instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_1383>?
The molecular formula for <BB_1383> (OC[C@@H]1C[C@H]1CO) is C5H10O2.
Describe the ring structures in building block <BB_1383>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_1383>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_1383>.
**Token:** <BB_1383> **SMILES:** OC[C@@H]1C[C@H]1CO **Molecular Formula:** C5H10O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_1384>.
CS(=O)(=O)Nc1cccc(O)c1
What is the building block token for the following molecule?
CS(=O)(=O)Nc1cccc(O)c1
<BB_1384>
What is the molecular formula for <BB_1384>?
The molecular formula for <BB_1384> (CS(=O)(=O)Nc1cccc(O)c1) is C7H9NO3S.
Describe the ring structures in building block <BB_1384>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1384>.
The molecule contains the following groups: Secondary Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_1384>.
**Token:** <BB_1384> **SMILES:** CS(=O)(=O)Nc1cccc(O)c1 **Molecular Formula:** C7H9NO3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_1385>.
Cl.NCCC1(C(F)(F)F)CCC1
What is the building block token for the following molecule?
Cl.NCCC1(C(F)(F)F)CCC1
<BB_1385>
What is the molecular formula for <BB_1385>?
The molecular formula for <BB_1385> (Cl.NCCC1(C(F)(F)F)CCC1) is C7H13ClF3N.
Describe the ring structures in building block <BB_1385>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_1385>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1385>.
**Token:** <BB_1385> **SMILES:** Cl.NCCC1(C(F)(F)F)CCC1 **Molecular Formula:** C7H13ClF3N **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1386>.
CCn1nc(Br)cc1C(=O)O
What is the building block token for the following molecule?
CCn1nc(Br)cc1C(=O)O
<BB_1386>
What is the molecular formula for <BB_1386>?
The molecular formula for <BB_1386> (CCn1nc(Br)cc1C(=O)O) is C6H7BrN2O2.
Describe the ring structures in building block <BB_1386>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1386>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1386>.
**Token:** <BB_1386> **SMILES:** CCn1nc(Br)cc1C(=O)O **Molecular Formula:** C6H7BrN2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1387>.
CCN(CC)c1ccc(I)cc1
What is the building block token for the following molecule?
CCN(CC)c1ccc(I)cc1
<BB_1387>
What is the molecular formula for <BB_1387>?
The molecular formula for <BB_1387> (CCN(CC)c1ccc(I)cc1) is C10H14IN.
Describe the ring structures in building block <BB_1387>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1387>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1387>.
**Token:** <BB_1387> **SMILES:** CCN(CC)c1ccc(I)cc1 **Molecular Formula:** C10H14IN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1388>.
CC(O)CN1CCSC(C)(C)C1
What is the building block token for the following molecule?
CC(O)CN1CCSC(C)(C)C1
<BB_1388>
What is the molecular formula for <BB_1388>?
The molecular formula for <BB_1388> (CC(O)CN1CCSC(C)(C)C1) is C9H19NOS.
Describe the ring structures in building block <BB_1388>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1388>.
The molecule contains the following groups: Tertiary Amine, Alcohol, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_1388>.
**Token:** <BB_1388> **SMILES:** CC(O)CN1CCSC(C)(C)C1 **Molecular Formula:** C9H19NOS **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine, Alcohol, Sulfide
Provide the SMILES representation for the building block token <BB_1389>.
CCCCN1CCCCC1C(=O)O
What is the building block token for the following molecule?
CCCCN1CCCCC1C(=O)O
<BB_1389>
What is the molecular formula for <BB_1389>?
The molecular formula for <BB_1389> (CCCCN1CCCCC1C(=O)O) is C10H19NO2.
Describe the ring structures in building block <BB_1389>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1389>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_1389>.
**Token:** <BB_1389> **SMILES:** CCCCN1CCCCC1C(=O)O **Molecular Formula:** C10H19NO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Tertiary Amine
Provide the SMILES representation for the building block token <BB_1390>.
CCO[Si](CCl)(OCC)OCC
What is the building block token for the following molecule?
CCO[Si](CCl)(OCC)OCC
<BB_1390>
What is the molecular formula for <BB_1390>?
The molecular formula for <BB_1390> (CCO[Si](CCl)(OCC)OCC) is C7H17ClO3Si.
Describe the ring structures in building block <BB_1390>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1390>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1390>.
**Token:** <BB_1390> **SMILES:** CCO[Si](CCl)(OCC)OCC **Molecular Formula:** C7H17ClO3Si **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1391>.
Cc1nccn1CCCl.Cl
What is the building block token for the following molecule?
Cc1nccn1CCCl.Cl
<BB_1391>
What is the molecular formula for <BB_1391>?
The molecular formula for <BB_1391> (Cc1nccn1CCCl.Cl) is C6H10Cl2N2.
Describe the ring structures in building block <BB_1391>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1391>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1391>.
