instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_1350>.
CCc1ccc(O)c(C(C)(C)C)c1
What is the building block token for the following molecule?
CCc1ccc(O)c(C(C)(C)C)c1
<BB_1350>
What is the molecular formula for <BB_1350>?
The molecular formula for <BB_1350> (CCc1ccc(O)c(C(C)(C)C)c1) is C12H18O.
Describe the ring structures in building block <BB_1350>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1350>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_1350>.
**Token:** <BB_1350> **SMILES:** CCc1ccc(O)c(C(C)(C)C)c1 **Molecular Formula:** C12H18O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_1351>.
Br.CC(Br)CCN
What is the building block token for the following molecule?
Br.CC(Br)CCN
<BB_1351>
What is the molecular formula for <BB_1351>?
The molecular formula for <BB_1351> (Br.CC(Br)CCN) is C4H11Br2N.
Describe the ring structures in building block <BB_1351>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1351>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1351>.
**Token:** <BB_1351> **SMILES:** Br.CC(Br)CCN **Molecular Formula:** C4H11Br2N **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1352>.
CC1CN(CCN)CCO1
What is the building block token for the following molecule?
CC1CN(CCN)CCO1
<BB_1352>
What is the molecular formula for <BB_1352>?
The molecular formula for <BB_1352> (CC1CN(CCN)CCO1) is C7H16N2O.
Describe the ring structures in building block <BB_1352>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1352>.
The molecule contains the following groups: Amine, Tertiary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_1352>.
**Token:** <BB_1352> **SMILES:** CC1CN(CCN)CCO1 **Molecular Formula:** C7H16N2O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Ether
Provide the SMILES representation for the building block token <BB_1353>.
N#Cc1ccc(C(O)C#N)cc1
What is the building block token for the following molecule?
N#Cc1ccc(C(O)C#N)cc1
<BB_1353>
What is the molecular formula for <BB_1353>?
The molecular formula for <BB_1353> (N#Cc1ccc(C(O)C#N)cc1) is C9H6N2O.
Describe the ring structures in building block <BB_1353>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1353>.
The molecule contains the following groups: Alcohol, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1353>.
**Token:** <BB_1353> **SMILES:** N#Cc1ccc(C(O)C#N)cc1 **Molecular Formula:** C9H6N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol, Nitrile
Provide the SMILES representation for the building block token <BB_1354>.
O=C(O)c1ccc2c(c1)CCCCC2=O
What is the building block token for the following molecule?
O=C(O)c1ccc2c(c1)CCCCC2=O
<BB_1354>
What is the molecular formula for <BB_1354>?
The molecular formula for <BB_1354> (O=C(O)c1ccc2c(c1)CCCCC2=O) is C12H12O3.
Describe the ring structures in building block <BB_1354>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 7.
List the primary functional groups present in <BB_1354>.
The molecule contains the following groups: Carboxylic Acid, Ketone.
Provide a comprehensive chemical profile for the building block <BB_1354>.
**Token:** <BB_1354> **SMILES:** O=C(O)c1ccc2c(c1)CCCCC2=O **Molecular Formula:** C12H12O3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 7. **Functional Groups:** Carboxylic Acid, Ketone
Provide the SMILES representation for the building block token <BB_1355>.
COc1cnn(C)c1S(N)(=O)=O
What is the building block token for the following molecule?
COc1cnn(C)c1S(N)(=O)=O
<BB_1355>
What is the molecular formula for <BB_1355>?
The molecular formula for <BB_1355> (COc1cnn(C)c1S(N)(=O)=O) is C5H9N3O3S.
Describe the ring structures in building block <BB_1355>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1355>.
The molecule contains the following groups: Amine, Ether, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_1355>.
**Token:** <BB_1355> **SMILES:** COc1cnn(C)c1S(N)(=O)=O **Molecular Formula:** C5H9N3O3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Ether, Sulfonamide
Provide the SMILES representation for the building block token <BB_1356>.
CCOC(=O)CS(=O)(=O)C(C)CC
What is the building block token for the following molecule?
CCOC(=O)CS(=O)(=O)C(C)CC
<BB_1356>
What is the molecular formula for <BB_1356>?
The molecular formula for <BB_1356> (CCOC(=O)CS(=O)(=O)C(C)CC) is C8H16O4S.
Describe the ring structures in building block <BB_1356>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1356>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_1356>.
**Token:** <BB_1356> **SMILES:** CCOC(=O)CS(=O)(=O)C(C)CC **Molecular Formula:** C8H16O4S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_1357>.
O=c1[nH]c2ccc(Br)c(F)c2[nH]1
What is the building block token for the following molecule?
O=c1[nH]c2ccc(Br)c(F)c2[nH]1
<BB_1357>
What is the molecular formula for <BB_1357>?
The molecular formula for <BB_1357> (O=c1[nH]c2ccc(Br)c(F)c2[nH]1) is C7H4BrFN2O.
Describe the ring structures in building block <BB_1357>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1357>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1357>.
**Token:** <BB_1357> **SMILES:** O=c1[nH]c2ccc(Br)c(F)c2[nH]1 **Molecular Formula:** C7H4BrFN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1358>.
Cc1ccc(C)n1-c1cc(C(F)(F)F)n[nH]1
What is the building block token for the following molecule?
Cc1ccc(C)n1-c1cc(C(F)(F)F)n[nH]1
<BB_1358>
What is the molecular formula for <BB_1358>?
The molecular formula for <BB_1358> (Cc1ccc(C)n1-c1cc(C(F)(F)F)n[nH]1) is C10H10F3N3.
