instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_1100>.
CC1(S(N)(=O)=O)CCCC1
What is the building block token for the following molecule?
CC1(S(N)(=O)=O)CCCC1
<BB_1100>
What is the molecular formula for <BB_1100>?
The molecular formula for <BB_1100> (CC1(S(N)(=O)=O)CCCC1) is C6H13NO2S.
Describe the ring structures in building block <BB_1100>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_1100>.
The molecule contains the following groups: Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_1100>.
**Token:** <BB_1100> **SMILES:** CC1(S(N)(=O)=O)CCCC1 **Molecular Formula:** C6H13NO2S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_1101>.
CCOS(=O)c1ccc(Cl)cc1
What is the building block token for the following molecule?
CCOS(=O)c1ccc(Cl)cc1
<BB_1101>
What is the molecular formula for <BB_1101>?
The molecular formula for <BB_1101> (CCOS(=O)c1ccc(Cl)cc1) is C8H9ClO2S.
Describe the ring structures in building block <BB_1101>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1101>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1101>.
**Token:** <BB_1101> **SMILES:** CCOS(=O)c1ccc(Cl)cc1 **Molecular Formula:** C8H9ClO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1102>.
Cc1cc(Cl)nc(N)c1C(=O)O
What is the building block token for the following molecule?
Cc1cc(Cl)nc(N)c1C(=O)O
<BB_1102>
What is the molecular formula for <BB_1102>?
The molecular formula for <BB_1102> (Cc1cc(Cl)nc(N)c1C(=O)O) is C7H7ClN2O2.
Describe the ring structures in building block <BB_1102>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1102>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1102>.
**Token:** <BB_1102> **SMILES:** Cc1cc(Cl)nc(N)c1C(=O)O **Molecular Formula:** C7H7ClN2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1103>.
CC1(C)OCC1N.O=C(O)C(F)(F)F
What is the building block token for the following molecule?
CC1(C)OCC1N.O=C(O)C(F)(F)F
<BB_1103>
What is the molecular formula for <BB_1103>?
The molecular formula for <BB_1103> (CC1(C)OCC1N.O=C(O)C(F)(F)F) is C7H12F3NO3.
Describe the ring structures in building block <BB_1103>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_1103>.
The molecule contains the following groups: Carboxylic Acid, Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1103>.
**Token:** <BB_1103> **SMILES:** CC1(C)OCC1N.O=C(O)C(F)(F)F **Molecular Formula:** C7H12F3NO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid, Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1104>.
COC(=O)c1sc2cc(F)ccc2c1N
What is the building block token for the following molecule?
COC(=O)c1sc2cc(F)ccc2c1N
<BB_1104>
What is the molecular formula for <BB_1104>?
The molecular formula for <BB_1104> (COC(=O)c1sc2cc(F)ccc2c1N) is C10H8FNO2S.
Describe the ring structures in building block <BB_1104>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1104>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1104>.
**Token:** <BB_1104> **SMILES:** COC(=O)c1sc2cc(F)ccc2c1N **Molecular Formula:** C10H8FNO2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1105>.
O=C(CCl)Nc1ccon1
What is the building block token for the following molecule?
O=C(CCl)Nc1ccon1
<BB_1105>
What is the molecular formula for <BB_1105>?
The molecular formula for <BB_1105> (O=C(CCl)Nc1ccon1) is C5H5ClN2O2.
Describe the ring structures in building block <BB_1105>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1105>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1105>.
**Token:** <BB_1105> **SMILES:** O=C(CCl)Nc1ccon1 **Molecular Formula:** C5H5ClN2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1106>.
CCn1cc(Br)nc1C
What is the building block token for the following molecule?
CCn1cc(Br)nc1C
<BB_1106>
What is the molecular formula for <BB_1106>?
The molecular formula for <BB_1106> (CCn1cc(Br)nc1C) is C6H9BrN2.
Describe the ring structures in building block <BB_1106>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1106>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1106>.
**Token:** <BB_1106> **SMILES:** CCn1cc(Br)nc1C **Molecular Formula:** C6H9BrN2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1107>.
BrCCOCCc1ccccc1
What is the building block token for the following molecule?
BrCCOCCc1ccccc1
<BB_1107>
What is the molecular formula for <BB_1107>?
The molecular formula for <BB_1107> (BrCCOCCc1ccccc1) is C10H13BrO.
Describe the ring structures in building block <BB_1107>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1107>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1107>.
**Token:** <BB_1107> **SMILES:** BrCCOCCc1ccccc1 **Molecular Formula:** C10H13BrO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1108>.
Cl.NCC1CCC2CC2C1
What is the building block token for the following molecule?
Cl.NCC1CCC2CC2C1
<BB_1108>
What is the molecular formula for <BB_1108>?
The molecular formula for <BB_1108> (Cl.NCC1CCC2CC2C1) is C8H16ClN.
Describe the ring structures in building block <BB_1108>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_1108>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1108>.
