instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_1233>?
The molecular formula for <BB_1233> (CS(=O)(=O)c1ccc(C=O)o1) is C6H6O4S.
Describe the ring structures in building block <BB_1233>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1233>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_1233>.
**Token:** <BB_1233> **SMILES:** CS(=O)(=O)c1ccc(C=O)o1 **Molecular Formula:** C6H6O4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_1234>.
Nc1cc(Oc2ccc(F)c(Cl)c2)cc([N+](=O)[O-])c1
What is the building block token for the following molecule?
Nc1cc(Oc2ccc(F)c(Cl)c2)cc([N+](=O)[O-])c1
<BB_1234>
What is the molecular formula for <BB_1234>?
The molecular formula for <BB_1234> (Nc1cc(Oc2ccc(F)c(Cl)c2)cc([N+](=O)[O-])c1) is C12H8ClFN2O3.
Describe the ring structures in building block <BB_1234>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1234>.
The molecule contains the following groups: Amine, Tertiary Amine, Ether, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_1234>.
**Token:** <BB_1234> **SMILES:** Nc1cc(Oc2ccc(F)c(Cl)c2)cc([N+](=O)[O-])c1 **Molecular Formula:** C12H8ClFN2O3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Ether, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_1235>.
CCC1(CS)COC1
What is the building block token for the following molecule?
CCC1(CS)COC1
<BB_1235>
What is the molecular formula for <BB_1235>?
The molecular formula for <BB_1235> (CCC1(CS)COC1) is C6H12OS.
Describe the ring structures in building block <BB_1235>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_1235>.
The molecule contains the following groups: Ether, Thiol.
Provide a comprehensive chemical profile for the building block <BB_1235>.
**Token:** <BB_1235> **SMILES:** CCC1(CS)COC1 **Molecular Formula:** C6H12OS **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Ether, Thiol
Provide the SMILES representation for the building block token <BB_1236>.
OC1c2ccccc2CC1F
What is the building block token for the following molecule?
OC1c2ccccc2CC1F
<BB_1236>
What is the molecular formula for <BB_1236>?
The molecular formula for <BB_1236> (OC1c2ccccc2CC1F) is C9H9FO.
Describe the ring structures in building block <BB_1236>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1236>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1236>.
**Token:** <BB_1236> **SMILES:** OC1c2ccccc2CC1F **Molecular Formula:** C9H9FO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1237>.
COC(=O)C1CCNC(=O)C1
What is the building block token for the following molecule?
COC(=O)C1CCNC(=O)C1
<BB_1237>
What is the molecular formula for <BB_1237>?
The molecular formula for <BB_1237> (COC(=O)C1CCNC(=O)C1) is C7H11NO3.
Describe the ring structures in building block <BB_1237>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1237>.
The molecule contains the following groups: Amide, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_1237>.
**Token:** <BB_1237> **SMILES:** COC(=O)C1CCNC(=O)C1 **Molecular Formula:** C7H11NO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amide, Ester, Ether
Provide the SMILES representation for the building block token <BB_1238>.
N#CCc1sccc1Br
What is the building block token for the following molecule?
N#CCc1sccc1Br
<BB_1238>
What is the molecular formula for <BB_1238>?
The molecular formula for <BB_1238> (N#CCc1sccc1Br) is C6H4BrNS.
Describe the ring structures in building block <BB_1238>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1238>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1238>.
**Token:** <BB_1238> **SMILES:** N#CCc1sccc1Br **Molecular Formula:** C6H4BrNS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_1239>.
Nc1cc2ccccc2c(=O)[nH]1
What is the building block token for the following molecule?
Nc1cc2ccccc2c(=O)[nH]1
<BB_1239>
What is the molecular formula for <BB_1239>?
The molecular formula for <BB_1239> (Nc1cc2ccccc2c(=O)[nH]1) is C9H8N2O.
Describe the ring structures in building block <BB_1239>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1239>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_1239>.
**Token:** <BB_1239> **SMILES:** Nc1cc2ccccc2c(=O)[nH]1 **Molecular Formula:** C9H8N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_1240>.
CCCNCCN1CCCCCC1
What is the building block token for the following molecule?
CCCNCCN1CCCCCC1
<BB_1240>
What is the molecular formula for <BB_1240>?
The molecular formula for <BB_1240> (CCCNCCN1CCCCCC1) is C11H24N2.
Describe the ring structures in building block <BB_1240>.
The molecule contains 1 ring(s): an aliphatic ring of size 7.
List the primary functional groups present in <BB_1240>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_1240>.
**Token:** <BB_1240> **SMILES:** CCCNCCN1CCCCCC1 **Molecular Formula:** C11H24N2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 7. **Functional Groups:** Secondary Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_1241>.
Cc1nn(-c2ccc(F)cc2)cc1C(=O)O
What is the building block token for the following molecule?
Cc1nn(-c2ccc(F)cc2)cc1C(=O)O
<BB_1241>
What is the molecular formula for <BB_1241>?
The molecular formula for <BB_1241> (Cc1nn(-c2ccc(F)cc2)cc1C(=O)O) is C11H9FN2O2.
Describe the ring structures in building block <BB_1241>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1241>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1241>.
