instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_1316>.
The molecule contains the following groups: Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_1316>.
**Token:** <BB_1316> **SMILES:** Cc1ccc(-c2cc(C(=O)NN)[nH]n2)cc1C **Molecular Formula:** C12H14N4O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine, Amide
Provide the SMILES representation for the building block token <BB_1317>.
COc1ccc(CN)cc1NC(C)=O
What is the building block token for the following molecule?
COc1ccc(CN)cc1NC(C)=O
<BB_1317>
What is the molecular formula for <BB_1317>?
The molecular formula for <BB_1317> (COc1ccc(CN)cc1NC(C)=O) is C10H14N2O2.
Describe the ring structures in building block <BB_1317>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1317>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_1317>.
**Token:** <BB_1317> **SMILES:** COc1ccc(CN)cc1NC(C)=O **Molecular Formula:** C10H14N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_1318>.
Cc1nnc(C23CC(CN2)C3)o1
What is the building block token for the following molecule?
Cc1nnc(C23CC(CN2)C3)o1
<BB_1318>
What is the molecular formula for <BB_1318>?
The molecular formula for <BB_1318> (Cc1nnc(C23CC(CN2)C3)o1) is C8H11N3O.
Describe the ring structures in building block <BB_1318>.
The molecule contains 4 ring(s): an aliphatic ring of size 4, an aromatic ring of size 5, an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1318>.
The molecule contains the following groups: Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_1318>.
**Token:** <BB_1318> **SMILES:** Cc1nnc(C23CC(CN2)C3)o1 **Molecular Formula:** C8H11N3O **Ring System:** The molecule contains 4 ring(s): an aliphatic ring of size 4, an aromatic ring of size 5, an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine
Provide the SMILES representation for the building block token <BB_1319>.
Cl.Cl.NC1(Cn2cccn2)CC(F)(F)C1
What is the building block token for the following molecule?
Cl.Cl.NC1(Cn2cccn2)CC(F)(F)C1
<BB_1319>
What is the molecular formula for <BB_1319>?
The molecular formula for <BB_1319> (Cl.Cl.NC1(Cn2cccn2)CC(F)(F)C1) is C8H13Cl2F2N3.
Describe the ring structures in building block <BB_1319>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 4.
List the primary functional groups present in <BB_1319>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1319>.
**Token:** <BB_1319> **SMILES:** Cl.Cl.NC1(Cn2cccn2)CC(F)(F)C1 **Molecular Formula:** C8H13Cl2F2N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 4. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1320>.
CCCc1cc(C(=O)O)ccc1Cl
What is the building block token for the following molecule?
CCCc1cc(C(=O)O)ccc1Cl
<BB_1320>
What is the molecular formula for <BB_1320>?
The molecular formula for <BB_1320> (CCCc1cc(C(=O)O)ccc1Cl) is C10H11ClO2.
Describe the ring structures in building block <BB_1320>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1320>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1320>.
**Token:** <BB_1320> **SMILES:** CCCc1cc(C(=O)O)ccc1Cl **Molecular Formula:** C10H11ClO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1321>.
O=C(O)c1ccc(S(=O)(=O)C2CCC2)cc1
What is the building block token for the following molecule?
O=C(O)c1ccc(S(=O)(=O)C2CCC2)cc1
<BB_1321>
What is the molecular formula for <BB_1321>?
The molecular formula for <BB_1321> (O=C(O)c1ccc(S(=O)(=O)C2CCC2)cc1) is C11H12O4S.
Describe the ring structures in building block <BB_1321>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_1321>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1321>.
**Token:** <BB_1321> **SMILES:** O=C(O)c1ccc(S(=O)(=O)C2CCC2)cc1 **Molecular Formula:** C11H12O4S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1322>.
CCC(C)(NC(C)=O)C(N)=S
What is the building block token for the following molecule?
CCC(C)(NC(C)=O)C(N)=S
<BB_1322>
What is the molecular formula for <BB_1322>?
The molecular formula for <BB_1322> (CCC(C)(NC(C)=O)C(N)=S) is C7H14N2OS.
Describe the ring structures in building block <BB_1322>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1322>.
The molecule contains the following groups: Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_1322>.
**Token:** <BB_1322> **SMILES:** CCC(C)(NC(C)=O)C(N)=S **Molecular Formula:** C7H14N2OS **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Amide
Provide the SMILES representation for the building block token <BB_1323>.
C#CC(C)OCC
What is the building block token for the following molecule?
C#CC(C)OCC
<BB_1323>
What is the molecular formula for <BB_1323>?
The molecular formula for <BB_1323> (C#CC(C)OCC) is C6H10O.
Describe the ring structures in building block <BB_1323>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1323>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_1323>.
**Token:** <BB_1323> **SMILES:** C#CC(C)OCC **Molecular Formula:** C6H10O **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_1324>.
CC(=O)Nc1cc(Cl)ccn1
What is the building block token for the following molecule?
CC(=O)Nc1cc(Cl)ccn1
<BB_1324>
What is the molecular formula for <BB_1324>?
The molecular formula for <BB_1324> (CC(=O)Nc1cc(Cl)ccn1) is C7H7ClN2O.
Describe the ring structures in building block <BB_1324>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1324>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1324>.
**Token:** <BB_1324> **SMILES:** CC(=O)Nc1cc(Cl)ccn1 **Molecular Formula:** C7H7ClN2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1325>.
