instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_1166>.
The molecule contains the following groups: Secondary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1166>.
**Token:** <BB_1166> **SMILES:** CC(=O)N1C[C@H]2CNC[C@H]2C1.Cl.Cl **Molecular Formula:** C8H16Cl2N2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1167>.
Cc1ccc(CC(N)=S)cc1
What is the building block token for the following molecule?
Cc1ccc(CC(N)=S)cc1
<BB_1167>
What is the molecular formula for <BB_1167>?
The molecular formula for <BB_1167> (Cc1ccc(CC(N)=S)cc1) is C9H11NS.
Describe the ring structures in building block <BB_1167>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1167>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_1167>.
**Token:** <BB_1167> **SMILES:** Cc1ccc(CC(N)=S)cc1 **Molecular Formula:** C9H11NS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_1168>.
NC1CCN(Cc2ccccc2)C1
What is the building block token for the following molecule?
NC1CCN(Cc2ccccc2)C1
<BB_1168>
What is the molecular formula for <BB_1168>?
The molecular formula for <BB_1168> (NC1CCN(Cc2ccccc2)C1) is C11H16N2.
Describe the ring structures in building block <BB_1168>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1168>.
The molecule contains the following groups: Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_1168>.
**Token:** <BB_1168> **SMILES:** NC1CCN(Cc2ccccc2)C1 **Molecular Formula:** C11H16N2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_1169>.
COC(=O)[C@H](N)CCCC(F)(F)F.Cl
What is the building block token for the following molecule?
COC(=O)[C@H](N)CCCC(F)(F)F.Cl
<BB_1169>
What is the molecular formula for <BB_1169>?
The molecular formula for <BB_1169> (COC(=O)[C@H](N)CCCC(F)(F)F.Cl) is C7H13ClF3NO2.
Describe the ring structures in building block <BB_1169>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1169>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1169>.
**Token:** <BB_1169> **SMILES:** COC(=O)[C@H](N)CCCC(F)(F)F.Cl **Molecular Formula:** C7H13ClF3NO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1170>.
FC(F)(F)c1ncc(Cl)nc1Cl
What is the building block token for the following molecule?
FC(F)(F)c1ncc(Cl)nc1Cl
<BB_1170>
What is the molecular formula for <BB_1170>?
The molecular formula for <BB_1170> (FC(F)(F)c1ncc(Cl)nc1Cl) is C5HCl2F3N2.
Describe the ring structures in building block <BB_1170>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1170>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1170>.
**Token:** <BB_1170> **SMILES:** FC(F)(F)c1ncc(Cl)nc1Cl **Molecular Formula:** C5HCl2F3N2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1171>.
COC(=O)Cc1ccc(S(=O)(=O)Cl)cc1
What is the building block token for the following molecule?
COC(=O)Cc1ccc(S(=O)(=O)Cl)cc1
<BB_1171>
What is the molecular formula for <BB_1171>?
The molecular formula for <BB_1171> (COC(=O)Cc1ccc(S(=O)(=O)Cl)cc1) is C9H9ClO4S.
Describe the ring structures in building block <BB_1171>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1171>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1171>.
**Token:** <BB_1171> **SMILES:** COC(=O)Cc1ccc(S(=O)(=O)Cl)cc1 **Molecular Formula:** C9H9ClO4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1172>.
Fc1ccc(N=C=S)nc1
What is the building block token for the following molecule?
Fc1ccc(N=C=S)nc1
<BB_1172>
What is the molecular formula for <BB_1172>?
The molecular formula for <BB_1172> (Fc1ccc(N=C=S)nc1) is C6H3FN2S.
Describe the ring structures in building block <BB_1172>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1172>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1172>.
**Token:** <BB_1172> **SMILES:** Fc1ccc(N=C=S)nc1 **Molecular Formula:** C6H3FN2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1173>.
O=Cc1cc(I)ccc1[N+](=O)[O-]
What is the building block token for the following molecule?
O=Cc1cc(I)ccc1[N+](=O)[O-]
<BB_1173>
What is the molecular formula for <BB_1173>?
The molecular formula for <BB_1173> (O=Cc1cc(I)ccc1[N+](=O)[O-]) is C7H4INO3.
Describe the ring structures in building block <BB_1173>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1173>.
The molecule contains the following groups: Tertiary Amine, Aldehyde, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_1173>.
**Token:** <BB_1173> **SMILES:** O=Cc1cc(I)ccc1[N+](=O)[O-] **Molecular Formula:** C7H4INO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Aldehyde, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_1174>.
Cc1cc(B(O)O)c(C)cn1.Cl
What is the building block token for the following molecule?
Cc1cc(B(O)O)c(C)cn1.Cl
<BB_1174>
What is the molecular formula for <BB_1174>?
The molecular formula for <BB_1174> (Cc1cc(B(O)O)c(C)cn1.Cl) is C7H11BClNO2.
Describe the ring structures in building block <BB_1174>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1174>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1174>.
