instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_1200>.
CC(C#N)N=[N+]=[N-]
What is the building block token for the following molecule?
CC(C#N)N=[N+]=[N-]
<BB_1200>
What is the molecular formula for <BB_1200>?
The molecular formula for <BB_1200> (CC(C#N)N=[N+]=[N-]) is C3H4N4.
Describe the ring structures in building block <BB_1200>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1200>.
The molecule contains the following groups: Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1200>.
**Token:** <BB_1200> **SMILES:** CC(C#N)N=[N+]=[N-] **Molecular Formula:** C3H4N4 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Nitrile
Provide the SMILES representation for the building block token <BB_1201>.
CC1(C)OB(c2cnc3occc3c2)OC1(C)C
What is the building block token for the following molecule?
CC1(C)OB(c2cnc3occc3c2)OC1(C)C
<BB_1201>
What is the molecular formula for <BB_1201>?
The molecular formula for <BB_1201> (CC1(C)OB(c2cnc3occc3c2)OC1(C)C) is C13H16BNO3.
Describe the ring structures in building block <BB_1201>.
The molecule contains 3 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1201>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_1201>.
**Token:** <BB_1201> **SMILES:** CC1(C)OB(c2cnc3occc3c2)OC1(C)C **Molecular Formula:** C13H16BNO3 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_1202>.
O=C(CCl)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1
What is the building block token for the following molecule?
O=C(CCl)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1
<BB_1202>
What is the molecular formula for <BB_1202>?
The molecular formula for <BB_1202> (O=C(CCl)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1) is C10H6ClF6NO.
Describe the ring structures in building block <BB_1202>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1202>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1202>.
**Token:** <BB_1202> **SMILES:** O=C(CCl)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 **Molecular Formula:** C10H6ClF6NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1203>.
CCOC(=O)Cn1cc(C)c(C(F)(F)F)n1
What is the building block token for the following molecule?
CCOC(=O)Cn1cc(C)c(C(F)(F)F)n1
<BB_1203>
What is the molecular formula for <BB_1203>?
The molecular formula for <BB_1203> (CCOC(=O)Cn1cc(C)c(C(F)(F)F)n1) is C9H11F3N2O2.
Describe the ring structures in building block <BB_1203>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1203>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1203>.
**Token:** <BB_1203> **SMILES:** CCOC(=O)Cn1cc(C)c(C(F)(F)F)n1 **Molecular Formula:** C9H11F3N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1204>.
Cc1ccc(C(C)Cl)cc1C
What is the building block token for the following molecule?
Cc1ccc(C(C)Cl)cc1C
<BB_1204>
What is the molecular formula for <BB_1204>?
The molecular formula for <BB_1204> (Cc1ccc(C(C)Cl)cc1C) is C10H13Cl.
Describe the ring structures in building block <BB_1204>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1204>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1204>.
**Token:** <BB_1204> **SMILES:** Cc1ccc(C(C)Cl)cc1C **Molecular Formula:** C10H13Cl **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1205>.
COc1ccc2c(c1)C(N)C(=O)N2.Cl
What is the building block token for the following molecule?
COc1ccc2c(c1)C(N)C(=O)N2.Cl
<BB_1205>
What is the molecular formula for <BB_1205>?
The molecular formula for <BB_1205> (COc1ccc2c(c1)C(N)C(=O)N2.Cl) is C9H11ClN2O2.
Describe the ring structures in building block <BB_1205>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1205>.
The molecule contains the following groups: Amine, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1205>.
**Token:** <BB_1205> **SMILES:** COc1ccc2c(c1)C(N)C(=O)N2.Cl **Molecular Formula:** C9H11ClN2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1206>.
CCn1c(CN)cnc1C.Cl.Cl
What is the building block token for the following molecule?
CCn1c(CN)cnc1C.Cl.Cl
<BB_1206>
What is the molecular formula for <BB_1206>?
The molecular formula for <BB_1206> (CCn1c(CN)cnc1C.Cl.Cl) is C7H15Cl2N3.
Describe the ring structures in building block <BB_1206>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1206>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1206>.
**Token:** <BB_1206> **SMILES:** CCn1c(CN)cnc1C.Cl.Cl **Molecular Formula:** C7H15Cl2N3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1207>.
CCC(=O)C1CC1(C)C
What is the building block token for the following molecule?
CCC(=O)C1CC1(C)C
<BB_1207>
What is the molecular formula for <BB_1207>?
The molecular formula for <BB_1207> (CCC(=O)C1CC1(C)C) is C8H14O.
Describe the ring structures in building block <BB_1207>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_1207>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_1207>.
**Token:** <BB_1207> **SMILES:** CCC(=O)C1CC1(C)C **Molecular Formula:** C8H14O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_1208>.
COC(=O)[C@H]1C[C@H](OC)CN1.Cl
What is the building block token for the following molecule?
COC(=O)[C@H]1C[C@H](OC)CN1.Cl
<BB_1208>
What is the molecular formula for <BB_1208>?
The molecular formula for <BB_1208> (COC(=O)[C@H]1C[C@H](OC)CN1.Cl) is C7H14ClNO3.