COC(=O)c1cnc2[nH]cc(Br)c2c1
What is the building block token for the following molecule?
COC(=O)c1cnc2[nH]cc(Br)c2c1
<BB_1325>
What is the molecular formula for <BB_1325>?
The molecular formula for <BB_1325> (COC(=O)c1cnc2[nH]cc(Br)c2c1) is C9H7BrN2O2.
Describe the ring structures in building block <BB_1325>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1325>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1325>.
**Token:** <BB_1325> **SMILES:** COC(=O)c1cnc2[nH]cc(Br)c2c1 **Molecular Formula:** C9H7BrN2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1326>.
O=c1c2ccccc2nc2n1CCOC2
What is the building block token for the following molecule?
O=c1c2ccccc2nc2n1CCOC2
<BB_1326>
What is the molecular formula for <BB_1326>?
The molecular formula for <BB_1326> (O=c1c2ccccc2nc2n1CCOC2) is C11H10N2O2.
Describe the ring structures in building block <BB_1326>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1326>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_1326>.
**Token:** <BB_1326> **SMILES:** O=c1c2ccccc2nc2n1CCOC2 **Molecular Formula:** C11H10N2O2 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_1327>.
CN1C(=O)NC(=O)C1(C)C
What is the building block token for the following molecule?
CN1C(=O)NC(=O)C1(C)C
<BB_1327>
What is the molecular formula for <BB_1327>?
The molecular formula for <BB_1327> (CN1C(=O)NC(=O)C1(C)C) is C6H10N2O2.
Describe the ring structures in building block <BB_1327>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_1327>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_1327>.
**Token:** <BB_1327> **SMILES:** CN1C(=O)NC(=O)C1(C)C **Molecular Formula:** C6H10N2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_1328>.
C#Cc1ccc(Cl)cc1OC
What is the building block token for the following molecule?
C#Cc1ccc(Cl)cc1OC
<BB_1328>
What is the molecular formula for <BB_1328>?
The molecular formula for <BB_1328> (C#Cc1ccc(Cl)cc1OC) is C9H7ClO.
Describe the ring structures in building block <BB_1328>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1328>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1328>.
**Token:** <BB_1328> **SMILES:** C#Cc1ccc(Cl)cc1OC **Molecular Formula:** C9H7ClO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1329>.
Cl.O=S1CC2CNCC(C2)C1
What is the building block token for the following molecule?
Cl.O=S1CC2CNCC(C2)C1
<BB_1329>
What is the molecular formula for <BB_1329>?
The molecular formula for <BB_1329> (Cl.O=S1CC2CNCC(C2)C1) is C7H14ClNOS.
Describe the ring structures in building block <BB_1329>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1329>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1329>.
**Token:** <BB_1329> **SMILES:** Cl.O=S1CC2CNCC(C2)C1 **Molecular Formula:** C7H14ClNOS **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1330>.
Cl.NCC12CC(C(=O)O)(C1)C1(CCC1)O2
What is the building block token for the following molecule?
Cl.NCC12CC(C(=O)O)(C1)C1(CCC1)O2
<BB_1330>
What is the molecular formula for <BB_1330>?
The molecular formula for <BB_1330> (Cl.NCC12CC(C(=O)O)(C1)C1(CCC1)O2) is C10H16ClNO3.
Describe the ring structures in building block <BB_1330>.
The molecule contains 4 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4, an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1330>.
The molecule contains the following groups: Carboxylic Acid, Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1330>.
**Token:** <BB_1330> **SMILES:** Cl.NCC12CC(C(=O)O)(C1)C1(CCC1)O2 **Molecular Formula:** C10H16ClNO3 **Ring System:** The molecule contains 4 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4, an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1331>.
Cc1nc2cnccc2c(=O)[nH]1
What is the building block token for the following molecule?
Cc1nc2cnccc2c(=O)[nH]1
<BB_1331>
What is the molecular formula for <BB_1331>?
The molecular formula for <BB_1331> (Cc1nc2cnccc2c(=O)[nH]1) is C8H7N3O.
Describe the ring structures in building block <BB_1331>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1331>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_1331>.
**Token:** <BB_1331> **SMILES:** Cc1nc2cnccc2c(=O)[nH]1 **Molecular Formula:** C8H7N3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_1332>.
Cn1cc([N+](=O)[O-])c(C(=O)N2CCC(CO)CC2)n1
What is the building block token for the following molecule?
Cn1cc([N+](=O)[O-])c(C(=O)N2CCC(CO)CC2)n1
<BB_1332>
What is the molecular formula for <BB_1332>?
The molecular formula for <BB_1332> (Cn1cc([N+](=O)[O-])c(C(=O)N2CCC(CO)CC2)n1) is C11H16N4O4.
Describe the ring structures in building block <BB_1332>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1332>.
The molecule contains the following groups: Tertiary Amine, Amide, Alcohol, Nitro.
Provide a comprehensive chemical profile for the building block <BB_1332>.
**Token:** <BB_1332> **SMILES:** Cn1cc([N+](=O)[O-])c(C(=O)N2CCC(CO)CC2)n1 **Molecular Formula:** C11H16N4O4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine, Amide, Alcohol, Nitro
Provide the SMILES representation for the building block token <BB_1333>.
Cc1cc(C(=O)O)nn1-c1ccccc1Br
What is the building block token for the following molecule?
Cc1cc(C(=O)O)nn1-c1ccccc1Br
<BB_1333>