instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_1300>.
CN1CCN(c2nc3c(c(=O)[nH]2)CCCN3)CC1
What is the building block token for the following molecule?
CN1CCN(c2nc3c(c(=O)[nH]2)CCCN3)CC1
<BB_1300>
What is the molecular formula for <BB_1300>?
The molecular formula for <BB_1300> (CN1CCN(c2nc3c(c(=O)[nH]2)CCCN3)CC1) is C12H19N5O.
Describe the ring structures in building block <BB_1300>.
The molecule contains 3 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1300>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_1300>.
**Token:** <BB_1300> **SMILES:** CN1CCN(c2nc3c(c(=O)[nH]2)CCCN3)CC1 **Molecular Formula:** C12H19N5O **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_1301>.
Nc1ccc(Cl)cc1N
What is the building block token for the following molecule?
Nc1ccc(Cl)cc1N
<BB_1301>
What is the molecular formula for <BB_1301>?
The molecular formula for <BB_1301> (Nc1ccc(Cl)cc1N) is C6H7ClN2.
Describe the ring structures in building block <BB_1301>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1301>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1301>.
**Token:** <BB_1301> **SMILES:** Nc1ccc(Cl)cc1N **Molecular Formula:** C6H7ClN2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1302>.
CC(=O)N1Cc2cc(O)ccc2C[C@H]1C(=O)O
What is the building block token for the following molecule?
CC(=O)N1Cc2cc(O)ccc2C[C@H]1C(=O)O
<BB_1302>
What is the molecular formula for <BB_1302>?
The molecular formula for <BB_1302> (CC(=O)N1Cc2cc(O)ccc2C[C@H]1C(=O)O) is C12H13NO4.
Describe the ring structures in building block <BB_1302>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1302>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_1302>.
**Token:** <BB_1302> **SMILES:** CC(=O)N1Cc2cc(O)ccc2C[C@H]1C(=O)O **Molecular Formula:** C12H13NO4 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_1303>.
C=CCC(C)I
What is the building block token for the following molecule?
C=CCC(C)I
<BB_1303>
What is the molecular formula for <BB_1303>?
The molecular formula for <BB_1303> (C=CCC(C)I) is C5H9I.
Describe the ring structures in building block <BB_1303>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1303>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1303>.
**Token:** <BB_1303> **SMILES:** C=CCC(C)I **Molecular Formula:** C5H9I **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1304>.
CC(C)(C)OC(=O)N1CCC1CN
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCC1CN
<BB_1304>
What is the molecular formula for <BB_1304>?
The molecular formula for <BB_1304> (CC(C)(C)OC(=O)N1CCC1CN) is C9H18N2O2.
Describe the ring structures in building block <BB_1304>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_1304>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_1304>.
**Token:** <BB_1304> **SMILES:** CC(C)(C)OC(=O)N1CCC1CN **Molecular Formula:** C9H18N2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_1305>.
Fc1cccc(F)c1N=C=S
What is the building block token for the following molecule?
Fc1cccc(F)c1N=C=S
<BB_1305>
What is the molecular formula for <BB_1305>?
The molecular formula for <BB_1305> (Fc1cccc(F)c1N=C=S) is C7H3F2NS.
Describe the ring structures in building block <BB_1305>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1305>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1305>.
**Token:** <BB_1305> **SMILES:** Fc1cccc(F)c1N=C=S **Molecular Formula:** C7H3F2NS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1306>.
Cl.Cn1ccc2c([C@H](N)CO)cccc21
What is the building block token for the following molecule?
Cl.Cn1ccc2c([C@H](N)CO)cccc21
<BB_1306>
What is the molecular formula for <BB_1306>?
The molecular formula for <BB_1306> (Cl.Cn1ccc2c([C@H](N)CO)cccc21) is C11H15ClN2O.
Describe the ring structures in building block <BB_1306>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1306>.
The molecule contains the following groups: Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1306>.
**Token:** <BB_1306> **SMILES:** Cl.Cn1ccc2c([C@H](N)CO)cccc21 **Molecular Formula:** C11H15ClN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1307>.
Cc1ccc(-c2ccc(N)cc2)cc1
What is the building block token for the following molecule?
Cc1ccc(-c2ccc(N)cc2)cc1
<BB_1307>
What is the molecular formula for <BB_1307>?
The molecular formula for <BB_1307> (Cc1ccc(-c2ccc(N)cc2)cc1) is C13H13N.
Describe the ring structures in building block <BB_1307>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1307>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_1307>.
**Token:** <BB_1307> **SMILES:** Cc1ccc(-c2ccc(N)cc2)cc1 **Molecular Formula:** C13H13N **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_1308>.
O=C([O-])C1CC(c2c(F)cccc2F)=NO1.[Na+]
What is the building block token for the following molecule?
O=C([O-])C1CC(c2c(F)cccc2F)=NO1.[Na+]
<BB_1308>
What is the molecular formula for <BB_1308>?
The molecular formula for <BB_1308> (O=C([O-])C1CC(c2c(F)cccc2F)=NO1.[Na+]) is C10H6F2NNaO3.
Describe the ring structures in building block <BB_1308>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1308>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1308>.
**Token:** <BB_1308> **SMILES:** O=C([O-])C1CC(c2c(F)cccc2F)=NO1.[Na+] **Molecular Formula:** C10H6F2NNaO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1309>.
