instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_1150>.
[N-]=[N+]=Nc1ccc(OC(F)(F)Cl)cc1
What is the building block token for the following molecule?
[N-]=[N+]=Nc1ccc(OC(F)(F)Cl)cc1
<BB_1150>
What is the molecular formula for <BB_1150>?
The molecular formula for <BB_1150> ([N-]=[N+]=Nc1ccc(OC(F)(F)Cl)cc1) is C7H4ClF2N3O.
Describe the ring structures in building block <BB_1150>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1150>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1150>.
**Token:** <BB_1150> **SMILES:** [N-]=[N+]=Nc1ccc(OC(F)(F)Cl)cc1 **Molecular Formula:** C7H4ClF2N3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1151>.
CSSC(C)(C)C(=O)O
What is the building block token for the following molecule?
CSSC(C)(C)C(=O)O
<BB_1151>
What is the molecular formula for <BB_1151>?
The molecular formula for <BB_1151> (CSSC(C)(C)C(=O)O) is C5H10O2S2.
Describe the ring structures in building block <BB_1151>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1151>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1151>.
**Token:** <BB_1151> **SMILES:** CSSC(C)(C)C(=O)O **Molecular Formula:** C5H10O2S2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1152>.
O=c1[nH]c(CCl)nc2cccc(F)c12
What is the building block token for the following molecule?
O=c1[nH]c(CCl)nc2cccc(F)c12
<BB_1152>
What is the molecular formula for <BB_1152>?
The molecular formula for <BB_1152> (O=c1[nH]c(CCl)nc2cccc(F)c12) is C9H6ClFN2O.
Describe the ring structures in building block <BB_1152>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1152>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1152>.
**Token:** <BB_1152> **SMILES:** O=c1[nH]c(CCl)nc2cccc(F)c12 **Molecular Formula:** C9H6ClFN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1153>.
CC(O)c1cc([N+](=O)[O-])ccc1Cl
What is the building block token for the following molecule?
CC(O)c1cc([N+](=O)[O-])ccc1Cl
<BB_1153>
What is the molecular formula for <BB_1153>?
The molecular formula for <BB_1153> (CC(O)c1cc([N+](=O)[O-])ccc1Cl) is C8H8ClNO3.
Describe the ring structures in building block <BB_1153>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1153>.
The molecule contains the following groups: Tertiary Amine, Alcohol, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_1153>.
**Token:** <BB_1153> **SMILES:** CC(O)c1cc([N+](=O)[O-])ccc1Cl **Molecular Formula:** C8H8ClNO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Alcohol, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_1154>.
CC(C)P(=O)(CC(=O)O)C(C)C
What is the building block token for the following molecule?
CC(C)P(=O)(CC(=O)O)C(C)C
<BB_1154>
What is the molecular formula for <BB_1154>?
The molecular formula for <BB_1154> (CC(C)P(=O)(CC(=O)O)C(C)C) is C8H17O3P.
Describe the ring structures in building block <BB_1154>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1154>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1154>.
**Token:** <BB_1154> **SMILES:** CC(C)P(=O)(CC(=O)O)C(C)C **Molecular Formula:** C8H17O3P **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1155>.
COC(=O)C1(Br)CCC1
What is the building block token for the following molecule?
COC(=O)C1(Br)CCC1
<BB_1155>
What is the molecular formula for <BB_1155>?
The molecular formula for <BB_1155> (COC(=O)C1(Br)CCC1) is C6H9BrO2.
Describe the ring structures in building block <BB_1155>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_1155>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1155>.
**Token:** <BB_1155> **SMILES:** COC(=O)C1(Br)CCC1 **Molecular Formula:** C6H9BrO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1156>.
CC(C)(C)OC(=O)N1[C@@H]2CC[C@H]1CN(S(=O)(=O)Cl)C2
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1[C@@H]2CC[C@H]1CN(S(=O)(=O)Cl)C2
<BB_1156>
What is the molecular formula for <BB_1156>?
The molecular formula for <BB_1156> (CC(C)(C)OC(=O)N1[C@@H]2CC[C@H]1CN(S(=O)(=O)Cl)C2) is C11H19ClN2O4S.
Describe the ring structures in building block <BB_1156>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1156>.
The molecule contains the following groups: Tertiary Amine, Amide, Ether, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_1156>.
**Token:** <BB_1156> **SMILES:** CC(C)(C)OC(=O)N1[C@@H]2CC[C@H]1CN(S(=O)(=O)Cl)C2 **Molecular Formula:** C11H19ClN2O4S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine, Amide, Ether, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_1157>.
Cn1nccc1C1CNCCO1
What is the building block token for the following molecule?
Cn1nccc1C1CNCCO1
<BB_1157>
What is the molecular formula for <BB_1157>?
The molecular formula for <BB_1157> (Cn1nccc1C1CNCCO1) is C8H13N3O.
Describe the ring structures in building block <BB_1157>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1157>.
The molecule contains the following groups: Secondary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_1157>.
**Token:** <BB_1157> **SMILES:** Cn1nccc1C1CNCCO1 **Molecular Formula:** C8H13N3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ether
Provide the SMILES representation for the building block token <BB_1158>.
COC(=O)CC1CCC1N.Cl
What is the building block token for the following molecule?
