instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_1116>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_1116>.
**Token:** <BB_1116> **SMILES:** O=C([O-])c1ncnn2cccc12.[K+] **Molecular Formula:** C7H4KN3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_1117>.
CCN1CCN(C(N)=O)CC1.Cl
What is the building block token for the following molecule?
CCN1CCN(C(N)=O)CC1.Cl
<BB_1117>
What is the molecular formula for <BB_1117>?
The molecular formula for <BB_1117> (CCN1CCN(C(N)=O)CC1.Cl) is C7H16ClN3O.
Describe the ring structures in building block <BB_1117>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1117>.
The molecule contains the following groups: Tertiary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1117>.
**Token:** <BB_1117> **SMILES:** CCN1CCN(C(N)=O)CC1.Cl **Molecular Formula:** C7H16ClN3O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1118>.
O=C(O)c1nc(Br)sc1C1CC1
What is the building block token for the following molecule?
O=C(O)c1nc(Br)sc1C1CC1
<BB_1118>
What is the molecular formula for <BB_1118>?
The molecular formula for <BB_1118> (O=C(O)c1nc(Br)sc1C1CC1) is C7H6BrNO2S.
Describe the ring structures in building block <BB_1118>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_1118>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1118>.
**Token:** <BB_1118> **SMILES:** O=C(O)c1nc(Br)sc1C1CC1 **Molecular Formula:** C7H6BrNO2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1119>.
COc1ccnc(F)c1
What is the building block token for the following molecule?
COc1ccnc(F)c1
<BB_1119>
What is the molecular formula for <BB_1119>?
The molecular formula for <BB_1119> (COc1ccnc(F)c1) is C6H6FNO.
Describe the ring structures in building block <BB_1119>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1119>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1119>.
**Token:** <BB_1119> **SMILES:** COc1ccnc(F)c1 **Molecular Formula:** C6H6FNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1120>.
Clc1nnc(-c2ccccn2)s1
What is the building block token for the following molecule?
Clc1nnc(-c2ccccn2)s1
<BB_1120>
What is the molecular formula for <BB_1120>?
The molecular formula for <BB_1120> (Clc1nnc(-c2ccccn2)s1) is C7H4ClN3S.
Describe the ring structures in building block <BB_1120>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1120>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1120>.
**Token:** <BB_1120> **SMILES:** Clc1nnc(-c2ccccn2)s1 **Molecular Formula:** C7H4ClN3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1121>.
Brc1cccc(-c2cc3ccccc3[nH]2)c1
What is the building block token for the following molecule?
Brc1cccc(-c2cc3ccccc3[nH]2)c1
<BB_1121>
What is the molecular formula for <BB_1121>?
The molecular formula for <BB_1121> (Brc1cccc(-c2cc3ccccc3[nH]2)c1) is C14H10BrN.
Describe the ring structures in building block <BB_1121>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1121>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1121>.
**Token:** <BB_1121> **SMILES:** Brc1cccc(-c2cc3ccccc3[nH]2)c1 **Molecular Formula:** C14H10BrN **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1122>.
COC(=O)Nc1ccc(S(=O)(=O)F)cc1[N+](=O)[O-]
What is the building block token for the following molecule?
COC(=O)Nc1ccc(S(=O)(=O)F)cc1[N+](=O)[O-]
<BB_1122>
What is the molecular formula for <BB_1122>?
The molecular formula for <BB_1122> (COC(=O)Nc1ccc(S(=O)(=O)F)cc1[N+](=O)[O-]) is C8H7FN2O6S.
Describe the ring structures in building block <BB_1122>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1122>.
The molecule contains the following groups: Tertiary Amine, Amide, Ether, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_1122>.
**Token:** <BB_1122> **SMILES:** COC(=O)Nc1ccc(S(=O)(=O)F)cc1[N+](=O)[O-] **Molecular Formula:** C8H7FN2O6S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Amide, Ether, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_1123>.
COc1ncc(C)cc1S(N)(=O)=O
What is the building block token for the following molecule?
COc1ncc(C)cc1S(N)(=O)=O
<BB_1123>
What is the molecular formula for <BB_1123>?
The molecular formula for <BB_1123> (COc1ncc(C)cc1S(N)(=O)=O) is C7H10N2O3S.
Describe the ring structures in building block <BB_1123>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1123>.
The molecule contains the following groups: Amine, Ether, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_1123>.
**Token:** <BB_1123> **SMILES:** COc1ncc(C)cc1S(N)(=O)=O **Molecular Formula:** C7H10N2O3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Sulfonamide
Provide the SMILES representation for the building block token <BB_1124>.
BrCC1=C(Br)CCCC1
What is the building block token for the following molecule?
BrCC1=C(Br)CCCC1
<BB_1124>
What is the molecular formula for <BB_1124>?
The molecular formula for <BB_1124> (BrCC1=C(Br)CCCC1) is C7H10Br2.
Describe the ring structures in building block <BB_1124>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1124>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1124>.
**Token:** <BB_1124> **SMILES:** BrCC1=C(Br)CCCC1 **Molecular Formula:** C7H10Br2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1125>.
