instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_1216>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_1216>.
**Token:** <BB_1216> **SMILES:** COc1ncnc(C)c1C(=O)O **Molecular Formula:** C7H8N2O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_1217>.
N#CCc1nccn1Cc1ccccc1
What is the building block token for the following molecule?
N#CCc1nccn1Cc1ccccc1
<BB_1217>
What is the molecular formula for <BB_1217>?
The molecular formula for <BB_1217> (N#CCc1nccn1Cc1ccccc1) is C12H11N3.
Describe the ring structures in building block <BB_1217>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1217>.
The molecule contains the following groups: Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1217>.
**Token:** <BB_1217> **SMILES:** N#CCc1nccn1Cc1ccccc1 **Molecular Formula:** C12H11N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Nitrile
Provide the SMILES representation for the building block token <BB_1218>.
NCCOc1cnc2[nH]ccc2c1
What is the building block token for the following molecule?
NCCOc1cnc2[nH]ccc2c1
<BB_1218>
What is the molecular formula for <BB_1218>?
The molecular formula for <BB_1218> (NCCOc1cnc2[nH]ccc2c1) is C9H11N3O.
Describe the ring structures in building block <BB_1218>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1218>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_1218>.
**Token:** <BB_1218> **SMILES:** NCCOc1cnc2[nH]ccc2c1 **Molecular Formula:** C9H11N3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_1219>.
Cl.NC(=O)[C@H]1CCNC1
What is the building block token for the following molecule?
Cl.NC(=O)[C@H]1CCNC1
<BB_1219>
What is the molecular formula for <BB_1219>?
The molecular formula for <BB_1219> (Cl.NC(=O)[C@H]1CCNC1) is C5H11ClN2O.
Describe the ring structures in building block <BB_1219>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_1219>.
The molecule contains the following groups: Secondary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1219>.
**Token:** <BB_1219> **SMILES:** Cl.NC(=O)[C@H]1CCNC1 **Molecular Formula:** C5H11ClN2O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1220>.
N#CC1CCCN1Cc1cccnc1
What is the building block token for the following molecule?
N#CC1CCCN1Cc1cccnc1
<BB_1220>
What is the molecular formula for <BB_1220>?
The molecular formula for <BB_1220> (N#CC1CCCN1Cc1cccnc1) is C11H13N3.
Describe the ring structures in building block <BB_1220>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1220>.
The molecule contains the following groups: Tertiary Amine, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1220>.
**Token:** <BB_1220> **SMILES:** N#CC1CCCN1Cc1cccnc1 **Molecular Formula:** C11H13N3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Nitrile
Provide the SMILES representation for the building block token <BB_1221>.
O=Cc1cc(Br)cc2cn[nH]c12
What is the building block token for the following molecule?
O=Cc1cc(Br)cc2cn[nH]c12
<BB_1221>
What is the molecular formula for <BB_1221>?
The molecular formula for <BB_1221> (O=Cc1cc(Br)cc2cn[nH]c12) is C8H5BrN2O.
Describe the ring structures in building block <BB_1221>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1221>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1221>.
**Token:** <BB_1221> **SMILES:** O=Cc1cc(Br)cc2cn[nH]c12 **Molecular Formula:** C8H5BrN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1222>.
CNc1cnc(Br)cn1
What is the building block token for the following molecule?
CNc1cnc(Br)cn1
<BB_1222>
What is the molecular formula for <BB_1222>?
The molecular formula for <BB_1222> (CNc1cnc(Br)cn1) is C5H6BrN3.
Describe the ring structures in building block <BB_1222>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1222>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1222>.
**Token:** <BB_1222> **SMILES:** CNc1cnc(Br)cn1 **Molecular Formula:** C5H6BrN3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1223>.
CC(=O)c1sc(-c2ccccc2F)nc1C
What is the building block token for the following molecule?
CC(=O)c1sc(-c2ccccc2F)nc1C
<BB_1223>
What is the molecular formula for <BB_1223>?
The molecular formula for <BB_1223> (CC(=O)c1sc(-c2ccccc2F)nc1C) is C12H10FNOS.
Describe the ring structures in building block <BB_1223>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1223>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1223>.
**Token:** <BB_1223> **SMILES:** CC(=O)c1sc(-c2ccccc2F)nc1C **Molecular Formula:** C12H10FNOS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1224>.
Cc1nn(COc2cccc(F)c2)c(C)c1N
What is the building block token for the following molecule?
Cc1nn(COc2cccc(F)c2)c(C)c1N
<BB_1224>
What is the molecular formula for <BB_1224>?
The molecular formula for <BB_1224> (Cc1nn(COc2cccc(F)c2)c(C)c1N) is C12H14FN3O.
Describe the ring structures in building block <BB_1224>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1224>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1224>.
**Token:** <BB_1224> **SMILES:** Cc1nn(COc2cccc(F)c2)c(C)c1N **Molecular Formula:** C12H14FN3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1225>.
Cl.NC(CO)Cc1ccc(Br)cc1Cl
What is the building block token for the following molecule?
