instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_1250>.
CC(Cl)C(=O)NC12CC3CC(CC(C3)C1)C2
What is the building block token for the following molecule?
CC(Cl)C(=O)NC12CC3CC(CC(C3)C1)C2
<BB_1250>
What is the molecular formula for <BB_1250>?
The molecular formula for <BB_1250> (CC(Cl)C(=O)NC12CC3CC(CC(C3)C1)C2) is C13H20ClNO.
Describe the ring structures in building block <BB_1250>.
The molecule contains 4 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1250>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1250>.
**Token:** <BB_1250> **SMILES:** CC(Cl)C(=O)NC12CC3CC(CC(C3)C1)C2 **Molecular Formula:** C13H20ClNO **Ring System:** The molecule contains 4 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1251>.
COC(=O)C1CCc2c(Br)cccc2C1
What is the building block token for the following molecule?
COC(=O)C1CCc2c(Br)cccc2C1
<BB_1251>
What is the molecular formula for <BB_1251>?
The molecular formula for <BB_1251> (COC(=O)C1CCc2c(Br)cccc2C1) is C12H13BrO2.
Describe the ring structures in building block <BB_1251>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1251>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1251>.
**Token:** <BB_1251> **SMILES:** COC(=O)C1CCc2c(Br)cccc2C1 **Molecular Formula:** C12H13BrO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1252>.
CCOc1ccc(CC2CNC2)cc1.Cl
What is the building block token for the following molecule?
CCOc1ccc(CC2CNC2)cc1.Cl
<BB_1252>
What is the molecular formula for <BB_1252>?
The molecular formula for <BB_1252> (CCOc1ccc(CC2CNC2)cc1.Cl) is C12H18ClNO.
Describe the ring structures in building block <BB_1252>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_1252>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1252>.
**Token:** <BB_1252> **SMILES:** CCOc1ccc(CC2CNC2)cc1.Cl **Molecular Formula:** C12H18ClNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1253>.
O=C(O)C1CCOC12CCC2
What is the building block token for the following molecule?
O=C(O)C1CCOC12CCC2
<BB_1253>
What is the molecular formula for <BB_1253>?
The molecular formula for <BB_1253> (O=C(O)C1CCOC12CCC2) is C8H12O3.
Describe the ring structures in building block <BB_1253>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 4.
List the primary functional groups present in <BB_1253>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_1253>.
**Token:** <BB_1253> **SMILES:** O=C(O)C1CCOC12CCC2 **Molecular Formula:** C8H12O3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_1254>.
Cl.Cl.Nc1ccc(CN2CCCCC2=O)cc1
What is the building block token for the following molecule?
Cl.Cl.Nc1ccc(CN2CCCCC2=O)cc1
<BB_1254>
What is the molecular formula for <BB_1254>?
The molecular formula for <BB_1254> (Cl.Cl.Nc1ccc(CN2CCCCC2=O)cc1) is C12H18Cl2N2O.
Describe the ring structures in building block <BB_1254>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1254>.
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1254>.
**Token:** <BB_1254> **SMILES:** Cl.Cl.Nc1ccc(CN2CCCCC2=O)cc1 **Molecular Formula:** C12H18Cl2N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1255>.
COc1ccc2c(c1)NC(=O)C2=O
What is the building block token for the following molecule?
COc1ccc2c(c1)NC(=O)C2=O
<BB_1255>
What is the molecular formula for <BB_1255>?
The molecular formula for <BB_1255> (COc1ccc2c(c1)NC(=O)C2=O) is C9H7NO3.
Describe the ring structures in building block <BB_1255>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1255>.
The molecule contains the following groups: Amide, Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_1255>.
**Token:** <BB_1255> **SMILES:** COc1ccc2c(c1)NC(=O)C2=O **Molecular Formula:** C9H7NO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amide, Ketone, Ether
Provide the SMILES representation for the building block token <BB_1256>.
O=S1(=O)CCCC(O)C1
What is the building block token for the following molecule?
O=S1(=O)CCCC(O)C1
<BB_1256>
What is the molecular formula for <BB_1256>?
The molecular formula for <BB_1256> (O=S1(=O)CCCC(O)C1) is C5H10O3S.
Describe the ring structures in building block <BB_1256>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1256>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_1256>.
**Token:** <BB_1256> **SMILES:** O=S1(=O)CCCC(O)C1 **Molecular Formula:** C5H10O3S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_1257>.
COc1ccc2c(c1)CC(C)N2
What is the building block token for the following molecule?
COc1ccc2c(c1)CC(C)N2
<BB_1257>
What is the molecular formula for <BB_1257>?
The molecular formula for <BB_1257> (COc1ccc2c(c1)CC(C)N2) is C10H13NO.
Describe the ring structures in building block <BB_1257>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1257>.
The molecule contains the following groups: Secondary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_1257>.
**Token:** <BB_1257> **SMILES:** COc1ccc2c(c1)CC(C)N2 **Molecular Formula:** C10H13NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Ether
Provide the SMILES representation for the building block token <BB_1258>.
O=C(O)CC1COCc2ccccc21
What is the building block token for the following molecule?
O=C(O)CC1COCc2ccccc21
<BB_1258>
What is the molecular formula for <BB_1258>?
The molecular formula for <BB_1258> (O=C(O)CC1COCc2ccccc21) is C11H12O3.