CC1(NN)CCCC1
What is the building block token for the following molecule?
CC1(NN)CCCC1
<BB_1125>
What is the molecular formula for <BB_1125>?
The molecular formula for <BB_1125> (CC1(NN)CCCC1) is C6H14N2.
Describe the ring structures in building block <BB_1125>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_1125>.
The molecule contains the following groups: Amine, Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_1125>.
**Token:** <BB_1125> **SMILES:** CC1(NN)CCCC1 **Molecular Formula:** C6H14N2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amine, Secondary Amine
Provide the SMILES representation for the building block token <BB_1126>.
O=C(O)c1cccc(C(=O)O)n1
What is the building block token for the following molecule?
O=C(O)c1cccc(C(=O)O)n1
<BB_1126>
What is the molecular formula for <BB_1126>?
The molecular formula for <BB_1126> (O=C(O)c1cccc(C(=O)O)n1) is C7H5NO4.
Describe the ring structures in building block <BB_1126>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1126>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1126>.
**Token:** <BB_1126> **SMILES:** O=C(O)c1cccc(C(=O)O)n1 **Molecular Formula:** C7H5NO4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1127>.
Fc1c(Br)ccc2c1CCNC2
What is the building block token for the following molecule?
Fc1c(Br)ccc2c1CCNC2
<BB_1127>
What is the molecular formula for <BB_1127>?
The molecular formula for <BB_1127> (Fc1c(Br)ccc2c1CCNC2) is C9H9BrFN.
Describe the ring structures in building block <BB_1127>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1127>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1127>.
**Token:** <BB_1127> **SMILES:** Fc1c(Br)ccc2c1CCNC2 **Molecular Formula:** C9H9BrFN **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1128>.
Clc1nc2cccc(Br)c2nc1Cl
What is the building block token for the following molecule?
Clc1nc2cccc(Br)c2nc1Cl
<BB_1128>
What is the molecular formula for <BB_1128>?
The molecular formula for <BB_1128> (Clc1nc2cccc(Br)c2nc1Cl) is C8H3BrCl2N2.
Describe the ring structures in building block <BB_1128>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1128>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1128>.
**Token:** <BB_1128> **SMILES:** Clc1nc2cccc(Br)c2nc1Cl **Molecular Formula:** C8H3BrCl2N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1129>.
CCn1cnnc1CCN.Cl.Cl
What is the building block token for the following molecule?
CCn1cnnc1CCN.Cl.Cl
<BB_1129>
What is the molecular formula for <BB_1129>?
The molecular formula for <BB_1129> (CCn1cnnc1CCN.Cl.Cl) is C6H14Cl2N4.
Describe the ring structures in building block <BB_1129>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1129>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1129>.
**Token:** <BB_1129> **SMILES:** CCn1cnnc1CCN.Cl.Cl **Molecular Formula:** C6H14Cl2N4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1130>.
COCCOCCC=O
What is the building block token for the following molecule?
COCCOCCC=O
<BB_1130>
What is the molecular formula for <BB_1130>?
The molecular formula for <BB_1130> (COCCOCCC=O) is C6H12O3.
Describe the ring structures in building block <BB_1130>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1130>.
The molecule contains the following groups: Aldehyde, Ether.
Provide a comprehensive chemical profile for the building block <BB_1130>.
**Token:** <BB_1130> **SMILES:** COCCOCCC=O **Molecular Formula:** C6H12O3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Aldehyde, Ether
Provide the SMILES representation for the building block token <BB_1131>.
Cl.N[C@H]1C[C@H](c2cccc(C(F)(F)F)c2)C1
What is the building block token for the following molecule?
Cl.N[C@H]1C[C@H](c2cccc(C(F)(F)F)c2)C1
<BB_1131>
What is the molecular formula for <BB_1131>?
The molecular formula for <BB_1131> (Cl.N[C@H]1C[C@H](c2cccc(C(F)(F)F)c2)C1) is C11H13ClF3N.
Describe the ring structures in building block <BB_1131>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 6.
List the primary functional groups present in <BB_1131>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1131>.
**Token:** <BB_1131> **SMILES:** Cl.N[C@H]1C[C@H](c2cccc(C(F)(F)F)c2)C1 **Molecular Formula:** C11H13ClF3N **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1132>.
CCOC(=O)c1cc2ccncc2[nH]c1=O
What is the building block token for the following molecule?
CCOC(=O)c1cc2ccncc2[nH]c1=O
<BB_1132>
What is the molecular formula for <BB_1132>?
The molecular formula for <BB_1132> (CCOC(=O)c1cc2ccncc2[nH]c1=O) is C11H10N2O3.
Describe the ring structures in building block <BB_1132>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1132>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_1132>.
**Token:** <BB_1132> **SMILES:** CCOC(=O)c1cc2ccncc2[nH]c1=O **Molecular Formula:** C11H10N2O3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_1133>.
Cl.O=C(c1ccccn1)N1CCNCC1
What is the building block token for the following molecule?
Cl.O=C(c1ccccn1)N1CCNCC1
<BB_1133>