instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_1133>?
The molecular formula for <BB_1133> (Cl.O=C(c1ccccn1)N1CCNCC1) is C10H14ClN3O.
Describe the ring structures in building block <BB_1133>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1133>.
The molecule contains the following groups: Secondary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1133>.
**Token:** <BB_1133> **SMILES:** Cl.O=C(c1ccccn1)N1CCNCC1 **Molecular Formula:** C10H14ClN3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1134>.
O=C(NC1CC1)C(Cl)c1ccc(F)cc1
What is the building block token for the following molecule?
O=C(NC1CC1)C(Cl)c1ccc(F)cc1
<BB_1134>
What is the molecular formula for <BB_1134>?
The molecular formula for <BB_1134> (O=C(NC1CC1)C(Cl)c1ccc(F)cc1) is C11H11ClFNO.
Describe the ring structures in building block <BB_1134>.
The molecule contains 2 ring(s): an aliphatic ring of size 3, an aromatic ring of size 6.
List the primary functional groups present in <BB_1134>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1134>.
**Token:** <BB_1134> **SMILES:** O=C(NC1CC1)C(Cl)c1ccc(F)cc1 **Molecular Formula:** C11H11ClFNO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 3, an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1135>.
CC(=O)c1cccc(-c2cn[nH]c2)c1
What is the building block token for the following molecule?
CC(=O)c1cccc(-c2cn[nH]c2)c1
<BB_1135>
What is the molecular formula for <BB_1135>?
The molecular formula for <BB_1135> (CC(=O)c1cccc(-c2cn[nH]c2)c1) is C11H10N2O.
Describe the ring structures in building block <BB_1135>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1135>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_1135>.
**Token:** <BB_1135> **SMILES:** CC(=O)c1cccc(-c2cn[nH]c2)c1 **Molecular Formula:** C11H10N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_1136>.
NNS(=O)(=O)c1ccc2c(c1)OCCO2
What is the building block token for the following molecule?
NNS(=O)(=O)c1ccc2c(c1)OCCO2
<BB_1136>
What is the molecular formula for <BB_1136>?
The molecular formula for <BB_1136> (NNS(=O)(=O)c1ccc2c(c1)OCCO2) is C8H10N2O4S.
Describe the ring structures in building block <BB_1136>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1136>.
The molecule contains the following groups: Amine, Secondary Amine, Ether, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_1136>.
**Token:** <BB_1136> **SMILES:** NNS(=O)(=O)c1ccc2c(c1)OCCO2 **Molecular Formula:** C8H10N2O4S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Ether, Sulfonamide
Provide the SMILES representation for the building block token <BB_1137>.
Cl.NCc1cccc(C2CC2)c1
What is the building block token for the following molecule?
Cl.NCc1cccc(C2CC2)c1
<BB_1137>
What is the molecular formula for <BB_1137>?
The molecular formula for <BB_1137> (Cl.NCc1cccc(C2CC2)c1) is C10H14ClN.
Describe the ring structures in building block <BB_1137>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_1137>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1137>.
**Token:** <BB_1137> **SMILES:** Cl.NCc1cccc(C2CC2)c1 **Molecular Formula:** C10H14ClN **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1138>.
O=C1c2ccccc2C(=O)N1OC1C=CCC1
What is the building block token for the following molecule?
O=C1c2ccccc2C(=O)N1OC1C=CCC1
<BB_1138>
What is the molecular formula for <BB_1138>?
The molecular formula for <BB_1138> (O=C1c2ccccc2C(=O)N1OC1C=CCC1) is C13H11NO3.
Describe the ring structures in building block <BB_1138>.
The molecule contains 3 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1138>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_1138>.
**Token:** <BB_1138> **SMILES:** O=C1c2ccccc2C(=O)N1OC1C=CCC1 **Molecular Formula:** C13H11NO3 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_1139>.
COc1ccc(C=O)cc1F
What is the building block token for the following molecule?
COc1ccc(C=O)cc1F
<BB_1139>
What is the molecular formula for <BB_1139>?
The molecular formula for <BB_1139> (COc1ccc(C=O)cc1F) is C8H7FO2.
Describe the ring structures in building block <BB_1139>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1139>.
The molecule contains the following groups: Aldehyde, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1139>.
**Token:** <BB_1139> **SMILES:** COc1ccc(C=O)cc1F **Molecular Formula:** C8H7FO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1140>.
Cc1ncc(C2CCNC2)s1.Cl.Cl
What is the building block token for the following molecule?
Cc1ncc(C2CCNC2)s1.Cl.Cl
<BB_1140>
What is the molecular formula for <BB_1140>?
The molecular formula for <BB_1140> (Cc1ncc(C2CCNC2)s1.Cl.Cl) is C8H14Cl2N2S.
Describe the ring structures in building block <BB_1140>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1140>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1140>.
**Token:** <BB_1140> **SMILES:** Cc1ncc(C2CCNC2)s1.Cl.Cl **Molecular Formula:** C8H14Cl2N2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1141>.
N#CCCOCCC#N
What is the building block token for the following molecule?
N#CCCOCCC#N
<BB_1141>
What is the molecular formula for <BB_1141>?
