instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_1066>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_1066>.
**Token:** <BB_1066> **SMILES:** CS(=O)(=O)N1CCC(Br)C1 **Molecular Formula:** C5H10BrNO2S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_1067>.
CC(C)(C)OC(=O)NC(Cc1cccs1)C(=O)O
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NC(Cc1cccs1)C(=O)O
<BB_1067>
What is the molecular formula for <BB_1067>?
The molecular formula for <BB_1067> (CC(C)(C)OC(=O)NC(Cc1cccs1)C(=O)O) is C12H17NO4S.
Describe the ring structures in building block <BB_1067>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1067>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_1067>.
**Token:** <BB_1067> **SMILES:** CC(C)(C)OC(=O)NC(Cc1cccs1)C(=O)O **Molecular Formula:** C12H17NO4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_1068>.
CC(C)(C)OC(=O)N1CC[C@]12C[C@@H](C(=O)O)C2
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CC[C@]12C[C@@H](C(=O)O)C2
<BB_1068>
What is the molecular formula for <BB_1068>?
The molecular formula for <BB_1068> (CC(C)(C)OC(=O)N1CC[C@]12C[C@@H](C(=O)O)C2) is C12H19NO4.
Describe the ring structures in building block <BB_1068>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4.
List the primary functional groups present in <BB_1068>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_1068>.
**Token:** <BB_1068> **SMILES:** CC(C)(C)OC(=O)N1CC[C@]12C[C@@H](C(=O)O)C2 **Molecular Formula:** C12H19NO4 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_1069>.
O=S(=O)(c1ccc(C(F)(F)F)cc1)N1CCNCC1
What is the building block token for the following molecule?
O=S(=O)(c1ccc(C(F)(F)F)cc1)N1CCNCC1
<BB_1069>
What is the molecular formula for <BB_1069>?
The molecular formula for <BB_1069> (O=S(=O)(c1ccc(C(F)(F)F)cc1)N1CCNCC1) is C11H13F3N2O2S.
Describe the ring structures in building block <BB_1069>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1069>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_1069>.
**Token:** <BB_1069> **SMILES:** O=S(=O)(c1ccc(C(F)(F)F)cc1)N1CCNCC1 **Molecular Formula:** C11H13F3N2O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_1070>.
COC(=O)c1cc(C(C)(C)C)sc1N
What is the building block token for the following molecule?
COC(=O)c1cc(C(C)(C)C)sc1N
<BB_1070>
What is the molecular formula for <BB_1070>?
The molecular formula for <BB_1070> (COC(=O)c1cc(C(C)(C)C)sc1N) is C10H15NO2S.
Describe the ring structures in building block <BB_1070>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1070>.
The molecule contains the following groups: Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_1070>.
**Token:** <BB_1070> **SMILES:** COC(=O)c1cc(C(C)(C)C)sc1N **Molecular Formula:** C10H15NO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_1071>.
Cl.Nc1ccc(CC(=O)NCCO)cc1
What is the building block token for the following molecule?
Cl.Nc1ccc(CC(=O)NCCO)cc1
<BB_1071>
What is the molecular formula for <BB_1071>?
The molecular formula for <BB_1071> (Cl.Nc1ccc(CC(=O)NCCO)cc1) is C10H15ClN2O2.
Describe the ring structures in building block <BB_1071>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1071>.
The molecule contains the following groups: Amine, Amide, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1071>.
**Token:** <BB_1071> **SMILES:** Cl.Nc1ccc(CC(=O)NCCO)cc1 **Molecular Formula:** C10H15ClN2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1072>.
N#CN=[N+]([O-])c1ccc(C(=O)O)cc1
What is the building block token for the following molecule?
N#CN=[N+]([O-])c1ccc(C(=O)O)cc1
<BB_1072>
What is the molecular formula for <BB_1072>?
The molecular formula for <BB_1072> (N#CN=[N+]([O-])c1ccc(C(=O)O)cc1) is C8H5N3O3.
Describe the ring structures in building block <BB_1072>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1072>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1072>.
**Token:** <BB_1072> **SMILES:** N#CN=[N+]([O-])c1ccc(C(=O)O)cc1 **Molecular Formula:** C8H5N3O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Tertiary Amine, Nitrile
Provide the SMILES representation for the building block token <BB_1073>.
O=C(O)CCCC1CCCCC1
What is the building block token for the following molecule?
O=C(O)CCCC1CCCCC1
<BB_1073>
What is the molecular formula for <BB_1073>?
The molecular formula for <BB_1073> (O=C(O)CCCC1CCCCC1) is C10H18O2.
Describe the ring structures in building block <BB_1073>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1073>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1073>.
**Token:** <BB_1073> **SMILES:** O=C(O)CCCC1CCCCC1 **Molecular Formula:** C10H18O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1074>.
COc1ccnc(CC#N)c1
What is the building block token for the following molecule?
COc1ccnc(CC#N)c1
<BB_1074>
What is the molecular formula for <BB_1074>?
The molecular formula for <BB_1074> (COc1ccnc(CC#N)c1) is C8H8N2O.
Describe the ring structures in building block <BB_1074>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1074>.
The molecule contains the following groups: Ether, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1074>.
**Token:** <BB_1074> **SMILES:** COc1ccnc(CC#N)c1 **Molecular Formula:** C8H8N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Nitrile
Provide the SMILES representation for the building block token <BB_1075>.