Cl.NC(CO)Cc1ccc(Br)cc1Cl
<BB_1225>
What is the molecular formula for <BB_1225>?
The molecular formula for <BB_1225> (Cl.NC(CO)Cc1ccc(Br)cc1Cl) is C9H12BrCl2NO.
Describe the ring structures in building block <BB_1225>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1225>.
The molecule contains the following groups: Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1225>.
**Token:** <BB_1225> **SMILES:** Cl.NC(CO)Cc1ccc(Br)cc1Cl **Molecular Formula:** C9H12BrCl2NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1226>.
CCN1CCN(N=O)CC1
What is the building block token for the following molecule?
CCN1CCN(N=O)CC1
<BB_1226>
What is the molecular formula for <BB_1226>?
The molecular formula for <BB_1226> (CCN1CCN(N=O)CC1) is C6H13N3O.
Describe the ring structures in building block <BB_1226>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1226>.
The molecule contains the following groups: Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_1226>.
**Token:** <BB_1226> **SMILES:** CCN1CCN(N=O)CC1 **Molecular Formula:** C6H13N3O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine
Provide the SMILES representation for the building block token <BB_1227>.
C=COc1ccc(B2OC(C)(C)C(C)(C)O2)cc1
What is the building block token for the following molecule?
C=COc1ccc(B2OC(C)(C)C(C)(C)O2)cc1
<BB_1227>
What is the molecular formula for <BB_1227>?
The molecular formula for <BB_1227> (C=COc1ccc(B2OC(C)(C)C(C)(C)O2)cc1) is C14H19BO3.
Describe the ring structures in building block <BB_1227>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1227>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_1227>.
**Token:** <BB_1227> **SMILES:** C=COc1ccc(B2OC(C)(C)C(C)(C)O2)cc1 **Molecular Formula:** C14H19BO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_1228>.
O=[N+]([O-])c1cc(I)cc(CO)c1
What is the building block token for the following molecule?
O=[N+]([O-])c1cc(I)cc(CO)c1
<BB_1228>
What is the molecular formula for <BB_1228>?
The molecular formula for <BB_1228> (O=[N+]([O-])c1cc(I)cc(CO)c1) is C7H6INO3.
Describe the ring structures in building block <BB_1228>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1228>.
The molecule contains the following groups: Tertiary Amine, Alcohol, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_1228>.
**Token:** <BB_1228> **SMILES:** O=[N+]([O-])c1cc(I)cc(CO)c1 **Molecular Formula:** C7H6INO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Alcohol, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_1229>.
Cc1cc2cc(C(=O)O)ccc2o1
What is the building block token for the following molecule?
Cc1cc2cc(C(=O)O)ccc2o1
<BB_1229>
What is the molecular formula for <BB_1229>?
The molecular formula for <BB_1229> (Cc1cc2cc(C(=O)O)ccc2o1) is C10H8O3.
Describe the ring structures in building block <BB_1229>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1229>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1229>.
**Token:** <BB_1229> **SMILES:** Cc1cc2cc(C(=O)O)ccc2o1 **Molecular Formula:** C10H8O3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1230>.
CC(C)(C)OC(=O)N[C@@H]1C[C@H](N)C1(C)C
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N[C@@H]1C[C@H](N)C1(C)C
<BB_1230>
What is the molecular formula for <BB_1230>?
The molecular formula for <BB_1230> (CC(C)(C)OC(=O)N[C@@H]1C[C@H](N)C1(C)C) is C11H22N2O2.
Describe the ring structures in building block <BB_1230>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_1230>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_1230>.
**Token:** <BB_1230> **SMILES:** CC(C)(C)OC(=O)N[C@@H]1C[C@H](N)C1(C)C **Molecular Formula:** C11H22N2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_1231>.
COCc1csc(N)n1
What is the building block token for the following molecule?
COCc1csc(N)n1
<BB_1231>
What is the molecular formula for <BB_1231>?
The molecular formula for <BB_1231> (COCc1csc(N)n1) is C5H8N2OS.
Describe the ring structures in building block <BB_1231>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1231>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_1231>.
**Token:** <BB_1231> **SMILES:** COCc1csc(N)n1 **Molecular Formula:** C5H8N2OS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_1232>.
CC(C)(C)c1cc(B(O)O)cc(C(C)(C)C)c1O
What is the building block token for the following molecule?
CC(C)(C)c1cc(B(O)O)cc(C(C)(C)C)c1O
<BB_1232>
What is the molecular formula for <BB_1232>?
The molecular formula for <BB_1232> (CC(C)(C)c1cc(B(O)O)cc(C(C)(C)C)c1O) is C14H23BO3.
Describe the ring structures in building block <BB_1232>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1232>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_1232>.
**Token:** <BB_1232> **SMILES:** CC(C)(C)c1cc(B(O)O)cc(C(C)(C)C)c1O **Molecular Formula:** C14H23BO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_1233>.
CS(=O)(=O)c1ccc(C=O)o1
What is the building block token for the following molecule?
CS(=O)(=O)c1ccc(C=O)o1
<BB_1233>