
What is the molecular formula for <BB_1095>?
The molecular formula for <BB_1095> (COc1cc(Cl)ncc1F) is C6H5ClFNO.
Describe the ring structures in building block <BB_1095>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1095>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1095>.
**Token:** <BB_1095> **SMILES:** COc1cc(Cl)ncc1F **Molecular Formula:** C6H5ClFNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1096>.
CN(C)Cc1cc(C#N)ccc1F
What is the building block token for the following molecule?
CN(C)Cc1cc(C#N)ccc1F
<BB_1096>
What is the molecular formula for <BB_1096>?
The molecular formula for <BB_1096> (CN(C)Cc1cc(C#N)ccc1F) is C10H11FN2.
Describe the ring structures in building block <BB_1096>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1096>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1096>.
**Token:** <BB_1096> **SMILES:** CN(C)Cc1cc(C#N)ccc1F **Molecular Formula:** C10H11FN2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_1097>.
CC(C)(C)OC(=O)N1[C@@H]2CC[C@H]1C[C@@H](CO)C2
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1[C@@H]2CC[C@H]1C[C@@H](CO)C2
<BB_1097>
What is the molecular formula for <BB_1097>?
The molecular formula for <BB_1097> (CC(C)(C)OC(=O)N1[C@@H]2CC[C@H]1C[C@@H](CO)C2) is C13H23NO3.
Describe the ring structures in building block <BB_1097>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1097>.
The molecule contains the following groups: Amide, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_1097>.
**Token:** <BB_1097> **SMILES:** CC(C)(C)OC(=O)N1[C@@H]2CC[C@H]1C[C@@H](CO)C2 **Molecular Formula:** C13H23NO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Amide, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_1098>.
COc1ccc(OC)c(C(=O)CCl)c1
What is the building block token for the following molecule?
COc1ccc(OC)c(C(=O)CCl)c1
<BB_1098>
What is the molecular formula for <BB_1098>?
The molecular formula for <BB_1098> (COc1ccc(OC)c(C(=O)CCl)c1) is C10H11ClO3.
Describe the ring structures in building block <BB_1098>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1098>.
The molecule contains the following groups: Ketone, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1098>.
**Token:** <BB_1098> **SMILES:** COc1ccc(OC)c(C(=O)CCl)c1 **Molecular Formula:** C10H11ClO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1099>.
Cl.[N-]=[N+]=NC[C@@H]1CCCN1
What is the building block token for the following molecule?
Cl.[N-]=[N+]=NC[C@@H]1CCCN1
<BB_1099>
What is the molecular formula for <BB_1099>?
The molecular formula for <BB_1099> (Cl.[N-]=[N+]=NC[C@@H]1CCCN1) is C5H11ClN4.
Describe the ring structures in building block <BB_1099>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_1099>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1099>.
**Token:** <BB_1099> **SMILES:** Cl.[N-]=[N+]=NC[C@@H]1CCCN1 **Molecular Formula:** C5H11ClN4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)