instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_1283>?
The molecular formula for <BB_1283> (OCC(O)c1ccc(F)cc1) is C8H9FO2.
Describe the ring structures in building block <BB_1283>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1283>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1283>.
**Token:** <BB_1283> **SMILES:** OCC(O)c1ccc(F)cc1 **Molecular Formula:** C8H9FO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1284>.
CC(C)(C)c1ccc(S(N)(=O)=O)cc1[N+](=O)[O-]
What is the building block token for the following molecule?
CC(C)(C)c1ccc(S(N)(=O)=O)cc1[N+](=O)[O-]
<BB_1284>
What is the molecular formula for <BB_1284>?
The molecular formula for <BB_1284> (CC(C)(C)c1ccc(S(N)(=O)=O)cc1[N+](=O)[O-]) is C10H14N2O4S.
Describe the ring structures in building block <BB_1284>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1284>.
The molecule contains the following groups: Amine, Tertiary Amine, Nitro, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_1284>.
**Token:** <BB_1284> **SMILES:** CC(C)(C)c1ccc(S(N)(=O)=O)cc1[N+](=O)[O-] **Molecular Formula:** C10H14N2O4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Nitro, Sulfonamide
Provide the SMILES representation for the building block token <BB_1285>.
Brc1ocnc1-c1ccccc1
What is the building block token for the following molecule?
Brc1ocnc1-c1ccccc1
<BB_1285>
What is the molecular formula for <BB_1285>?
The molecular formula for <BB_1285> (Brc1ocnc1-c1ccccc1) is C9H6BrNO.
Describe the ring structures in building block <BB_1285>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1285>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1285>.
**Token:** <BB_1285> **SMILES:** Brc1ocnc1-c1ccccc1 **Molecular Formula:** C9H6BrNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1286>.
Cc1nnc([C@H](C)O)o1
What is the building block token for the following molecule?
Cc1nnc([C@H](C)O)o1
<BB_1286>
What is the molecular formula for <BB_1286>?
The molecular formula for <BB_1286> (Cc1nnc([C@H](C)O)o1) is C5H8N2O2.
Describe the ring structures in building block <BB_1286>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1286>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_1286>.
**Token:** <BB_1286> **SMILES:** Cc1nnc([C@H](C)O)o1 **Molecular Formula:** C5H8N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_1287>.
COC(=O)[C@H](O)c1ccc(Cl)cc1Br
What is the building block token for the following molecule?
COC(=O)[C@H](O)c1ccc(Cl)cc1Br
<BB_1287>
What is the molecular formula for <BB_1287>?
The molecular formula for <BB_1287> (COC(=O)[C@H](O)c1ccc(Cl)cc1Br) is C9H8BrClO3.
Describe the ring structures in building block <BB_1287>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1287>.
The molecule contains the following groups: Ester, Alcohol, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1287>.
**Token:** <BB_1287> **SMILES:** COC(=O)[C@H](O)c1ccc(Cl)cc1Br **Molecular Formula:** C9H8BrClO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Alcohol, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1288>.
Cc1ccc(-n2ccnc2)cn1
What is the building block token for the following molecule?
Cc1ccc(-n2ccnc2)cn1
<BB_1288>
What is the molecular formula for <BB_1288>?
The molecular formula for <BB_1288> (Cc1ccc(-n2ccnc2)cn1) is C9H9N3.
Describe the ring structures in building block <BB_1288>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1288>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_1288>.
**Token:** <BB_1288> **SMILES:** Cc1ccc(-n2ccnc2)cn1 **Molecular Formula:** C9H9N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_1289>.
O=S(=O)(F)c1cc(O)cc(F)c1
What is the building block token for the following molecule?
O=S(=O)(F)c1cc(O)cc(F)c1
<BB_1289>
What is the molecular formula for <BB_1289>?
The molecular formula for <BB_1289> (O=S(=O)(F)c1cc(O)cc(F)c1) is C6H4F2O3S.
Describe the ring structures in building block <BB_1289>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1289>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1289>.
**Token:** <BB_1289> **SMILES:** O=S(=O)(F)c1cc(O)cc(F)c1 **Molecular Formula:** C6H4F2O3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1290>.
FC(F)(F)Cc1ccc(Cl)nc1
What is the building block token for the following molecule?
FC(F)(F)Cc1ccc(Cl)nc1
<BB_1290>
What is the molecular formula for <BB_1290>?
The molecular formula for <BB_1290> (FC(F)(F)Cc1ccc(Cl)nc1) is C7H5ClF3N.
Describe the ring structures in building block <BB_1290>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1290>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1290>.
**Token:** <BB_1290> **SMILES:** FC(F)(F)Cc1ccc(Cl)nc1 **Molecular Formula:** C7H5ClF3N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1291>.
O=C(O)CP1(=O)CCCC1
What is the building block token for the following molecule?
O=C(O)CP1(=O)CCCC1
<BB_1291>
What is the molecular formula for <BB_1291>?
The molecular formula for <BB_1291> (O=C(O)CP1(=O)CCCC1) is C6H11O3P.
