instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_1366>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1366>.
**Token:** <BB_1366> **SMILES:** Cl.Cl.N[C@@H]1c2ccccc2C[C@@H]1N **Molecular Formula:** C9H14Cl2N2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1367>.
CCn1cc(CNC)nn1.Cl
What is the building block token for the following molecule?
CCn1cc(CNC)nn1.Cl
<BB_1367>
What is the molecular formula for <BB_1367>?
The molecular formula for <BB_1367> (CCn1cc(CNC)nn1.Cl) is C6H13ClN4.
Describe the ring structures in building block <BB_1367>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1367>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1367>.
**Token:** <BB_1367> **SMILES:** CCn1cc(CNC)nn1.Cl **Molecular Formula:** C6H13ClN4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1368>.
COC(C)C(C)=O
What is the building block token for the following molecule?
COC(C)C(C)=O
<BB_1368>
What is the molecular formula for <BB_1368>?
The molecular formula for <BB_1368> (COC(C)C(C)=O) is C5H10O2.
Describe the ring structures in building block <BB_1368>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1368>.
The molecule contains the following groups: Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_1368>.
**Token:** <BB_1368> **SMILES:** COC(C)C(C)=O **Molecular Formula:** C5H10O2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ketone, Ether
Provide the SMILES representation for the building block token <BB_1369>.
COC(=O)CCc1cnc(C)o1
What is the building block token for the following molecule?
COC(=O)CCc1cnc(C)o1
<BB_1369>
What is the molecular formula for <BB_1369>?
The molecular formula for <BB_1369> (COC(=O)CCc1cnc(C)o1) is C8H11NO3.
Describe the ring structures in building block <BB_1369>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1369>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_1369>.
**Token:** <BB_1369> **SMILES:** COC(=O)CCc1cnc(C)o1 **Molecular Formula:** C8H11NO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_1370>.
NC(CO)CC(O)c1ccccc1
What is the building block token for the following molecule?
NC(CO)CC(O)c1ccccc1
<BB_1370>
What is the molecular formula for <BB_1370>?
The molecular formula for <BB_1370> (NC(CO)CC(O)c1ccccc1) is C10H15NO2.
Describe the ring structures in building block <BB_1370>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1370>.
The molecule contains the following groups: Amine, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_1370>.
**Token:** <BB_1370> **SMILES:** NC(CO)CC(O)c1ccccc1 **Molecular Formula:** C10H15NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Alcohol
Provide the SMILES representation for the building block token <BB_1371>.
CC(C)(C)OC(=O)N[C@@H]1C[C@H]1c1cc(Br)ccc1F
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N[C@@H]1C[C@H]1c1cc(Br)ccc1F
<BB_1371>
What is the molecular formula for <BB_1371>?
The molecular formula for <BB_1371> (CC(C)(C)OC(=O)N[C@@H]1C[C@H]1c1cc(Br)ccc1F) is C14H17BrFNO2.
Describe the ring structures in building block <BB_1371>.
The molecule contains 2 ring(s): an aliphatic ring of size 3, an aromatic ring of size 6.
List the primary functional groups present in <BB_1371>.
The molecule contains the following groups: Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1371>.
**Token:** <BB_1371> **SMILES:** CC(C)(C)OC(=O)N[C@@H]1C[C@H]1c1cc(Br)ccc1F **Molecular Formula:** C14H17BrFNO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 3, an aromatic ring of size 6. **Functional Groups:** Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1372>.
N#CC1(c2cccc(O)c2)CC1
What is the building block token for the following molecule?
N#CC1(c2cccc(O)c2)CC1
<BB_1372>
What is the molecular formula for <BB_1372>?
The molecular formula for <BB_1372> (N#CC1(c2cccc(O)c2)CC1) is C10H9NO.
Describe the ring structures in building block <BB_1372>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_1372>.
The molecule contains the following groups: Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1372>.
**Token:** <BB_1372> **SMILES:** N#CC1(c2cccc(O)c2)CC1 **Molecular Formula:** C10H9NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Nitrile
Provide the SMILES representation for the building block token <BB_1373>.
Brc1ncnn1C1CCCC1
What is the building block token for the following molecule?
Brc1ncnn1C1CCCC1
<BB_1373>
What is the molecular formula for <BB_1373>?
The molecular formula for <BB_1373> (Brc1ncnn1C1CCCC1) is C7H10BrN3.
Describe the ring structures in building block <BB_1373>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1373>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1373>.
**Token:** <BB_1373> **SMILES:** Brc1ncnn1C1CCCC1 **Molecular Formula:** C7H10BrN3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1374>.
C[Si](C)(C)C#Cc1ncc[nH]c1=O
What is the building block token for the following molecule?
C[Si](C)(C)C#Cc1ncc[nH]c1=O
<BB_1374>
What is the molecular formula for <BB_1374>?
The molecular formula for <BB_1374> (C[Si](C)(C)C#Cc1ncc[nH]c1=O) is C9H12N2OSi.
Describe the ring structures in building block <BB_1374>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1374>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_1374>.
**Token:** <BB_1374> **SMILES:** C[Si](C)(C)C#Cc1ncc[nH]c1=O **Molecular Formula:** C9H12N2OSi **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_1375>.