Describe the ring structures in building block <BB_1358>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_1358>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1358>.
**Token:** <BB_1358> **SMILES:** Cc1ccc(C)n1-c1cc(C(F)(F)F)n[nH]1 **Molecular Formula:** C10H10F3N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1359>.
CC(C)(C)OC(=O)N1CC(S(C)(=N)=O)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CC(S(C)(=N)=O)C1
<BB_1359>
What is the molecular formula for <BB_1359>?
The molecular formula for <BB_1359> (CC(C)(C)OC(=O)N1CC(S(C)(=N)=O)C1) is C9H18N2O3S.
Describe the ring structures in building block <BB_1359>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_1359>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_1359>.
**Token:** <BB_1359> **SMILES:** CC(C)(C)OC(=O)N1CC(S(C)(=N)=O)C1 **Molecular Formula:** C9H18N2O3S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Amide, Ether
Provide the SMILES representation for the building block token <BB_1360>.
[N-]=[N+]=NCc1cc(-c2ccco2)on1
What is the building block token for the following molecule?
[N-]=[N+]=NCc1cc(-c2ccco2)on1
<BB_1360>
What is the molecular formula for <BB_1360>?
The molecular formula for <BB_1360> ([N-]=[N+]=NCc1cc(-c2ccco2)on1) is C8H6N4O2.
Describe the ring structures in building block <BB_1360>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_1360>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_1360>.
**Token:** <BB_1360> **SMILES:** [N-]=[N+]=NCc1cc(-c2ccco2)on1 **Molecular Formula:** C8H6N4O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_1361>.
CC(C)(C)OC(=O)NC12CC(CO)(C1)C2(F)F
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NC12CC(CO)(C1)C2(F)F
<BB_1361>
What is the molecular formula for <BB_1361>?
The molecular formula for <BB_1361> (CC(C)(C)OC(=O)NC12CC(CO)(C1)C2(F)F) is C11H17F2NO3.
Describe the ring structures in building block <BB_1361>.
The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4, an aliphatic ring of size 4.
List the primary functional groups present in <BB_1361>.
The molecule contains the following groups: Amide, Alcohol, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1361>.
**Token:** <BB_1361> **SMILES:** CC(C)(C)OC(=O)NC12CC(CO)(C1)C2(F)F **Molecular Formula:** C11H17F2NO3 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4, an aliphatic ring of size 4. **Functional Groups:** Amide, Alcohol, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1362>.
Nc1ccc(Br)c([N+](=O)[O-])c1
What is the building block token for the following molecule?
Nc1ccc(Br)c([N+](=O)[O-])c1
<BB_1362>
What is the molecular formula for <BB_1362>?
The molecular formula for <BB_1362> (Nc1ccc(Br)c([N+](=O)[O-])c1) is C6H5BrN2O2.
Describe the ring structures in building block <BB_1362>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1362>.
The molecule contains the following groups: Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_1362>.
**Token:** <BB_1362> **SMILES:** Nc1ccc(Br)c([N+](=O)[O-])c1 **Molecular Formula:** C6H5BrN2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_1363>.
CC(C)(N)c1ccc(OC(F)F)cc1.Cl
What is the building block token for the following molecule?
CC(C)(N)c1ccc(OC(F)F)cc1.Cl
<BB_1363>
What is the molecular formula for <BB_1363>?
The molecular formula for <BB_1363> (CC(C)(N)c1ccc(OC(F)F)cc1.Cl) is C10H14ClF2NO.
Describe the ring structures in building block <BB_1363>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1363>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1363>.
**Token:** <BB_1363> **SMILES:** CC(C)(N)c1ccc(OC(F)F)cc1.Cl **Molecular Formula:** C10H14ClF2NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1364>.
C1CNCC(c2n[nH]c(C3CC3)n2)C1
What is the building block token for the following molecule?
C1CNCC(c2n[nH]c(C3CC3)n2)C1
<BB_1364>
What is the molecular formula for <BB_1364>?
The molecular formula for <BB_1364> (C1CNCC(c2n[nH]c(C3CC3)n2)C1) is C10H16N4.
Describe the ring structures in building block <BB_1364>.
The molecule contains 3 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_1364>.
The molecule contains the following groups: Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_1364>.
**Token:** <BB_1364> **SMILES:** C1CNCC(c2n[nH]c(C3CC3)n2)C1 **Molecular Formula:** C10H16N4 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Secondary Amine
Provide the SMILES representation for the building block token <BB_1365>.
Clc1c(Br)ccc2cc[nH]c12
What is the building block token for the following molecule?
Clc1c(Br)ccc2cc[nH]c12
<BB_1365>
What is the molecular formula for <BB_1365>?
The molecular formula for <BB_1365> (Clc1c(Br)ccc2cc[nH]c12) is C8H5BrClN.
Describe the ring structures in building block <BB_1365>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1365>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1365>.
**Token:** <BB_1365> **SMILES:** Clc1c(Br)ccc2cc[nH]c12 **Molecular Formula:** C8H5BrClN **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1366>.
Cl.Cl.N[C@@H]1c2ccccc2C[C@@H]1N
What is the building block token for the following molecule?
Cl.Cl.N[C@@H]1c2ccccc2C[C@@H]1N
<BB_1366>
What is the molecular formula for <BB_1366>?
The molecular formula for <BB_1366> (Cl.Cl.N[C@@H]1c2ccccc2C[C@@H]1N) is C9H14Cl2N2.
Describe the ring structures in building block <BB_1366>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.