COC(=O)CC1CCC1N.Cl
<BB_1158>
What is the molecular formula for <BB_1158>?
The molecular formula for <BB_1158> (COC(=O)CC1CCC1N.Cl) is C7H14ClNO2.
Describe the ring structures in building block <BB_1158>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_1158>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1158>.
**Token:** <BB_1158> **SMILES:** COC(=O)CC1CCC1N.Cl **Molecular Formula:** C7H14ClNO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1159>.
COC(=O)c1cc(Cl)c(N)cc1F
What is the building block token for the following molecule?
COC(=O)c1cc(Cl)c(N)cc1F
<BB_1159>
What is the molecular formula for <BB_1159>?
The molecular formula for <BB_1159> (COC(=O)c1cc(Cl)c(N)cc1F) is C8H7ClFNO2.
Describe the ring structures in building block <BB_1159>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1159>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1159>.
**Token:** <BB_1159> **SMILES:** COC(=O)c1cc(Cl)c(N)cc1F **Molecular Formula:** C8H7ClFNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1160>.
C1CC23CNCC12COC3.Cl
What is the building block token for the following molecule?
C1CC23CNCC12COC3.Cl
<BB_1160>
What is the molecular formula for <BB_1160>?
The molecular formula for <BB_1160> (C1CC23CNCC12COC3.Cl) is C8H14ClNO.
Describe the ring structures in building block <BB_1160>.
The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1160>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1160>.
**Token:** <BB_1160> **SMILES:** C1CC23CNCC12COC3.Cl **Molecular Formula:** C8H14ClNO **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1161>.
Cl.O=C(O)Cc1ccn[nH]1
What is the building block token for the following molecule?
Cl.O=C(O)Cc1ccn[nH]1
<BB_1161>
What is the molecular formula for <BB_1161>?
The molecular formula for <BB_1161> (Cl.O=C(O)Cc1ccn[nH]1) is C5H7ClN2O2.
Describe the ring structures in building block <BB_1161>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1161>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1161>.
**Token:** <BB_1161> **SMILES:** Cl.O=C(O)Cc1ccn[nH]1 **Molecular Formula:** C5H7ClN2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1162>.
Fc1c(CBr)ccnc1C(F)(F)F
What is the building block token for the following molecule?
Fc1c(CBr)ccnc1C(F)(F)F
<BB_1162>
What is the molecular formula for <BB_1162>?
The molecular formula for <BB_1162> (Fc1c(CBr)ccnc1C(F)(F)F) is C7H4BrF4N.
Describe the ring structures in building block <BB_1162>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1162>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1162>.
**Token:** <BB_1162> **SMILES:** Fc1c(CBr)ccnc1C(F)(F)F **Molecular Formula:** C7H4BrF4N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1163>.
Cc1cc(NC(=O)C2CCNCC2)no1.Cl
What is the building block token for the following molecule?
Cc1cc(NC(=O)C2CCNCC2)no1.Cl
<BB_1163>
What is the molecular formula for <BB_1163>?
The molecular formula for <BB_1163> (Cc1cc(NC(=O)C2CCNCC2)no1.Cl) is C10H16ClN3O2.
Describe the ring structures in building block <BB_1163>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1163>.
The molecule contains the following groups: Secondary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1163>.
**Token:** <BB_1163> **SMILES:** Cc1cc(NC(=O)C2CCNCC2)no1.Cl **Molecular Formula:** C10H16ClN3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1164>.
O=c1ccn2ncc(Br)c2[nH]1
What is the building block token for the following molecule?
O=c1ccn2ncc(Br)c2[nH]1
<BB_1164>
What is the molecular formula for <BB_1164>?
The molecular formula for <BB_1164> (O=c1ccn2ncc(Br)c2[nH]1) is C6H4BrN3O.
Describe the ring structures in building block <BB_1164>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1164>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1164>.
**Token:** <BB_1164> **SMILES:** O=c1ccn2ncc(Br)c2[nH]1 **Molecular Formula:** C6H4BrN3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1165>.
Nc1cc2n(n1)CCN(Cc1ccccc1)C2
What is the building block token for the following molecule?
Nc1cc2n(n1)CCN(Cc1ccccc1)C2
<BB_1165>
What is the molecular formula for <BB_1165>?
The molecular formula for <BB_1165> (Nc1cc2n(n1)CCN(Cc1ccccc1)C2) is C13H16N4.
Describe the ring structures in building block <BB_1165>.
The molecule contains 3 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1165>.
The molecule contains the following groups: Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_1165>.
**Token:** <BB_1165> **SMILES:** Nc1cc2n(n1)CCN(Cc1ccccc1)C2 **Molecular Formula:** C13H16N4 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_1166>.
CC(=O)N1C[C@H]2CNC[C@H]2C1.Cl.Cl
What is the building block token for the following molecule?
CC(=O)N1C[C@H]2CNC[C@H]2C1.Cl.Cl
<BB_1166>
What is the molecular formula for <BB_1166>?
The molecular formula for <BB_1166> (CC(=O)N1C[C@H]2CNC[C@H]2C1.Cl.Cl) is C8H16Cl2N2O.
Describe the ring structures in building block <BB_1166>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5.