CC(C)(C)OC(=O)N1CCN(CC(=N)NO)CC1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCN(CC(=N)NO)CC1
<BB_1309>
What is the molecular formula for <BB_1309>?
The molecular formula for <BB_1309> (CC(C)(C)OC(=O)N1CCN(CC(=N)NO)CC1) is C11H22N4O3.
Describe the ring structures in building block <BB_1309>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1309>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_1309>.
**Token:** <BB_1309> **SMILES:** CC(C)(C)OC(=O)N1CCN(CC(=N)NO)CC1 **Molecular Formula:** C11H22N4O3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_1310>.
O=C(O)Cc1cccc(OC(F)F)n1
What is the building block token for the following molecule?
O=C(O)Cc1cccc(OC(F)F)n1
<BB_1310>
What is the molecular formula for <BB_1310>?
The molecular formula for <BB_1310> (O=C(O)Cc1cccc(OC(F)F)n1) is C8H7F2NO3.
Describe the ring structures in building block <BB_1310>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1310>.
The molecule contains the following groups: Carboxylic Acid, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1310>.
**Token:** <BB_1310> **SMILES:** O=C(O)Cc1cccc(OC(F)F)n1 **Molecular Formula:** C8H7F2NO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1311>.
N#CCS(=O)(=O)NC1CC1
What is the building block token for the following molecule?
N#CCS(=O)(=O)NC1CC1
<BB_1311>
What is the molecular formula for <BB_1311>?
The molecular formula for <BB_1311> (N#CCS(=O)(=O)NC1CC1) is C5H8N2O2S.
Describe the ring structures in building block <BB_1311>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_1311>.
The molecule contains the following groups: Secondary Amine, Nitrile, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_1311>.
**Token:** <BB_1311> **SMILES:** N#CCS(=O)(=O)NC1CC1 **Molecular Formula:** C5H8N2O2S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Secondary Amine, Nitrile, Sulfonamide
Provide the SMILES representation for the building block token <BB_1312>.
CCn1c([C@@H]2C[C@H](OC)CN2)n[nH]c1=O
What is the building block token for the following molecule?
CCn1c([C@@H]2C[C@H](OC)CN2)n[nH]c1=O
<BB_1312>
What is the molecular formula for <BB_1312>?
The molecular formula for <BB_1312> (CCn1c([C@@H]2C[C@H](OC)CN2)n[nH]c1=O) is C9H16N4O2.
Describe the ring structures in building block <BB_1312>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1312>.
The molecule contains the following groups: Secondary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_1312>.
**Token:** <BB_1312> **SMILES:** CCn1c([C@@H]2C[C@H](OC)CN2)n[nH]c1=O **Molecular Formula:** C9H16N4O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Ether
Provide the SMILES representation for the building block token <BB_1313>.
CN(C)C(OC(C)(C)C)OC(C)(C)C
What is the building block token for the following molecule?
CN(C)C(OC(C)(C)C)OC(C)(C)C
<BB_1313>
What is the molecular formula for <BB_1313>?
The molecular formula for <BB_1313> (CN(C)C(OC(C)(C)C)OC(C)(C)C) is C11H25NO2.
Describe the ring structures in building block <BB_1313>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1313>.
The molecule contains the following groups: Tertiary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_1313>.
**Token:** <BB_1313> **SMILES:** CN(C)C(OC(C)(C)C)OC(C)(C)C **Molecular Formula:** C11H25NO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Tertiary Amine, Ether
Provide the SMILES representation for the building block token <BB_1314>.
CC1(Cc2ccccc2Cl)CCCN1.Cl
What is the building block token for the following molecule?
CC1(Cc2ccccc2Cl)CCCN1.Cl
<BB_1314>
What is the molecular formula for <BB_1314>?
The molecular formula for <BB_1314> (CC1(Cc2ccccc2Cl)CCCN1.Cl) is C12H17Cl2N.
Describe the ring structures in building block <BB_1314>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1314>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1314>.
**Token:** <BB_1314> **SMILES:** CC1(Cc2ccccc2Cl)CCCN1.Cl **Molecular Formula:** C12H17Cl2N **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1315>.
COC(=O)C(CN)Cc1ccccc1.Cl
What is the building block token for the following molecule?
COC(=O)C(CN)Cc1ccccc1.Cl
<BB_1315>
What is the molecular formula for <BB_1315>?
The molecular formula for <BB_1315> (COC(=O)C(CN)Cc1ccccc1.Cl) is C11H16ClNO2.
Describe the ring structures in building block <BB_1315>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1315>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1315>.
**Token:** <BB_1315> **SMILES:** COC(=O)C(CN)Cc1ccccc1.Cl **Molecular Formula:** C11H16ClNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1316>.
Cc1ccc(-c2cc(C(=O)NN)[nH]n2)cc1C
What is the building block token for the following molecule?
Cc1ccc(-c2cc(C(=O)NN)[nH]n2)cc1C
<BB_1316>
What is the molecular formula for <BB_1316>?
The molecular formula for <BB_1316> (Cc1ccc(-c2cc(C(=O)NN)[nH]n2)cc1C) is C12H14N4O.
Describe the ring structures in building block <BB_1316>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.