instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_1183>?
The molecular formula for <BB_1183> (O=C(O)[C@@H]1C[C@H]1C1CC1) is C7H10O2.
Describe the ring structures in building block <BB_1183>.
The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 3.
List the primary functional groups present in <BB_1183>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1183>.
**Token:** <BB_1183> **SMILES:** O=C(O)[C@@H]1C[C@H]1C1CC1 **Molecular Formula:** C7H10O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 3. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1184>.
Fc1c(Br)ccc2ccncc12
What is the building block token for the following molecule?
Fc1c(Br)ccc2ccncc12
<BB_1184>
What is the molecular formula for <BB_1184>?
The molecular formula for <BB_1184> (Fc1c(Br)ccc2ccncc12) is C9H5BrFN.
Describe the ring structures in building block <BB_1184>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1184>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1184>.
**Token:** <BB_1184> **SMILES:** Fc1c(Br)ccc2ccncc12 **Molecular Formula:** C9H5BrFN **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1185>.
O=C(O)C1CCCCN1
What is the building block token for the following molecule?
O=C(O)C1CCCCN1
<BB_1185>
What is the molecular formula for <BB_1185>?
The molecular formula for <BB_1185> (O=C(O)C1CCCCN1) is C6H11NO2.
Describe the ring structures in building block <BB_1185>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1185>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_1185>.
**Token:** <BB_1185> **SMILES:** O=C(O)C1CCCCN1 **Molecular Formula:** C6H11NO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine
Provide the SMILES representation for the building block token <BB_1186>.
C[C@H](N)c1ccncc1O.Cl.Cl
What is the building block token for the following molecule?
C[C@H](N)c1ccncc1O.Cl.Cl
<BB_1186>
What is the molecular formula for <BB_1186>?
The molecular formula for <BB_1186> (C[C@H](N)c1ccncc1O.Cl.Cl) is C7H12Cl2N2O.
Describe the ring structures in building block <BB_1186>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1186>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1186>.
**Token:** <BB_1186> **SMILES:** C[C@H](N)c1ccncc1O.Cl.Cl **Molecular Formula:** C7H12Cl2N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1187>.
CC(C)(C)OC(=O)N1CCC2(CCCCC2)C1=O
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCC2(CCCCC2)C1=O
<BB_1187>
What is the molecular formula for <BB_1187>?
The molecular formula for <BB_1187> (CC(C)(C)OC(=O)N1CCC2(CCCCC2)C1=O) is C14H23NO3.
Describe the ring structures in building block <BB_1187>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1187>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_1187>.
**Token:** <BB_1187> **SMILES:** CC(C)(C)OC(=O)N1CCC2(CCCCC2)C1=O **Molecular Formula:** C14H23NO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Amide, Ether
Provide the SMILES representation for the building block token <BB_1188>.
COC(=O)c1nccc(N)c1Cl
What is the building block token for the following molecule?
COC(=O)c1nccc(N)c1Cl
<BB_1188>
What is the molecular formula for <BB_1188>?
The molecular formula for <BB_1188> (COC(=O)c1nccc(N)c1Cl) is C7H7ClN2O2.
Describe the ring structures in building block <BB_1188>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1188>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1188>.
**Token:** <BB_1188> **SMILES:** COC(=O)c1nccc(N)c1Cl **Molecular Formula:** C7H7ClN2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1189>.
Brc1ccccc1Oc1cnccn1
What is the building block token for the following molecule?
Brc1ccccc1Oc1cnccn1
<BB_1189>
What is the molecular formula for <BB_1189>?
The molecular formula for <BB_1189> (Brc1ccccc1Oc1cnccn1) is C10H7BrN2O.
Describe the ring structures in building block <BB_1189>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1189>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1189>.
**Token:** <BB_1189> **SMILES:** Brc1ccccc1Oc1cnccn1 **Molecular Formula:** C10H7BrN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1190>.
CCC(C(C)=O)C(C)=O
What is the building block token for the following molecule?
CCC(C(C)=O)C(C)=O
<BB_1190>
What is the molecular formula for <BB_1190>?
The molecular formula for <BB_1190> (CCC(C(C)=O)C(C)=O) is C7H12O2.
Describe the ring structures in building block <BB_1190>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1190>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_1190>.
**Token:** <BB_1190> **SMILES:** CCC(C(C)=O)C(C)=O **Molecular Formula:** C7H12O2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_1191>.
C=CCN(CC=C)C(=O)c1ccc(N)cc1
What is the building block token for the following molecule?
C=CCN(CC=C)C(=O)c1ccc(N)cc1
<BB_1191>
What is the molecular formula for <BB_1191>?
The molecular formula for <BB_1191> (C=CCN(CC=C)C(=O)c1ccc(N)cc1) is C13H16N2O.
Describe the ring structures in building block <BB_1191>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1191>.