Cc1cc(F)cc(Br)c1Cl
What is the building block token for the following molecule?
Cc1cc(F)cc(Br)c1Cl
<BB_1075>
What is the molecular formula for <BB_1075>?
The molecular formula for <BB_1075> (Cc1cc(F)cc(Br)c1Cl) is C7H5BrClF.
Describe the ring structures in building block <BB_1075>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1075>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1075>.
**Token:** <BB_1075> **SMILES:** Cc1cc(F)cc(Br)c1Cl **Molecular Formula:** C7H5BrClF **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1076>.
Cc1ccc(CN)cc1S(C)(=O)=O.Cl
What is the building block token for the following molecule?
Cc1ccc(CN)cc1S(C)(=O)=O.Cl
<BB_1076>
What is the molecular formula for <BB_1076>?
The molecular formula for <BB_1076> (Cc1ccc(CN)cc1S(C)(=O)=O.Cl) is C9H14ClNO2S.
Describe the ring structures in building block <BB_1076>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1076>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1076>.
**Token:** <BB_1076> **SMILES:** Cc1ccc(CN)cc1S(C)(=O)=O.Cl **Molecular Formula:** C9H14ClNO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1077>.
CC(C)(C)OC(=O)N1CCCOC(CC=O)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCCOC(CC=O)C1
<BB_1077>
What is the molecular formula for <BB_1077>?
The molecular formula for <BB_1077> (CC(C)(C)OC(=O)N1CCCOC(CC=O)C1) is C12H21NO4.
Describe the ring structures in building block <BB_1077>.
The molecule contains 1 ring(s): an aliphatic ring of size 7.
List the primary functional groups present in <BB_1077>.
The molecule contains the following groups: Amide, Aldehyde, Ether.
Provide a comprehensive chemical profile for the building block <BB_1077>.
**Token:** <BB_1077> **SMILES:** CC(C)(C)OC(=O)N1CCCOC(CC=O)C1 **Molecular Formula:** C12H21NO4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 7. **Functional Groups:** Amide, Aldehyde, Ether
Provide the SMILES representation for the building block token <BB_1078>.
O=C(O)C1CCCN(c2ccc(C(F)(F)F)cn2)C1
What is the building block token for the following molecule?
O=C(O)C1CCCN(c2ccc(C(F)(F)F)cn2)C1
<BB_1078>
What is the molecular formula for <BB_1078>?
The molecular formula for <BB_1078> (O=C(O)C1CCCN(c2ccc(C(F)(F)F)cn2)C1) is C12H13F3N2O2.
Describe the ring structures in building block <BB_1078>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1078>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1078>.
**Token:** <BB_1078> **SMILES:** O=C(O)C1CCCN(c2ccc(C(F)(F)F)cn2)C1 **Molecular Formula:** C12H13F3N2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1079>.
CCOC(=O)C12COC(CO)(C1)C2
What is the building block token for the following molecule?
CCOC(=O)C12COC(CO)(C1)C2
<BB_1079>
What is the molecular formula for <BB_1079>?
The molecular formula for <BB_1079> (CCOC(=O)C12COC(CO)(C1)C2) is C9H14O4.
Describe the ring structures in building block <BB_1079>.
The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1079>.
The molecule contains the following groups: Ester, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_1079>.
**Token:** <BB_1079> **SMILES:** CCOC(=O)C12COC(CO)(C1)C2 **Molecular Formula:** C9H14O4 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Ester, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_1080>.
FC(F)Oc1nccnc1Cl
What is the building block token for the following molecule?
FC(F)Oc1nccnc1Cl
<BB_1080>
What is the molecular formula for <BB_1080>?
The molecular formula for <BB_1080> (FC(F)Oc1nccnc1Cl) is C5H3ClF2N2O.
Describe the ring structures in building block <BB_1080>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1080>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1080>.
**Token:** <BB_1080> **SMILES:** FC(F)Oc1nccnc1Cl **Molecular Formula:** C5H3ClF2N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1081>.
COC(=O)C1(C(F)F)CCNC1.Cl
What is the building block token for the following molecule?
COC(=O)C1(C(F)F)CCNC1.Cl
<BB_1081>
What is the molecular formula for <BB_1081>?
The molecular formula for <BB_1081> (COC(=O)C1(C(F)F)CCNC1.Cl) is C7H12ClF2NO2.
Describe the ring structures in building block <BB_1081>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_1081>.
The molecule contains the following groups: Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1081>.
**Token:** <BB_1081> **SMILES:** COC(=O)C1(C(F)F)CCNC1.Cl **Molecular Formula:** C7H12ClF2NO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1082>.
C=CC(=O)N1CCCC1
What is the building block token for the following molecule?
C=CC(=O)N1CCCC1
<BB_1082>
What is the molecular formula for <BB_1082>?
The molecular formula for <BB_1082> (C=CC(=O)N1CCCC1) is C7H11NO.
Describe the ring structures in building block <BB_1082>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_1082>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_1082>.
**Token:** <BB_1082> **SMILES:** C=CC(=O)N1CCCC1 **Molecular Formula:** C7H11NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_1083>.
Cn1cncc1C1CCCNC1
What is the building block token for the following molecule?
Cn1cncc1C1CCCNC1
<BB_1083>