**Token:** <BB_1174> **SMILES:** Cc1cc(B(O)O)c(C)cn1.Cl **Molecular Formula:** C7H11BClNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1175>.
COc1ccc(N2C(=O)C=CC2=O)cn1
What is the building block token for the following molecule?
COc1ccc(N2C(=O)C=CC2=O)cn1
<BB_1175>
What is the molecular formula for <BB_1175>?
The molecular formula for <BB_1175> (COc1ccc(N2C(=O)C=CC2=O)cn1) is C10H8N2O3.
Describe the ring structures in building block <BB_1175>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1175>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_1175>.
**Token:** <BB_1175> **SMILES:** COc1ccc(N2C(=O)C=CC2=O)cn1 **Molecular Formula:** C10H8N2O3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amide, Ether
Provide the SMILES representation for the building block token <BB_1176>.
CNCC1(C)CCCO1.Cl
What is the building block token for the following molecule?
CNCC1(C)CCCO1.Cl
<BB_1176>
What is the molecular formula for <BB_1176>?
The molecular formula for <BB_1176> (CNCC1(C)CCCO1.Cl) is C7H16ClNO.
Describe the ring structures in building block <BB_1176>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_1176>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1176>.
**Token:** <BB_1176> **SMILES:** CNCC1(C)CCCO1.Cl **Molecular Formula:** C7H16ClNO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1177>.
CCOC1(CO)CCC1
What is the building block token for the following molecule?
CCOC1(CO)CCC1
<BB_1177>
What is the molecular formula for <BB_1177>?
The molecular formula for <BB_1177> (CCOC1(CO)CCC1) is C7H14O2.
Describe the ring structures in building block <BB_1177>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_1177>.
The molecule contains the following groups: Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_1177>.
**Token:** <BB_1177> **SMILES:** CCOC1(CO)CCC1 **Molecular Formula:** C7H14O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Alcohol, Ether
Provide the SMILES representation for the building block token <BB_1178>.
O=S(=O)(c1ccccc1)C1CCCCC1
What is the building block token for the following molecule?
O=S(=O)(c1ccccc1)C1CCCCC1
<BB_1178>
What is the molecular formula for <BB_1178>?
The molecular formula for <BB_1178> (O=S(=O)(c1ccccc1)C1CCCCC1) is C12H16O2S.
Describe the ring structures in building block <BB_1178>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1178>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_1178>.
**Token:** <BB_1178> **SMILES:** O=S(=O)(c1ccccc1)C1CCCCC1 **Molecular Formula:** C12H16O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_1179>.
NCC1(Nc2ccccc2)CCCCC1
What is the building block token for the following molecule?
NCC1(Nc2ccccc2)CCCCC1
<BB_1179>
What is the molecular formula for <BB_1179>?
The molecular formula for <BB_1179> (NCC1(Nc2ccccc2)CCCCC1) is C13H20N2.
Describe the ring structures in building block <BB_1179>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1179>.
The molecule contains the following groups: Amine, Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_1179>.
**Token:** <BB_1179> **SMILES:** NCC1(Nc2ccccc2)CCCCC1 **Molecular Formula:** C13H20N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Secondary Amine
Provide the SMILES representation for the building block token <BB_1180>.
CC(=O)c1ncccn1
What is the building block token for the following molecule?
CC(=O)c1ncccn1
<BB_1180>
What is the molecular formula for <BB_1180>?
The molecular formula for <BB_1180> (CC(=O)c1ncccn1) is C6H6N2O.
Describe the ring structures in building block <BB_1180>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1180>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_1180>.
**Token:** <BB_1180> **SMILES:** CC(=O)c1ncccn1 **Molecular Formula:** C6H6N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_1181>.
CC(C)(C)C#Cc1ccc(N)cc1
What is the building block token for the following molecule?
CC(C)(C)C#Cc1ccc(N)cc1
<BB_1181>
What is the molecular formula for <BB_1181>?
The molecular formula for <BB_1181> (CC(C)(C)C#Cc1ccc(N)cc1) is C12H15N.
Describe the ring structures in building block <BB_1181>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1181>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_1181>.
**Token:** <BB_1181> **SMILES:** CC(C)(C)C#Cc1ccc(N)cc1 **Molecular Formula:** C12H15N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_1182>.
COC(=O)c1cc(N)c(O)cc1F
What is the building block token for the following molecule?
COC(=O)c1cc(N)c(O)cc1F
<BB_1182>
What is the molecular formula for <BB_1182>?
The molecular formula for <BB_1182> (COC(=O)c1cc(N)c(O)cc1F) is C8H8FNO3.
Describe the ring structures in building block <BB_1182>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1182>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1182>.
**Token:** <BB_1182> **SMILES:** COC(=O)c1cc(N)c(O)cc1F **Molecular Formula:** C8H8FNO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1183>.
O=C(O)[C@@H]1C[C@H]1C1CC1
What is the building block token for the following molecule?
O=C(O)[C@@H]1C[C@H]1C1CC1
<BB_1183>