**Token:** <BB_1391> **SMILES:** Cc1nccn1CCCl.Cl **Molecular Formula:** C6H10Cl2N2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1392>.
O=C(O)[C@@H]1CSC(c2cccc(Cl)c2Cl)N1
What is the building block token for the following molecule?
O=C(O)[C@@H]1CSC(c2cccc(Cl)c2Cl)N1
<BB_1392>
What is the molecular formula for <BB_1392>?
The molecular formula for <BB_1392> (O=C(O)[C@@H]1CSC(c2cccc(Cl)c2Cl)N1) is C10H9Cl2NO2S.
Describe the ring structures in building block <BB_1392>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1392>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Sulfide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1392>.
**Token:** <BB_1392> **SMILES:** O=C(O)[C@@H]1CSC(c2cccc(Cl)c2Cl)N1 **Molecular Formula:** C10H9Cl2NO2S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine, Sulfide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1393>.
CC(C)(C)OC(=O)NCC12COCC(N)(C1)C2
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NCC12COCC(N)(C1)C2
<BB_1393>
What is the molecular formula for <BB_1393>?
The molecular formula for <BB_1393> (CC(C)(C)OC(=O)NCC12COCC(N)(C1)C2) is C12H22N2O3.
Describe the ring structures in building block <BB_1393>.
The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1393>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_1393>.
**Token:** <BB_1393> **SMILES:** CC(C)(C)OC(=O)NCC12COCC(N)(C1)C2 **Molecular Formula:** C12H22N2O3 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_1394>.
OCc1c(F)cccc1F
What is the building block token for the following molecule?
OCc1c(F)cccc1F
<BB_1394>
What is the molecular formula for <BB_1394>?
The molecular formula for <BB_1394> (OCc1c(F)cccc1F) is C7H6F2O.
Describe the ring structures in building block <BB_1394>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1394>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1394>.
**Token:** <BB_1394> **SMILES:** OCc1c(F)cccc1F **Molecular Formula:** C7H6F2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1395>.
COc1cc(C(=O)O)cc(N)c1OC
What is the building block token for the following molecule?
COc1cc(C(=O)O)cc(N)c1OC
<BB_1395>
What is the molecular formula for <BB_1395>?
The molecular formula for <BB_1395> (COc1cc(C(=O)O)cc(N)c1OC) is C9H11NO4.
Describe the ring structures in building block <BB_1395>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1395>.
The molecule contains the following groups: Carboxylic Acid, Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_1395>.
**Token:** <BB_1395> **SMILES:** COc1cc(C(=O)O)cc(N)c1OC **Molecular Formula:** C9H11NO4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine, Ether
Provide the SMILES representation for the building block token <BB_1396>.
COC(=O)C1NCCc2ccccc21.Cl
What is the building block token for the following molecule?
COC(=O)C1NCCc2ccccc21.Cl
<BB_1396>
What is the molecular formula for <BB_1396>?
The molecular formula for <BB_1396> (COC(=O)C1NCCc2ccccc21.Cl) is C11H14ClNO2.
Describe the ring structures in building block <BB_1396>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1396>.
The molecule contains the following groups: Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1396>.
**Token:** <BB_1396> **SMILES:** COC(=O)C1NCCc2ccccc21.Cl **Molecular Formula:** C11H14ClNO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1397>.
Clc1ccc2ncccc2c1
What is the building block token for the following molecule?
Clc1ccc2ncccc2c1
<BB_1397>
What is the molecular formula for <BB_1397>?
The molecular formula for <BB_1397> (Clc1ccc2ncccc2c1) is C9H6ClN.
Describe the ring structures in building block <BB_1397>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1397>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1397>.
**Token:** <BB_1397> **SMILES:** Clc1ccc2ncccc2c1 **Molecular Formula:** C9H6ClN **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1398>.
O=C(c1ccc(Br)cc1)c1cncnc1
What is the building block token for the following molecule?
O=C(c1ccc(Br)cc1)c1cncnc1
<BB_1398>
What is the molecular formula for <BB_1398>?
The molecular formula for <BB_1398> (O=C(c1ccc(Br)cc1)c1cncnc1) is C11H7BrN2O.
Describe the ring structures in building block <BB_1398>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1398>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1398>.
**Token:** <BB_1398> **SMILES:** O=C(c1ccc(Br)cc1)c1cncnc1 **Molecular Formula:** C11H7BrN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1399>.
CN1Cc2cc(N)ccc2NC1=O
What is the building block token for the following molecule?
CN1Cc2cc(N)ccc2NC1=O
<BB_1399>
What is the molecular formula for <BB_1399>?
The molecular formula for <BB_1399> (CN1Cc2cc(N)ccc2NC1=O) is C9H11N3O.
Describe the ring structures in building block <BB_1399>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1399>.
The molecule contains the following groups: Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_1399>.
**Token:** <BB_1399> **SMILES:** CN1Cc2cc(N)ccc2NC1=O **Molecular Formula:** C9H11N3O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Amide