Describe the ring structures in building block <BB_1258>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1258>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_1258>.
**Token:** <BB_1258> **SMILES:** O=C(O)CC1COCc2ccccc21 **Molecular Formula:** C11H12O3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_1259>.
COC(=O)C1(CS(=O)(=O)Cl)CC(F)(F)C1
What is the building block token for the following molecule?
COC(=O)C1(CS(=O)(=O)Cl)CC(F)(F)C1
<BB_1259>
What is the molecular formula for <BB_1259>?
The molecular formula for <BB_1259> (COC(=O)C1(CS(=O)(=O)Cl)CC(F)(F)C1) is C7H9ClF2O4S.
Describe the ring structures in building block <BB_1259>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_1259>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1259>.
**Token:** <BB_1259> **SMILES:** COC(=O)C1(CS(=O)(=O)Cl)CC(F)(F)C1 **Molecular Formula:** C7H9ClF2O4S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1260>.
CCOC(=O)C1(C(F)(F)F)CC(C)(C)C1
What is the building block token for the following molecule?
CCOC(=O)C1(C(F)(F)F)CC(C)(C)C1
<BB_1260>
What is the molecular formula for <BB_1260>?
The molecular formula for <BB_1260> (CCOC(=O)C1(C(F)(F)F)CC(C)(C)C1) is C10H15F3O2.
Describe the ring structures in building block <BB_1260>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_1260>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1260>.
**Token:** <BB_1260> **SMILES:** CCOC(=O)C1(C(F)(F)F)CC(C)(C)C1 **Molecular Formula:** C10H15F3O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1261>.
O=C1CCCCC1c1ccc(C(F)(F)F)cc1
What is the building block token for the following molecule?
O=C1CCCCC1c1ccc(C(F)(F)F)cc1
<BB_1261>
What is the molecular formula for <BB_1261>?
The molecular formula for <BB_1261> (O=C1CCCCC1c1ccc(C(F)(F)F)cc1) is C13H13F3O.
Describe the ring structures in building block <BB_1261>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1261>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1261>.
**Token:** <BB_1261> **SMILES:** O=C1CCCCC1c1ccc(C(F)(F)F)cc1 **Molecular Formula:** C13H13F3O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1262>.
COC(=O)CN(CC(=O)OC)CC(=O)OC(C)(C)C
What is the building block token for the following molecule?
COC(=O)CN(CC(=O)OC)CC(=O)OC(C)(C)C
<BB_1262>
What is the molecular formula for <BB_1262>?
The molecular formula for <BB_1262> (COC(=O)CN(CC(=O)OC)CC(=O)OC(C)(C)C) is C12H21NO6.
Describe the ring structures in building block <BB_1262>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1262>.
The molecule contains the following groups: Tertiary Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_1262>.
**Token:** <BB_1262> **SMILES:** COC(=O)CN(CC(=O)OC)CC(=O)OC(C)(C)C **Molecular Formula:** C12H21NO6 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Tertiary Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_1263>.
Cc1cc(C)c(S(N)(=O)=O)c(C)c1
What is the building block token for the following molecule?
Cc1cc(C)c(S(N)(=O)=O)c(C)c1
<BB_1263>
What is the molecular formula for <BB_1263>?
The molecular formula for <BB_1263> (Cc1cc(C)c(S(N)(=O)=O)c(C)c1) is C9H13NO2S.
Describe the ring structures in building block <BB_1263>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1263>.
The molecule contains the following groups: Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_1263>.
**Token:** <BB_1263> **SMILES:** Cc1cc(C)c(S(N)(=O)=O)c(C)c1 **Molecular Formula:** C9H13NO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_1264>.
O=C(O)C1CCCN(S(=O)(=O)C(F)F)C1
What is the building block token for the following molecule?
O=C(O)C1CCCN(S(=O)(=O)C(F)F)C1
<BB_1264>
What is the molecular formula for <BB_1264>?
The molecular formula for <BB_1264> (O=C(O)C1CCCN(S(=O)(=O)C(F)F)C1) is C7H11F2NO4S.
Describe the ring structures in building block <BB_1264>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1264>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_1264>.
**Token:** <BB_1264> **SMILES:** O=C(O)C1CCCN(S(=O)(=O)C(F)F)C1 **Molecular Formula:** C7H11F2NO4S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Tertiary Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_1265>.
CSc1ncncn1
What is the building block token for the following molecule?
CSc1ncncn1
<BB_1265>
What is the molecular formula for <BB_1265>?
The molecular formula for <BB_1265> (CSc1ncncn1) is C4H5N3S.
Describe the ring structures in building block <BB_1265>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1265>.
The molecule contains the following groups: Sulfide.
Provide a comprehensive chemical profile for the building block <BB_1265>.
**Token:** <BB_1265> **SMILES:** CSc1ncncn1 **Molecular Formula:** C4H5N3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Sulfide
Provide the SMILES representation for the building block token <BB_1266>.
CSCCC(NC(=O)OC(C)(C)C)C(=O)O
What is the building block token for the following molecule?
CSCCC(NC(=O)OC(C)(C)C)C(=O)O
<BB_1266>
What is the molecular formula for <BB_1266>?
The molecular formula for <BB_1266> (CSCCC(NC(=O)OC(C)(C)C)C(=O)O) is C10H19NO4S.
Describe the ring structures in building block <BB_1266>.
The molecule is acyclic (contains no rings).