instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_1266>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_1266>.
**Token:** <BB_1266> **SMILES:** CSCCC(NC(=O)OC(C)(C)C)C(=O)O **Molecular Formula:** C10H19NO4S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Amide, Ether, Sulfide
Provide the SMILES representation for the building block token <BB_1267>.
C#CC1CCC2(CC1)CC2
What is the building block token for the following molecule?
C#CC1CCC2(CC1)CC2
<BB_1267>
What is the molecular formula for <BB_1267>?
The molecular formula for <BB_1267> (C#CC1CCC2(CC1)CC2) is C10H14.
Describe the ring structures in building block <BB_1267>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_1267>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_1267>.
**Token:** <BB_1267> **SMILES:** C#CC1CCC2(CC1)CC2 **Molecular Formula:** C10H14 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_1268>.
Clc1cncc(N2CCCC2)n1
What is the building block token for the following molecule?
Clc1cncc(N2CCCC2)n1
<BB_1268>
What is the molecular formula for <BB_1268>?
The molecular formula for <BB_1268> (Clc1cncc(N2CCCC2)n1) is C8H10ClN3.
Describe the ring structures in building block <BB_1268>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1268>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1268>.
**Token:** <BB_1268> **SMILES:** Clc1cncc(N2CCCC2)n1 **Molecular Formula:** C8H10ClN3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1269>.
NC(=S)c1cccc(NC(=O)c2cn[nH]c2)c1
What is the building block token for the following molecule?
NC(=S)c1cccc(NC(=O)c2cn[nH]c2)c1
<BB_1269>
What is the molecular formula for <BB_1269>?
The molecular formula for <BB_1269> (NC(=S)c1cccc(NC(=O)c2cn[nH]c2)c1) is C11H10N4OS.
Describe the ring structures in building block <BB_1269>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1269>.
The molecule contains the following groups: Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_1269>.
**Token:** <BB_1269> **SMILES:** NC(=S)c1cccc(NC(=O)c2cn[nH]c2)c1 **Molecular Formula:** C11H10N4OS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine, Amide
Provide the SMILES representation for the building block token <BB_1270>.
Cl.Cl.NCc1nnc(C2CCOC2)[nH]1
What is the building block token for the following molecule?
Cl.Cl.NCc1nnc(C2CCOC2)[nH]1
<BB_1270>
What is the molecular formula for <BB_1270>?
The molecular formula for <BB_1270> (Cl.Cl.NCc1nnc(C2CCOC2)[nH]1) is C7H14Cl2N4O.
Describe the ring structures in building block <BB_1270>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1270>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1270>.
**Token:** <BB_1270> **SMILES:** Cl.Cl.NCc1nnc(C2CCOC2)[nH]1 **Molecular Formula:** C7H14Cl2N4O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1271>.
CC(C)C(C#N)c1ccc(Cl)cc1
What is the building block token for the following molecule?
CC(C)C(C#N)c1ccc(Cl)cc1
<BB_1271>
What is the molecular formula for <BB_1271>?
The molecular formula for <BB_1271> (CC(C)C(C#N)c1ccc(Cl)cc1) is C11H12ClN.
Describe the ring structures in building block <BB_1271>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1271>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1271>.
**Token:** <BB_1271> **SMILES:** CC(C)C(C#N)c1ccc(Cl)cc1 **Molecular Formula:** C11H12ClN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_1272>.
Cc1cccc(S(N)(=O)=O)c1[N+](=O)[O-]
What is the building block token for the following molecule?
Cc1cccc(S(N)(=O)=O)c1[N+](=O)[O-]
<BB_1272>
What is the molecular formula for <BB_1272>?
The molecular formula for <BB_1272> (Cc1cccc(S(N)(=O)=O)c1[N+](=O)[O-]) is C7H8N2O4S.
Describe the ring structures in building block <BB_1272>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1272>.
The molecule contains the following groups: Amine, Tertiary Amine, Nitro, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_1272>.
**Token:** <BB_1272> **SMILES:** Cc1cccc(S(N)(=O)=O)c1[N+](=O)[O-] **Molecular Formula:** C7H8N2O4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Nitro, Sulfonamide
Provide the SMILES representation for the building block token <BB_1273>.
Cc1nnc(Cl)nc1C
What is the building block token for the following molecule?
Cc1nnc(Cl)nc1C
<BB_1273>
What is the molecular formula for <BB_1273>?
The molecular formula for <BB_1273> (Cc1nnc(Cl)nc1C) is C5H6ClN3.
Describe the ring structures in building block <BB_1273>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1273>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1273>.
**Token:** <BB_1273> **SMILES:** Cc1nnc(Cl)nc1C **Molecular Formula:** C5H6ClN3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1274>.
CCOC(=O)Cn1nc([N+](=O)[O-])cc1C
What is the building block token for the following molecule?
CCOC(=O)Cn1nc([N+](=O)[O-])cc1C
<BB_1274>
What is the molecular formula for <BB_1274>?
The molecular formula for <BB_1274> (CCOC(=O)Cn1nc([N+](=O)[O-])cc1C) is C8H11N3O4.
Describe the ring structures in building block <BB_1274>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1274>.
The molecule contains the following groups: Tertiary Amine, Ester, Ether, Nitro.
Provide a comprehensive chemical profile for the building block <BB_1274>.
**Token:** <BB_1274> **SMILES:** CCOC(=O)Cn1nc([N+](=O)[O-])cc1C **Molecular Formula:** C8H11N3O4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Tertiary Amine, Ester, Ether, Nitro
Provide the SMILES representation for the building block token <BB_1275>.