Describe the ring structures in building block <BB_1208>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_1208>.
The molecule contains the following groups: Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1208>.
**Token:** <BB_1208> **SMILES:** COC(=O)[C@H]1C[C@H](OC)CN1.Cl **Molecular Formula:** C7H14ClNO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1209>.
CCC(C)C(=O)CN.Cl
What is the building block token for the following molecule?
CCC(C)C(=O)CN.Cl
<BB_1209>
What is the molecular formula for <BB_1209>?
The molecular formula for <BB_1209> (CCC(C)C(=O)CN.Cl) is C6H14ClNO.
Describe the ring structures in building block <BB_1209>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1209>.
The molecule contains the following groups: Amine, Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1209>.
**Token:** <BB_1209> **SMILES:** CCC(C)C(=O)CN.Cl **Molecular Formula:** C6H14ClNO **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1210>.
O=S(=O)(Cl)c1cc(Cl)ccc1OC(F)(F)F
What is the building block token for the following molecule?
O=S(=O)(Cl)c1cc(Cl)ccc1OC(F)(F)F
<BB_1210>
What is the molecular formula for <BB_1210>?
The molecular formula for <BB_1210> (O=S(=O)(Cl)c1cc(Cl)ccc1OC(F)(F)F) is C7H3Cl2F3O3S.
Describe the ring structures in building block <BB_1210>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1210>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1210>.
**Token:** <BB_1210> **SMILES:** O=S(=O)(Cl)c1cc(Cl)ccc1OC(F)(F)F **Molecular Formula:** C7H3Cl2F3O3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1211>.
CS(=O)(=O)[C@H]1C[C@H](O)C1
What is the building block token for the following molecule?
CS(=O)(=O)[C@H]1C[C@H](O)C1
<BB_1211>
What is the molecular formula for <BB_1211>?
The molecular formula for <BB_1211> (CS(=O)(=O)[C@H]1C[C@H](O)C1) is C5H10O3S.
Describe the ring structures in building block <BB_1211>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_1211>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_1211>.
**Token:** <BB_1211> **SMILES:** CS(=O)(=O)[C@H]1C[C@H](O)C1 **Molecular Formula:** C5H10O3S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_1212>.
COC(=O)Cn1ncc(N)n1
What is the building block token for the following molecule?
COC(=O)Cn1ncc(N)n1
<BB_1212>
What is the molecular formula for <BB_1212>?
The molecular formula for <BB_1212> (COC(=O)Cn1ncc(N)n1) is C5H8N4O2.
Describe the ring structures in building block <BB_1212>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1212>.
The molecule contains the following groups: Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_1212>.
**Token:** <BB_1212> **SMILES:** COC(=O)Cn1ncc(N)n1 **Molecular Formula:** C5H8N4O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_1213>.
Cc1ccnc(C)c1N
What is the building block token for the following molecule?
Cc1ccnc(C)c1N
<BB_1213>
What is the molecular formula for <BB_1213>?
The molecular formula for <BB_1213> (Cc1ccnc(C)c1N) is C7H10N2.
Describe the ring structures in building block <BB_1213>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1213>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_1213>.
**Token:** <BB_1213> **SMILES:** Cc1ccnc(C)c1N **Molecular Formula:** C7H10N2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_1214>.
CC(C)(C)OC(=O)NC1(CO)CC(C[Si](C)(C)C)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NC1(CO)CC(C[Si](C)(C)C)C1
<BB_1214>
What is the molecular formula for <BB_1214>?
The molecular formula for <BB_1214> (CC(C)(C)OC(=O)NC1(CO)CC(C[Si](C)(C)C)C1) is C14H29NO3Si.
Describe the ring structures in building block <BB_1214>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_1214>.
The molecule contains the following groups: Amide, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_1214>.
**Token:** <BB_1214> **SMILES:** CC(C)(C)OC(=O)NC1(CO)CC(C[Si](C)(C)C)C1 **Molecular Formula:** C14H29NO3Si **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Amide, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_1215>.
CC(C)(C)OC(=O)NC(C)(CC1CCC1)C(=O)O
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NC(C)(CC1CCC1)C(=O)O
<BB_1215>
What is the molecular formula for <BB_1215>?
The molecular formula for <BB_1215> (CC(C)(C)OC(=O)NC(C)(CC1CCC1)C(=O)O) is C13H23NO4.
Describe the ring structures in building block <BB_1215>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_1215>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_1215>.
**Token:** <BB_1215> **SMILES:** CC(C)(C)OC(=O)NC(C)(CC1CCC1)C(=O)O **Molecular Formula:** C13H23NO4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_1216>.
COc1ncnc(C)c1C(=O)O
What is the building block token for the following molecule?
COc1ncnc(C)c1C(=O)O
<BB_1216>
What is the molecular formula for <BB_1216>?
The molecular formula for <BB_1216> (COc1ncnc(C)c1C(=O)O) is C7H8N2O3.
Describe the ring structures in building block <BB_1216>.
The molecule contains 1 ring(s): an aromatic ring of size 6.