instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_1333>?
The molecular formula for <BB_1333> (Cc1cc(C(=O)O)nn1-c1ccccc1Br) is C11H9BrN2O2.
Describe the ring structures in building block <BB_1333>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1333>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1333>.
**Token:** <BB_1333> **SMILES:** Cc1cc(C(=O)O)nn1-c1ccccc1Br **Molecular Formula:** C11H9BrN2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1334>.
CC(C)(C)[Si](C)(C)OCC(F)(F)CC(=O)O
What is the building block token for the following molecule?
CC(C)(C)[Si](C)(C)OCC(F)(F)CC(=O)O
<BB_1334>
What is the molecular formula for <BB_1334>?
The molecular formula for <BB_1334> (CC(C)(C)[Si](C)(C)OCC(F)(F)CC(=O)O) is C10H20F2O3Si.
Describe the ring structures in building block <BB_1334>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1334>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1334>.
**Token:** <BB_1334> **SMILES:** CC(C)(C)[Si](C)(C)OCC(F)(F)CC(=O)O **Molecular Formula:** C10H20F2O3Si **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1335>.
Cl.NCCc1c(F)cccc1I
What is the building block token for the following molecule?
Cl.NCCc1c(F)cccc1I
<BB_1335>
What is the molecular formula for <BB_1335>?
The molecular formula for <BB_1335> (Cl.NCCc1c(F)cccc1I) is C8H10ClFIN.
Describe the ring structures in building block <BB_1335>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1335>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1335>.
**Token:** <BB_1335> **SMILES:** Cl.NCCc1c(F)cccc1I **Molecular Formula:** C8H10ClFIN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1336>.
Cc1cccc2c(C(=O)O)c[nH]c12
What is the building block token for the following molecule?
Cc1cccc2c(C(=O)O)c[nH]c12
<BB_1336>
What is the molecular formula for <BB_1336>?
The molecular formula for <BB_1336> (Cc1cccc2c(C(=O)O)c[nH]c12) is C10H9NO2.
Describe the ring structures in building block <BB_1336>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1336>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1336>.
**Token:** <BB_1336> **SMILES:** Cc1cccc2c(C(=O)O)c[nH]c12 **Molecular Formula:** C10H9NO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1337>.
N#Cc1c(NC(=O)CCl)sc2c1CCC2
What is the building block token for the following molecule?
N#Cc1c(NC(=O)CCl)sc2c1CCC2
<BB_1337>
What is the molecular formula for <BB_1337>?
The molecular formula for <BB_1337> (N#Cc1c(NC(=O)CCl)sc2c1CCC2) is C10H9ClN2OS.
Describe the ring structures in building block <BB_1337>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1337>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1337>.
**Token:** <BB_1337> **SMILES:** N#Cc1c(NC(=O)CCl)sc2c1CCC2 **Molecular Formula:** C10H9ClN2OS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Amide, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_1338>.
Nc1noc2cccc(I)c12
What is the building block token for the following molecule?
Nc1noc2cccc(I)c12
<BB_1338>
What is the molecular formula for <BB_1338>?
The molecular formula for <BB_1338> (Nc1noc2cccc(I)c12) is C7H5IN2O.
Describe the ring structures in building block <BB_1338>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1338>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1338>.
**Token:** <BB_1338> **SMILES:** Nc1noc2cccc(I)c12 **Molecular Formula:** C7H5IN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1339>.
O/N=C1/CN(Cc2ccccc2)Cc2ccccc21
What is the building block token for the following molecule?
O/N=C1/CN(Cc2ccccc2)Cc2ccccc21
<BB_1339>
What is the molecular formula for <BB_1339>?
The molecular formula for <BB_1339> (O/N=C1/CN(Cc2ccccc2)Cc2ccccc21) is C16H16N2O.
Describe the ring structures in building block <BB_1339>.
The molecule contains 3 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1339>.
The molecule contains the following groups: Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_1339>.
**Token:** <BB_1339> **SMILES:** O/N=C1/CN(Cc2ccccc2)Cc2ccccc21 **Molecular Formula:** C16H16N2O **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Tertiary Amine
Provide the SMILES representation for the building block token <BB_1340>.
COC(=O)c1nnn2cc(C)[nH]c(=O)c12
What is the building block token for the following molecule?
COC(=O)c1nnn2cc(C)[nH]c(=O)c12
<BB_1340>
What is the molecular formula for <BB_1340>?
The molecular formula for <BB_1340> (COC(=O)c1nnn2cc(C)[nH]c(=O)c12) is C8H8N4O3.
Describe the ring structures in building block <BB_1340>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1340>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_1340>.
**Token:** <BB_1340> **SMILES:** COC(=O)c1nnn2cc(C)[nH]c(=O)c12 **Molecular Formula:** C8H8N4O3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_1341>.
O=C(O)C1CC(O)CN1S(=O)(=O)c1ccc(F)cc1
What is the building block token for the following molecule?
O=C(O)C1CC(O)CN1S(=O)(=O)c1ccc(F)cc1
<BB_1341>
What is the molecular formula for <BB_1341>?
The molecular formula for <BB_1341> (O=C(O)C1CC(O)CN1S(=O)(=O)c1ccc(F)cc1) is C11H12FNO5S.
Describe the ring structures in building block <BB_1341>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1341>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Alcohol, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_1341>.