The molecular formula for <BB_1141> (N#CCCOCCC#N) is C6H8N2O.
Describe the ring structures in building block <BB_1141>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1141>.
The molecule contains the following groups: Ether, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1141>.
**Token:** <BB_1141> **SMILES:** N#CCCOCCC#N **Molecular Formula:** C6H8N2O **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ether, Nitrile
Provide the SMILES representation for the building block token <BB_1142>.
NC(=O)c1ccnc(Cl)c1Br
What is the building block token for the following molecule?
NC(=O)c1ccnc(Cl)c1Br
<BB_1142>
What is the molecular formula for <BB_1142>?
The molecular formula for <BB_1142> (NC(=O)c1ccnc(Cl)c1Br) is C6H4BrClN2O.
Describe the ring structures in building block <BB_1142>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1142>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1142>.
**Token:** <BB_1142> **SMILES:** NC(=O)c1ccnc(Cl)c1Br **Molecular Formula:** C6H4BrClN2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1143>.
CCOC(=O)CSc1ccc([C@@H](C)O)cc1
What is the building block token for the following molecule?
CCOC(=O)CSc1ccc([C@@H](C)O)cc1
<BB_1143>
What is the molecular formula for <BB_1143>?
The molecular formula for <BB_1143> (CCOC(=O)CSc1ccc([C@@H](C)O)cc1) is C12H16O3S.
Describe the ring structures in building block <BB_1143>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1143>.
The molecule contains the following groups: Ester, Alcohol, Ether, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_1143>.
**Token:** <BB_1143> **SMILES:** CCOC(=O)CSc1ccc([C@@H](C)O)cc1 **Molecular Formula:** C12H16O3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Alcohol, Ether, Sulfide
Provide the SMILES representation for the building block token <BB_1144>.
CC(C)(C(=O)O)c1ccc(F)cc1Cl
What is the building block token for the following molecule?
CC(C)(C(=O)O)c1ccc(F)cc1Cl
<BB_1144>
What is the molecular formula for <BB_1144>?
The molecular formula for <BB_1144> (CC(C)(C(=O)O)c1ccc(F)cc1Cl) is C10H10ClFO2.
Describe the ring structures in building block <BB_1144>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1144>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1144>.
**Token:** <BB_1144> **SMILES:** CC(C)(C(=O)O)c1ccc(F)cc1Cl **Molecular Formula:** C10H10ClFO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1145>.
NNc1ccnc(Cl)c1
What is the building block token for the following molecule?
NNc1ccnc(Cl)c1
<BB_1145>
What is the molecular formula for <BB_1145>?
The molecular formula for <BB_1145> (NNc1ccnc(Cl)c1) is C5H6ClN3.
Describe the ring structures in building block <BB_1145>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1145>.
The molecule contains the following groups: Amine, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1145>.
**Token:** <BB_1145> **SMILES:** NNc1ccnc(Cl)c1 **Molecular Formula:** C5H6ClN3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1146>.
CCn1cc(C)c(C=O)n1
What is the building block token for the following molecule?
CCn1cc(C)c(C=O)n1
<BB_1146>
What is the molecular formula for <BB_1146>?
The molecular formula for <BB_1146> (CCn1cc(C)c(C=O)n1) is C7H10N2O.
Describe the ring structures in building block <BB_1146>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1146>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_1146>.
**Token:** <BB_1146> **SMILES:** CCn1cc(C)c(C=O)n1 **Molecular Formula:** C7H10N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_1147>.
CC1=CCNCC1.Cl
What is the building block token for the following molecule?
CC1=CCNCC1.Cl
<BB_1147>
What is the molecular formula for <BB_1147>?
The molecular formula for <BB_1147> (CC1=CCNCC1.Cl) is C6H12ClN.
Describe the ring structures in building block <BB_1147>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1147>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1147>.
**Token:** <BB_1147> **SMILES:** CC1=CCNCC1.Cl **Molecular Formula:** C6H12ClN **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1148>.
CC1(C)CN(O)C1=O.Cl
What is the building block token for the following molecule?
CC1(C)CN(O)C1=O.Cl
<BB_1148>
What is the molecular formula for <BB_1148>?
The molecular formula for <BB_1148> (CC1(C)CN(O)C1=O.Cl) is C5H10ClNO2.
Describe the ring structures in building block <BB_1148>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_1148>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1148>.
**Token:** <BB_1148> **SMILES:** CC1(C)CN(O)C1=O.Cl **Molecular Formula:** C5H10ClNO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1149>.
CCC(=O)Nc1nnc(S(N)(=O)=O)s1
What is the building block token for the following molecule?
CCC(=O)Nc1nnc(S(N)(=O)=O)s1
<BB_1149>
What is the molecular formula for <BB_1149>?
The molecular formula for <BB_1149> (CCC(=O)Nc1nnc(S(N)(=O)=O)s1) is C5H8N4O3S2.
Describe the ring structures in building block <BB_1149>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1149>.
The molecule contains the following groups: Amine, Amide, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_1149>.
**Token:** <BB_1149> **SMILES:** CCC(=O)Nc1nnc(S(N)(=O)=O)s1 **Molecular Formula:** C5H8N4O3S2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Amide, Sulfonamide