O=C(O)Cn1cnc(Cl)n1
What is the building block token for the following molecule?
O=C(O)Cn1cnc(Cl)n1
<BB_1275>
What is the molecular formula for <BB_1275>?
The molecular formula for <BB_1275> (O=C(O)Cn1cnc(Cl)n1) is C4H4ClN3O2.
Describe the ring structures in building block <BB_1275>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1275>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1275>.
**Token:** <BB_1275> **SMILES:** O=C(O)Cn1cnc(Cl)n1 **Molecular Formula:** C4H4ClN3O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1276>.
CCCCN(C(=O)CCl)C1CCS(=O)(=O)C1
What is the building block token for the following molecule?
CCCCN(C(=O)CCl)C1CCS(=O)(=O)C1
<BB_1276>
What is the molecular formula for <BB_1276>?
The molecular formula for <BB_1276> (CCCCN(C(=O)CCl)C1CCS(=O)(=O)C1) is C10H18ClNO3S.
Describe the ring structures in building block <BB_1276>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_1276>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1276>.
**Token:** <BB_1276> **SMILES:** CCCCN(C(=O)CCl)C1CCS(=O)(=O)C1 **Molecular Formula:** C10H18ClNO3S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1277>.
O=C1NC(=O)C(c2ccc(C(=O)O)cc2)S1
What is the building block token for the following molecule?
O=C1NC(=O)C(c2ccc(C(=O)O)cc2)S1
<BB_1277>
What is the molecular formula for <BB_1277>?
The molecular formula for <BB_1277> (O=C1NC(=O)C(c2ccc(C(=O)O)cc2)S1) is C10H7NO4S.
Describe the ring structures in building block <BB_1277>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1277>.
The molecule contains the following groups: Carboxylic Acid, Amide, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_1277>.
**Token:** <BB_1277> **SMILES:** O=C1NC(=O)C(c2ccc(C(=O)O)cc2)S1 **Molecular Formula:** C10H7NO4S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide, Sulfide
Provide the SMILES representation for the building block token <BB_1278>.
CSc1ccc(Br)c(Cl)c1
What is the building block token for the following molecule?
CSc1ccc(Br)c(Cl)c1
<BB_1278>
What is the molecular formula for <BB_1278>?
The molecular formula for <BB_1278> (CSc1ccc(Br)c(Cl)c1) is C7H6BrClS.
Describe the ring structures in building block <BB_1278>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1278>.
The molecule contains the following groups: Sulfide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1278>.
**Token:** <BB_1278> **SMILES:** CSc1ccc(Br)c(Cl)c1 **Molecular Formula:** C7H6BrClS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Sulfide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1279>.
CNCc1ccc(C(=O)NCC(F)(F)F)cc1.Cl
What is the building block token for the following molecule?
CNCc1ccc(C(=O)NCC(F)(F)F)cc1.Cl
<BB_1279>
What is the molecular formula for <BB_1279>?
The molecular formula for <BB_1279> (CNCc1ccc(C(=O)NCC(F)(F)F)cc1.Cl) is C11H14ClF3N2O.
Describe the ring structures in building block <BB_1279>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1279>.
The molecule contains the following groups: Secondary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1279>.
**Token:** <BB_1279> **SMILES:** CNCc1ccc(C(=O)NCC(F)(F)F)cc1.Cl **Molecular Formula:** C11H14ClF3N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1280>.
COc1ccc(CBr)cc1[N+](=O)[O-]
What is the building block token for the following molecule?
COc1ccc(CBr)cc1[N+](=O)[O-]
<BB_1280>
What is the molecular formula for <BB_1280>?
The molecular formula for <BB_1280> (COc1ccc(CBr)cc1[N+](=O)[O-]) is C8H8BrNO3.
Describe the ring structures in building block <BB_1280>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1280>.
The molecule contains the following groups: Tertiary Amine, Ether, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_1280>.
**Token:** <BB_1280> **SMILES:** COc1ccc(CBr)cc1[N+](=O)[O-] **Molecular Formula:** C8H8BrNO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Ether, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_1281>.
Cc1cc(=O)n2nc(Cl)c(C)cc2n1
What is the building block token for the following molecule?
Cc1cc(=O)n2nc(Cl)c(C)cc2n1
<BB_1281>
What is the molecular formula for <BB_1281>?
The molecular formula for <BB_1281> (Cc1cc(=O)n2nc(Cl)c(C)cc2n1) is C9H8ClN3O.
Describe the ring structures in building block <BB_1281>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1281>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1281>.
**Token:** <BB_1281> **SMILES:** Cc1cc(=O)n2nc(Cl)c(C)cc2n1 **Molecular Formula:** C9H8ClN3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1282>.
CC1(C)C(=O)CC12CSC2
What is the building block token for the following molecule?
CC1(C)C(=O)CC12CSC2
<BB_1282>
What is the molecular formula for <BB_1282>?
The molecular formula for <BB_1282> (CC1(C)C(=O)CC12CSC2) is C8H12OS.
Describe the ring structures in building block <BB_1282>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4.
List the primary functional groups present in <BB_1282>.
The molecule contains the following groups: Ketone, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_1282>.
**Token:** <BB_1282> **SMILES:** CC1(C)C(=O)CC12CSC2 **Molecular Formula:** C8H12OS **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4. **Functional Groups:** Ketone, Sulfide
Provide the SMILES representation for the building block token <BB_1283>.
OCC(O)c1ccc(F)cc1
What is the building block token for the following molecule?
OCC(O)c1ccc(F)cc1
<BB_1283>