Describe the ring structures in building block <BB_1291>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_1291>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1291>.
**Token:** <BB_1291> **SMILES:** O=C(O)CP1(=O)CCCC1 **Molecular Formula:** C6H11O3P **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1292>.
C=CCOc1ccc(C)cc1Br
What is the building block token for the following molecule?
C=CCOc1ccc(C)cc1Br
<BB_1292>
What is the molecular formula for <BB_1292>?
The molecular formula for <BB_1292> (C=CCOc1ccc(C)cc1Br) is C10H11BrO.
Describe the ring structures in building block <BB_1292>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1292>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1292>.
**Token:** <BB_1292> **SMILES:** C=CCOc1ccc(C)cc1Br **Molecular Formula:** C10H11BrO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1293>.
CC(C)=CC(C)(N)c1ccccc1
What is the building block token for the following molecule?
CC(C)=CC(C)(N)c1ccccc1
<BB_1293>
What is the molecular formula for <BB_1293>?
The molecular formula for <BB_1293> (CC(C)=CC(C)(N)c1ccccc1) is C12H17N.
Describe the ring structures in building block <BB_1293>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1293>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_1293>.
**Token:** <BB_1293> **SMILES:** CC(C)=CC(C)(N)c1ccccc1 **Molecular Formula:** C12H17N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_1294>.
Cn1c(C2CC2)cc(C(=O)O)c1C1CC1
What is the building block token for the following molecule?
Cn1c(C2CC2)cc(C(=O)O)c1C1CC1
<BB_1294>
What is the molecular formula for <BB_1294>?
The molecular formula for <BB_1294> (Cn1c(C2CC2)cc(C(=O)O)c1C1CC1) is C12H15NO2.
Describe the ring structures in building block <BB_1294>.
The molecule contains 3 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3, an aliphatic ring of size 3.
List the primary functional groups present in <BB_1294>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1294>.
**Token:** <BB_1294> **SMILES:** Cn1c(C2CC2)cc(C(=O)O)c1C1CC1 **Molecular Formula:** C12H15NO2 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3, an aliphatic ring of size 3. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1295>.
O=C(CCl)C1CCCCCC1
What is the building block token for the following molecule?
O=C(CCl)C1CCCCCC1
<BB_1295>
What is the molecular formula for <BB_1295>?
The molecular formula for <BB_1295> (O=C(CCl)C1CCCCCC1) is C9H15ClO.
Describe the ring structures in building block <BB_1295>.
The molecule contains 1 ring(s): an aliphatic ring of size 7.
List the primary functional groups present in <BB_1295>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1295>.
**Token:** <BB_1295> **SMILES:** O=C(CCl)C1CCCCCC1 **Molecular Formula:** C9H15ClO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 7. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1296>.
CN(C)c1cccc(C(=O)O)n1
What is the building block token for the following molecule?
CN(C)c1cccc(C(=O)O)n1
<BB_1296>
What is the molecular formula for <BB_1296>?
The molecular formula for <BB_1296> (CN(C)c1cccc(C(=O)O)n1) is C8H10N2O2.
Describe the ring structures in building block <BB_1296>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1296>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_1296>.
**Token:** <BB_1296> **SMILES:** CN(C)c1cccc(C(=O)O)n1 **Molecular Formula:** C8H10N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Tertiary Amine
Provide the SMILES representation for the building block token <BB_1297>.
O=C(O)c1coc2cc(Br)ccc12
What is the building block token for the following molecule?
O=C(O)c1coc2cc(Br)ccc12
<BB_1297>
What is the molecular formula for <BB_1297>?
The molecular formula for <BB_1297> (O=C(O)c1coc2cc(Br)ccc12) is C9H5BrO3.
Describe the ring structures in building block <BB_1297>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1297>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1297>.
**Token:** <BB_1297> **SMILES:** O=C(O)c1coc2cc(Br)ccc12 **Molecular Formula:** C9H5BrO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1298>.
CC(C)(Br)C(=O)O
What is the building block token for the following molecule?
CC(C)(Br)C(=O)O
<BB_1298>
What is the molecular formula for <BB_1298>?
The molecular formula for <BB_1298> (CC(C)(Br)C(=O)O) is C4H7BrO2.
Describe the ring structures in building block <BB_1298>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1298>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1298>.
**Token:** <BB_1298> **SMILES:** CC(C)(Br)C(=O)O **Molecular Formula:** C4H7BrO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1299>.
Clc1ccc2c(Cl)c(I)cnc2c1
What is the building block token for the following molecule?
Clc1ccc2c(Cl)c(I)cnc2c1
<BB_1299>
What is the molecular formula for <BB_1299>?
The molecular formula for <BB_1299> (Clc1ccc2c(Cl)c(I)cnc2c1) is C9H4Cl2IN.
Describe the ring structures in building block <BB_1299>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1299>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1299>.
**Token:** <BB_1299> **SMILES:** Clc1ccc2c(Cl)c(I)cnc2c1 **Molecular Formula:** C9H4Cl2IN **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)