**Token:** <BB_1108> **SMILES:** Cl.NCC1CCC2CC2C1 **Molecular Formula:** C8H16ClN **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1109>.
O[B-](O)(O)c1ncc(C(F)(F)F)cc1Cl.[Li+]
What is the building block token for the following molecule?
O[B-](O)(O)c1ncc(C(F)(F)F)cc1Cl.[Li+]
<BB_1109>
What is the molecular formula for <BB_1109>?
The molecular formula for <BB_1109> (O[B-](O)(O)c1ncc(C(F)(F)F)cc1Cl.[Li+]) is C6H5BClF3LiNO3.
Describe the ring structures in building block <BB_1109>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1109>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1109>.
**Token:** <BB_1109> **SMILES:** O[B-](O)(O)c1ncc(C(F)(F)F)cc1Cl.[Li+] **Molecular Formula:** C6H5BClF3LiNO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1110>.
NC(=O)CN=C=S
What is the building block token for the following molecule?
NC(=O)CN=C=S
<BB_1110>
What is the molecular formula for <BB_1110>?
The molecular formula for <BB_1110> (NC(=O)CN=C=S) is C3H4N2OS.
Describe the ring structures in building block <BB_1110>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1110>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_1110>.
**Token:** <BB_1110> **SMILES:** NC(=O)CN=C=S **Molecular Formula:** C3H4N2OS **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_1111>.
COc1c(O)ccnc1F
What is the building block token for the following molecule?
COc1c(O)ccnc1F
<BB_1111>
What is the molecular formula for <BB_1111>?
The molecular formula for <BB_1111> (COc1c(O)ccnc1F) is C6H6FNO2.
Describe the ring structures in building block <BB_1111>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1111>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1111>.
**Token:** <BB_1111> **SMILES:** COc1c(O)ccnc1F **Molecular Formula:** C6H6FNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1112>.
Cc1ncsc1-c1ccc(CN)c(O)c1.Cl.Cl
What is the building block token for the following molecule?
Cc1ncsc1-c1ccc(CN)c(O)c1.Cl.Cl
<BB_1112>
What is the molecular formula for <BB_1112>?
The molecular formula for <BB_1112> (Cc1ncsc1-c1ccc(CN)c(O)c1.Cl.Cl) is C11H14Cl2N2OS.
Describe the ring structures in building block <BB_1112>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1112>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1112>.
**Token:** <BB_1112> **SMILES:** Cc1ncsc1-c1ccc(CN)c(O)c1.Cl.Cl **Molecular Formula:** C11H14Cl2N2OS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1113>.
CN[C@H]1CCC[C@]1(C)O
What is the building block token for the following molecule?
CN[C@H]1CCC[C@]1(C)O
<BB_1113>
What is the molecular formula for <BB_1113>?
The molecular formula for <BB_1113> (CN[C@H]1CCC[C@]1(C)O) is C7H15NO.
Describe the ring structures in building block <BB_1113>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_1113>.
The molecule contains the following groups: Secondary Amine, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_1113>.
**Token:** <BB_1113> **SMILES:** CN[C@H]1CCC[C@]1(C)O **Molecular Formula:** C7H15NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Alcohol
Provide the SMILES representation for the building block token <BB_1114>.
O=C(NC1CC1)C(Br)c1ccc(F)cc1
What is the building block token for the following molecule?
O=C(NC1CC1)C(Br)c1ccc(F)cc1
<BB_1114>
What is the molecular formula for <BB_1114>?
The molecular formula for <BB_1114> (O=C(NC1CC1)C(Br)c1ccc(F)cc1) is C11H11BrFNO.
Describe the ring structures in building block <BB_1114>.
The molecule contains 2 ring(s): an aliphatic ring of size 3, an aromatic ring of size 6.
List the primary functional groups present in <BB_1114>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1114>.
**Token:** <BB_1114> **SMILES:** O=C(NC1CC1)C(Br)c1ccc(F)cc1 **Molecular Formula:** C11H11BrFNO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 3, an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1115>.
CCOC(=O)c1cc(Cl)c(Cl)cc1N
What is the building block token for the following molecule?
CCOC(=O)c1cc(Cl)c(Cl)cc1N
<BB_1115>
What is the molecular formula for <BB_1115>?
The molecular formula for <BB_1115> (CCOC(=O)c1cc(Cl)c(Cl)cc1N) is C9H9Cl2NO2.
Describe the ring structures in building block <BB_1115>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1115>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1115>.
**Token:** <BB_1115> **SMILES:** CCOC(=O)c1cc(Cl)c(Cl)cc1N **Molecular Formula:** C9H9Cl2NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1116>.
O=C([O-])c1ncnn2cccc12.[K+]
What is the building block token for the following molecule?
O=C([O-])c1ncnn2cccc12.[K+]
<BB_1116>
What is the molecular formula for <BB_1116>?
The molecular formula for <BB_1116> (O=C([O-])c1ncnn2cccc12.[K+]) is C7H4KN3O2.
Describe the ring structures in building block <BB_1116>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.