**Token:** <BB_1241> **SMILES:** Cc1nn(-c2ccc(F)cc2)cc1C(=O)O **Molecular Formula:** C11H9FN2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1242>.
COc1nc(OC)c(C=O)cc1Br
What is the building block token for the following molecule?
COc1nc(OC)c(C=O)cc1Br
<BB_1242>
What is the molecular formula for <BB_1242>?
The molecular formula for <BB_1242> (COc1nc(OC)c(C=O)cc1Br) is C8H8BrNO3.
Describe the ring structures in building block <BB_1242>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1242>.
The molecule contains the following groups: Aldehyde, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1242>.
**Token:** <BB_1242> **SMILES:** COc1nc(OC)c(C=O)cc1Br **Molecular Formula:** C8H8BrNO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1243>.
COc1ccc(OCC(=O)O)cc1
What is the building block token for the following molecule?
COc1ccc(OCC(=O)O)cc1
<BB_1243>
What is the molecular formula for <BB_1243>?
The molecular formula for <BB_1243> (COc1ccc(OCC(=O)O)cc1) is C9H10O4.
Describe the ring structures in building block <BB_1243>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1243>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_1243>.
**Token:** <BB_1243> **SMILES:** COc1ccc(OCC(=O)O)cc1 **Molecular Formula:** C9H10O4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_1244>.
COC(=O)c1cn(-c2cccc(N)c2)nn1
What is the building block token for the following molecule?
COC(=O)c1cn(-c2cccc(N)c2)nn1
<BB_1244>
What is the molecular formula for <BB_1244>?
The molecular formula for <BB_1244> (COC(=O)c1cn(-c2cccc(N)c2)nn1) is C10H10N4O2.
Describe the ring structures in building block <BB_1244>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1244>.
The molecule contains the following groups: Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_1244>.
**Token:** <BB_1244> **SMILES:** COC(=O)c1cn(-c2cccc(N)c2)nn1 **Molecular Formula:** C10H10N4O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_1245>.
Cl.O=C(O)C12CCCC(CNC1)C2
What is the building block token for the following molecule?
Cl.O=C(O)C12CCCC(CNC1)C2
<BB_1245>
What is the molecular formula for <BB_1245>?
The molecular formula for <BB_1245> (Cl.O=C(O)C12CCCC(CNC1)C2) is C9H16ClNO2.
Describe the ring structures in building block <BB_1245>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1245>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1245>.
**Token:** <BB_1245> **SMILES:** Cl.O=C(O)C12CCCC(CNC1)C2 **Molecular Formula:** C9H16ClNO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1246>.
CCCCS(=O)(=O)CC#N
What is the building block token for the following molecule?
CCCCS(=O)(=O)CC#N
<BB_1246>
What is the molecular formula for <BB_1246>?
The molecular formula for <BB_1246> (CCCCS(=O)(=O)CC#N) is C6H11NO2S.
Describe the ring structures in building block <BB_1246>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1246>.
The molecule contains the following groups: Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1246>.
**Token:** <BB_1246> **SMILES:** CCCCS(=O)(=O)CC#N **Molecular Formula:** C6H11NO2S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Nitrile
Provide the SMILES representation for the building block token <BB_1247>.
CCOc1c(Cl)cc(C=O)cc1Cl
What is the building block token for the following molecule?
CCOc1c(Cl)cc(C=O)cc1Cl
<BB_1247>
What is the molecular formula for <BB_1247>?
The molecular formula for <BB_1247> (CCOc1c(Cl)cc(C=O)cc1Cl) is C9H8Cl2O2.
Describe the ring structures in building block <BB_1247>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1247>.
The molecule contains the following groups: Aldehyde, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1247>.
**Token:** <BB_1247> **SMILES:** CCOc1c(Cl)cc(C=O)cc1Cl **Molecular Formula:** C9H8Cl2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1248>.
O=C1CCCCCc2ccccc21
What is the building block token for the following molecule?
O=C1CCCCCc2ccccc21
<BB_1248>
What is the molecular formula for <BB_1248>?
The molecular formula for <BB_1248> (O=C1CCCCCc2ccccc21) is C12H14O.
Describe the ring structures in building block <BB_1248>.
The molecule contains 2 ring(s): an aliphatic ring of size 8, an aromatic ring of size 6.
List the primary functional groups present in <BB_1248>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_1248>.
**Token:** <BB_1248> **SMILES:** O=C1CCCCCc2ccccc21 **Molecular Formula:** C12H14O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 8, an aromatic ring of size 6. **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_1249>.
CCNCC(=O)NC(C)(C)C.Cl
What is the building block token for the following molecule?
CCNCC(=O)NC(C)(C)C.Cl
<BB_1249>
What is the molecular formula for <BB_1249>?
The molecular formula for <BB_1249> (CCNCC(=O)NC(C)(C)C.Cl) is C8H19ClN2O.
Describe the ring structures in building block <BB_1249>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1249>.
The molecule contains the following groups: Secondary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1249>.
**Token:** <BB_1249> **SMILES:** CCNCC(=O)NC(C)(C)C.Cl **Molecular Formula:** C8H19ClN2O **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Secondary Amine, Amide, Halogen (F,Cl,Br,I)