**Token:** <BB_1341> **SMILES:** O=C(O)C1CC(O)CN1S(=O)(=O)c1ccc(F)cc1 **Molecular Formula:** C11H12FNO5S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Tertiary Amine, Alcohol, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_1342>.
Cc1cc(C2OCCO2)c(C)cc1C=O
What is the building block token for the following molecule?
Cc1cc(C2OCCO2)c(C)cc1C=O
<BB_1342>
What is the molecular formula for <BB_1342>?
The molecular formula for <BB_1342> (Cc1cc(C2OCCO2)c(C)cc1C=O) is C12H14O3.
Describe the ring structures in building block <BB_1342>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1342>.
The molecule contains the following groups: Aldehyde, Ether.
Provide a comprehensive chemical profile for the building block <BB_1342>.
**Token:** <BB_1342> **SMILES:** Cc1cc(C2OCCO2)c(C)cc1C=O **Molecular Formula:** C12H14O3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Aldehyde, Ether
Provide the SMILES representation for the building block token <BB_1343>.
Cl.NCC12CCC(F)(CC1)CC2
What is the building block token for the following molecule?
Cl.NCC12CCC(F)(CC1)CC2
<BB_1343>
What is the molecular formula for <BB_1343>?
The molecular formula for <BB_1343> (Cl.NCC12CCC(F)(CC1)CC2) is C9H17ClFN.
Describe the ring structures in building block <BB_1343>.
The molecule contains 3 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1343>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1343>.
**Token:** <BB_1343> **SMILES:** Cl.NCC12CCC(F)(CC1)CC2 **Molecular Formula:** C9H17ClFN **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1344>.
CCOC1(C(F)F)CNC1.Cl
What is the building block token for the following molecule?
CCOC1(C(F)F)CNC1.Cl
<BB_1344>
What is the molecular formula for <BB_1344>?
The molecular formula for <BB_1344> (CCOC1(C(F)F)CNC1.Cl) is C6H12ClF2NO.
Describe the ring structures in building block <BB_1344>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_1344>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1344>.
**Token:** <BB_1344> **SMILES:** CCOC1(C(F)F)CNC1.Cl **Molecular Formula:** C6H12ClF2NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1345>.
CC(C)(C)OC(=O)N[C@H]1C[C@@H](C(=N)NO)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N[C@H]1C[C@@H](C(=N)NO)C1
<BB_1345>
What is the molecular formula for <BB_1345>?
The molecular formula for <BB_1345> (CC(C)(C)OC(=O)N[C@H]1C[C@@H](C(=N)NO)C1) is C10H19N3O3.
Describe the ring structures in building block <BB_1345>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_1345>.
The molecule contains the following groups: Secondary Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_1345>.
**Token:** <BB_1345> **SMILES:** CC(C)(C)OC(=O)N[C@H]1C[C@@H](C(=N)NO)C1 **Molecular Formula:** C10H19N3O3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Secondary Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_1346>.
CC1CC(NC(=O)OC(C)(C)C)CCN1
What is the building block token for the following molecule?
CC1CC(NC(=O)OC(C)(C)C)CCN1
<BB_1346>
What is the molecular formula for <BB_1346>?
The molecular formula for <BB_1346> (CC1CC(NC(=O)OC(C)(C)C)CCN1) is C11H22N2O2.
Describe the ring structures in building block <BB_1346>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1346>.
The molecule contains the following groups: Secondary Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_1346>.
**Token:** <BB_1346> **SMILES:** CC1CC(NC(=O)OC(C)(C)C)CCN1 **Molecular Formula:** C11H22N2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_1347>.
CC(=O)COc1ccc(Cl)c(Cl)c1
What is the building block token for the following molecule?
CC(=O)COc1ccc(Cl)c(Cl)c1
<BB_1347>
What is the molecular formula for <BB_1347>?
The molecular formula for <BB_1347> (CC(=O)COc1ccc(Cl)c(Cl)c1) is C9H8Cl2O2.
Describe the ring structures in building block <BB_1347>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1347>.
The molecule contains the following groups: Ketone, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1347>.
**Token:** <BB_1347> **SMILES:** CC(=O)COc1ccc(Cl)c(Cl)c1 **Molecular Formula:** C9H8Cl2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1348>.
COc1ccc(-c2nc(CC(=O)O)cs2)cc1OC
What is the building block token for the following molecule?
COc1ccc(-c2nc(CC(=O)O)cs2)cc1OC
<BB_1348>
What is the molecular formula for <BB_1348>?
The molecular formula for <BB_1348> (COc1ccc(-c2nc(CC(=O)O)cs2)cc1OC) is C13H13NO4S.
Describe the ring structures in building block <BB_1348>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1348>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_1348>.
**Token:** <BB_1348> **SMILES:** COc1ccc(-c2nc(CC(=O)O)cs2)cc1OC **Molecular Formula:** C13H13NO4S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_1349>.
COC(CO)C1CC1
What is the building block token for the following molecule?
COC(CO)C1CC1
<BB_1349>
What is the molecular formula for <BB_1349>?
The molecular formula for <BB_1349> (COC(CO)C1CC1) is C6H12O2.
Describe the ring structures in building block <BB_1349>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_1349>.
The molecule contains the following groups: Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_1349>.
**Token:** <BB_1349> **SMILES:** COC(CO)C1CC1 **Molecular Formula:** C6H12O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Alcohol, Ether