COc1cc(C)c(C#N)cn1
What is the building block token for the following molecule?
COc1cc(C)c(C#N)cn1
<BB_1375>
What is the molecular formula for <BB_1375>?
The molecular formula for <BB_1375> (COc1cc(C)c(C#N)cn1) is C8H8N2O.
Describe the ring structures in building block <BB_1375>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1375>.
The molecule contains the following groups: Ether, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1375>.
**Token:** <BB_1375> **SMILES:** COc1cc(C)c(C#N)cn1 **Molecular Formula:** C8H8N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Nitrile
Provide the SMILES representation for the building block token <BB_1376>.
CCOC(=O)c1nc2ncccc2o1
What is the building block token for the following molecule?
CCOC(=O)c1nc2ncccc2o1
<BB_1376>
What is the molecular formula for <BB_1376>?
The molecular formula for <BB_1376> (CCOC(=O)c1nc2ncccc2o1) is C9H8N2O3.
Describe the ring structures in building block <BB_1376>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1376>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_1376>.
**Token:** <BB_1376> **SMILES:** CCOC(=O)c1nc2ncccc2o1 **Molecular Formula:** C9H8N2O3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_1377>.
Cl.NC1(C(=O)OCc2ccccc2)CCC1
What is the building block token for the following molecule?
Cl.NC1(C(=O)OCc2ccccc2)CCC1
<BB_1377>
What is the molecular formula for <BB_1377>?
The molecular formula for <BB_1377> (Cl.NC1(C(=O)OCc2ccccc2)CCC1) is C12H16ClNO2.
Describe the ring structures in building block <BB_1377>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_1377>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1377>.
**Token:** <BB_1377> **SMILES:** Cl.NC1(C(=O)OCc2ccccc2)CCC1 **Molecular Formula:** C12H16ClNO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1378>.
CC(C)(C)OC(=O)NC(CN)c1ccc(F)cc1F
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NC(CN)c1ccc(F)cc1F
<BB_1378>
What is the molecular formula for <BB_1378>?
The molecular formula for <BB_1378> (CC(C)(C)OC(=O)NC(CN)c1ccc(F)cc1F) is C13H18F2N2O2.
Describe the ring structures in building block <BB_1378>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1378>.
The molecule contains the following groups: Amine, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1378>.
**Token:** <BB_1378> **SMILES:** CC(C)(C)OC(=O)NC(CN)c1ccc(F)cc1F **Molecular Formula:** C13H18F2N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1379>.
CC(C)(C)OC(=O)NC1CCN(S(N)(=O)=O)CC1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NC1CCN(S(N)(=O)=O)CC1
<BB_1379>
What is the molecular formula for <BB_1379>?
The molecular formula for <BB_1379> (CC(C)(C)OC(=O)NC1CCN(S(N)(=O)=O)CC1) is C10H21N3O4S.
Describe the ring structures in building block <BB_1379>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1379>.
The molecule contains the following groups: Amine, Tertiary Amine, Amide, Ether, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_1379>.
**Token:** <BB_1379> **SMILES:** CC(C)(C)OC(=O)NC1CCN(S(N)(=O)=O)CC1 **Molecular Formula:** C10H21N3O4S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Amide, Ether, Sulfonamide
Provide the SMILES representation for the building block token <BB_1380>.
Cc1nc(CN)c(C(=O)O)o1.Cl.Cl
What is the building block token for the following molecule?
Cc1nc(CN)c(C(=O)O)o1.Cl.Cl
<BB_1380>
What is the molecular formula for <BB_1380>?
The molecular formula for <BB_1380> (Cc1nc(CN)c(C(=O)O)o1.Cl.Cl) is C6H10Cl2N2O3.
Describe the ring structures in building block <BB_1380>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1380>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1380>.
**Token:** <BB_1380> **SMILES:** Cc1nc(CN)c(C(=O)O)o1.Cl.Cl **Molecular Formula:** C6H10Cl2N2O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1381>.
COC(=O)CC(C)=O
What is the building block token for the following molecule?
COC(=O)CC(C)=O
<BB_1381>
What is the molecular formula for <BB_1381>?
The molecular formula for <BB_1381> (COC(=O)CC(C)=O) is C5H8O3.
Describe the ring structures in building block <BB_1381>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1381>.
The molecule contains the following groups: Ester, Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_1381>.
**Token:** <BB_1381> **SMILES:** COC(=O)CC(C)=O **Molecular Formula:** C5H8O3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ester, Ketone, Ether
Provide the SMILES representation for the building block token <BB_1382>.
Cc1ccc(C=O)c(Br)c1
What is the building block token for the following molecule?
Cc1ccc(C=O)c(Br)c1
<BB_1382>
What is the molecular formula for <BB_1382>?
The molecular formula for <BB_1382> (Cc1ccc(C=O)c(Br)c1) is C8H7BrO.
Describe the ring structures in building block <BB_1382>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1382>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1382>.
**Token:** <BB_1382> **SMILES:** Cc1ccc(C=O)c(Br)c1 **Molecular Formula:** C8H7BrO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1383>.
OC[C@@H]1C[C@H]1CO
What is the building block token for the following molecule?
OC[C@@H]1C[C@H]1CO
<BB_1383>