The molecule contains the following groups: Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_1191>.
**Token:** <BB_1191> **SMILES:** C=CCN(CC=C)C(=O)c1ccc(N)cc1 **Molecular Formula:** C13H16N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Amide
Provide the SMILES representation for the building block token <BB_1192>.
Cc1nc(C(=O)O)nn1-c1ccccn1
What is the building block token for the following molecule?
Cc1nc(C(=O)O)nn1-c1ccccn1
<BB_1192>
What is the molecular formula for <BB_1192>?
The molecular formula for <BB_1192> (Cc1nc(C(=O)O)nn1-c1ccccn1) is C9H8N4O2.
Describe the ring structures in building block <BB_1192>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1192>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1192>.
**Token:** <BB_1192> **SMILES:** Cc1nc(C(=O)O)nn1-c1ccccn1 **Molecular Formula:** C9H8N4O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1193>.
CC(Cl)c1ccon1
What is the building block token for the following molecule?
CC(Cl)c1ccon1
<BB_1193>
What is the molecular formula for <BB_1193>?
The molecular formula for <BB_1193> (CC(Cl)c1ccon1) is C5H6ClNO.
Describe the ring structures in building block <BB_1193>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1193>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1193>.
**Token:** <BB_1193> **SMILES:** CC(Cl)c1ccon1 **Molecular Formula:** C5H6ClNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1194>.
FC(F)(F)c1ccc(Br)c(C(F)(F)F)n1
What is the building block token for the following molecule?
FC(F)(F)c1ccc(Br)c(C(F)(F)F)n1
<BB_1194>
What is the molecular formula for <BB_1194>?
The molecular formula for <BB_1194> (FC(F)(F)c1ccc(Br)c(C(F)(F)F)n1) is C7H2BrF6N.
Describe the ring structures in building block <BB_1194>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1194>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1194>.
**Token:** <BB_1194> **SMILES:** FC(F)(F)c1ccc(Br)c(C(F)(F)F)n1 **Molecular Formula:** C7H2BrF6N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1195>.
COC(=O)c1n[nH]c2cccc(C)c12
What is the building block token for the following molecule?
COC(=O)c1n[nH]c2cccc(C)c12
<BB_1195>
What is the molecular formula for <BB_1195>?
The molecular formula for <BB_1195> (COC(=O)c1n[nH]c2cccc(C)c12) is C10H10N2O2.
Describe the ring structures in building block <BB_1195>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1195>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_1195>.
**Token:** <BB_1195> **SMILES:** COC(=O)c1n[nH]c2cccc(C)c12 **Molecular Formula:** C10H10N2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_1196>.
O=C(O)c1nn(C(F)F)cc1Cl
What is the building block token for the following molecule?
O=C(O)c1nn(C(F)F)cc1Cl
<BB_1196>
What is the molecular formula for <BB_1196>?
The molecular formula for <BB_1196> (O=C(O)c1nn(C(F)F)cc1Cl) is C5H3ClF2N2O2.
Describe the ring structures in building block <BB_1196>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1196>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1196>.
**Token:** <BB_1196> **SMILES:** O=C(O)c1nn(C(F)F)cc1Cl **Molecular Formula:** C5H3ClF2N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1197>.
Cl.O=C1COCC(=O)N1C1CCNCC1
What is the building block token for the following molecule?
Cl.O=C1COCC(=O)N1C1CCNCC1
<BB_1197>
What is the molecular formula for <BB_1197>?
The molecular formula for <BB_1197> (Cl.O=C1COCC(=O)N1C1CCNCC1) is C9H15ClN2O3.
Describe the ring structures in building block <BB_1197>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1197>.
The molecule contains the following groups: Secondary Amine, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1197>.
**Token:** <BB_1197> **SMILES:** Cl.O=C1COCC(=O)N1C1CCNCC1 **Molecular Formula:** C9H15ClN2O3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1198>.
Cn1c(C#N)cnc1Cl
What is the building block token for the following molecule?
Cn1c(C#N)cnc1Cl
<BB_1198>
What is the molecular formula for <BB_1198>?
The molecular formula for <BB_1198> (Cn1c(C#N)cnc1Cl) is C5H4ClN3.
Describe the ring structures in building block <BB_1198>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1198>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1198>.
**Token:** <BB_1198> **SMILES:** Cn1c(C#N)cnc1Cl **Molecular Formula:** C5H4ClN3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_1199>.
COCCN1CCNCC1C
What is the building block token for the following molecule?
COCCN1CCNCC1C
<BB_1199>
What is the molecular formula for <BB_1199>?
The molecular formula for <BB_1199> (COCCN1CCNCC1C) is C8H18N2O.
Describe the ring structures in building block <BB_1199>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1199>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_1199>.
**Token:** <BB_1199> **SMILES:** COCCN1CCNCC1C **Molecular Formula:** C8H18N2O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Ether